import {
  APP_BOOTSTRAP_LISTENER,
  APP_ID,
  APP_INITIALIZER,
  ApplicationModule,
  ApplicationRef,
  Attribute,
  BehaviorSubject,
  CSP_NONCE,
  ChangeDetectorRef,
  Compiler,
  Component,
  ConnectableObservable,
  Console,
  ContentChildren,
  DEFAULT_CURRENCY_CODE,
  DestroyRef,
  Directive,
  EMPTY,
  ENVIRONMENT_INITIALIZER,
  ElementRef,
  EmptyError,
  EnvironmentInjector,
  ErrorHandler,
  EventEmitter,
  Host,
  HostBinding,
  HostListener,
  IMAGE_CONFIG,
  IMAGE_CONFIG_DEFAULTS,
  INJECTOR_SCOPE,
  INTERNAL_APPLICATION_ERROR_HANDLER,
  Inject,
  Injectable,
  InjectionToken,
  Injector,
  Input,
  IterableDiffers,
  KeyValueDiffers,
  LOCALE_ID,
  LocaleDataIndex,
  NgModule,
  NgModuleFactory$1,
  NgModuleRef$1,
  NgZone,
  Observable,
  Optional,
  Output,
  PLATFORM_ID,
  PLATFORM_INITIALIZER,
  PendingTasksInternal,
  Pipe,
  Renderer2,
  RendererFactory2,
  RendererStyleFlags2,
  ResourceImpl,
  ResourceStatus,
  RuntimeError,
  SecurityContext,
  SkipSelf,
  Subject,
  Subscription,
  TESTABILITY,
  TESTABILITY_GETTER,
  TemplateRef,
  Testability,
  TestabilityRegistry,
  TracingService,
  TransferState,
  Version,
  ViewContainerRef,
  ViewEncapsulation,
  XSS_SECURITY_URL,
  ZONELESS_ENABLED,
  __objRest,
  __spreadProps,
  __spreadValues,
  _global,
  _sanitizeHtml,
  _sanitizeUrl,
  afterNextRender,
  allowSanitizationBypassAndThrow,
  assertInInjectionContext,
  booleanAttribute,
  bypassSanitizationTrustHtml,
  bypassSanitizationTrustResourceUrl,
  bypassSanitizationTrustScript,
  bypassSanitizationTrustStyle,
  bypassSanitizationTrustUrl,
  catchError,
  combineLatest,
  computed,
  concat,
  concatMap,
  createEnvironmentInjector,
  createNgModule,
  createPlatformFactory,
  defaultIfEmpty,
  defer,
  filter,
  finalize,
  findLocaleData,
  first,
  formatRuntimeError,
  forwardRef,
  from,
  getLocalePluralCase,
  inject,
  input,
  internalCreateApplication,
  isInjectable,
  isNgModule,
  isObservable,
  isPromise,
  isStandalone,
  isSubscribable,
  last,
  linkedSignal,
  makeEnvironmentProviders,
  makeStateKey,
  map,
  mergeAll,
  mergeMap,
  numberAttribute,
  of,
  performanceMarkFeature,
  pipe,
  platformCore,
  refCount,
  reflectComponentType,
  runInInjectionContext,
  scan,
  setClassMetadata,
  setDocument,
  signal,
  startWith,
  stringify,
  switchMap,
  take,
  takeLast,
  takeUntil,
  tap,
  throwError,
  truncateMiddle,
  untracked,
  unwrapSafeValue,
  withDomHydration,
  ɵɵNgOnChangesFeature,
  ɵɵattribute,
  ɵɵcontentQuery,
  ɵɵdefineComponent,
  ɵɵdefineDirective,
  ɵɵdefineInjectable,
  ɵɵdefineInjector,
  ɵɵdefineNgModule,
  ɵɵdefinePipe,
  ɵɵdirectiveInject,
  ɵɵelement,
  ɵɵgetInheritedFactory,
  ɵɵinject,
  ɵɵinjectAttribute,
  ɵɵinvalidFactory,
  ɵɵlistener,
  ɵɵloadQuery,
  ɵɵqueryRefresh,
  ɵɵsanitizeUrlOrResourceUrl,
  ɵɵstyleProp
} from "./chunk-G3VQHART.js";

// node_modules/@angular/common/fesm2022/common.mjs
var _DOM = null;
function getDOM() {
  return _DOM;
}
function setRootDomAdapter(adapter) {
  _DOM ??= adapter;
}
var DomAdapter = class {
};
var PlatformNavigation = class _PlatformNavigation {
  static \u0275fac = function PlatformNavigation_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PlatformNavigation)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PlatformNavigation,
    factory: () => (() => window.navigation)(),
    providedIn: "platform"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PlatformNavigation, [{
    type: Injectable,
    args: [{
      providedIn: "platform",
      useFactory: () => window.navigation
    }]
  }], null, null);
})();
var DOCUMENT = new InjectionToken(ngDevMode ? "DocumentToken" : "");
var PlatformLocation = class _PlatformLocation {
  historyGo(relativePosition) {
    throw new Error(ngDevMode ? "Not implemented" : "");
  }
  static \u0275fac = function PlatformLocation_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PlatformLocation)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PlatformLocation,
    factory: () => (() => inject(BrowserPlatformLocation))(),
    providedIn: "platform"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PlatformLocation, [{
    type: Injectable,
    args: [{
      providedIn: "platform",
      useFactory: () => inject(BrowserPlatformLocation)
    }]
  }], null, null);
})();
var LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? "Location Initialized" : "");
var BrowserPlatformLocation = class _BrowserPlatformLocation extends PlatformLocation {
  _location;
  _history;
  _doc = inject(DOCUMENT);
  constructor() {
    super();
    this._location = window.location;
    this._history = window.history;
  }
  getBaseHrefFromDOM() {
    return getDOM().getBaseHref(this._doc);
  }
  onPopState(fn) {
    const window2 = getDOM().getGlobalEventTarget(this._doc, "window");
    window2.addEventListener("popstate", fn, false);
    return () => window2.removeEventListener("popstate", fn);
  }
  onHashChange(fn) {
    const window2 = getDOM().getGlobalEventTarget(this._doc, "window");
    window2.addEventListener("hashchange", fn, false);
    return () => window2.removeEventListener("hashchange", fn);
  }
  get href() {
    return this._location.href;
  }
  get protocol() {
    return this._location.protocol;
  }
  get hostname() {
    return this._location.hostname;
  }
  get port() {
    return this._location.port;
  }
  get pathname() {
    return this._location.pathname;
  }
  get search() {
    return this._location.search;
  }
  get hash() {
    return this._location.hash;
  }
  set pathname(newPath) {
    this._location.pathname = newPath;
  }
  pushState(state, title, url) {
    this._history.pushState(state, title, url);
  }
  replaceState(state, title, url) {
    this._history.replaceState(state, title, url);
  }
  forward() {
    this._history.forward();
  }
  back() {
    this._history.back();
  }
  historyGo(relativePosition = 0) {
    this._history.go(relativePosition);
  }
  getState() {
    return this._history.state;
  }
  static \u0275fac = function BrowserPlatformLocation_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _BrowserPlatformLocation)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _BrowserPlatformLocation,
    factory: () => (() => new _BrowserPlatformLocation())(),
    providedIn: "platform"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserPlatformLocation, [{
    type: Injectable,
    args: [{
      providedIn: "platform",
      useFactory: () => new BrowserPlatformLocation()
    }]
  }], () => [], null);
})();
function joinWithSlash(start, end) {
  if (!start) return end;
  if (!end) return start;
  if (start.endsWith("/")) {
    return end.startsWith("/") ? start + end.slice(1) : start + end;
  }
  return end.startsWith("/") ? start + end : `${start}/${end}`;
}
function stripTrailingSlash(url) {
  const pathEndIdx = url.search(/#|\?|$/);
  return url[pathEndIdx - 1] === "/" ? url.slice(0, pathEndIdx - 1) + url.slice(pathEndIdx) : url;
}
function normalizeQueryParams(params) {
  return params && params[0] !== "?" ? `?${params}` : params;
}
var LocationStrategy = class _LocationStrategy {
  historyGo(relativePosition) {
    throw new Error(ngDevMode ? "Not implemented" : "");
  }
  static \u0275fac = function LocationStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _LocationStrategy)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _LocationStrategy,
    factory: () => (() => inject(PathLocationStrategy))(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LocationStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(PathLocationStrategy)
    }]
  }], null, null);
})();
var APP_BASE_HREF = new InjectionToken(ngDevMode ? "appBaseHref" : "");
var PathLocationStrategy = class _PathLocationStrategy extends LocationStrategy {
  _platformLocation;
  _baseHref;
  _removeListenerFns = [];
  constructor(_platformLocation, href) {
    super();
    this._platformLocation = _platformLocation;
    this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ?? inject(DOCUMENT).location?.origin ?? "";
  }
  /** @nodoc */
  ngOnDestroy() {
    while (this._removeListenerFns.length) {
      this._removeListenerFns.pop()();
    }
  }
  onPopState(fn) {
    this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
  }
  getBaseHref() {
    return this._baseHref;
  }
  prepareExternalUrl(internal) {
    return joinWithSlash(this._baseHref, internal);
  }
  path(includeHash = false) {
    const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);
    const hash = this._platformLocation.hash;
    return hash && includeHash ? `${pathname}${hash}` : pathname;
  }
  pushState(state, title, url, queryParams) {
    const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
    this._platformLocation.pushState(state, title, externalUrl);
  }
  replaceState(state, title, url, queryParams) {
    const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
    this._platformLocation.replaceState(state, title, externalUrl);
  }
  forward() {
    this._platformLocation.forward();
  }
  back() {
    this._platformLocation.back();
  }
  getState() {
    return this._platformLocation.getState();
  }
  historyGo(relativePosition = 0) {
    this._platformLocation.historyGo?.(relativePosition);
  }
  static \u0275fac = function PathLocationStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PathLocationStrategy)(\u0275\u0275inject(PlatformLocation), \u0275\u0275inject(APP_BASE_HREF, 8));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PathLocationStrategy,
    factory: _PathLocationStrategy.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PathLocationStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: PlatformLocation
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [APP_BASE_HREF]
    }]
  }], null);
})();
var HashLocationStrategy = class _HashLocationStrategy extends LocationStrategy {
  _platformLocation;
  _baseHref = "";
  _removeListenerFns = [];
  constructor(_platformLocation, _baseHref) {
    super();
    this._platformLocation = _platformLocation;
    if (_baseHref != null) {
      this._baseHref = _baseHref;
    }
  }
  /** @nodoc */
  ngOnDestroy() {
    while (this._removeListenerFns.length) {
      this._removeListenerFns.pop()();
    }
  }
  onPopState(fn) {
    this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
  }
  getBaseHref() {
    return this._baseHref;
  }
  path(includeHash = false) {
    const path = this._platformLocation.hash ?? "#";
    return path.length > 0 ? path.substring(1) : path;
  }
  prepareExternalUrl(internal) {
    const url = joinWithSlash(this._baseHref, internal);
    return url.length > 0 ? "#" + url : url;
  }
  pushState(state, title, path, queryParams) {
    const url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)) || this._platformLocation.pathname;
    this._platformLocation.pushState(state, title, url);
  }
  replaceState(state, title, path, queryParams) {
    const url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)) || this._platformLocation.pathname;
    this._platformLocation.replaceState(state, title, url);
  }
  forward() {
    this._platformLocation.forward();
  }
  back() {
    this._platformLocation.back();
  }
  getState() {
    return this._platformLocation.getState();
  }
  historyGo(relativePosition = 0) {
    this._platformLocation.historyGo?.(relativePosition);
  }
  static \u0275fac = function HashLocationStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HashLocationStrategy)(\u0275\u0275inject(PlatformLocation), \u0275\u0275inject(APP_BASE_HREF, 8));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HashLocationStrategy,
    factory: _HashLocationStrategy.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HashLocationStrategy, [{
    type: Injectable
  }], () => [{
    type: PlatformLocation
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [APP_BASE_HREF]
    }]
  }], null);
})();
var Location = class _Location {
  /** @internal */
  _subject = new Subject();
  /** @internal */
  _basePath;
  /** @internal */
  _locationStrategy;
  /** @internal */
  _urlChangeListeners = [];
  /** @internal */
  _urlChangeSubscription = null;
  constructor(locationStrategy) {
    this._locationStrategy = locationStrategy;
    const baseHref = this._locationStrategy.getBaseHref();
    this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));
    this._locationStrategy.onPopState((ev) => {
      this._subject.next({
        "url": this.path(true),
        "pop": true,
        "state": ev.state,
        "type": ev.type
      });
    });
  }
  /** @nodoc */
  ngOnDestroy() {
    this._urlChangeSubscription?.unsubscribe();
    this._urlChangeListeners = [];
  }
  /**
   * Normalizes the URL path for this location.
   *
   * @param includeHash True to include an anchor fragment in the path.
   *
   * @returns The normalized URL path.
   */
  // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is
  // removed.
  path(includeHash = false) {
    return this.normalize(this._locationStrategy.path(includeHash));
  }
  /**
   * Reports the current state of the location history.
   * @returns The current value of the `history.state` object.
   */
  getState() {
    return this._locationStrategy.getState();
  }
  /**
   * Normalizes the given path and compares to the current normalized path.
   *
   * @param path The given URL path.
   * @param query Query parameters.
   *
   * @returns True if the given URL path is equal to the current normalized path, false
   * otherwise.
   */
  isCurrentPathEqualTo(path, query = "") {
    return this.path() == this.normalize(path + normalizeQueryParams(query));
  }
  /**
   * Normalizes a URL path by stripping any trailing slashes.
   *
   * @param url String representing a URL.
   *
   * @returns The normalized URL string.
   */
  normalize(url) {
    return _Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));
  }
  /**
   * Normalizes an external URL path.
   * If the given URL doesn't begin with a leading slash (`'/'`), adds one
   * before normalizing. Adds a hash if `HashLocationStrategy` is
   * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.
   *
   * @param url String representing a URL.
   *
   * @returns  A normalized platform-specific URL.
   */
  prepareExternalUrl(url) {
    if (url && url[0] !== "/") {
      url = "/" + url;
    }
    return this._locationStrategy.prepareExternalUrl(url);
  }
  // TODO: rename this method to pushState
  /**
   * Changes the browser's URL to a normalized version of a given URL, and pushes a
   * new item onto the platform's history.
   *
   * @param path  URL path to normalize.
   * @param query Query parameters.
   * @param state Location history state.
   *
   */
  go(path, query = "", state = null) {
    this._locationStrategy.pushState(state, "", path, query);
    this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
  }
  /**
   * Changes the browser's URL to a normalized version of the given URL, and replaces
   * the top item on the platform's history stack.
   *
   * @param path  URL path to normalize.
   * @param query Query parameters.
   * @param state Location history state.
   */
  replaceState(path, query = "", state = null) {
    this._locationStrategy.replaceState(state, "", path, query);
    this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
  }
  /**
   * Navigates forward in the platform's history.
   */
  forward() {
    this._locationStrategy.forward();
  }
  /**
   * Navigates back in the platform's history.
   */
  back() {
    this._locationStrategy.back();
  }
  /**
   * Navigate to a specific page from session history, identified by its relative position to the
   * current page.
   *
   * @param relativePosition  Position of the target page in the history relative to the current
   *     page.
   * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`
   * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go
   * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs
   * when `relativePosition` equals 0.
   * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history
   */
  historyGo(relativePosition = 0) {
    this._locationStrategy.historyGo?.(relativePosition);
  }
  /**
   * Registers a URL change listener. Use to catch updates performed by the Angular
   * framework that are not detectible through "popstate" or "hashchange" events.
   *
   * @param fn The change handler function, which take a URL and a location history state.
   * @returns A function that, when executed, unregisters a URL change listener.
   */
  onUrlChange(fn) {
    this._urlChangeListeners.push(fn);
    this._urlChangeSubscription ??= this.subscribe((v) => {
      this._notifyUrlChangeListeners(v.url, v.state);
    });
    return () => {
      const fnIndex = this._urlChangeListeners.indexOf(fn);
      this._urlChangeListeners.splice(fnIndex, 1);
      if (this._urlChangeListeners.length === 0) {
        this._urlChangeSubscription?.unsubscribe();
        this._urlChangeSubscription = null;
      }
    };
  }
  /** @internal */
  _notifyUrlChangeListeners(url = "", state) {
    this._urlChangeListeners.forEach((fn) => fn(url, state));
  }
  /**
   * Subscribes to the platform's `popState` events.
   *
   * Note: `Location.go()` does not trigger the `popState` event in the browser. Use
   * `Location.onUrlChange()` to subscribe to URL changes instead.
   *
   * @param value Event that is triggered when the state history changes.
   * @param exception The exception to throw.
   *
   * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)
   *
   * @returns Subscribed events.
   */
  subscribe(onNext, onThrow, onReturn) {
    return this._subject.subscribe({
      next: onNext,
      error: onThrow ?? void 0,
      complete: onReturn ?? void 0
    });
  }
  /**
   * Normalizes URL parameters by prepending with `?` if needed.
   *
   * @param  params String of URL parameters.
   *
   * @returns The normalized URL parameters string.
   */
  static normalizeQueryParams = normalizeQueryParams;
  /**
   * Joins two parts of a URL with a slash if needed.
   *
   * @param start  URL string
   * @param end    URL string
   *
   *
   * @returns The joined URL string.
   */
  static joinWithSlash = joinWithSlash;
  /**
   * Removes a trailing slash from a URL string if needed.
   * Looks for the first occurrence of either `#`, `?`, or the end of the
   * line as `/` characters and removes the trailing slash if one exists.
   *
   * @param url URL string.
   *
   * @returns The URL string, modified if needed.
   */
  static stripTrailingSlash = stripTrailingSlash;
  static \u0275fac = function Location_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _Location)(\u0275\u0275inject(LocationStrategy));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _Location,
    factory: () => createLocation(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Location, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      // See #23917
      useFactory: createLocation
    }]
  }], () => [{
    type: LocationStrategy
  }], null);
})();
function createLocation() {
  return new Location(\u0275\u0275inject(LocationStrategy));
}
function _stripBasePath(basePath, url) {
  if (!basePath || !url.startsWith(basePath)) {
    return url;
  }
  const strippedUrl = url.substring(basePath.length);
  if (strippedUrl === "" || ["/", ";", "?", "#"].includes(strippedUrl[0])) {
    return strippedUrl;
  }
  return url;
}
function _stripIndexHtml(url) {
  return url.replace(/\/index.html$/, "");
}
function _stripOrigin(baseHref) {
  const isAbsoluteUrl2 = new RegExp("^(https?:)?//").test(baseHref);
  if (isAbsoluteUrl2) {
    const [, pathname] = baseHref.split(/\/\/[^\/]+/);
    return pathname;
  }
  return baseHref;
}
var CURRENCIES_EN = {
  "ADP": [void 0, void 0, 0],
  "AFN": [void 0, "\u060B", 0],
  "ALL": [void 0, void 0, 0],
  "AMD": [void 0, "\u058F", 2],
  "AOA": [void 0, "Kz"],
  "ARS": [void 0, "$"],
  "AUD": ["A$", "$"],
  "AZN": [void 0, "\u20BC"],
  "BAM": [void 0, "KM"],
  "BBD": [void 0, "$"],
  "BDT": [void 0, "\u09F3"],
  "BHD": [void 0, void 0, 3],
  "BIF": [void 0, void 0, 0],
  "BMD": [void 0, "$"],
  "BND": [void 0, "$"],
  "BOB": [void 0, "Bs"],
  "BRL": ["R$"],
  "BSD": [void 0, "$"],
  "BWP": [void 0, "P"],
  "BYN": [void 0, void 0, 2],
  "BYR": [void 0, void 0, 0],
  "BZD": [void 0, "$"],
  "CAD": ["CA$", "$", 2],
  "CHF": [void 0, void 0, 2],
  "CLF": [void 0, void 0, 4],
  "CLP": [void 0, "$", 0],
  "CNY": ["CN\xA5", "\xA5"],
  "COP": [void 0, "$", 2],
  "CRC": [void 0, "\u20A1", 2],
  "CUC": [void 0, "$"],
  "CUP": [void 0, "$"],
  "CZK": [void 0, "K\u010D", 2],
  "DJF": [void 0, void 0, 0],
  "DKK": [void 0, "kr", 2],
  "DOP": [void 0, "$"],
  "EGP": [void 0, "E\xA3"],
  "ESP": [void 0, "\u20A7", 0],
  "EUR": ["\u20AC"],
  "FJD": [void 0, "$"],
  "FKP": [void 0, "\xA3"],
  "GBP": ["\xA3"],
  "GEL": [void 0, "\u20BE"],
  "GHS": [void 0, "GH\u20B5"],
  "GIP": [void 0, "\xA3"],
  "GNF": [void 0, "FG", 0],
  "GTQ": [void 0, "Q"],
  "GYD": [void 0, "$", 2],
  "HKD": ["HK$", "$"],
  "HNL": [void 0, "L"],
  "HRK": [void 0, "kn"],
  "HUF": [void 0, "Ft", 2],
  "IDR": [void 0, "Rp", 2],
  "ILS": ["\u20AA"],
  "INR": ["\u20B9"],
  "IQD": [void 0, void 0, 0],
  "IRR": [void 0, void 0, 0],
  "ISK": [void 0, "kr", 0],
  "ITL": [void 0, void 0, 0],
  "JMD": [void 0, "$"],
  "JOD": [void 0, void 0, 3],
  "JPY": ["\xA5", void 0, 0],
  "KHR": [void 0, "\u17DB"],
  "KMF": [void 0, "CF", 0],
  "KPW": [void 0, "\u20A9", 0],
  "KRW": ["\u20A9", void 0, 0],
  "KWD": [void 0, void 0, 3],
  "KYD": [void 0, "$"],
  "KZT": [void 0, "\u20B8"],
  "LAK": [void 0, "\u20AD", 0],
  "LBP": [void 0, "L\xA3", 0],
  "LKR": [void 0, "Rs"],
  "LRD": [void 0, "$"],
  "LTL": [void 0, "Lt"],
  "LUF": [void 0, void 0, 0],
  "LVL": [void 0, "Ls"],
  "LYD": [void 0, void 0, 3],
  "MGA": [void 0, "Ar", 0],
  "MGF": [void 0, void 0, 0],
  "MMK": [void 0, "K", 0],
  "MNT": [void 0, "\u20AE", 2],
  "MRO": [void 0, void 0, 0],
  "MUR": [void 0, "Rs", 2],
  "MXN": ["MX$", "$"],
  "MYR": [void 0, "RM"],
  "NAD": [void 0, "$"],
  "NGN": [void 0, "\u20A6"],
  "NIO": [void 0, "C$"],
  "NOK": [void 0, "kr", 2],
  "NPR": [void 0, "Rs"],
  "NZD": ["NZ$", "$"],
  "OMR": [void 0, void 0, 3],
  "PHP": ["\u20B1"],
  "PKR": [void 0, "Rs", 2],
  "PLN": [void 0, "z\u0142"],
  "PYG": [void 0, "\u20B2", 0],
  "RON": [void 0, "lei"],
  "RSD": [void 0, void 0, 0],
  "RUB": [void 0, "\u20BD"],
  "RWF": [void 0, "RF", 0],
  "SBD": [void 0, "$"],
  "SEK": [void 0, "kr", 2],
  "SGD": [void 0, "$"],
  "SHP": [void 0, "\xA3"],
  "SLE": [void 0, void 0, 2],
  "SLL": [void 0, void 0, 0],
  "SOS": [void 0, void 0, 0],
  "SRD": [void 0, "$"],
  "SSP": [void 0, "\xA3"],
  "STD": [void 0, void 0, 0],
  "STN": [void 0, "Db"],
  "SYP": [void 0, "\xA3", 0],
  "THB": [void 0, "\u0E3F"],
  "TMM": [void 0, void 0, 0],
  "TND": [void 0, void 0, 3],
  "TOP": [void 0, "T$"],
  "TRL": [void 0, void 0, 0],
  "TRY": [void 0, "\u20BA"],
  "TTD": [void 0, "$"],
  "TWD": ["NT$", "$", 2],
  "TZS": [void 0, void 0, 2],
  "UAH": [void 0, "\u20B4"],
  "UGX": [void 0, void 0, 0],
  "USD": ["$"],
  "UYI": [void 0, void 0, 0],
  "UYU": [void 0, "$"],
  "UYW": [void 0, void 0, 4],
  "UZS": [void 0, void 0, 2],
  "VEF": [void 0, "Bs", 2],
  "VND": ["\u20AB", void 0, 0],
  "VUV": [void 0, void 0, 0],
  "XAF": ["FCFA", void 0, 0],
  "XCD": ["EC$", "$"],
  "XOF": ["F\u202FCFA", void 0, 0],
  "XPF": ["CFPF", void 0, 0],
  "XXX": ["\xA4"],
  "YER": [void 0, void 0, 0],
  "ZAR": [void 0, "R"],
  "ZMK": [void 0, void 0, 0],
  "ZMW": [void 0, "ZK"],
  "ZWD": [void 0, void 0, 0]
};
var NumberFormatStyle;
(function(NumberFormatStyle2) {
  NumberFormatStyle2[NumberFormatStyle2["Decimal"] = 0] = "Decimal";
  NumberFormatStyle2[NumberFormatStyle2["Percent"] = 1] = "Percent";
  NumberFormatStyle2[NumberFormatStyle2["Currency"] = 2] = "Currency";
  NumberFormatStyle2[NumberFormatStyle2["Scientific"] = 3] = "Scientific";
})(NumberFormatStyle || (NumberFormatStyle = {}));
var Plural;
(function(Plural2) {
  Plural2[Plural2["Zero"] = 0] = "Zero";
  Plural2[Plural2["One"] = 1] = "One";
  Plural2[Plural2["Two"] = 2] = "Two";
  Plural2[Plural2["Few"] = 3] = "Few";
  Plural2[Plural2["Many"] = 4] = "Many";
  Plural2[Plural2["Other"] = 5] = "Other";
})(Plural || (Plural = {}));
var FormStyle;
(function(FormStyle2) {
  FormStyle2[FormStyle2["Format"] = 0] = "Format";
  FormStyle2[FormStyle2["Standalone"] = 1] = "Standalone";
})(FormStyle || (FormStyle = {}));
var TranslationWidth;
(function(TranslationWidth2) {
  TranslationWidth2[TranslationWidth2["Narrow"] = 0] = "Narrow";
  TranslationWidth2[TranslationWidth2["Abbreviated"] = 1] = "Abbreviated";
  TranslationWidth2[TranslationWidth2["Wide"] = 2] = "Wide";
  TranslationWidth2[TranslationWidth2["Short"] = 3] = "Short";
})(TranslationWidth || (TranslationWidth = {}));
var FormatWidth;
(function(FormatWidth2) {
  FormatWidth2[FormatWidth2["Short"] = 0] = "Short";
  FormatWidth2[FormatWidth2["Medium"] = 1] = "Medium";
  FormatWidth2[FormatWidth2["Long"] = 2] = "Long";
  FormatWidth2[FormatWidth2["Full"] = 3] = "Full";
})(FormatWidth || (FormatWidth = {}));
var NumberSymbol = {
  /**
   * Decimal separator.
   * For `en-US`, the dot character.
   * Example: 2,345`.`67
   */
  Decimal: 0,
  /**
   * Grouping separator, typically for thousands.
   * For `en-US`, the comma character.
   * Example: 2`,`345.67
   */
  Group: 1,
  /**
   * List-item separator.
   * Example: "one, two, and three"
   */
  List: 2,
  /**
   * Sign for percentage (out of 100).
   * Example: 23.4%
   */
  PercentSign: 3,
  /**
   * Sign for positive numbers.
   * Example: +23
   */
  PlusSign: 4,
  /**
   * Sign for negative numbers.
   * Example: -23
   */
  MinusSign: 5,
  /**
   * Computer notation for exponential value (n times a power of 10).
   * Example: 1.2E3
   */
  Exponential: 6,
  /**
   * Human-readable format of exponential.
   * Example: 1.2x103
   */
  SuperscriptingExponent: 7,
  /**
   * Sign for permille (out of 1000).
   * Example: 23.4‰
   */
  PerMille: 8,
  /**
   * Infinity, can be used with plus and minus.
   * Example: ∞, +∞, -∞
   */
  Infinity: 9,
  /**
   * Not a number.
   * Example: NaN
   */
  NaN: 10,
  /**
   * Symbol used between time units.
   * Example: 10:52
   */
  TimeSeparator: 11,
  /**
   * Decimal separator for currency values (fallback to `Decimal`).
   * Example: $2,345.67
   */
  CurrencyDecimal: 12,
  /**
   * Group separator for currency values (fallback to `Group`).
   * Example: $2,345.67
   */
  CurrencyGroup: 13
};
var WeekDay;
(function(WeekDay2) {
  WeekDay2[WeekDay2["Sunday"] = 0] = "Sunday";
  WeekDay2[WeekDay2["Monday"] = 1] = "Monday";
  WeekDay2[WeekDay2["Tuesday"] = 2] = "Tuesday";
  WeekDay2[WeekDay2["Wednesday"] = 3] = "Wednesday";
  WeekDay2[WeekDay2["Thursday"] = 4] = "Thursday";
  WeekDay2[WeekDay2["Friday"] = 5] = "Friday";
  WeekDay2[WeekDay2["Saturday"] = 6] = "Saturday";
})(WeekDay || (WeekDay = {}));
function getLocaleId(locale) {
  return findLocaleData(locale)[LocaleDataIndex.LocaleId];
}
function getLocaleDayPeriods(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const amPmData = [data[LocaleDataIndex.DayPeriodsFormat], data[LocaleDataIndex.DayPeriodsStandalone]];
  const amPm = getLastDefinedValue(amPmData, formStyle);
  return getLastDefinedValue(amPm, width);
}
function getLocaleDayNames(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const daysData = [data[LocaleDataIndex.DaysFormat], data[LocaleDataIndex.DaysStandalone]];
  const days = getLastDefinedValue(daysData, formStyle);
  return getLastDefinedValue(days, width);
}
function getLocaleMonthNames(locale, formStyle, width) {
  const data = findLocaleData(locale);
  const monthsData = [data[LocaleDataIndex.MonthsFormat], data[LocaleDataIndex.MonthsStandalone]];
  const months = getLastDefinedValue(monthsData, formStyle);
  return getLastDefinedValue(months, width);
}
function getLocaleEraNames(locale, width) {
  const data = findLocaleData(locale);
  const erasData = data[LocaleDataIndex.Eras];
  return getLastDefinedValue(erasData, width);
}
function getLocaleDateFormat(locale, width) {
  const data = findLocaleData(locale);
  return getLastDefinedValue(data[LocaleDataIndex.DateFormat], width);
}
function getLocaleTimeFormat(locale, width) {
  const data = findLocaleData(locale);
  return getLastDefinedValue(data[LocaleDataIndex.TimeFormat], width);
}
function getLocaleDateTimeFormat(locale, width) {
  const data = findLocaleData(locale);
  const dateTimeFormatData = data[LocaleDataIndex.DateTimeFormat];
  return getLastDefinedValue(dateTimeFormatData, width);
}
function getLocaleNumberSymbol(locale, symbol) {
  const data = findLocaleData(locale);
  const res = data[LocaleDataIndex.NumberSymbols][symbol];
  if (typeof res === "undefined") {
    if (symbol === NumberSymbol.CurrencyDecimal) {
      return data[LocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];
    } else if (symbol === NumberSymbol.CurrencyGroup) {
      return data[LocaleDataIndex.NumberSymbols][NumberSymbol.Group];
    }
  }
  return res;
}
function getLocaleNumberFormat(locale, type) {
  const data = findLocaleData(locale);
  return data[LocaleDataIndex.NumberFormats][type];
}
function getLocaleCurrencies(locale) {
  const data = findLocaleData(locale);
  return data[LocaleDataIndex.Currencies];
}
var getLocalePluralCase2 = getLocalePluralCase;
function checkFullData(data) {
  if (!data[LocaleDataIndex.ExtraData]) {
    throw new Error(`Missing extra locale data for the locale "${data[LocaleDataIndex.LocaleId]}". Use "registerLocaleData" to load new data. See the "I18n guide" on angular.io to know more.`);
  }
}
function getLocaleExtraDayPeriodRules(locale) {
  const data = findLocaleData(locale);
  checkFullData(data);
  const rules = data[LocaleDataIndex.ExtraData][
    2
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */
  ] || [];
  return rules.map((rule) => {
    if (typeof rule === "string") {
      return extractTime(rule);
    }
    return [extractTime(rule[0]), extractTime(rule[1])];
  });
}
function getLocaleExtraDayPeriods(locale, formStyle, width) {
  const data = findLocaleData(locale);
  checkFullData(data);
  const dayPeriodsData = [data[LocaleDataIndex.ExtraData][
    0
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */
  ], data[LocaleDataIndex.ExtraData][
    1
    /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */
  ]];
  const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];
  return getLastDefinedValue(dayPeriods, width) || [];
}
function getLastDefinedValue(data, index) {
  for (let i = index; i > -1; i--) {
    if (typeof data[i] !== "undefined") {
      return data[i];
    }
  }
  throw new Error("Locale data API: locale data undefined");
}
function extractTime(time) {
  const [h, m] = time.split(":");
  return {
    hours: +h,
    minutes: +m
  };
}
function getCurrencySymbol(code, format, locale = "en") {
  const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];
  const symbolNarrow = currency[
    1
    /* ɵCurrencyIndex.SymbolNarrow */
  ];
  if (format === "narrow" && typeof symbolNarrow === "string") {
    return symbolNarrow;
  }
  return currency[
    0
    /* ɵCurrencyIndex.Symbol */
  ] || code;
}
var DEFAULT_NB_OF_CURRENCY_DIGITS = 2;
function getNumberOfCurrencyDigits(code) {
  let digits;
  const currency = CURRENCIES_EN[code];
  if (currency) {
    digits = currency[
      2
      /* ɵCurrencyIndex.NbOfDigits */
    ];
  }
  return typeof digits === "number" ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;
}
var ISO8601_DATE_REGEX = /^(\d{4,})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/;
var NAMED_FORMATS = {};
var DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\s\S]*)/;
function formatDate(value, format, locale, timezone) {
  let date = toDate(value);
  const namedFormat = getNamedFormat(locale, format);
  format = namedFormat || format;
  let parts = [];
  let match2;
  while (format) {
    match2 = DATE_FORMATS_SPLIT.exec(format);
    if (match2) {
      parts = parts.concat(match2.slice(1));
      const part = parts.pop();
      if (!part) {
        break;
      }
      format = part;
    } else {
      parts.push(format);
      break;
    }
  }
  if (typeof ngDevMode === "undefined" || ngDevMode) {
    assertValidDateFormat(parts);
  }
  let dateTimezoneOffset = date.getTimezoneOffset();
  if (timezone) {
    dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
    date = convertTimezoneToLocal(date, timezone);
  }
  let text = "";
  parts.forEach((value2) => {
    const dateFormatter = getDateFormatter(value2);
    text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) : value2 === "''" ? "'" : value2.replace(/(^'|'$)/g, "").replace(/''/g, "'");
  });
  return text;
}
function assertValidDateFormat(parts) {
  if (parts.some((part) => /^Y+$/.test(part)) && !parts.some((part) => /^w+$/.test(part))) {
    const message = `Suspicious use of week-based year "Y" in date pattern "${parts.join("")}". Did you mean to use calendar year "y" instead?`;
    if (parts.length === 1) {
      console.error(formatRuntimeError(2300, message));
    } else {
      throw new RuntimeError(2300, message);
    }
  }
}
function createDate(year, month, date) {
  const newDate = /* @__PURE__ */ new Date(0);
  newDate.setFullYear(year, month, date);
  newDate.setHours(0, 0, 0);
  return newDate;
}
function getNamedFormat(locale, format) {
  const localeId = getLocaleId(locale);
  NAMED_FORMATS[localeId] ??= {};
  if (NAMED_FORMATS[localeId][format]) {
    return NAMED_FORMATS[localeId][format];
  }
  let formatValue = "";
  switch (format) {
    case "shortDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Short);
      break;
    case "mediumDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);
      break;
    case "longDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Long);
      break;
    case "fullDate":
      formatValue = getLocaleDateFormat(locale, FormatWidth.Full);
      break;
    case "shortTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);
      break;
    case "mediumTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);
      break;
    case "longTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);
      break;
    case "fullTime":
      formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);
      break;
    case "short":
      const shortTime = getNamedFormat(locale, "shortTime");
      const shortDate = getNamedFormat(locale, "shortDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);
      break;
    case "medium":
      const mediumTime = getNamedFormat(locale, "mediumTime");
      const mediumDate = getNamedFormat(locale, "mediumDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);
      break;
    case "long":
      const longTime = getNamedFormat(locale, "longTime");
      const longDate = getNamedFormat(locale, "longDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);
      break;
    case "full":
      const fullTime = getNamedFormat(locale, "fullTime");
      const fullDate = getNamedFormat(locale, "fullDate");
      formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);
      break;
  }
  if (formatValue) {
    NAMED_FORMATS[localeId][format] = formatValue;
  }
  return formatValue;
}
function formatDateTime(str, opt_values) {
  if (opt_values) {
    str = str.replace(/\{([^}]+)}/g, function(match2, key) {
      return opt_values != null && key in opt_values ? opt_values[key] : match2;
    });
  }
  return str;
}
function padNumber(num, digits, minusSign = "-", trim, negWrap) {
  let neg = "";
  if (num < 0 || negWrap && num <= 0) {
    if (negWrap) {
      num = -num + 1;
    } else {
      num = -num;
      neg = minusSign;
    }
  }
  let strNum = String(num);
  while (strNum.length < digits) {
    strNum = "0" + strNum;
  }
  if (trim) {
    strNum = strNum.slice(strNum.length - digits);
  }
  return neg + strNum;
}
function formatFractionalSeconds(milliseconds, digits) {
  const strMs = padNumber(milliseconds, 3);
  return strMs.substring(0, digits);
}
function dateGetter(name, size, offset = 0, trim = false, negWrap = false) {
  return function(date, locale) {
    let part = getDatePart(name, date);
    if (offset > 0 || part > -offset) {
      part += offset;
    }
    if (name === 3) {
      if (part === 0 && offset === -12) {
        part = 12;
      }
    } else if (name === 6) {
      return formatFractionalSeconds(part, size);
    }
    const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
    return padNumber(part, size, localeMinus, trim, negWrap);
  };
}
function getDatePart(part, date) {
  switch (part) {
    case 0:
      return date.getFullYear();
    case 1:
      return date.getMonth();
    case 2:
      return date.getDate();
    case 3:
      return date.getHours();
    case 4:
      return date.getMinutes();
    case 5:
      return date.getSeconds();
    case 6:
      return date.getMilliseconds();
    case 7:
      return date.getDay();
    default:
      throw new RuntimeError(2301, ngDevMode && `Unknown DateType value "${part}".`);
  }
}
function dateStrGetter(name, width, form = FormStyle.Format, extended = false) {
  return function(date, locale) {
    return getDateTranslation(date, locale, name, width, form, extended);
  };
}
function getDateTranslation(date, locale, name, width, form, extended) {
  switch (name) {
    case 2:
      return getLocaleMonthNames(locale, form, width)[date.getMonth()];
    case 1:
      return getLocaleDayNames(locale, form, width)[date.getDay()];
    case 0:
      const currentHours = date.getHours();
      const currentMinutes = date.getMinutes();
      if (extended) {
        const rules = getLocaleExtraDayPeriodRules(locale);
        const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);
        const index = rules.findIndex((rule) => {
          if (Array.isArray(rule)) {
            const [from2, to] = rule;
            const afterFrom = currentHours >= from2.hours && currentMinutes >= from2.minutes;
            const beforeTo = currentHours < to.hours || currentHours === to.hours && currentMinutes < to.minutes;
            if (from2.hours < to.hours) {
              if (afterFrom && beforeTo) {
                return true;
              }
            } else if (afterFrom || beforeTo) {
              return true;
            }
          } else {
            if (rule.hours === currentHours && rule.minutes === currentMinutes) {
              return true;
            }
          }
          return false;
        });
        if (index !== -1) {
          return dayPeriods[index];
        }
      }
      return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];
    case 3:
      return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];
    default:
      const unexpected = name;
      throw new RuntimeError(2302, ngDevMode && `unexpected translation type ${unexpected}`);
  }
}
function timeZoneGetter(width) {
  return function(date, locale, offset) {
    const zone = -1 * offset;
    const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
    const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);
    switch (width) {
      case 0:
        return (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + padNumber(Math.abs(zone % 60), 2, minusSign);
      case 1:
        return "GMT" + (zone >= 0 ? "+" : "") + padNumber(hours, 1, minusSign);
      case 2:
        return "GMT" + (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + ":" + padNumber(Math.abs(zone % 60), 2, minusSign);
      case 3:
        if (offset === 0) {
          return "Z";
        } else {
          return (zone >= 0 ? "+" : "") + padNumber(hours, 2, minusSign) + ":" + padNumber(Math.abs(zone % 60), 2, minusSign);
        }
      default:
        throw new RuntimeError(2302, ngDevMode && `Unknown zone width "${width}"`);
    }
  };
}
var JANUARY = 0;
var THURSDAY = 4;
function getFirstThursdayOfYear(year) {
  const firstDayOfYear = createDate(year, JANUARY, 1).getDay();
  return createDate(year, 0, 1 + (firstDayOfYear <= THURSDAY ? THURSDAY : THURSDAY + 7) - firstDayOfYear);
}
function getThursdayThisIsoWeek(datetime) {
  const currentDay = datetime.getDay();
  const deltaToThursday = currentDay === 0 ? -3 : THURSDAY - currentDay;
  return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + deltaToThursday);
}
function weekGetter(size, monthBased = false) {
  return function(date, locale) {
    let result;
    if (monthBased) {
      const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;
      const today = date.getDate();
      result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);
    } else {
      const thisThurs = getThursdayThisIsoWeek(date);
      const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());
      const diff = thisThurs.getTime() - firstThurs.getTime();
      result = 1 + Math.round(diff / 6048e5);
    }
    return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  };
}
function weekNumberingYearGetter(size, trim = false) {
  return function(date, locale) {
    const thisThurs = getThursdayThisIsoWeek(date);
    const weekNumberingYear = thisThurs.getFullYear();
    return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);
  };
}
var DATE_FORMATS = {};
function getDateFormatter(format) {
  if (DATE_FORMATS[format]) {
    return DATE_FORMATS[format];
  }
  let formatter;
  switch (format) {
    // Era name (AD/BC)
    case "G":
    case "GG":
    case "GGG":
      formatter = dateStrGetter(3, TranslationWidth.Abbreviated);
      break;
    case "GGGG":
      formatter = dateStrGetter(3, TranslationWidth.Wide);
      break;
    case "GGGGG":
      formatter = dateStrGetter(3, TranslationWidth.Narrow);
      break;
    // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)
    case "y":
      formatter = dateGetter(0, 1, 0, false, true);
      break;
    // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)
    case "yy":
      formatter = dateGetter(0, 2, 0, true, true);
      break;
    // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)
    case "yyy":
      formatter = dateGetter(0, 3, 0, false, true);
      break;
    // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)
    case "yyyy":
      formatter = dateGetter(0, 4, 0, false, true);
      break;
    // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)
    case "Y":
      formatter = weekNumberingYearGetter(1);
      break;
    // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD
    // 2010 => 10)
    case "YY":
      formatter = weekNumberingYearGetter(2, true);
      break;
    // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD
    // 2010 => 2010)
    case "YYY":
      formatter = weekNumberingYearGetter(3);
      break;
    // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)
    case "YYYY":
      formatter = weekNumberingYearGetter(4);
      break;
    // Month of the year (1-12), numeric
    case "M":
    case "L":
      formatter = dateGetter(1, 1, 1);
      break;
    case "MM":
    case "LL":
      formatter = dateGetter(1, 2, 1);
      break;
    // Month of the year (January, ...), string, format
    case "MMM":
      formatter = dateStrGetter(2, TranslationWidth.Abbreviated);
      break;
    case "MMMM":
      formatter = dateStrGetter(2, TranslationWidth.Wide);
      break;
    case "MMMMM":
      formatter = dateStrGetter(2, TranslationWidth.Narrow);
      break;
    // Month of the year (January, ...), string, standalone
    case "LLL":
      formatter = dateStrGetter(2, TranslationWidth.Abbreviated, FormStyle.Standalone);
      break;
    case "LLLL":
      formatter = dateStrGetter(2, TranslationWidth.Wide, FormStyle.Standalone);
      break;
    case "LLLLL":
      formatter = dateStrGetter(2, TranslationWidth.Narrow, FormStyle.Standalone);
      break;
    // Week of the year (1, ... 52)
    case "w":
      formatter = weekGetter(1);
      break;
    case "ww":
      formatter = weekGetter(2);
      break;
    // Week of the month (1, ...)
    case "W":
      formatter = weekGetter(1, true);
      break;
    // Day of the month (1-31)
    case "d":
      formatter = dateGetter(2, 1);
      break;
    case "dd":
      formatter = dateGetter(2, 2);
      break;
    // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)
    case "c":
    case "cc":
      formatter = dateGetter(7, 1);
      break;
    case "ccc":
      formatter = dateStrGetter(1, TranslationWidth.Abbreviated, FormStyle.Standalone);
      break;
    case "cccc":
      formatter = dateStrGetter(1, TranslationWidth.Wide, FormStyle.Standalone);
      break;
    case "ccccc":
      formatter = dateStrGetter(1, TranslationWidth.Narrow, FormStyle.Standalone);
      break;
    case "cccccc":
      formatter = dateStrGetter(1, TranslationWidth.Short, FormStyle.Standalone);
      break;
    // Day of the Week
    case "E":
    case "EE":
    case "EEE":
      formatter = dateStrGetter(1, TranslationWidth.Abbreviated);
      break;
    case "EEEE":
      formatter = dateStrGetter(1, TranslationWidth.Wide);
      break;
    case "EEEEE":
      formatter = dateStrGetter(1, TranslationWidth.Narrow);
      break;
    case "EEEEEE":
      formatter = dateStrGetter(1, TranslationWidth.Short);
      break;
    // Generic period of the day (am-pm)
    case "a":
    case "aa":
    case "aaa":
      formatter = dateStrGetter(0, TranslationWidth.Abbreviated);
      break;
    case "aaaa":
      formatter = dateStrGetter(0, TranslationWidth.Wide);
      break;
    case "aaaaa":
      formatter = dateStrGetter(0, TranslationWidth.Narrow);
      break;
    // Extended period of the day (midnight, at night, ...), standalone
    case "b":
    case "bb":
    case "bbb":
      formatter = dateStrGetter(0, TranslationWidth.Abbreviated, FormStyle.Standalone, true);
      break;
    case "bbbb":
      formatter = dateStrGetter(0, TranslationWidth.Wide, FormStyle.Standalone, true);
      break;
    case "bbbbb":
      formatter = dateStrGetter(0, TranslationWidth.Narrow, FormStyle.Standalone, true);
      break;
    // Extended period of the day (midnight, night, ...), standalone
    case "B":
    case "BB":
    case "BBB":
      formatter = dateStrGetter(0, TranslationWidth.Abbreviated, FormStyle.Format, true);
      break;
    case "BBBB":
      formatter = dateStrGetter(0, TranslationWidth.Wide, FormStyle.Format, true);
      break;
    case "BBBBB":
      formatter = dateStrGetter(0, TranslationWidth.Narrow, FormStyle.Format, true);
      break;
    // Hour in AM/PM, (1-12)
    case "h":
      formatter = dateGetter(3, 1, -12);
      break;
    case "hh":
      formatter = dateGetter(3, 2, -12);
      break;
    // Hour of the day (0-23)
    case "H":
      formatter = dateGetter(3, 1);
      break;
    // Hour in day, padded (00-23)
    case "HH":
      formatter = dateGetter(3, 2);
      break;
    // Minute of the hour (0-59)
    case "m":
      formatter = dateGetter(4, 1);
      break;
    case "mm":
      formatter = dateGetter(4, 2);
      break;
    // Second of the minute (0-59)
    case "s":
      formatter = dateGetter(5, 1);
      break;
    case "ss":
      formatter = dateGetter(5, 2);
      break;
    // Fractional second
    case "S":
      formatter = dateGetter(6, 1);
      break;
    case "SS":
      formatter = dateGetter(6, 2);
      break;
    case "SSS":
      formatter = dateGetter(6, 3);
      break;
    // Timezone ISO8601 short format (-0430)
    case "Z":
    case "ZZ":
    case "ZZZ":
      formatter = timeZoneGetter(
        0
        /* ZoneWidth.Short */
      );
      break;
    // Timezone ISO8601 extended format (-04:30)
    case "ZZZZZ":
      formatter = timeZoneGetter(
        3
        /* ZoneWidth.Extended */
      );
      break;
    // Timezone GMT short format (GMT+4)
    case "O":
    case "OO":
    case "OOO":
    // Should be location, but fallback to format O instead because we don't have the data yet
    case "z":
    case "zz":
    case "zzz":
      formatter = timeZoneGetter(
        1
        /* ZoneWidth.ShortGMT */
      );
      break;
    // Timezone GMT long format (GMT+0430)
    case "OOOO":
    case "ZZZZ":
    // Should be location, but fallback to format O instead because we don't have the data yet
    case "zzzz":
      formatter = timeZoneGetter(
        2
        /* ZoneWidth.Long */
      );
      break;
    default:
      return null;
  }
  DATE_FORMATS[format] = formatter;
  return formatter;
}
function timezoneToOffset(timezone, fallback) {
  timezone = timezone.replace(/:/g, "");
  const requestedTimezoneOffset = Date.parse("Jan 01, 1970 00:00:00 " + timezone) / 6e4;
  return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;
}
function addDateMinutes(date, minutes) {
  date = new Date(date.getTime());
  date.setMinutes(date.getMinutes() + minutes);
  return date;
}
function convertTimezoneToLocal(date, timezone, reverse) {
  const reverseValue = -1;
  const dateTimezoneOffset = date.getTimezoneOffset();
  const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
  return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));
}
function toDate(value) {
  if (isDate(value)) {
    return value;
  }
  if (typeof value === "number" && !isNaN(value)) {
    return new Date(value);
  }
  if (typeof value === "string") {
    value = value.trim();
    if (/^(\d{4}(-\d{1,2}(-\d{1,2})?)?)$/.test(value)) {
      const [y, m = 1, d = 1] = value.split("-").map((val) => +val);
      return createDate(y, m - 1, d);
    }
    const parsedNb = parseFloat(value);
    if (!isNaN(value - parsedNb)) {
      return new Date(parsedNb);
    }
    let match2;
    if (match2 = value.match(ISO8601_DATE_REGEX)) {
      return isoStringToDate(match2);
    }
  }
  const date = new Date(value);
  if (!isDate(date)) {
    throw new RuntimeError(2302, ngDevMode && `Unable to convert "${value}" into a date`);
  }
  return date;
}
function isoStringToDate(match2) {
  const date = /* @__PURE__ */ new Date(0);
  let tzHour = 0;
  let tzMin = 0;
  const dateSetter = match2[8] ? date.setUTCFullYear : date.setFullYear;
  const timeSetter = match2[8] ? date.setUTCHours : date.setHours;
  if (match2[9]) {
    tzHour = Number(match2[9] + match2[10]);
    tzMin = Number(match2[9] + match2[11]);
  }
  dateSetter.call(date, Number(match2[1]), Number(match2[2]) - 1, Number(match2[3]));
  const h = Number(match2[4] || 0) - tzHour;
  const m = Number(match2[5] || 0) - tzMin;
  const s = Number(match2[6] || 0);
  const ms = Math.floor(parseFloat("0." + (match2[7] || 0)) * 1e3);
  timeSetter.call(date, h, m, s, ms);
  return date;
}
function isDate(value) {
  return value instanceof Date && !isNaN(value.valueOf());
}
var NUMBER_FORMAT_REGEXP = /^(\d+)?\.((\d+)(-(\d+))?)?$/;
var MAX_DIGITS = 22;
var DECIMAL_SEP = ".";
var ZERO_CHAR = "0";
var PATTERN_SEP = ";";
var GROUP_SEP = ",";
var DIGIT_CHAR = "#";
var CURRENCY_CHAR = "\xA4";
var PERCENT_CHAR = "%";
function formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {
  let formattedText = "";
  let isZero = false;
  if (!isFinite(value)) {
    formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);
  } else {
    let parsedNumber = parseNumber(value);
    if (isPercent) {
      parsedNumber = toPercent(parsedNumber);
    }
    let minInt = pattern.minInt;
    let minFraction = pattern.minFrac;
    let maxFraction = pattern.maxFrac;
    if (digitsInfo) {
      const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);
      if (parts === null) {
        throw new Error(`${digitsInfo} is not a valid digit info`);
      }
      const minIntPart = parts[1];
      const minFractionPart = parts[3];
      const maxFractionPart = parts[5];
      if (minIntPart != null) {
        minInt = parseIntAutoRadix(minIntPart);
      }
      if (minFractionPart != null) {
        minFraction = parseIntAutoRadix(minFractionPart);
      }
      if (maxFractionPart != null) {
        maxFraction = parseIntAutoRadix(maxFractionPart);
      } else if (minFractionPart != null && minFraction > maxFraction) {
        maxFraction = minFraction;
      }
    }
    roundNumber(parsedNumber, minFraction, maxFraction);
    let digits = parsedNumber.digits;
    let integerLen = parsedNumber.integerLen;
    const exponent = parsedNumber.exponent;
    let decimals = [];
    isZero = digits.every((d) => !d);
    for (; integerLen < minInt; integerLen++) {
      digits.unshift(0);
    }
    for (; integerLen < 0; integerLen++) {
      digits.unshift(0);
    }
    if (integerLen > 0) {
      decimals = digits.splice(integerLen, digits.length);
    } else {
      decimals = digits;
      digits = [0];
    }
    const groups = [];
    if (digits.length >= pattern.lgSize) {
      groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(""));
    }
    while (digits.length > pattern.gSize) {
      groups.unshift(digits.splice(-pattern.gSize, digits.length).join(""));
    }
    if (digits.length) {
      groups.unshift(digits.join(""));
    }
    formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));
    if (decimals.length) {
      formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join("");
    }
    if (exponent) {
      formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + "+" + exponent;
    }
  }
  if (value < 0 && !isZero) {
    formattedText = pattern.negPre + formattedText + pattern.negSuf;
  } else {
    formattedText = pattern.posPre + formattedText + pattern.posSuf;
  }
  return formattedText;
}
function formatCurrency(value, locale, currency, currencyCode, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);
  pattern.maxFrac = pattern.minFrac;
  const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);
  return res.replace(CURRENCY_CHAR, currency).replace(CURRENCY_CHAR, "").trim();
}
function formatPercent(value, locale, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);
  return res.replace(new RegExp(PERCENT_CHAR, "g"), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));
}
function formatNumber(value, locale, digitsInfo) {
  const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);
  const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
  return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);
}
function parseNumberFormat(format, minusSign = "-") {
  const p = {
    minInt: 1,
    minFrac: 0,
    maxFrac: 0,
    posPre: "",
    posSuf: "",
    negPre: "",
    negSuf: "",
    gSize: 0,
    lgSize: 0
  };
  const patternParts = format.split(PATTERN_SEP);
  const positive = patternParts[0];
  const negative = patternParts[1];
  const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ? positive.split(DECIMAL_SEP) : [positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1), positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)], integer = positiveParts[0], fraction = positiveParts[1] || "";
  p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));
  for (let i = 0; i < fraction.length; i++) {
    const ch = fraction.charAt(i);
    if (ch === ZERO_CHAR) {
      p.minFrac = p.maxFrac = i + 1;
    } else if (ch === DIGIT_CHAR) {
      p.maxFrac = i + 1;
    } else {
      p.posSuf += ch;
    }
  }
  const groups = integer.split(GROUP_SEP);
  p.gSize = groups[1] ? groups[1].length : 0;
  p.lgSize = groups[2] || groups[1] ? (groups[2] || groups[1]).length : 0;
  if (negative) {
    const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);
    p.negPre = negative.substring(0, pos).replace(/'/g, "");
    p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, "");
  } else {
    p.negPre = minusSign + p.posPre;
    p.negSuf = p.posSuf;
  }
  return p;
}
function toPercent(parsedNumber) {
  if (parsedNumber.digits[0] === 0) {
    return parsedNumber;
  }
  const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;
  if (parsedNumber.exponent) {
    parsedNumber.exponent += 2;
  } else {
    if (fractionLen === 0) {
      parsedNumber.digits.push(0, 0);
    } else if (fractionLen === 1) {
      parsedNumber.digits.push(0);
    }
    parsedNumber.integerLen += 2;
  }
  return parsedNumber;
}
function parseNumber(num) {
  let numStr = Math.abs(num) + "";
  let exponent = 0, digits, integerLen;
  let i, j, zeros;
  if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {
    numStr = numStr.replace(DECIMAL_SEP, "");
  }
  if ((i = numStr.search(/e/i)) > 0) {
    if (integerLen < 0) integerLen = i;
    integerLen += +numStr.slice(i + 1);
    numStr = numStr.substring(0, i);
  } else if (integerLen < 0) {
    integerLen = numStr.length;
  }
  for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) {
  }
  if (i === (zeros = numStr.length)) {
    digits = [0];
    integerLen = 1;
  } else {
    zeros--;
    while (numStr.charAt(zeros) === ZERO_CHAR) zeros--;
    integerLen -= i;
    digits = [];
    for (j = 0; i <= zeros; i++, j++) {
      digits[j] = Number(numStr.charAt(i));
    }
  }
  if (integerLen > MAX_DIGITS) {
    digits = digits.splice(0, MAX_DIGITS - 1);
    exponent = integerLen - 1;
    integerLen = 1;
  }
  return {
    digits,
    exponent,
    integerLen
  };
}
function roundNumber(parsedNumber, minFrac, maxFrac) {
  if (minFrac > maxFrac) {
    throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);
  }
  let digits = parsedNumber.digits;
  let fractionLen = digits.length - parsedNumber.integerLen;
  const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);
  let roundAt = fractionSize + parsedNumber.integerLen;
  let digit = digits[roundAt];
  if (roundAt > 0) {
    digits.splice(Math.max(parsedNumber.integerLen, roundAt));
    for (let j = roundAt; j < digits.length; j++) {
      digits[j] = 0;
    }
  } else {
    fractionLen = Math.max(0, fractionLen);
    parsedNumber.integerLen = 1;
    digits.length = Math.max(1, roundAt = fractionSize + 1);
    digits[0] = 0;
    for (let i = 1; i < roundAt; i++) digits[i] = 0;
  }
  if (digit >= 5) {
    if (roundAt - 1 < 0) {
      for (let k = 0; k > roundAt; k--) {
        digits.unshift(0);
        parsedNumber.integerLen++;
      }
      digits.unshift(1);
      parsedNumber.integerLen++;
    } else {
      digits[roundAt - 1]++;
    }
  }
  for (; fractionLen < Math.max(0, fractionSize); fractionLen++) digits.push(0);
  let dropTrailingZeros = fractionSize !== 0;
  const minLen = minFrac + parsedNumber.integerLen;
  const carry = digits.reduceRight(function(carry2, d, i, digits2) {
    d = d + carry2;
    digits2[i] = d < 10 ? d : d - 10;
    if (dropTrailingZeros) {
      if (digits2[i] === 0 && i >= minLen) {
        digits2.pop();
      } else {
        dropTrailingZeros = false;
      }
    }
    return d >= 10 ? 1 : 0;
  }, 0);
  if (carry) {
    digits.unshift(carry);
    parsedNumber.integerLen++;
  }
}
function parseIntAutoRadix(text) {
  const result = parseInt(text);
  if (isNaN(result)) {
    throw new Error("Invalid integer literal when parsing " + text);
  }
  return result;
}
var NgLocalization = class _NgLocalization {
  static \u0275fac = function NgLocalization_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgLocalization)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _NgLocalization,
    factory: function NgLocalization_Factory(__ngFactoryType__) {
      let __ngConditionalFactory__ = null;
      if (__ngFactoryType__) {
        __ngConditionalFactory__ = new __ngFactoryType__();
      } else {
        __ngConditionalFactory__ = ((locale) => new NgLocaleLocalization(locale))(\u0275\u0275inject(LOCALE_ID));
      }
      return __ngConditionalFactory__;
    },
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgLocalization, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: (locale) => new NgLocaleLocalization(locale),
      deps: [LOCALE_ID]
    }]
  }], null, null);
})();
function getPluralCategory(value, cases, ngLocalization, locale) {
  let key = `=${value}`;
  if (cases.indexOf(key) > -1) {
    return key;
  }
  key = ngLocalization.getPluralCategory(value, locale);
  if (cases.indexOf(key) > -1) {
    return key;
  }
  if (cases.indexOf("other") > -1) {
    return "other";
  }
  throw new Error(`No plural message found for value "${value}"`);
}
var NgLocaleLocalization = class _NgLocaleLocalization extends NgLocalization {
  locale;
  constructor(locale) {
    super();
    this.locale = locale;
  }
  getPluralCategory(value, locale) {
    const plural = getLocalePluralCase2(locale || this.locale)(value);
    switch (plural) {
      case Plural.Zero:
        return "zero";
      case Plural.One:
        return "one";
      case Plural.Two:
        return "two";
      case Plural.Few:
        return "few";
      case Plural.Many:
        return "many";
      default:
        return "other";
    }
  }
  static \u0275fac = function NgLocaleLocalization_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgLocaleLocalization)(\u0275\u0275inject(LOCALE_ID));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _NgLocaleLocalization,
    factory: _NgLocaleLocalization.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgLocaleLocalization, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
function parseCookieValue(cookieStr, name) {
  name = encodeURIComponent(name);
  for (const cookie of cookieStr.split(";")) {
    const eqIndex = cookie.indexOf("=");
    const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ""] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];
    if (cookieName.trim() === name) {
      return decodeURIComponent(cookieValue);
    }
  }
  return null;
}
var WS_REGEXP = /\s+/;
var EMPTY_ARRAY = [];
var NgClass = class _NgClass {
  _ngEl;
  _renderer;
  initialClasses = EMPTY_ARRAY;
  rawClass;
  stateMap = /* @__PURE__ */ new Map();
  constructor(_ngEl, _renderer) {
    this._ngEl = _ngEl;
    this._renderer = _renderer;
  }
  set klass(value) {
    this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;
  }
  set ngClass(value) {
    this.rawClass = typeof value === "string" ? value.trim().split(WS_REGEXP) : value;
  }
  /*
  The NgClass directive uses the custom change detection algorithm for its inputs. The custom
  algorithm is necessary since inputs are represented as complex object or arrays that need to be
  deeply-compared.
     This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance
  might negatively impact runtime performance of the entire change detection cycle. The design of
  this algorithm is making sure that:
  - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when
  needed), even if references to bound objects change;
  - there is no memory allocation if nothing changes (even relatively modest memory allocation
  during the change detection cycle can result in GC pauses for some of the CD cycles).
     The algorithm works by iterating over the set of bound classes, staring with [class] binding and
  then going over [ngClass] binding. For each CSS class name:
  - check if it was seen before (this information is tracked in the state map) and if its value
  changed;
  - mark it as "touched" - names that are not marked are not present in the latest set of binding
  and we can remove such class name from the internal data structures;
     After iteration over all the CSS class names we've got data structure with all the information
  necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush
  changes to the DOM and reset internal data structures so those are ready for the next change
  detection cycle.
   */
  ngDoCheck() {
    for (const klass of this.initialClasses) {
      this._updateState(klass, true);
    }
    const rawClass = this.rawClass;
    if (Array.isArray(rawClass) || rawClass instanceof Set) {
      for (const klass of rawClass) {
        this._updateState(klass, true);
      }
    } else if (rawClass != null) {
      for (const klass of Object.keys(rawClass)) {
        this._updateState(klass, Boolean(rawClass[klass]));
      }
    }
    this._applyStateDiff();
  }
  _updateState(klass, nextEnabled) {
    const state = this.stateMap.get(klass);
    if (state !== void 0) {
      if (state.enabled !== nextEnabled) {
        state.changed = true;
        state.enabled = nextEnabled;
      }
      state.touched = true;
    } else {
      this.stateMap.set(klass, {
        enabled: nextEnabled,
        changed: true,
        touched: true
      });
    }
  }
  _applyStateDiff() {
    for (const stateEntry of this.stateMap) {
      const klass = stateEntry[0];
      const state = stateEntry[1];
      if (state.changed) {
        this._toggleClass(klass, state.enabled);
        state.changed = false;
      } else if (!state.touched) {
        if (state.enabled) {
          this._toggleClass(klass, false);
        }
        this.stateMap.delete(klass);
      }
      state.touched = false;
    }
  }
  _toggleClass(klass, enabled) {
    if (ngDevMode) {
      if (typeof klass !== "string") {
        throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${stringify(klass)}`);
      }
    }
    klass = klass.trim();
    if (klass.length > 0) {
      klass.split(WS_REGEXP).forEach((klass2) => {
        if (enabled) {
          this._renderer.addClass(this._ngEl.nativeElement, klass2);
        } else {
          this._renderer.removeClass(this._ngEl.nativeElement, klass2);
        }
      });
    }
  }
  static \u0275fac = function NgClass_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgClass)(\u0275\u0275directiveInject(ElementRef), \u0275\u0275directiveInject(Renderer2));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgClass,
    selectors: [["", "ngClass", ""]],
    inputs: {
      klass: [0, "class", "klass"],
      ngClass: "ngClass"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgClass, [{
    type: Directive,
    args: [{
      selector: "[ngClass]"
    }]
  }], () => [{
    type: ElementRef
  }, {
    type: Renderer2
  }], {
    klass: [{
      type: Input,
      args: ["class"]
    }],
    ngClass: [{
      type: Input,
      args: ["ngClass"]
    }]
  });
})();
var NgComponentOutlet = class _NgComponentOutlet {
  _viewContainerRef;
  // TODO(crisbeto): this should be `Type<T>`, but doing so broke a few
  // targets in a TGP so we need to do it in a major version.
  /** Component that should be rendered in the outlet. */
  ngComponentOutlet = null;
  ngComponentOutletInputs;
  ngComponentOutletInjector;
  ngComponentOutletContent;
  ngComponentOutletNgModule;
  /**
   * @deprecated This input is deprecated, use `ngComponentOutletNgModule` instead.
   */
  ngComponentOutletNgModuleFactory;
  _componentRef;
  _moduleRef;
  /**
   * A helper data structure that allows us to track inputs that were part of the
   * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones
   * that are no longer referenced.
   */
  _inputsUsed = /* @__PURE__ */ new Map();
  /**
   * Gets the instance of the currently-rendered component.
   * Will be null if no component has been rendered.
   */
  get componentInstance() {
    return this._componentRef?.instance ?? null;
  }
  constructor(_viewContainerRef) {
    this._viewContainerRef = _viewContainerRef;
  }
  _needToReCreateNgModuleInstance(changes) {
    return changes["ngComponentOutletNgModule"] !== void 0 || changes["ngComponentOutletNgModuleFactory"] !== void 0;
  }
  _needToReCreateComponentInstance(changes) {
    return changes["ngComponentOutlet"] !== void 0 || changes["ngComponentOutletContent"] !== void 0 || changes["ngComponentOutletInjector"] !== void 0 || this._needToReCreateNgModuleInstance(changes);
  }
  /** @nodoc */
  ngOnChanges(changes) {
    if (this._needToReCreateComponentInstance(changes)) {
      this._viewContainerRef.clear();
      this._inputsUsed.clear();
      this._componentRef = void 0;
      if (this.ngComponentOutlet) {
        const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;
        if (this._needToReCreateNgModuleInstance(changes)) {
          this._moduleRef?.destroy();
          if (this.ngComponentOutletNgModule) {
            this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));
          } else if (this.ngComponentOutletNgModuleFactory) {
            this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));
          } else {
            this._moduleRef = void 0;
          }
        }
        this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {
          injector,
          ngModuleRef: this._moduleRef,
          projectableNodes: this.ngComponentOutletContent
        });
      }
    }
  }
  /** @nodoc */
  ngDoCheck() {
    if (this._componentRef) {
      if (this.ngComponentOutletInputs) {
        for (const inputName of Object.keys(this.ngComponentOutletInputs)) {
          this._inputsUsed.set(inputName, true);
        }
      }
      this._applyInputStateDiff(this._componentRef);
    }
  }
  /** @nodoc */
  ngOnDestroy() {
    this._moduleRef?.destroy();
  }
  _applyInputStateDiff(componentRef) {
    for (const [inputName, touched] of this._inputsUsed) {
      if (!touched) {
        componentRef.setInput(inputName, void 0);
        this._inputsUsed.delete(inputName);
      } else {
        componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);
        this._inputsUsed.set(inputName, false);
      }
    }
  }
  static \u0275fac = function NgComponentOutlet_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgComponentOutlet)(\u0275\u0275directiveInject(ViewContainerRef));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgComponentOutlet,
    selectors: [["", "ngComponentOutlet", ""]],
    inputs: {
      ngComponentOutlet: "ngComponentOutlet",
      ngComponentOutletInputs: "ngComponentOutletInputs",
      ngComponentOutletInjector: "ngComponentOutletInjector",
      ngComponentOutletContent: "ngComponentOutletContent",
      ngComponentOutletNgModule: "ngComponentOutletNgModule",
      ngComponentOutletNgModuleFactory: "ngComponentOutletNgModuleFactory"
    },
    exportAs: ["ngComponentOutlet"],
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgComponentOutlet, [{
    type: Directive,
    args: [{
      selector: "[ngComponentOutlet]",
      exportAs: "ngComponentOutlet"
    }]
  }], () => [{
    type: ViewContainerRef
  }], {
    ngComponentOutlet: [{
      type: Input
    }],
    ngComponentOutletInputs: [{
      type: Input
    }],
    ngComponentOutletInjector: [{
      type: Input
    }],
    ngComponentOutletContent: [{
      type: Input
    }],
    ngComponentOutletNgModule: [{
      type: Input
    }],
    ngComponentOutletNgModuleFactory: [{
      type: Input
    }]
  });
})();
function getParentInjector(injector) {
  const parentNgModule = injector.get(NgModuleRef$1);
  return parentNgModule.injector;
}
var NgForOfContext = class {
  $implicit;
  ngForOf;
  index;
  count;
  constructor($implicit, ngForOf, index, count) {
    this.$implicit = $implicit;
    this.ngForOf = ngForOf;
    this.index = index;
    this.count = count;
  }
  // Indicates whether this is the first item in the collection.
  get first() {
    return this.index === 0;
  }
  // Indicates whether this is the last item in the collection.
  get last() {
    return this.index === this.count - 1;
  }
  // Indicates whether an index of this item in the collection is even.
  get even() {
    return this.index % 2 === 0;
  }
  // Indicates whether an index of this item in the collection is odd.
  get odd() {
    return !this.even;
  }
};
var NgForOf = class _NgForOf {
  _viewContainer;
  _template;
  _differs;
  /**
   * The value of the iterable expression, which can be used as a
   * [template input variable](guide/directives/structural-directives#shorthand).
   */
  set ngForOf(ngForOf) {
    this._ngForOf = ngForOf;
    this._ngForOfDirty = true;
  }
  /**
   * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.
   *
   * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object
   * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)
   * as the key.
   *
   * `NgForOf` uses the computed key to associate items in an iterable with DOM elements
   * it produces for these items.
   *
   * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an
   * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a
   * primary key), and this iterable could be updated with new object instances that still
   * represent the same underlying entity (for example, when data is re-fetched from the server,
   * and the iterable is recreated and re-rendered, but most of the data is still the same).
   *
   * @see {@link TrackByFunction}
   */
  set ngForTrackBy(fn) {
    if ((typeof ngDevMode === "undefined" || ngDevMode) && fn != null && typeof fn !== "function") {
      console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. See https://angular.io/api/common/NgForOf#change-propagation for more information.`);
    }
    this._trackByFn = fn;
  }
  get ngForTrackBy() {
    return this._trackByFn;
  }
  _ngForOf = null;
  _ngForOfDirty = true;
  _differ = null;
  // TODO(issue/24571): remove '!'
  // waiting for microsoft/typescript#43662 to allow the return type `TrackByFunction|undefined` for
  // the getter
  _trackByFn;
  constructor(_viewContainer, _template, _differs) {
    this._viewContainer = _viewContainer;
    this._template = _template;
    this._differs = _differs;
  }
  /**
   * A reference to the template that is stamped out for each item in the iterable.
   * @see [template reference variable](guide/templates/variables#template-reference-variables)
   */
  set ngForTemplate(value) {
    if (value) {
      this._template = value;
    }
  }
  /**
   * Applies the changes when needed.
   * @nodoc
   */
  ngDoCheck() {
    if (this._ngForOfDirty) {
      this._ngForOfDirty = false;
      const value = this._ngForOf;
      if (!this._differ && value) {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          try {
            this._differ = this._differs.find(value).create(this.ngForTrackBy);
          } catch {
            let errorMessage = `Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;
            if (typeof value === "object") {
              errorMessage += " Did you mean to use the keyvalue pipe?";
            }
            throw new RuntimeError(-2200, errorMessage);
          }
        } else {
          this._differ = this._differs.find(value).create(this.ngForTrackBy);
        }
      }
    }
    if (this._differ) {
      const changes = this._differ.diff(this._ngForOf);
      if (changes) this._applyChanges(changes);
    }
  }
  _applyChanges(changes) {
    const viewContainer = this._viewContainer;
    changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {
      if (item.previousIndex == null) {
        viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? void 0 : currentIndex);
      } else if (currentIndex == null) {
        viewContainer.remove(adjustedPreviousIndex === null ? void 0 : adjustedPreviousIndex);
      } else if (adjustedPreviousIndex !== null) {
        const view = viewContainer.get(adjustedPreviousIndex);
        viewContainer.move(view, currentIndex);
        applyViewChange(view, item);
      }
    });
    for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {
      const viewRef = viewContainer.get(i);
      const context = viewRef.context;
      context.index = i;
      context.count = ilen;
      context.ngForOf = this._ngForOf;
    }
    changes.forEachIdentityChange((record) => {
      const viewRef = viewContainer.get(record.currentIndex);
      applyViewChange(viewRef, record);
    });
  }
  /**
   * Asserts the correct type of the context for the template that `NgForOf` will render.
   *
   * The presence of this method is a signal to the Ivy template type-check compiler that the
   * `NgForOf` structural directive renders its template with a specific context type.
   */
  static ngTemplateContextGuard(dir, ctx) {
    return true;
  }
  static \u0275fac = function NgForOf_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgForOf)(\u0275\u0275directiveInject(ViewContainerRef), \u0275\u0275directiveInject(TemplateRef), \u0275\u0275directiveInject(IterableDiffers));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgForOf,
    selectors: [["", "ngFor", "", "ngForOf", ""]],
    inputs: {
      ngForOf: "ngForOf",
      ngForTrackBy: "ngForTrackBy",
      ngForTemplate: "ngForTemplate"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgForOf, [{
    type: Directive,
    args: [{
      selector: "[ngFor][ngForOf]"
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: IterableDiffers
  }], {
    ngForOf: [{
      type: Input
    }],
    ngForTrackBy: [{
      type: Input
    }],
    ngForTemplate: [{
      type: Input
    }]
  });
})();
function applyViewChange(view, record) {
  view.context.$implicit = record.item;
}
function getTypeName(type) {
  return type["name"] || typeof type;
}
var NgIf = class _NgIf {
  _viewContainer;
  _context = new NgIfContext();
  _thenTemplateRef = null;
  _elseTemplateRef = null;
  _thenViewRef = null;
  _elseViewRef = null;
  constructor(_viewContainer, templateRef) {
    this._viewContainer = _viewContainer;
    this._thenTemplateRef = templateRef;
  }
  /**
   * The Boolean expression to evaluate as the condition for showing a template.
   */
  set ngIf(condition) {
    this._context.$implicit = this._context.ngIf = condition;
    this._updateView();
  }
  /**
   * A template to show if the condition expression evaluates to true.
   */
  set ngIfThen(templateRef) {
    assertTemplate(templateRef, (typeof ngDevMode === "undefined" || ngDevMode) && "ngIfThen");
    this._thenTemplateRef = templateRef;
    this._thenViewRef = null;
    this._updateView();
  }
  /**
   * A template to show if the condition expression evaluates to false.
   */
  set ngIfElse(templateRef) {
    assertTemplate(templateRef, (typeof ngDevMode === "undefined" || ngDevMode) && "ngIfElse");
    this._elseTemplateRef = templateRef;
    this._elseViewRef = null;
    this._updateView();
  }
  _updateView() {
    if (this._context.$implicit) {
      if (!this._thenViewRef) {
        this._viewContainer.clear();
        this._elseViewRef = null;
        if (this._thenTemplateRef) {
          this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);
        }
      }
    } else {
      if (!this._elseViewRef) {
        this._viewContainer.clear();
        this._thenViewRef = null;
        if (this._elseTemplateRef) {
          this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);
        }
      }
    }
  }
  /** @internal */
  static ngIfUseIfTypeGuard;
  /**
   * Assert the correct type of the expression bound to the `ngIf` input within the template.
   *
   * The presence of this static field is a signal to the Ivy template type check compiler that
   * when the `NgIf` structural directive renders its template, the type of the expression bound
   * to `ngIf` should be narrowed in some way. For `NgIf`, the binding expression itself is used to
   * narrow its type, which allows the strictNullChecks feature of TypeScript to work with `NgIf`.
   */
  static ngTemplateGuard_ngIf;
  /**
   * Asserts the correct type of the context for the template that `NgIf` will render.
   *
   * The presence of this method is a signal to the Ivy template type-check compiler that the
   * `NgIf` structural directive renders its template with a specific context type.
   */
  static ngTemplateContextGuard(dir, ctx) {
    return true;
  }
  static \u0275fac = function NgIf_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgIf)(\u0275\u0275directiveInject(ViewContainerRef), \u0275\u0275directiveInject(TemplateRef));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgIf,
    selectors: [["", "ngIf", ""]],
    inputs: {
      ngIf: "ngIf",
      ngIfThen: "ngIfThen",
      ngIfElse: "ngIfElse"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgIf, [{
    type: Directive,
    args: [{
      selector: "[ngIf]"
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }], {
    ngIf: [{
      type: Input
    }],
    ngIfThen: [{
      type: Input
    }],
    ngIfElse: [{
      type: Input
    }]
  });
})();
var NgIfContext = class {
  $implicit = null;
  ngIf = null;
};
function assertTemplate(templateRef, property) {
  if (templateRef && !templateRef.createEmbeddedView) {
    throw new RuntimeError(2020, (typeof ngDevMode === "undefined" || ngDevMode) && `${property} must be a TemplateRef, but received '${stringify(templateRef)}'.`);
  }
}
var SwitchView = class {
  _viewContainerRef;
  _templateRef;
  _created = false;
  constructor(_viewContainerRef, _templateRef) {
    this._viewContainerRef = _viewContainerRef;
    this._templateRef = _templateRef;
  }
  create() {
    this._created = true;
    this._viewContainerRef.createEmbeddedView(this._templateRef);
  }
  destroy() {
    this._created = false;
    this._viewContainerRef.clear();
  }
  enforceState(created) {
    if (created && !this._created) {
      this.create();
    } else if (!created && this._created) {
      this.destroy();
    }
  }
};
var NgSwitch = class _NgSwitch {
  _defaultViews = [];
  _defaultUsed = false;
  _caseCount = 0;
  _lastCaseCheckIndex = 0;
  _lastCasesMatched = false;
  _ngSwitch;
  set ngSwitch(newValue) {
    this._ngSwitch = newValue;
    if (this._caseCount === 0) {
      this._updateDefaultCases(true);
    }
  }
  /** @internal */
  _addCase() {
    return this._caseCount++;
  }
  /** @internal */
  _addDefault(view) {
    this._defaultViews.push(view);
  }
  /** @internal */
  _matchCase(value) {
    const matched = value === this._ngSwitch;
    this._lastCasesMatched ||= matched;
    this._lastCaseCheckIndex++;
    if (this._lastCaseCheckIndex === this._caseCount) {
      this._updateDefaultCases(!this._lastCasesMatched);
      this._lastCaseCheckIndex = 0;
      this._lastCasesMatched = false;
    }
    return matched;
  }
  _updateDefaultCases(useDefault) {
    if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {
      this._defaultUsed = useDefault;
      for (const defaultView of this._defaultViews) {
        defaultView.enforceState(useDefault);
      }
    }
  }
  static \u0275fac = function NgSwitch_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgSwitch)();
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgSwitch,
    selectors: [["", "ngSwitch", ""]],
    inputs: {
      ngSwitch: "ngSwitch"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitch, [{
    type: Directive,
    args: [{
      selector: "[ngSwitch]"
    }]
  }], null, {
    ngSwitch: [{
      type: Input
    }]
  });
})();
var NgSwitchCase = class _NgSwitchCase {
  ngSwitch;
  _view;
  /**
   * Stores the HTML template to be selected on match.
   */
  ngSwitchCase;
  constructor(viewContainer, templateRef, ngSwitch) {
    this.ngSwitch = ngSwitch;
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !ngSwitch) {
      throwNgSwitchProviderNotFoundError("ngSwitchCase", "NgSwitchCase");
    }
    ngSwitch._addCase();
    this._view = new SwitchView(viewContainer, templateRef);
  }
  /**
   * Performs case matching. For internal use only.
   * @nodoc
   */
  ngDoCheck() {
    this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));
  }
  static \u0275fac = function NgSwitchCase_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgSwitchCase)(\u0275\u0275directiveInject(ViewContainerRef), \u0275\u0275directiveInject(TemplateRef), \u0275\u0275directiveInject(NgSwitch, 9));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgSwitchCase,
    selectors: [["", "ngSwitchCase", ""]],
    inputs: {
      ngSwitchCase: "ngSwitchCase"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitchCase, [{
    type: Directive,
    args: [{
      selector: "[ngSwitchCase]"
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: NgSwitch,
    decorators: [{
      type: Optional
    }, {
      type: Host
    }]
  }], {
    ngSwitchCase: [{
      type: Input
    }]
  });
})();
var NgSwitchDefault = class _NgSwitchDefault {
  constructor(viewContainer, templateRef, ngSwitch) {
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !ngSwitch) {
      throwNgSwitchProviderNotFoundError("ngSwitchDefault", "NgSwitchDefault");
    }
    ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));
  }
  static \u0275fac = function NgSwitchDefault_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgSwitchDefault)(\u0275\u0275directiveInject(ViewContainerRef), \u0275\u0275directiveInject(TemplateRef), \u0275\u0275directiveInject(NgSwitch, 9));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgSwitchDefault,
    selectors: [["", "ngSwitchDefault", ""]]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgSwitchDefault, [{
    type: Directive,
    args: [{
      selector: "[ngSwitchDefault]"
    }]
  }], () => [{
    type: ViewContainerRef
  }, {
    type: TemplateRef
  }, {
    type: NgSwitch,
    decorators: [{
      type: Optional
    }, {
      type: Host
    }]
  }], null);
})();
function throwNgSwitchProviderNotFoundError(attrName, directiveName) {
  throw new RuntimeError(2e3, `An element with the "${attrName}" attribute (matching the "${directiveName}" directive) must be located inside an element with the "ngSwitch" attribute (matching "NgSwitch" directive)`);
}
var NgPlural = class _NgPlural {
  _localization;
  _activeView;
  _caseViews = {};
  constructor(_localization) {
    this._localization = _localization;
  }
  set ngPlural(value) {
    this._updateView(value);
  }
  addCase(value, switchView) {
    this._caseViews[value] = switchView;
  }
  _updateView(switchValue) {
    this._clearViews();
    const cases = Object.keys(this._caseViews);
    const key = getPluralCategory(switchValue, cases, this._localization);
    this._activateView(this._caseViews[key]);
  }
  _clearViews() {
    if (this._activeView) this._activeView.destroy();
  }
  _activateView(view) {
    if (view) {
      this._activeView = view;
      this._activeView.create();
    }
  }
  static \u0275fac = function NgPlural_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgPlural)(\u0275\u0275directiveInject(NgLocalization));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgPlural,
    selectors: [["", "ngPlural", ""]],
    inputs: {
      ngPlural: "ngPlural"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgPlural, [{
    type: Directive,
    args: [{
      selector: "[ngPlural]"
    }]
  }], () => [{
    type: NgLocalization
  }], {
    ngPlural: [{
      type: Input
    }]
  });
})();
var NgPluralCase = class _NgPluralCase {
  value;
  constructor(value, template, viewContainer, ngPlural) {
    this.value = value;
    const isANumber = !isNaN(Number(value));
    ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));
  }
  static \u0275fac = function NgPluralCase_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgPluralCase)(\u0275\u0275injectAttribute("ngPluralCase"), \u0275\u0275directiveInject(TemplateRef), \u0275\u0275directiveInject(ViewContainerRef), \u0275\u0275directiveInject(NgPlural, 1));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgPluralCase,
    selectors: [["", "ngPluralCase", ""]]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgPluralCase, [{
    type: Directive,
    args: [{
      selector: "[ngPluralCase]"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Attribute,
      args: ["ngPluralCase"]
    }]
  }, {
    type: TemplateRef
  }, {
    type: ViewContainerRef
  }, {
    type: NgPlural,
    decorators: [{
      type: Host
    }]
  }], null);
})();
var NgStyle = class _NgStyle {
  _ngEl;
  _differs;
  _renderer;
  _ngStyle = null;
  _differ = null;
  constructor(_ngEl, _differs, _renderer) {
    this._ngEl = _ngEl;
    this._differs = _differs;
    this._renderer = _renderer;
  }
  set ngStyle(values) {
    this._ngStyle = values;
    if (!this._differ && values) {
      this._differ = this._differs.find(values).create();
    }
  }
  ngDoCheck() {
    if (this._differ) {
      const changes = this._differ.diff(this._ngStyle);
      if (changes) {
        this._applyChanges(changes);
      }
    }
  }
  _setStyle(nameAndUnit, value) {
    const [name, unit] = nameAndUnit.split(".");
    const flags = name.indexOf("-") === -1 ? void 0 : RendererStyleFlags2.DashCase;
    if (value != null) {
      this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);
    } else {
      this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);
    }
  }
  _applyChanges(changes) {
    changes.forEachRemovedItem((record) => this._setStyle(record.key, null));
    changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));
    changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));
  }
  static \u0275fac = function NgStyle_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgStyle)(\u0275\u0275directiveInject(ElementRef), \u0275\u0275directiveInject(KeyValueDiffers), \u0275\u0275directiveInject(Renderer2));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgStyle,
    selectors: [["", "ngStyle", ""]],
    inputs: {
      ngStyle: "ngStyle"
    }
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgStyle, [{
    type: Directive,
    args: [{
      selector: "[ngStyle]"
    }]
  }], () => [{
    type: ElementRef
  }, {
    type: KeyValueDiffers
  }, {
    type: Renderer2
  }], {
    ngStyle: [{
      type: Input,
      args: ["ngStyle"]
    }]
  });
})();
var NgTemplateOutlet = class _NgTemplateOutlet {
  _viewContainerRef;
  _viewRef = null;
  /**
   * A context object to attach to the {@link EmbeddedViewRef}. This should be an
   * object, the object's keys will be available for binding by the local template `let`
   * declarations.
   * Using the key `$implicit` in the context object will set its value as default.
   */
  ngTemplateOutletContext = null;
  /**
   * A string defining the template reference and optionally the context object for the template.
   */
  ngTemplateOutlet = null;
  /** Injector to be used within the embedded view. */
  ngTemplateOutletInjector = null;
  constructor(_viewContainerRef) {
    this._viewContainerRef = _viewContainerRef;
  }
  ngOnChanges(changes) {
    if (this._shouldRecreateView(changes)) {
      const viewContainerRef = this._viewContainerRef;
      if (this._viewRef) {
        viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));
      }
      if (!this.ngTemplateOutlet) {
        this._viewRef = null;
        return;
      }
      const viewContext = this._createContextForwardProxy();
      this._viewRef = viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, viewContext, {
        injector: this.ngTemplateOutletInjector ?? void 0
      });
    }
  }
  /**
   * We need to re-create existing embedded view if either is true:
   * - the outlet changed.
   * - the injector changed.
   */
  _shouldRecreateView(changes) {
    return !!changes["ngTemplateOutlet"] || !!changes["ngTemplateOutletInjector"];
  }
  /**
   * For a given outlet instance, we create a proxy object that delegates
   * to the user-specified context. This allows changing, or swapping out
   * the context object completely without having to destroy/re-create the view.
   */
  _createContextForwardProxy() {
    return new Proxy({}, {
      set: (_target, prop, newValue) => {
        if (!this.ngTemplateOutletContext) {
          return false;
        }
        return Reflect.set(this.ngTemplateOutletContext, prop, newValue);
      },
      get: (_target, prop, receiver) => {
        if (!this.ngTemplateOutletContext) {
          return void 0;
        }
        return Reflect.get(this.ngTemplateOutletContext, prop, receiver);
      }
    });
  }
  static \u0275fac = function NgTemplateOutlet_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgTemplateOutlet)(\u0275\u0275directiveInject(ViewContainerRef));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgTemplateOutlet,
    selectors: [["", "ngTemplateOutlet", ""]],
    inputs: {
      ngTemplateOutletContext: "ngTemplateOutletContext",
      ngTemplateOutlet: "ngTemplateOutlet",
      ngTemplateOutletInjector: "ngTemplateOutletInjector"
    },
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgTemplateOutlet, [{
    type: Directive,
    args: [{
      selector: "[ngTemplateOutlet]"
    }]
  }], () => [{
    type: ViewContainerRef
  }], {
    ngTemplateOutletContext: [{
      type: Input
    }],
    ngTemplateOutlet: [{
      type: Input
    }],
    ngTemplateOutletInjector: [{
      type: Input
    }]
  });
})();
var COMMON_DIRECTIVES = [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase];
function invalidPipeArgumentError(type, value) {
  return new RuntimeError(2100, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${stringify(type)}'`);
}
var SubscribableStrategy = class {
  createSubscription(async, updateLatestValue, onError) {
    return untracked(() => async.subscribe({
      next: updateLatestValue,
      error: onError
    }));
  }
  dispose(subscription) {
    untracked(() => subscription.unsubscribe());
  }
};
var PromiseStrategy = class {
  createSubscription(async, updateLatestValue, onError) {
    return async.then(updateLatestValue, onError);
  }
  dispose(subscription) {
  }
};
var _promiseStrategy = new PromiseStrategy();
var _subscribableStrategy = new SubscribableStrategy();
var AsyncPipe = class _AsyncPipe {
  _ref;
  _latestValue = null;
  markForCheckOnValueUpdate = true;
  _subscription = null;
  _obj = null;
  _strategy = null;
  applicationErrorHandler = inject(INTERNAL_APPLICATION_ERROR_HANDLER);
  constructor(ref) {
    this._ref = ref;
  }
  ngOnDestroy() {
    if (this._subscription) {
      this._dispose();
    }
    this._ref = null;
  }
  transform(obj) {
    if (!this._obj) {
      if (obj) {
        try {
          this.markForCheckOnValueUpdate = false;
          this._subscribe(obj);
        } finally {
          this.markForCheckOnValueUpdate = true;
        }
      }
      return this._latestValue;
    }
    if (obj !== this._obj) {
      this._dispose();
      return this.transform(obj);
    }
    return this._latestValue;
  }
  _subscribe(obj) {
    this._obj = obj;
    this._strategy = this._selectStrategy(obj);
    this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value), (e) => this.applicationErrorHandler(e));
  }
  _selectStrategy(obj) {
    if (isPromise(obj)) {
      return _promiseStrategy;
    }
    if (isSubscribable(obj)) {
      return _subscribableStrategy;
    }
    throw invalidPipeArgumentError(_AsyncPipe, obj);
  }
  _dispose() {
    this._strategy.dispose(this._subscription);
    this._latestValue = null;
    this._subscription = null;
    this._obj = null;
  }
  _updateLatestValue(async, value) {
    if (async === this._obj) {
      this._latestValue = value;
      if (this.markForCheckOnValueUpdate) {
        this._ref?.markForCheck();
      }
    }
  }
  static \u0275fac = function AsyncPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _AsyncPipe)(\u0275\u0275directiveInject(ChangeDetectorRef, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "async",
    type: _AsyncPipe,
    pure: false
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(AsyncPipe, [{
    type: Pipe,
    args: [{
      name: "async",
      pure: false
    }]
  }], () => [{
    type: ChangeDetectorRef
  }], null);
})();
var LowerCasePipe = class _LowerCasePipe {
  transform(value) {
    if (value == null) return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_LowerCasePipe, value);
    }
    return value.toLowerCase();
  }
  static \u0275fac = function LowerCasePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _LowerCasePipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "lowercase",
    type: _LowerCasePipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LowerCasePipe, [{
    type: Pipe,
    args: [{
      name: "lowercase"
    }]
  }], null, null);
})();
var unicodeWordMatch = /(?:[0-9A-Za-z\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0560-\u0588\u05D0-\u05EA\u05EF-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u0860-\u086A\u0870-\u0887\u0889-\u088E\u08A0-\u08C9\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u09FC\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C5D\u0C60\u0C61\u0C80\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D04-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D54-\u0D56\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E86-\u0E8A\u0E8C-\u0EA3\u0EA5\u0EA7-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16F1-\u16F8\u1700-\u1711\u171F-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1878\u1880-\u1884\u1887-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4C\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1C80-\u1C88\u1C90-\u1CBA\u1CBD-\u1CBF\u1CE9-\u1CEC\u1CEE-\u1CF3\u1CF5\u1CF6\u1CFA\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2119-\u211D\u2124\u2126\u2128\u212A-\u212D\u212F-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2183\u2184\u2C00-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2E2F\u3005\u3006\u3031-\u3035\u303B\u303C\u3041-\u3096\u309D-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312F\u3131-\u318E\u31A0-\u31BF\u31F0-\u31FF\u3400-\u4DBF\u4E00-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6E5\uA717-\uA71F\uA722-\uA788\uA78B-\uA7CA\uA7D0\uA7D1\uA7D3\uA7D5-\uA7D9\uA7F2-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA8FE\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB69\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE70-\uFE74\uFE76-\uFEFC\uFF21-\uFF3A\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDE80-\uDE9C\uDEA0-\uDED0\uDF00-\uDF1F\uDF2D-\uDF40\uDF42-\uDF49\uDF50-\uDF75\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF]|\uD801[\uDC00-\uDC9D\uDCB0-\uDCD3\uDCD8-\uDCFB\uDD00-\uDD27\uDD30-\uDD63\uDD70-\uDD7A\uDD7C-\uDD8A\uDD8C-\uDD92\uDD94\uDD95\uDD97-\uDDA1\uDDA3-\uDDB1\uDDB3-\uDDB9\uDDBB\uDDBC\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67\uDF80-\uDF85\uDF87-\uDFB0\uDFB2-\uDFBA]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00\uDE10-\uDE13\uDE15-\uDE17\uDE19-\uDE35\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE4\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2\uDD00-\uDD23\uDE80-\uDEA9\uDEB0\uDEB1\uDF00-\uDF1C\uDF27\uDF30-\uDF45\uDF70-\uDF81\uDFB0-\uDFC4\uDFE0-\uDFF6]|\uD804[\uDC03-\uDC37\uDC71\uDC72\uDC75\uDC83-\uDCAF\uDCD0-\uDCE8\uDD03-\uDD26\uDD44\uDD47\uDD50-\uDD72\uDD76\uDD83-\uDDB2\uDDC1-\uDDC4\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE2B\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEDE\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3D\uDF50\uDF5D-\uDF61]|\uD805[\uDC00-\uDC34\uDC47-\uDC4A\uDC5F-\uDC61\uDC80-\uDCAF\uDCC4\uDCC5\uDCC7\uDD80-\uDDAE\uDDD8-\uDDDB\uDE00-\uDE2F\uDE44\uDE80-\uDEAA\uDEB8\uDF00-\uDF1A\uDF40-\uDF46]|\uD806[\uDC00-\uDC2B\uDCA0-\uDCDF\uDCFF-\uDD06\uDD09\uDD0C-\uDD13\uDD15\uDD16\uDD18-\uDD2F\uDD3F\uDD41\uDDA0-\uDDA7\uDDAA-\uDDD0\uDDE1\uDDE3\uDE00\uDE0B-\uDE32\uDE3A\uDE50\uDE5C-\uDE89\uDE9D\uDEB0-\uDEF8]|\uD807[\uDC00-\uDC08\uDC0A-\uDC2E\uDC40\uDC72-\uDC8F\uDD00-\uDD06\uDD08\uDD09\uDD0B-\uDD30\uDD46\uDD60-\uDD65\uDD67\uDD68\uDD6A-\uDD89\uDD98\uDEE0-\uDEF2\uDFB0]|\uD808[\uDC00-\uDF99]|\uD809[\uDC80-\uDD43]|\uD80B[\uDF90-\uDFF0]|[\uD80C\uD81C-\uD820\uD822\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872\uD874-\uD879\uD880-\uD883][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDE70-\uDEBE\uDED0-\uDEED\uDF00-\uDF2F\uDF40-\uDF43\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDE40-\uDE7F\uDF00-\uDF4A\uDF50\uDF93-\uDF9F\uDFE0\uDFE1\uDFE3]|\uD821[\uDC00-\uDFF7]|\uD823[\uDC00-\uDCD5\uDD00-\uDD08]|\uD82B[\uDFF0-\uDFF3\uDFF5-\uDFFB\uDFFD\uDFFE]|\uD82C[\uDC00-\uDD22\uDD50-\uDD52\uDD64-\uDD67\uDD70-\uDEFB]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB]|\uD837[\uDF00-\uDF1E]|\uD838[\uDD00-\uDD2C\uDD37-\uDD3D\uDD4E\uDE90-\uDEAD\uDEC0-\uDEEB]|\uD839[\uDFE0-\uDFE6\uDFE8-\uDFEB\uDFED\uDFEE\uDFF0-\uDFFE]|\uD83A[\uDC00-\uDCC4\uDD00-\uDD43\uDD4B]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDEDF\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF38\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1\uDEB0-\uDFFF]|\uD87A[\uDC00-\uDFE0]|\uD87E[\uDC00-\uDE1D]|\uD884[\uDC00-\uDF4A])\S*/g;
var TitleCasePipe = class _TitleCasePipe {
  transform(value) {
    if (value == null) return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_TitleCasePipe, value);
    }
    return value.replace(unicodeWordMatch, (txt) => txt[0].toUpperCase() + txt.slice(1).toLowerCase());
  }
  static \u0275fac = function TitleCasePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _TitleCasePipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "titlecase",
    type: _TitleCasePipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(TitleCasePipe, [{
    type: Pipe,
    args: [{
      name: "titlecase"
    }]
  }], null, null);
})();
var UpperCasePipe = class _UpperCasePipe {
  transform(value) {
    if (value == null) return null;
    if (typeof value !== "string") {
      throw invalidPipeArgumentError(_UpperCasePipe, value);
    }
    return value.toUpperCase();
  }
  static \u0275fac = function UpperCasePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _UpperCasePipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "uppercase",
    type: _UpperCasePipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(UpperCasePipe, [{
    type: Pipe,
    args: [{
      name: "uppercase"
    }]
  }], null, null);
})();
var DEFAULT_DATE_FORMAT = "mediumDate";
var DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken(ngDevMode ? "DATE_PIPE_DEFAULT_TIMEZONE" : "");
var DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken(ngDevMode ? "DATE_PIPE_DEFAULT_OPTIONS" : "");
var DatePipe = class _DatePipe {
  locale;
  defaultTimezone;
  defaultOptions;
  constructor(locale, defaultTimezone, defaultOptions) {
    this.locale = locale;
    this.defaultTimezone = defaultTimezone;
    this.defaultOptions = defaultOptions;
  }
  transform(value, format, timezone, locale) {
    if (value == null || value === "" || value !== value) return null;
    try {
      const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;
      const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? void 0;
      return formatDate(value, _format, locale || this.locale, _timezone);
    } catch (error) {
      throw invalidPipeArgumentError(_DatePipe, error.message);
    }
  }
  static \u0275fac = function DatePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DatePipe)(\u0275\u0275directiveInject(LOCALE_ID, 16), \u0275\u0275directiveInject(DATE_PIPE_DEFAULT_TIMEZONE, 24), \u0275\u0275directiveInject(DATE_PIPE_DEFAULT_OPTIONS, 24));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "date",
    type: _DatePipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DatePipe, [{
    type: Pipe,
    args: [{
      name: "date"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DATE_PIPE_DEFAULT_TIMEZONE]
    }, {
      type: Optional
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DATE_PIPE_DEFAULT_OPTIONS]
    }, {
      type: Optional
    }]
  }], null);
})();
var _INTERPOLATION_REGEXP = /#/g;
var I18nPluralPipe = class _I18nPluralPipe {
  _localization;
  constructor(_localization) {
    this._localization = _localization;
  }
  /**
   * @param value the number to be formatted
   * @param pluralMap an object that mimics the ICU format, see
   * https://unicode-org.github.io/icu/userguide/format_parse/messages/.
   * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by
   * default).
   */
  transform(value, pluralMap, locale) {
    if (value == null) return "";
    if (typeof pluralMap !== "object" || pluralMap === null) {
      throw invalidPipeArgumentError(_I18nPluralPipe, pluralMap);
    }
    const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);
    return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());
  }
  static \u0275fac = function I18nPluralPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _I18nPluralPipe)(\u0275\u0275directiveInject(NgLocalization, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "i18nPlural",
    type: _I18nPluralPipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(I18nPluralPipe, [{
    type: Pipe,
    args: [{
      name: "i18nPlural"
    }]
  }], () => [{
    type: NgLocalization
  }], null);
})();
var I18nSelectPipe = class _I18nSelectPipe {
  /**
   * @param value a string to be internationalized.
   * @param mapping an object that indicates the text that should be displayed
   * for different values of the provided `value`.
   */
  transform(value, mapping) {
    if (value == null) return "";
    if (typeof mapping !== "object" || typeof value !== "string") {
      throw invalidPipeArgumentError(_I18nSelectPipe, mapping);
    }
    if (mapping.hasOwnProperty(value)) {
      return mapping[value];
    }
    if (mapping.hasOwnProperty("other")) {
      return mapping["other"];
    }
    return "";
  }
  static \u0275fac = function I18nSelectPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _I18nSelectPipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "i18nSelect",
    type: _I18nSelectPipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(I18nSelectPipe, [{
    type: Pipe,
    args: [{
      name: "i18nSelect"
    }]
  }], null, null);
})();
var JsonPipe = class _JsonPipe {
  /**
   * @param value A value of any type to convert into a JSON-format string.
   */
  transform(value) {
    return JSON.stringify(value, null, 2);
  }
  static \u0275fac = function JsonPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _JsonPipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "json",
    type: _JsonPipe,
    pure: false
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonPipe, [{
    type: Pipe,
    args: [{
      name: "json",
      pure: false
    }]
  }], null, null);
})();
function makeKeyValuePair(key, value) {
  return {
    key,
    value
  };
}
var KeyValuePipe = class _KeyValuePipe {
  differs;
  constructor(differs) {
    this.differs = differs;
  }
  differ;
  keyValues = [];
  compareFn = defaultComparator;
  transform(input2, compareFn = defaultComparator) {
    if (!input2 || !(input2 instanceof Map) && typeof input2 !== "object") {
      return null;
    }
    this.differ ??= this.differs.find(input2).create();
    const differChanges = this.differ.diff(input2);
    const compareFnChanged = compareFn !== this.compareFn;
    if (differChanges) {
      this.keyValues = [];
      differChanges.forEachItem((r) => {
        this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));
      });
    }
    if (differChanges || compareFnChanged) {
      if (compareFn) {
        this.keyValues.sort(compareFn);
      }
      this.compareFn = compareFn;
    }
    return this.keyValues;
  }
  static \u0275fac = function KeyValuePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _KeyValuePipe)(\u0275\u0275directiveInject(KeyValueDiffers, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "keyvalue",
    type: _KeyValuePipe,
    pure: false
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(KeyValuePipe, [{
    type: Pipe,
    args: [{
      name: "keyvalue",
      pure: false
    }]
  }], () => [{
    type: KeyValueDiffers
  }], null);
})();
function defaultComparator(keyValueA, keyValueB) {
  const a = keyValueA.key;
  const b = keyValueB.key;
  if (a === b) return 0;
  if (a == null) return 1;
  if (b == null) return -1;
  if (typeof a == "string" && typeof b == "string") {
    return a < b ? -1 : 1;
  }
  if (typeof a == "number" && typeof b == "number") {
    return a - b;
  }
  if (typeof a == "boolean" && typeof b == "boolean") {
    return a < b ? -1 : 1;
  }
  const aString = String(a);
  const bString = String(b);
  return aString == bString ? 0 : aString < bString ? -1 : 1;
}
var DecimalPipe = class _DecimalPipe {
  _locale;
  constructor(_locale) {
    this._locale = _locale;
  }
  transform(value, digitsInfo, locale) {
    if (!isValue(value)) return null;
    locale ||= this._locale;
    try {
      const num = strToNumber(value);
      return formatNumber(num, locale, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_DecimalPipe, error.message);
    }
  }
  static \u0275fac = function DecimalPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DecimalPipe)(\u0275\u0275directiveInject(LOCALE_ID, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "number",
    type: _DecimalPipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DecimalPipe, [{
    type: Pipe,
    args: [{
      name: "number"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
var PercentPipe = class _PercentPipe {
  _locale;
  constructor(_locale) {
    this._locale = _locale;
  }
  /**
   *
   * @param value The number to be formatted as a percentage.
   * @param digitsInfo Decimal representation options, specified by a string
   * in the following format:<br>
   * <code>{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}</code>.
   *   - `minIntegerDigits`: The minimum number of integer digits before the decimal point.
   * Default is `1`.
   *   - `minFractionDigits`: The minimum number of digits after the decimal point.
   * Default is `0`.
   *   - `maxFractionDigits`: The maximum number of digits after the decimal point.
   * Default is `0`.
   * @param locale A locale code for the locale format rules to use.
   * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
   * See [Setting your app locale](guide/i18n/locale-id).
   */
  transform(value, digitsInfo, locale) {
    if (!isValue(value)) return null;
    locale ||= this._locale;
    try {
      const num = strToNumber(value);
      return formatPercent(num, locale, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_PercentPipe, error.message);
    }
  }
  static \u0275fac = function PercentPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PercentPipe)(\u0275\u0275directiveInject(LOCALE_ID, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "percent",
    type: _PercentPipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PercentPipe, [{
    type: Pipe,
    args: [{
      name: "percent"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }], null);
})();
var CurrencyPipe = class _CurrencyPipe {
  _locale;
  _defaultCurrencyCode;
  constructor(_locale, _defaultCurrencyCode = "USD") {
    this._locale = _locale;
    this._defaultCurrencyCode = _defaultCurrencyCode;
  }
  transform(value, currencyCode = this._defaultCurrencyCode, display = "symbol", digitsInfo, locale) {
    if (!isValue(value)) return null;
    locale ||= this._locale;
    if (typeof display === "boolean") {
      if ((typeof ngDevMode === "undefined" || ngDevMode) && console && console.warn) {
        console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are "code", "symbol" or "symbol-narrow".`);
      }
      display = display ? "symbol" : "code";
    }
    let currency = currencyCode || this._defaultCurrencyCode;
    if (display !== "code") {
      if (display === "symbol" || display === "symbol-narrow") {
        currency = getCurrencySymbol(currency, display === "symbol" ? "wide" : "narrow", locale);
      } else {
        currency = display;
      }
    }
    try {
      const num = strToNumber(value);
      return formatCurrency(num, locale, currency, currencyCode, digitsInfo);
    } catch (error) {
      throw invalidPipeArgumentError(_CurrencyPipe, error.message);
    }
  }
  static \u0275fac = function CurrencyPipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _CurrencyPipe)(\u0275\u0275directiveInject(LOCALE_ID, 16), \u0275\u0275directiveInject(DEFAULT_CURRENCY_CODE, 16));
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "currency",
    type: _CurrencyPipe,
    pure: true
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(CurrencyPipe, [{
    type: Pipe,
    args: [{
      name: "currency"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [LOCALE_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DEFAULT_CURRENCY_CODE]
    }]
  }], null);
})();
function isValue(value) {
  return !(value == null || value === "" || value !== value);
}
function strToNumber(value) {
  if (typeof value === "string" && !isNaN(Number(value) - parseFloat(value))) {
    return Number(value);
  }
  if (typeof value !== "number") {
    throw new Error(`${value} is not a number`);
  }
  return value;
}
var SlicePipe = class _SlicePipe {
  transform(value, start, end) {
    if (value == null) return null;
    const supports = typeof value === "string" || Array.isArray(value);
    if (!supports) {
      throw invalidPipeArgumentError(_SlicePipe, value);
    }
    return value.slice(start, end);
  }
  static \u0275fac = function SlicePipe_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _SlicePipe)();
  };
  static \u0275pipe = /* @__PURE__ */ \u0275\u0275definePipe({
    name: "slice",
    type: _SlicePipe,
    pure: false
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(SlicePipe, [{
    type: Pipe,
    args: [{
      name: "slice",
      pure: false
    }]
  }], null, null);
})();
var COMMON_PIPES = [AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe];
var CommonModule = class _CommonModule {
  static \u0275fac = function CommonModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _CommonModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _CommonModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({});
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(CommonModule, [{
    type: NgModule,
    args: [{
      imports: [COMMON_DIRECTIVES, COMMON_PIPES],
      exports: [COMMON_DIRECTIVES, COMMON_PIPES]
    }]
  }], null, null);
})();
var PLATFORM_BROWSER_ID = "browser";
var PLATFORM_SERVER_ID = "server";
function isPlatformBrowser(platformId) {
  return platformId === PLATFORM_BROWSER_ID;
}
function isPlatformServer(platformId) {
  return platformId === PLATFORM_SERVER_ID;
}
var VERSION = new Version("0.0.0");
var ViewportScroller = class _ViewportScroller {
  // De-sugared tree-shakable injection
  // See #23917
  /** @nocollapse */
  static \u0275prov = (
    /** @pureOrBreakMyCode */
    /* @__PURE__ */ \u0275\u0275defineInjectable({
      token: _ViewportScroller,
      providedIn: "root",
      factory: () => false ? new NullViewportScroller() : new BrowserViewportScroller(inject(DOCUMENT), window)
    })
  );
};
var BrowserViewportScroller = class {
  document;
  window;
  offset = () => [0, 0];
  constructor(document2, window2) {
    this.document = document2;
    this.window = window2;
  }
  /**
   * Configures the top offset used when scrolling to an anchor.
   * @param offset A position in screen coordinates (a tuple with x and y values)
   * or a function that returns the top offset position.
   *
   */
  setOffset(offset) {
    if (Array.isArray(offset)) {
      this.offset = () => offset;
    } else {
      this.offset = offset;
    }
  }
  /**
   * Retrieves the current scroll position.
   * @returns The position in screen coordinates.
   */
  getScrollPosition() {
    return [this.window.scrollX, this.window.scrollY];
  }
  /**
   * Sets the scroll position.
   * @param position The new position in screen coordinates.
   */
  scrollToPosition(position) {
    this.window.scrollTo(position[0], position[1]);
  }
  /**
   * Scrolls to an element and attempts to focus the element.
   *
   * Note that the function name here is misleading in that the target string may be an ID for a
   * non-anchor element.
   *
   * @param target The ID of an element or name of the anchor.
   *
   * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document
   * @see https://html.spec.whatwg.org/#scroll-to-fragid
   */
  scrollToAnchor(target) {
    const elSelected = findAnchorFromDocument(this.document, target);
    if (elSelected) {
      this.scrollToElement(elSelected);
      elSelected.focus();
    }
  }
  /**
   * Disables automatic scroll restoration provided by the browser.
   */
  setHistoryScrollRestoration(scrollRestoration) {
    this.window.history.scrollRestoration = scrollRestoration;
  }
  /**
   * Scrolls to an element using the native offset and the specified offset set on this scroller.
   *
   * The offset can be used when we know that there is a floating header and scrolling naively to an
   * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.
   */
  scrollToElement(el) {
    const rect = el.getBoundingClientRect();
    const left = rect.left + this.window.pageXOffset;
    const top = rect.top + this.window.pageYOffset;
    const offset = this.offset();
    this.window.scrollTo(left - offset[0], top - offset[1]);
  }
};
function findAnchorFromDocument(document2, target) {
  const documentResult = document2.getElementById(target) || document2.getElementsByName(target)[0];
  if (documentResult) {
    return documentResult;
  }
  if (typeof document2.createTreeWalker === "function" && document2.body && typeof document2.body.attachShadow === "function") {
    const treeWalker = document2.createTreeWalker(document2.body, NodeFilter.SHOW_ELEMENT);
    let currentNode = treeWalker.currentNode;
    while (currentNode) {
      const shadowRoot = currentNode.shadowRoot;
      if (shadowRoot) {
        const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name="${target}"]`);
        if (result) {
          return result;
        }
      }
      currentNode = treeWalker.nextNode();
    }
  }
  return null;
}
var XhrFactory = class {
};
var PLACEHOLDER_QUALITY = "20";
function getUrl(src, win) {
  return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);
}
function isAbsoluteUrl(src) {
  return /^https?:\/\//.test(src);
}
function extractHostname(url) {
  return isAbsoluteUrl(url) ? new URL(url).hostname : url;
}
function isValidPath(path) {
  const isString = typeof path === "string";
  if (!isString || path.trim() === "") {
    return false;
  }
  try {
    const url = new URL(path);
    return true;
  } catch {
    return false;
  }
}
function normalizePath(path) {
  return path.endsWith("/") ? path.slice(0, -1) : path;
}
function normalizeSrc(src) {
  return src.startsWith("/") ? src.slice(1) : src;
}
var noopImageLoader = (config) => config.src;
var IMAGE_LOADER = new InjectionToken(ngDevMode ? "ImageLoader" : "", {
  providedIn: "root",
  factory: () => noopImageLoader
});
function createImageLoader(buildUrlFn, exampleUrls) {
  return function provideImageLoader(path) {
    if (!isValidPath(path)) {
      throwInvalidPathError(path, exampleUrls || []);
    }
    path = normalizePath(path);
    const loaderFn = (config) => {
      if (isAbsoluteUrl(config.src)) {
        throwUnexpectedAbsoluteUrlError(path, config.src);
      }
      return buildUrlFn(path, __spreadProps(__spreadValues({}, config), {
        src: normalizeSrc(config.src)
      }));
    };
    const providers = [{
      provide: IMAGE_LOADER,
      useValue: loaderFn
    }];
    return providers;
  };
}
function throwInvalidPathError(path, exampleUrls) {
  throw new RuntimeError(2959, ngDevMode && `Image loader has detected an invalid path (\`${path}\`). To fix this, supply a path using one of the following formats: ${exampleUrls.join(" or ")}`);
}
function throwUnexpectedAbsoluteUrlError(path, url) {
  throw new RuntimeError(2959, ngDevMode && `Image loader has detected a \`<img>\` tag with an invalid \`ngSrc\` attribute: ${url}. This image loader expects \`ngSrc\` to be a relative URL - however the provided value is an absolute URL. To fix this, provide \`ngSrc\` as a path relative to the base URL configured for this loader (\`${path}\`).`);
}
var provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ["https://<ZONE>/cdn-cgi/image/<OPTIONS>/<SOURCE-IMAGE>"] : void 0);
function createCloudflareUrl(path, config) {
  let params = `format=auto`;
  if (config.width) {
    params += `,width=${config.width}`;
  }
  if (config.isPlaceholder) {
    params += `,quality=${PLACEHOLDER_QUALITY}`;
  }
  return `${path}/cdn-cgi/image/${params}/${config.src}`;
}
var cloudinaryLoaderInfo = {
  name: "Cloudinary",
  testUrl: isCloudinaryUrl
};
var CLOUDINARY_LOADER_REGEX = /https?\:\/\/[^\/]+\.cloudinary\.com\/.+/;
function isCloudinaryUrl(url) {
  return CLOUDINARY_LOADER_REGEX.test(url);
}
var provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ? ["https://res.cloudinary.com/mysite", "https://mysite.cloudinary.com", "https://subdomain.mysite.com"] : void 0);
function createCloudinaryUrl(path, config) {
  const quality = config.isPlaceholder ? "q_auto:low" : "q_auto";
  let params = `f_auto,${quality}`;
  if (config.width) {
    params += `,w_${config.width}`;
  }
  if (config.loaderParams?.["rounded"]) {
    params += `,r_max`;
  }
  return `${path}/image/upload/${params}/${config.src}`;
}
var imageKitLoaderInfo = {
  name: "ImageKit",
  testUrl: isImageKitUrl
};
var IMAGE_KIT_LOADER_REGEX = /https?\:\/\/[^\/]+\.imagekit\.io\/.+/;
function isImageKitUrl(url) {
  return IMAGE_KIT_LOADER_REGEX.test(url);
}
var provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ["https://ik.imagekit.io/mysite", "https://subdomain.mysite.com"] : void 0);
function createImagekitUrl(path, config) {
  const {
    src,
    width
  } = config;
  const params = [];
  if (width) {
    params.push(`w-${width}`);
  }
  if (config.isPlaceholder) {
    params.push(`q-${PLACEHOLDER_QUALITY}`);
  }
  const urlSegments = params.length ? [path, `tr:${params.join(",")}`, src] : [path, src];
  const url = new URL(urlSegments.join("/"));
  return url.href;
}
var imgixLoaderInfo = {
  name: "Imgix",
  testUrl: isImgixUrl
};
var IMGIX_LOADER_REGEX = /https?\:\/\/[^\/]+\.imgix\.net\/.+/;
function isImgixUrl(url) {
  return IMGIX_LOADER_REGEX.test(url);
}
var provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ["https://somepath.imgix.net/"] : void 0);
function createImgixUrl(path, config) {
  const url = new URL(`${path}/${config.src}`);
  url.searchParams.set("auto", "format");
  if (config.width) {
    url.searchParams.set("w", config.width.toString());
  }
  if (config.isPlaceholder) {
    url.searchParams.set("q", PLACEHOLDER_QUALITY);
  }
  return url.href;
}
var netlifyLoaderInfo = {
  name: "Netlify",
  testUrl: isNetlifyUrl
};
var NETLIFY_LOADER_REGEX = /https?\:\/\/[^\/]+\.netlify\.app\/.+/;
function isNetlifyUrl(url) {
  return NETLIFY_LOADER_REGEX.test(url);
}
function imgDirectiveDetails(ngSrc, includeNgSrc = true) {
  const ngSrcInfo = includeNgSrc ? `(activated on an <img> element with the \`ngSrc="proxy.php?url=https%3A%2F%2Fangular-kr-docs.web.app%2F%24%7BngSrc%7D"\`) ` : "";
  return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;
}
function assertDevMode(checkName) {
  if (!ngDevMode) {
    throw new RuntimeError(2958, `Unexpected invocation of the ${checkName} in the prod mode. Please make sure that the prod mode is enabled for production builds.`);
  }
}
var LCPImageObserver = class _LCPImageObserver {
  // Map of full image URLs -> original `ngSrc` values.
  images = /* @__PURE__ */ new Map();
  window = null;
  observer = null;
  constructor() {
    const isBrowser = isPlatformBrowser(inject(PLATFORM_ID));
    assertDevMode("LCP checker");
    const win = inject(DOCUMENT).defaultView;
    if (isBrowser && typeof PerformanceObserver !== "undefined") {
      this.window = win;
      this.observer = this.initPerformanceObserver();
    }
  }
  /**
   * Inits PerformanceObserver and subscribes to LCP events.
   * Based on https://web.dev/lcp/#measure-lcp-in-javascript
   */
  initPerformanceObserver() {
    const observer = new PerformanceObserver((entryList) => {
      const entries = entryList.getEntries();
      if (entries.length === 0) return;
      const lcpElement = entries[entries.length - 1];
      const imgSrc = lcpElement.element?.src ?? "";
      if (imgSrc.startsWith("data:") || imgSrc.startsWith("blob:")) return;
      const img = this.images.get(imgSrc);
      if (!img) return;
      if (!img.priority && !img.alreadyWarnedPriority) {
        img.alreadyWarnedPriority = true;
        logMissingPriorityError(imgSrc);
      }
      if (img.modified && !img.alreadyWarnedModified) {
        img.alreadyWarnedModified = true;
        logModifiedWarning(imgSrc);
      }
    });
    observer.observe({
      type: "largest-contentful-paint",
      buffered: true
    });
    return observer;
  }
  registerImage(rewrittenSrc, originalNgSrc, isPriority) {
    if (!this.observer) return;
    const newObservedImageState = {
      priority: isPriority,
      modified: false,
      alreadyWarnedModified: false,
      alreadyWarnedPriority: false
    };
    this.images.set(getUrl(rewrittenSrc, this.window).href, newObservedImageState);
  }
  unregisterImage(rewrittenSrc) {
    if (!this.observer) return;
    this.images.delete(getUrl(rewrittenSrc, this.window).href);
  }
  updateImage(originalSrc, newSrc) {
    if (!this.observer) return;
    const originalUrl = getUrl(originalSrc, this.window).href;
    const img = this.images.get(originalUrl);
    if (img) {
      img.modified = true;
      this.images.set(getUrl(newSrc, this.window).href, img);
      this.images.delete(originalUrl);
    }
  }
  ngOnDestroy() {
    if (!this.observer) return;
    this.observer.disconnect();
    this.images.clear();
  }
  static \u0275fac = function LCPImageObserver_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _LCPImageObserver)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _LCPImageObserver,
    factory: _LCPImageObserver.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(LCPImageObserver, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function logMissingPriorityError(ngSrc) {
  const directiveDetails = imgDirectiveDetails(ngSrc);
  console.error(formatRuntimeError(2955, `${directiveDetails} this image is the Largest Contentful Paint (LCP) element but was not marked "priority". This image should be marked "priority" in order to prioritize its loading. To fix this, add the "priority" attribute.`));
}
function logModifiedWarning(ngSrc) {
  const directiveDetails = imgDirectiveDetails(ngSrc);
  console.warn(formatRuntimeError(2964, `${directiveDetails} this image is the Largest Contentful Paint (LCP) element and has had its "ngSrc" attribute modified. This can cause slower loading performance. It is recommended not to modify the "ngSrc" property on any image which could be the LCP element.`));
}
var INTERNAL_PRECONNECT_CHECK_BLOCKLIST = /* @__PURE__ */ new Set(["localhost", "127.0.0.1", "0.0.0.0"]);
var PRECONNECT_CHECK_BLOCKLIST = new InjectionToken(ngDevMode ? "PRECONNECT_CHECK_BLOCKLIST" : "");
var PreconnectLinkChecker = class _PreconnectLinkChecker {
  document = inject(DOCUMENT);
  /**
   * Set of <link rel="preconnect"> tags found on this page.
   * The `null` value indicates that there was no DOM query operation performed.
   */
  preconnectLinks = null;
  /*
   * Keep track of all already seen origin URLs to avoid repeating the same check.
   */
  alreadySeen = /* @__PURE__ */ new Set();
  window = this.document.defaultView;
  blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);
  constructor() {
    assertDevMode("preconnect link checker");
    const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, {
      optional: true
    });
    if (blocklist) {
      this.populateBlocklist(blocklist);
    }
  }
  populateBlocklist(origins) {
    if (Array.isArray(origins)) {
      deepForEach(origins, (origin) => {
        this.blocklist.add(extractHostname(origin));
      });
    } else {
      this.blocklist.add(extractHostname(origins));
    }
  }
  /**
   * Checks that a preconnect resource hint exists in the head for the
   * given src.
   *
   * @param rewrittenSrc src formatted with loader
   * @param originalNgSrc ngSrc value
   */
  assertPreconnect(rewrittenSrc, originalNgSrc) {
    if (false) return;
    const imgUrl = getUrl(rewrittenSrc, this.window);
    if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin)) return;
    this.alreadySeen.add(imgUrl.origin);
    this.preconnectLinks ??= this.queryPreconnectLinks();
    if (!this.preconnectLinks.has(imgUrl.origin)) {
      console.warn(formatRuntimeError(2956, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this image. Preconnecting to the origin(s) that serve priority images ensures that these images are delivered as soon as possible. To fix this, please add the following element into the <head> of the document:
  <link rel="preconnect" href="proxy.php?url=https%3A%2F%2Fangular-kr-docs.web.app%2F%24%7BimgUrl.origin%7D">`));
    }
  }
  queryPreconnectLinks() {
    const preconnectUrls = /* @__PURE__ */ new Set();
    const selector = "link[rel=preconnect]";
    const links = Array.from(this.document.querySelectorAll(selector));
    for (let link of links) {
      const url = getUrl(link.href, this.window);
      preconnectUrls.add(url.origin);
    }
    return preconnectUrls;
  }
  ngOnDestroy() {
    this.preconnectLinks?.clear();
    this.alreadySeen.clear();
  }
  static \u0275fac = function PreconnectLinkChecker_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PreconnectLinkChecker)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PreconnectLinkChecker,
    factory: _PreconnectLinkChecker.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PreconnectLinkChecker, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function deepForEach(input2, fn) {
  for (let value of input2) {
    Array.isArray(value) ? deepForEach(value, fn) : fn(value);
  }
}
var DEFAULT_PRELOADED_IMAGES_LIMIT = 5;
var PRELOADED_IMAGES = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "NG_OPTIMIZED_PRELOADED_IMAGES" : "", {
  providedIn: "root",
  factory: () => /* @__PURE__ */ new Set()
});
var PreloadLinkCreator = class _PreloadLinkCreator {
  preloadedImages = inject(PRELOADED_IMAGES);
  document = inject(DOCUMENT);
  /**
   * @description Add a preload `<link>` to the `<head>` of the `index.html` that is served from the
   * server while using Angular Universal and SSR to kick off image loads for high priority images.
   *
   * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)
   * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`
   * respectively, on the preload `<link>` tag so that the correctly sized image is preloaded from
   * the CDN.
   *
   * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}
   *
   * @param renderer The `Renderer2` passed in from the directive
   * @param src The original src of the image that is set on the `ngSrc` input.
   * @param srcset The parsed and formatted srcset created from the `ngSrcset` input
   * @param sizes The value of the `sizes` attribute passed in to the `<img>` tag
   */
  createPreloadLinkTag(renderer, src, srcset, sizes) {
    if (ngDevMode) {
      if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {
        throw new RuntimeError(2961, ngDevMode && `The \`NgOptimizedImage\` directive has detected that more than ${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. This might negatively affect an overall performance of the page. To fix this, remove the "priority" attribute from images with less priority.`);
      }
    }
    if (this.preloadedImages.has(src)) {
      return;
    }
    this.preloadedImages.add(src);
    const preload = renderer.createElement("link");
    renderer.setAttribute(preload, "as", "image");
    renderer.setAttribute(preload, "href", src);
    renderer.setAttribute(preload, "rel", "preload");
    renderer.setAttribute(preload, "fetchpriority", "high");
    if (sizes) {
      renderer.setAttribute(preload, "imageSizes", sizes);
    }
    if (srcset) {
      renderer.setAttribute(preload, "imageSrcset", srcset);
    }
    renderer.appendChild(this.document.head, preload);
  }
  static \u0275fac = function PreloadLinkCreator_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PreloadLinkCreator)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PreloadLinkCreator,
    factory: _PreloadLinkCreator.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PreloadLinkCreator, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;
var VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\s*\d+w\s*(,|$)){1,})$/;
var VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\s*\d+(\.\d+)?x\s*(,|$)){1,})$/;
var ABSOLUTE_SRCSET_DENSITY_CAP = 3;
var RECOMMENDED_SRCSET_DENSITY_CAP = 2;
var DENSITY_SRCSET_MULTIPLIERS = [1, 2];
var VIEWPORT_BREAKPOINT_CUTOFF = 640;
var ASPECT_RATIO_TOLERANCE = 0.1;
var OVERSIZED_IMAGE_TOLERANCE = 1e3;
var FIXED_SRCSET_WIDTH_LIMIT = 1920;
var FIXED_SRCSET_HEIGHT_LIMIT = 1080;
var PLACEHOLDER_DIMENSION_LIMIT = 1e3;
var DATA_URL_WARN_LIMIT = 4e3;
var DATA_URL_ERROR_LIMIT = 1e4;
var BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo, netlifyLoaderInfo];
var PRIORITY_COUNT_THRESHOLD = 10;
var IMGS_WITH_PRIORITY_ATTR_COUNT = 0;
var NgOptimizedImage = class _NgOptimizedImage {
  imageLoader = inject(IMAGE_LOADER);
  config = processConfig(inject(IMAGE_CONFIG));
  renderer = inject(Renderer2);
  imgElement = inject(ElementRef).nativeElement;
  injector = inject(Injector);
  // An LCP image observer should be injected only in development mode.
  // Do not assign it to `null` to avoid having a redundant property in the production bundle.
  lcpObserver;
  /**
   * Calculate the rewritten `src` once and store it.
   * This is needed to avoid repetitive calculations and make sure the directive cleanup in the
   * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other
   * instance that might be already destroyed).
   */
  _renderedSrc = null;
  /**
   * Name of the source image.
   * Image name will be processed by the image loader and the final URL will be applied as the `src`
   * property of the image.
   */
  ngSrc;
  /**
   * A comma separated list of width or density descriptors.
   * The image name will be taken from `ngSrc` and combined with the list of width or density
   * descriptors to generate the final `srcset` property of the image.
   *
   * Example:
   * ```html
   * <img ngSrc="proxy.php?url=https%3A%2F%2Fangular-kr-docs.web.app%2Fhello.jpg" ngSrcset="100w, 200w" />  =>
   * <img src="proxy.php?url=https%3A%2F%2Fangular-kr-docs.web.app%2Fpath%2Fhello.jpg" srcset="path/hello.jpg?w=100 100w, path/hello.jpg?w=200 200w" />
   * ```
   */
  ngSrcset;
  /**
   * The base `sizes` attribute passed through to the `<img>` element.
   * Providing sizes causes the image to create an automatic responsive srcset.
   */
  sizes;
  /**
   * For responsive images: the intrinsic width of the image in pixels.
   * For fixed size images: the desired rendered width of the image in pixels.
   */
  width;
  /**
   * For responsive images: the intrinsic height of the image in pixels.
   * For fixed size images: the desired rendered height of the image in pixels.
   */
  height;
  /**
   * The desired loading behavior (lazy, eager, or auto). Defaults to `lazy`,
   * which is recommended for most images.
   *
   * Warning: Setting images as loading="eager" or loading="auto" marks them
   * as non-priority images and can hurt loading performance. For images which
   * may be the LCP element, use the `priority` attribute instead of `loading`.
   */
  loading;
  /**
   * Indicates whether this image should have a high priority.
   */
  priority = false;
  /**
   * Data to pass through to custom loaders.
   */
  loaderParams;
  /**
   * Disables automatic srcset generation for this image.
   */
  disableOptimizedSrcset = false;
  /**
   * Sets the image to "fill mode", which eliminates the height/width requirement and adds
   * styles such that the image fills its containing element.
   */
  fill = false;
  /**
   * A URL or data URL for an image to be used as a placeholder while this image loads.
   */
  placeholder;
  /**
   * Configuration object for placeholder settings. Options:
   *   * blur: Setting this to false disables the automatic CSS blur.
   */
  placeholderConfig;
  /**
   * Value of the `src` attribute if set on the host `<img>` element.
   * This input is exclusively read to assert that `src` is not set in conflict
   * with `ngSrc` and that images don't start to load until a lazy loading strategy is set.
   * @internal
   */
  src;
  /**
   * Value of the `srcset` attribute if set on the host `<img>` element.
   * This input is exclusively read to assert that `srcset` is not set in conflict
   * with `ngSrcset` and that images don't start to load until a lazy loading strategy is set.
   * @internal
   */
  srcset;
  constructor() {
    if (ngDevMode) {
      this.lcpObserver = this.injector.get(LCPImageObserver);
      const destroyRef = inject(DestroyRef);
      destroyRef.onDestroy(() => {
        if (!this.priority && this._renderedSrc !== null) {
          this.lcpObserver.unregisterImage(this._renderedSrc);
        }
      });
    }
  }
  /** @nodoc */
  ngOnInit() {
    performanceMarkFeature("NgOptimizedImage");
    if (ngDevMode) {
      const ngZone = this.injector.get(NgZone);
      assertNonEmptyInput(this, "ngSrc", this.ngSrc);
      assertValidNgSrcset(this, this.ngSrcset);
      assertNoConflictingSrc(this);
      if (this.ngSrcset) {
        assertNoConflictingSrcset(this);
      }
      assertNotBase64Image(this);
      assertNotBlobUrl(this);
      if (this.fill) {
        assertEmptyWidthAndHeight(this);
        ngZone.runOutsideAngular(() => assertNonZeroRenderedHeight(this, this.imgElement, this.renderer));
      } else {
        assertNonEmptyWidthAndHeight(this);
        if (this.height !== void 0) {
          assertGreaterThanZero(this, this.height, "height");
        }
        if (this.width !== void 0) {
          assertGreaterThanZero(this, this.width, "width");
        }
        ngZone.runOutsideAngular(() => assertNoImageDistortion(this, this.imgElement, this.renderer));
      }
      assertValidLoadingInput(this);
      if (!this.ngSrcset) {
        assertNoComplexSizes(this);
      }
      assertValidPlaceholder(this, this.imageLoader);
      assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);
      assertNoNgSrcsetWithoutLoader(this, this.imageLoader);
      assertNoLoaderParamsWithoutLoader(this, this.imageLoader);
      ngZone.runOutsideAngular(() => {
        this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc, this.priority);
      });
      if (this.priority) {
        const checker = this.injector.get(PreconnectLinkChecker);
        checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);
        if (true) {
          const applicationRef = this.injector.get(ApplicationRef);
          assetPriorityCountBelowThreshold(applicationRef);
        }
      }
    }
    if (this.placeholder) {
      this.removePlaceholderOnLoad(this.imgElement);
    }
    this.setHostAttributes();
  }
  setHostAttributes() {
    if (this.fill) {
      this.sizes ||= "100vw";
    } else {
      this.setHostAttribute("width", this.width.toString());
      this.setHostAttribute("height", this.height.toString());
    }
    this.setHostAttribute("loading", this.getLoadingBehavior());
    this.setHostAttribute("fetchpriority", this.getFetchPriority());
    this.setHostAttribute("ng-img", "true");
    const rewrittenSrcset = this.updateSrcAndSrcset();
    if (this.sizes) {
      if (this.getLoadingBehavior() === "lazy") {
        this.setHostAttribute("sizes", "auto, " + this.sizes);
      } else {
        this.setHostAttribute("sizes", this.sizes);
      }
    } else {
      if (this.ngSrcset && VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset) && this.getLoadingBehavior() === "lazy") {
        this.setHostAttribute("sizes", "auto, 100vw");
      }
    }
    if (false) {
      const preloadLinkCreator = this.injector.get(PreloadLinkCreator);
      preloadLinkCreator.createPreloadLinkTag(this.renderer, this.getRewrittenSrc(), rewrittenSrcset, this.sizes);
    }
  }
  /** @nodoc */
  ngOnChanges(changes) {
    if (ngDevMode) {
      assertNoPostInitInputChange(this, changes, ["ngSrcset", "width", "height", "priority", "fill", "loading", "sizes", "loaderParams", "disableOptimizedSrcset"]);
    }
    if (changes["ngSrc"] && !changes["ngSrc"].isFirstChange()) {
      const oldSrc = this._renderedSrc;
      this.updateSrcAndSrcset(true);
      if (ngDevMode) {
        const newSrc = this._renderedSrc;
        if (oldSrc && newSrc && oldSrc !== newSrc) {
          const ngZone = this.injector.get(NgZone);
          ngZone.runOutsideAngular(() => {
            this.lcpObserver.updateImage(oldSrc, newSrc);
          });
        }
      }
    }
    if (ngDevMode && changes["placeholder"]?.currentValue && true && true) {
      assertPlaceholderDimensions(this, this.imgElement);
    }
  }
  callImageLoader(configWithoutCustomParams) {
    let augmentedConfig = configWithoutCustomParams;
    if (this.loaderParams) {
      augmentedConfig.loaderParams = this.loaderParams;
    }
    return this.imageLoader(augmentedConfig);
  }
  getLoadingBehavior() {
    if (!this.priority && this.loading !== void 0) {
      return this.loading;
    }
    return this.priority ? "eager" : "lazy";
  }
  getFetchPriority() {
    return this.priority ? "high" : "auto";
  }
  getRewrittenSrc() {
    if (!this._renderedSrc) {
      const imgConfig = {
        src: this.ngSrc
      };
      this._renderedSrc = this.callImageLoader(imgConfig);
    }
    return this._renderedSrc;
  }
  getRewrittenSrcset() {
    const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);
    const finalSrcs = this.ngSrcset.split(",").filter((src) => src !== "").map((srcStr) => {
      srcStr = srcStr.trim();
      const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;
      return `${this.callImageLoader({
        src: this.ngSrc,
        width
      })} ${srcStr}`;
    });
    return finalSrcs.join(", ");
  }
  getAutomaticSrcset() {
    if (this.sizes) {
      return this.getResponsiveSrcset();
    } else {
      return this.getFixedSrcset();
    }
  }
  getResponsiveSrcset() {
    const {
      breakpoints
    } = this.config;
    let filteredBreakpoints = breakpoints;
    if (this.sizes?.trim() === "100vw") {
      filteredBreakpoints = breakpoints.filter((bp) => bp >= VIEWPORT_BREAKPOINT_CUTOFF);
    }
    const finalSrcs = filteredBreakpoints.map((bp) => `${this.callImageLoader({
      src: this.ngSrc,
      width: bp
    })} ${bp}w`);
    return finalSrcs.join(", ");
  }
  updateSrcAndSrcset(forceSrcRecalc = false) {
    if (forceSrcRecalc) {
      this._renderedSrc = null;
    }
    const rewrittenSrc = this.getRewrittenSrc();
    this.setHostAttribute("src", rewrittenSrc);
    let rewrittenSrcset = void 0;
    if (this.ngSrcset) {
      rewrittenSrcset = this.getRewrittenSrcset();
    } else if (this.shouldGenerateAutomaticSrcset()) {
      rewrittenSrcset = this.getAutomaticSrcset();
    }
    if (rewrittenSrcset) {
      this.setHostAttribute("srcset", rewrittenSrcset);
    }
    return rewrittenSrcset;
  }
  getFixedSrcset() {
    const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map((multiplier) => `${this.callImageLoader({
      src: this.ngSrc,
      width: this.width * multiplier
    })} ${multiplier}x`);
    return finalSrcs.join(", ");
  }
  shouldGenerateAutomaticSrcset() {
    let oversizedImage = false;
    if (!this.sizes) {
      oversizedImage = this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT;
    }
    return !this.disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader && !oversizedImage;
  }
  /**
   * Returns an image url formatted for use with the CSS background-image property. Expects one of:
   * * A base64 encoded image, which is wrapped and passed through.
   * * A boolean. If true, calls the image loader to generate a small placeholder url.
   */
  generatePlaceholder(placeholderInput) {
    const {
      placeholderResolution
    } = this.config;
    if (placeholderInput === true) {
      return `url(${this.callImageLoader({
        src: this.ngSrc,
        width: placeholderResolution,
        isPlaceholder: true
      })})`;
    } else if (typeof placeholderInput === "string") {
      return `url(${placeholderInput})`;
    }
    return null;
  }
  /**
   * Determines if blur should be applied, based on an optional boolean
   * property `blur` within the optional configuration object `placeholderConfig`.
   */
  shouldBlurPlaceholder(placeholderConfig) {
    if (!placeholderConfig || !placeholderConfig.hasOwnProperty("blur")) {
      return true;
    }
    return Boolean(placeholderConfig.blur);
  }
  removePlaceholderOnLoad(img) {
    const callback = () => {
      const changeDetectorRef = this.injector.get(ChangeDetectorRef);
      removeLoadListenerFn();
      removeErrorListenerFn();
      this.placeholder = false;
      changeDetectorRef.markForCheck();
    };
    const removeLoadListenerFn = this.renderer.listen(img, "load", callback);
    const removeErrorListenerFn = this.renderer.listen(img, "error", callback);
    callOnLoadIfImageIsLoaded(img, callback);
  }
  setHostAttribute(name, value) {
    this.renderer.setAttribute(this.imgElement, name, value);
  }
  static \u0275fac = function NgOptimizedImage_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NgOptimizedImage)();
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _NgOptimizedImage,
    selectors: [["img", "ngSrc", ""]],
    hostVars: 18,
    hostBindings: function NgOptimizedImage_HostBindings(rf, ctx) {
      if (rf & 2) {
        \u0275\u0275styleProp("position", ctx.fill ? "absolute" : null)("width", ctx.fill ? "100%" : null)("height", ctx.fill ? "100%" : null)("inset", ctx.fill ? "0" : null)("background-size", ctx.placeholder ? "cover" : null)("background-position", ctx.placeholder ? "50% 50%" : null)("background-repeat", ctx.placeholder ? "no-repeat" : null)("background-image", ctx.placeholder ? ctx.generatePlaceholder(ctx.placeholder) : null)("filter", ctx.placeholder && ctx.shouldBlurPlaceholder(ctx.placeholderConfig) ? "blur(15px)" : null);
      }
    },
    inputs: {
      ngSrc: [2, "ngSrc", "ngSrc", unwrapSafeUrl],
      ngSrcset: "ngSrcset",
      sizes: "sizes",
      width: [2, "width", "width", numberAttribute],
      height: [2, "height", "height", numberAttribute],
      loading: "loading",
      priority: [2, "priority", "priority", booleanAttribute],
      loaderParams: "loaderParams",
      disableOptimizedSrcset: [2, "disableOptimizedSrcset", "disableOptimizedSrcset", booleanAttribute],
      fill: [2, "fill", "fill", booleanAttribute],
      placeholder: [2, "placeholder", "placeholder", booleanOrUrlAttribute],
      placeholderConfig: "placeholderConfig",
      src: "src",
      srcset: "srcset"
    },
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NgOptimizedImage, [{
    type: Directive,
    args: [{
      selector: "img[ngSrc]",
      host: {
        "[style.position]": 'fill ? "absolute" : null',
        "[style.width]": 'fill ? "100%" : null',
        "[style.height]": 'fill ? "100%" : null',
        "[style.inset]": 'fill ? "0" : null',
        "[style.background-size]": 'placeholder ? "cover" : null',
        "[style.background-position]": 'placeholder ? "50% 50%" : null',
        "[style.background-repeat]": 'placeholder ? "no-repeat" : null',
        "[style.background-image]": "placeholder ? generatePlaceholder(placeholder) : null",
        "[style.filter]": 'placeholder && shouldBlurPlaceholder(placeholderConfig) ? "blur(15px)" : null'
      }
    }]
  }], () => [], {
    ngSrc: [{
      type: Input,
      args: [{
        required: true,
        transform: unwrapSafeUrl
      }]
    }],
    ngSrcset: [{
      type: Input
    }],
    sizes: [{
      type: Input
    }],
    width: [{
      type: Input,
      args: [{
        transform: numberAttribute
      }]
    }],
    height: [{
      type: Input,
      args: [{
        transform: numberAttribute
      }]
    }],
    loading: [{
      type: Input
    }],
    priority: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    loaderParams: [{
      type: Input
    }],
    disableOptimizedSrcset: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    fill: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    placeholder: [{
      type: Input,
      args: [{
        transform: booleanOrUrlAttribute
      }]
    }],
    placeholderConfig: [{
      type: Input
    }],
    src: [{
      type: Input
    }],
    srcset: [{
      type: Input
    }]
  });
})();
function processConfig(config) {
  let sortedBreakpoints = {};
  if (config.breakpoints) {
    sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);
  }
  return Object.assign({}, IMAGE_CONFIG_DEFAULTS, config, sortedBreakpoints);
}
function assertNoConflictingSrc(dir) {
  if (dir.src) {
    throw new RuntimeError(2950, `${imgDirectiveDetails(dir.ngSrc)} both \`src\` and \`ngSrc\` have been set. Supplying both of these attributes breaks lazy loading. The NgOptimizedImage directive sets \`src\` itself based on the value of \`ngSrc\`. To fix this, please remove the \`src\` attribute.`);
  }
}
function assertNoConflictingSrcset(dir) {
  if (dir.srcset) {
    throw new RuntimeError(2951, `${imgDirectiveDetails(dir.ngSrc)} both \`srcset\` and \`ngSrcset\` have been set. Supplying both of these attributes breaks lazy loading. The NgOptimizedImage directive sets \`srcset\` itself based on the value of \`ngSrcset\`. To fix this, please remove the \`srcset\` attribute.`);
  }
}
function assertNotBase64Image(dir) {
  let ngSrc = dir.ngSrc.trim();
  if (ngSrc.startsWith("data:")) {
    if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {
      ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + "...";
    }
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc, false)} \`ngSrc\` is a Base64-encoded string (${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. To fix this, disable the NgOptimizedImage directive for this element by removing \`ngSrc\` and using a standard \`src\` attribute instead.`);
  }
}
function assertNoComplexSizes(dir) {
  let sizes = dir.sizes;
  if (sizes?.match(/((\)|,)\s|^)\d+px/)) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc, false)} \`sizes\` was set to a string including pixel values. For automatic \`srcset\` generation, \`sizes\` must only include responsive values, such as \`sizes="50vw"\` or \`sizes="(min-width: 768px) 50vw, 100vw"\`. To fix this, modify the \`sizes\` attribute, or provide your own \`ngSrcset\` value directly.`);
  }
}
function assertValidPlaceholder(dir, imageLoader) {
  assertNoPlaceholderConfigWithoutPlaceholder(dir);
  assertNoRelativePlaceholderWithoutLoader(dir, imageLoader);
  assertNoOversizedDataUrl(dir);
}
function assertNoPlaceholderConfigWithoutPlaceholder(dir) {
  if (dir.placeholderConfig && !dir.placeholder) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc, false)} \`placeholderConfig\` options were provided for an image that does not use the \`placeholder\` attribute, and will have no effect.`);
  }
}
function assertNoRelativePlaceholderWithoutLoader(dir, imageLoader) {
  if (dir.placeholder === true && imageLoader === noopImageLoader) {
    throw new RuntimeError(2963, `${imgDirectiveDetails(dir.ngSrc)} the \`placeholder\` attribute is set to true but no image loader is configured (i.e. the default one is being used), which would result in the same image being used for the primary image and its placeholder. To fix this, provide a loader or remove the \`placeholder\` attribute from the image.`);
  }
}
function assertNoOversizedDataUrl(dir) {
  if (dir.placeholder && typeof dir.placeholder === "string" && dir.placeholder.startsWith("data:")) {
    if (dir.placeholder.length > DATA_URL_ERROR_LIMIT) {
      throw new RuntimeError(2965, `${imgDirectiveDetails(dir.ngSrc)} the \`placeholder\` attribute is set to a data URL which is longer than ${DATA_URL_ERROR_LIMIT} characters. This is strongly discouraged, as large inline placeholders directly increase the bundle size of Angular and hurt page load performance. To fix this, generate a smaller data URL placeholder.`);
    }
    if (dir.placeholder.length > DATA_URL_WARN_LIMIT) {
      console.warn(formatRuntimeError(2965, `${imgDirectiveDetails(dir.ngSrc)} the \`placeholder\` attribute is set to a data URL which is longer than ${DATA_URL_WARN_LIMIT} characters. This is discouraged, as large inline placeholders directly increase the bundle size of Angular and hurt page load performance. For better loading performance, generate a smaller data URL placeholder.`));
    }
  }
}
function assertNotBlobUrl(dir) {
  const ngSrc = dir.ngSrc.trim();
  if (ngSrc.startsWith("blob:")) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`ngSrc\` was set to a blob URL (${ngSrc}). Blob URLs are not supported by the NgOptimizedImage directive. To fix this, disable the NgOptimizedImage directive for this element by removing \`ngSrc\` and using a regular \`src\` attribute instead.`);
  }
}
function assertNonEmptyInput(dir, name, value) {
  const isString = typeof value === "string";
  const isEmptyString = isString && value.trim() === "";
  if (!isString || isEmptyString) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`${name}\` has an invalid value (\`${value}\`). To fix this, change the value to a non-empty string.`);
  }
}
function assertValidNgSrcset(dir, value) {
  if (value == null) return;
  assertNonEmptyInput(dir, "ngSrcset", value);
  const stringVal = value;
  const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);
  const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);
  if (isValidDensityDescriptor) {
    assertUnderDensityCap(dir, stringVal);
  }
  const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;
  if (!isValidSrcset) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`ngSrcset\` has an invalid value (\`${value}\`). To fix this, supply \`ngSrcset\` using a comma-separated list of one or more width descriptors (e.g. "100w, 200w") or density descriptors (e.g. "1x, 2x").`);
  }
}
function assertUnderDensityCap(dir, value) {
  const underDensityCap = value.split(",").every((num) => num === "" || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);
  if (!underDensityCap) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`ngSrcset\` contains an unsupported image density:\`${value}\`. NgOptimizedImage generally recommends a max image density of ${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for most use cases. Images that will be pinch-zoomed are typically the primary use case for ${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);
  }
}
function postInitInputChangeError(dir, inputName) {
  let reason;
  if (inputName === "width" || inputName === "height") {
    reason = `Changing \`${inputName}\` may result in different attribute value applied to the underlying image element and cause layout shifts on a page.`;
  } else {
    reason = `Changing the \`${inputName}\` would have no effect on the underlying image element, because the resource loading has already occurred.`;
  }
  return new RuntimeError(2953, `${imgDirectiveDetails(dir.ngSrc)} \`${inputName}\` was updated after initialization. The NgOptimizedImage directive will not react to this input change. ${reason} To fix this, either switch \`${inputName}\` to a static value or wrap the image element in an @if that is gated on the necessary value.`);
}
function assertNoPostInitInputChange(dir, changes, inputs) {
  inputs.forEach((input2) => {
    const isUpdated = changes.hasOwnProperty(input2);
    if (isUpdated && !changes[input2].isFirstChange()) {
      if (input2 === "ngSrc") {
        dir = {
          ngSrc: changes[input2].previousValue
        };
      }
      throw postInitInputChangeError(dir, input2);
    }
  });
}
function assertGreaterThanZero(dir, inputValue, inputName) {
  const validNumber = typeof inputValue === "number" && inputValue > 0;
  const validString = typeof inputValue === "string" && /^\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;
  if (!validNumber && !validString) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} \`${inputName}\` has an invalid value. To fix this, provide \`${inputName}\` as a number greater than 0.`);
  }
}
function assertNoImageDistortion(dir, img, renderer) {
  const callback = () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
    const computedStyle = window.getComputedStyle(img);
    let renderedWidth = parseFloat(computedStyle.getPropertyValue("width"));
    let renderedHeight = parseFloat(computedStyle.getPropertyValue("height"));
    const boxSizing = computedStyle.getPropertyValue("box-sizing");
    if (boxSizing === "border-box") {
      const paddingTop = computedStyle.getPropertyValue("padding-top");
      const paddingRight = computedStyle.getPropertyValue("padding-right");
      const paddingBottom = computedStyle.getPropertyValue("padding-bottom");
      const paddingLeft = computedStyle.getPropertyValue("padding-left");
      renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);
      renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);
    }
    const renderedAspectRatio = renderedWidth / renderedHeight;
    const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;
    const intrinsicWidth = img.naturalWidth;
    const intrinsicHeight = img.naturalHeight;
    const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;
    const suppliedWidth = dir.width;
    const suppliedHeight = dir.height;
    const suppliedAspectRatio = suppliedWidth / suppliedHeight;
    const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;
    const stylingDistortion = nonZeroRenderedDimensions && Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;
    if (inaccurateDimensions) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match the aspect ratio indicated by the width and height attributes. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h (aspect-ratio: ${round(intrinsicAspectRatio)}). 
Supplied width and height attributes: ${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${round(suppliedAspectRatio)}). 
To fix this, update the width and height attributes.`));
    } else if (stylingDistortion) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image does not match the image's intrinsic aspect ratio. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h (aspect-ratio: ${round(intrinsicAspectRatio)}). 
Rendered image size: ${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ${round(renderedAspectRatio)}). 
This issue can occur if "width" and "height" attributes are added to an image without updating the corresponding image styling. To fix this, adjust image styling. In most cases, adding "height: auto" or "width: auto" to the image styling will fix this issue.`));
    } else if (!dir.ngSrcset && nonZeroRenderedDimensions) {
      const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;
      const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;
      const oversizedWidth = intrinsicWidth - recommendedWidth >= OVERSIZED_IMAGE_TOLERANCE;
      const oversizedHeight = intrinsicHeight - recommendedHeight >= OVERSIZED_IMAGE_TOLERANCE;
      if (oversizedWidth || oversizedHeight) {
        console.warn(formatRuntimeError(2960, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly larger than necessary. 
Rendered image size: ${renderedWidth}w x ${renderedHeight}h. 
Intrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. 
Recommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. 
Note: Recommended intrinsic image size is calculated assuming a maximum DPR of ${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image or consider using the "ngSrcset" and "sizes" attributes.`));
      }
    }
  };
  const removeLoadListenerFn = renderer.listen(img, "load", callback);
  const removeErrorListenerFn = renderer.listen(img, "error", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
  });
  callOnLoadIfImageIsLoaded(img, callback);
}
function assertNonEmptyWidthAndHeight(dir) {
  let missingAttributes = [];
  if (dir.width === void 0) missingAttributes.push("width");
  if (dir.height === void 0) missingAttributes.push("height");
  if (missingAttributes.length > 0) {
    throw new RuntimeError(2954, `${imgDirectiveDetails(dir.ngSrc)} these required attributes are missing: ${missingAttributes.map((attr) => `"${attr}"`).join(", ")}. Including "width" and "height" attributes will prevent image-related layout shifts. To fix this, include "width" and "height" attributes on the image tag or turn on "fill" mode with the \`fill\` attribute.`);
  }
}
function assertEmptyWidthAndHeight(dir) {
  if (dir.width || dir.height) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the attributes \`height\` and/or \`width\` are present along with the \`fill\` attribute. Because \`fill\` mode causes an image to fill its containing element, the size attributes have no effect and should be removed.`);
  }
}
function assertNonZeroRenderedHeight(dir, img, renderer) {
  const callback = () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
    const renderedHeight = img.clientHeight;
    if (dir.fill && renderedHeight === 0) {
      console.warn(formatRuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. This is likely because the containing element does not have the CSS 'position' property set to one of the following: "relative", "fixed", or "absolute". To fix this problem, make sure the container element has the CSS 'position' property defined and the height of the element is not zero.`));
    }
  };
  const removeLoadListenerFn = renderer.listen(img, "load", callback);
  const removeErrorListenerFn = renderer.listen(img, "error", () => {
    removeLoadListenerFn();
    removeErrorListenerFn();
  });
  callOnLoadIfImageIsLoaded(img, callback);
}
function assertValidLoadingInput(dir) {
  if (dir.loading && dir.priority) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`loading\` attribute was used on an image that was marked "priority". Setting \`loading\` on priority images is not allowed because these images will always be eagerly loaded. To fix this, remove the \u201Cloading\u201D attribute from the priority image.`);
  }
  const validInputs = ["auto", "eager", "lazy"];
  if (typeof dir.loading === "string" && !validInputs.includes(dir.loading)) {
    throw new RuntimeError(2952, `${imgDirectiveDetails(dir.ngSrc)} the \`loading\` attribute has an invalid value (\`${dir.loading}\`). To fix this, provide a valid value ("lazy", "eager", or "auto").`);
  }
}
function assertNotMissingBuiltInLoader(ngSrc, imageLoader) {
  if (imageLoader === noopImageLoader) {
    let builtInLoaderName = "";
    for (const loader of BUILT_IN_LOADERS) {
      if (loader.testUrl(ngSrc)) {
        builtInLoaderName = loader.name;
        break;
      }
    }
    if (builtInLoaderName) {
      console.warn(formatRuntimeError(2962, `NgOptimizedImage: It looks like your images may be hosted on the ${builtInLoaderName} CDN, but your app is not using Angular's built-in loader for that CDN. We recommend switching to use the built-in by calling \`provide${builtInLoaderName}Loader()\` in your \`providers\` and passing it your instance's base URL. If you don't want to use the built-in loader, define a custom loader function using IMAGE_LOADER to silence this warning.`));
    }
  }
}
function assertNoNgSrcsetWithoutLoader(dir, imageLoader) {
  if (dir.ngSrcset && imageLoader === noopImageLoader) {
    console.warn(formatRuntimeError(2963, `${imgDirectiveDetails(dir.ngSrc)} the \`ngSrcset\` attribute is present but no image loader is configured (i.e. the default one is being used), which would result in the same image being used for all configured sizes. To fix this, provide a loader or remove the \`ngSrcset\` attribute from the image.`));
  }
}
function assertNoLoaderParamsWithoutLoader(dir, imageLoader) {
  if (dir.loaderParams && imageLoader === noopImageLoader) {
    console.warn(formatRuntimeError(2963, `${imgDirectiveDetails(dir.ngSrc)} the \`loaderParams\` attribute is present but no image loader is configured (i.e. the default one is being used), which means that the loaderParams data will not be consumed and will not affect the URL. To fix this, provide a custom loader or remove the \`loaderParams\` attribute from the image.`));
  }
}
async function assetPriorityCountBelowThreshold(appRef) {
  if (IMGS_WITH_PRIORITY_ATTR_COUNT === 0) {
    IMGS_WITH_PRIORITY_ATTR_COUNT++;
    await appRef.whenStable();
    if (IMGS_WITH_PRIORITY_ATTR_COUNT > PRIORITY_COUNT_THRESHOLD) {
      console.warn(formatRuntimeError(2966, `NgOptimizedImage: The "priority" attribute is set to true more than ${PRIORITY_COUNT_THRESHOLD} times (${IMGS_WITH_PRIORITY_ATTR_COUNT} times). Marking too many images as "high" priority can hurt your application's LCP (https://web.dev/lcp). "Priority" should only be set on the image expected to be the page's LCP element.`));
    }
  } else {
    IMGS_WITH_PRIORITY_ATTR_COUNT++;
  }
}
function assertPlaceholderDimensions(dir, imgElement) {
  const computedStyle = window.getComputedStyle(imgElement);
  let renderedWidth = parseFloat(computedStyle.getPropertyValue("width"));
  let renderedHeight = parseFloat(computedStyle.getPropertyValue("height"));
  if (renderedWidth > PLACEHOLDER_DIMENSION_LIMIT || renderedHeight > PLACEHOLDER_DIMENSION_LIMIT) {
    console.warn(formatRuntimeError(2967, `${imgDirectiveDetails(dir.ngSrc)} it uses a placeholder image, but at least one of the dimensions attribute (height or width) exceeds the limit of ${PLACEHOLDER_DIMENSION_LIMIT}px. To fix this, use a smaller image as a placeholder.`));
  }
}
function callOnLoadIfImageIsLoaded(img, callback) {
  if (img.complete && img.naturalWidth) {
    callback();
  }
}
function round(input2) {
  return Number.isInteger(input2) ? input2 : input2.toFixed(2);
}
function unwrapSafeUrl(value) {
  if (typeof value === "string") {
    return value;
  }
  return unwrapSafeValue(value);
}
function booleanOrUrlAttribute(value) {
  if (typeof value === "string" && value !== "true" && value !== "false" && value !== "") {
    return value;
  }
  return booleanAttribute(value);
}

// node_modules/@angular/common/fesm2022/http.mjs
var HttpHandler = class {
};
var HttpBackend = class {
};
var HttpHeaders = class _HttpHeaders {
  /**
   * Internal map of lowercase header names to values.
   */
  // TODO(issue/24571): remove '!'.
  headers;
  /**
   * Internal map of lowercased header names to the normalized
   * form of the name (the form seen first).
   */
  normalizedNames = /* @__PURE__ */ new Map();
  /**
   * Complete the lazy initialization of this object (needed before reading).
   */
  lazyInit;
  /**
   * Queued updates to be materialized the next initialization.
   */
  lazyUpdate = null;
  /**  Constructs a new HTTP header object with the given values.*/
  constructor(headers) {
    if (!headers) {
      this.headers = /* @__PURE__ */ new Map();
    } else if (typeof headers === "string") {
      this.lazyInit = () => {
        this.headers = /* @__PURE__ */ new Map();
        headers.split("\n").forEach((line) => {
          const index = line.indexOf(":");
          if (index > 0) {
            const name = line.slice(0, index);
            const value = line.slice(index + 1).trim();
            this.addHeaderEntry(name, value);
          }
        });
      };
    } else if (typeof Headers !== "undefined" && headers instanceof Headers) {
      this.headers = /* @__PURE__ */ new Map();
      headers.forEach((value, name) => {
        this.addHeaderEntry(name, value);
      });
    } else {
      this.lazyInit = () => {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          assertValidHeaders(headers);
        }
        this.headers = /* @__PURE__ */ new Map();
        Object.entries(headers).forEach(([name, values]) => {
          this.setHeaderEntries(name, values);
        });
      };
    }
  }
  /**
   * Checks for existence of a given header.
   *
   * @param name The header name to check for existence.
   *
   * @returns True if the header exists, false otherwise.
   */
  has(name) {
    this.init();
    return this.headers.has(name.toLowerCase());
  }
  /**
   * Retrieves the first value of a given header.
   *
   * @param name The header name.
   *
   * @returns The value string if the header exists, null otherwise
   */
  get(name) {
    this.init();
    const values = this.headers.get(name.toLowerCase());
    return values && values.length > 0 ? values[0] : null;
  }
  /**
   * Retrieves the names of the headers.
   *
   * @returns A list of header names.
   */
  keys() {
    this.init();
    return Array.from(this.normalizedNames.values());
  }
  /**
   * Retrieves a list of values for a given header.
   *
   * @param name The header name from which to retrieve values.
   *
   * @returns A string of values if the header exists, null otherwise.
   */
  getAll(name) {
    this.init();
    return this.headers.get(name.toLowerCase()) || null;
  }
  /**
   * Appends a new value to the existing set of values for a header
   * and returns them in a clone of the original instance.
   *
   * @param name The header name for which to append the values.
   * @param value The value to append.
   *
   * @returns A clone of the HTTP headers object with the value appended to the given header.
   */
  append(name, value) {
    return this.clone({
      name,
      value,
      op: "a"
    });
  }
  /**
   * Sets or modifies a value for a given header in a clone of the original instance.
   * If the header already exists, its value is replaced with the given value
   * in the returned object.
   *
   * @param name The header name.
   * @param value The value or values to set or override for the given header.
   *
   * @returns A clone of the HTTP headers object with the newly set header value.
   */
  set(name, value) {
    return this.clone({
      name,
      value,
      op: "s"
    });
  }
  /**
   * Deletes values for a given header in a clone of the original instance.
   *
   * @param name The header name.
   * @param value The value or values to delete for the given header.
   *
   * @returns A clone of the HTTP headers object with the given value deleted.
   */
  delete(name, value) {
    return this.clone({
      name,
      value,
      op: "d"
    });
  }
  maybeSetNormalizedName(name, lcName) {
    if (!this.normalizedNames.has(lcName)) {
      this.normalizedNames.set(lcName, name);
    }
  }
  init() {
    if (!!this.lazyInit) {
      if (this.lazyInit instanceof _HttpHeaders) {
        this.copyFrom(this.lazyInit);
      } else {
        this.lazyInit();
      }
      this.lazyInit = null;
      if (!!this.lazyUpdate) {
        this.lazyUpdate.forEach((update) => this.applyUpdate(update));
        this.lazyUpdate = null;
      }
    }
  }
  copyFrom(other) {
    other.init();
    Array.from(other.headers.keys()).forEach((key) => {
      this.headers.set(key, other.headers.get(key));
      this.normalizedNames.set(key, other.normalizedNames.get(key));
    });
  }
  clone(update) {
    const clone = new _HttpHeaders();
    clone.lazyInit = !!this.lazyInit && this.lazyInit instanceof _HttpHeaders ? this.lazyInit : this;
    clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);
    return clone;
  }
  applyUpdate(update) {
    const key = update.name.toLowerCase();
    switch (update.op) {
      case "a":
      case "s":
        let value = update.value;
        if (typeof value === "string") {
          value = [value];
        }
        if (value.length === 0) {
          return;
        }
        this.maybeSetNormalizedName(update.name, key);
        const base = (update.op === "a" ? this.headers.get(key) : void 0) || [];
        base.push(...value);
        this.headers.set(key, base);
        break;
      case "d":
        const toDelete = update.value;
        if (!toDelete) {
          this.headers.delete(key);
          this.normalizedNames.delete(key);
        } else {
          let existing = this.headers.get(key);
          if (!existing) {
            return;
          }
          existing = existing.filter((value2) => toDelete.indexOf(value2) === -1);
          if (existing.length === 0) {
            this.headers.delete(key);
            this.normalizedNames.delete(key);
          } else {
            this.headers.set(key, existing);
          }
        }
        break;
    }
  }
  addHeaderEntry(name, value) {
    const key = name.toLowerCase();
    this.maybeSetNormalizedName(name, key);
    if (this.headers.has(key)) {
      this.headers.get(key).push(value);
    } else {
      this.headers.set(key, [value]);
    }
  }
  setHeaderEntries(name, values) {
    const headerValues = (Array.isArray(values) ? values : [values]).map((value) => value.toString());
    const key = name.toLowerCase();
    this.headers.set(key, headerValues);
    this.maybeSetNormalizedName(name, key);
  }
  /**
   * @internal
   */
  forEach(fn) {
    this.init();
    Array.from(this.normalizedNames.keys()).forEach((key) => fn(this.normalizedNames.get(key), this.headers.get(key)));
  }
};
function assertValidHeaders(headers) {
  for (const [key, value] of Object.entries(headers)) {
    if (!(typeof value === "string" || typeof value === "number") && !Array.isArray(value)) {
      throw new Error(`Unexpected value of the \`${key}\` header provided. Expecting either a string, a number or an array, but got: \`${value}\`.`);
    }
  }
}
var HttpUrlEncodingCodec = class {
  /**
   * Encodes a key name for a URL parameter or query-string.
   * @param key The key name.
   * @returns The encoded key name.
   */
  encodeKey(key) {
    return standardEncoding(key);
  }
  /**
   * Encodes the value of a URL parameter or query-string.
   * @param value The value.
   * @returns The encoded value.
   */
  encodeValue(value) {
    return standardEncoding(value);
  }
  /**
   * Decodes an encoded URL parameter or query-string key.
   * @param key The encoded key name.
   * @returns The decoded key name.
   */
  decodeKey(key) {
    return decodeURIComponent(key);
  }
  /**
   * Decodes an encoded URL parameter or query-string value.
   * @param value The encoded value.
   * @returns The decoded value.
   */
  decodeValue(value) {
    return decodeURIComponent(value);
  }
};
function paramParser(rawParams, codec) {
  const map2 = /* @__PURE__ */ new Map();
  if (rawParams.length > 0) {
    const params = rawParams.replace(/^\?/, "").split("&");
    params.forEach((param) => {
      const eqIdx = param.indexOf("=");
      const [key, val] = eqIdx == -1 ? [codec.decodeKey(param), ""] : [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];
      const list = map2.get(key) || [];
      list.push(val);
      map2.set(key, list);
    });
  }
  return map2;
}
var STANDARD_ENCODING_REGEX = /%(\d[a-f0-9])/gi;
var STANDARD_ENCODING_REPLACEMENTS = {
  "40": "@",
  "3A": ":",
  "24": "$",
  "2C": ",",
  "3B": ";",
  "3D": "=",
  "3F": "?",
  "2F": "/"
};
function standardEncoding(v) {
  return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);
}
function valueToString(value) {
  return `${value}`;
}
var HttpParams = class _HttpParams {
  map;
  encoder;
  updates = null;
  cloneFrom = null;
  constructor(options = {}) {
    this.encoder = options.encoder || new HttpUrlEncodingCodec();
    if (options.fromString) {
      if (options.fromObject) {
        throw new RuntimeError(2805, ngDevMode && "Cannot specify both fromString and fromObject.");
      }
      this.map = paramParser(options.fromString, this.encoder);
    } else if (!!options.fromObject) {
      this.map = /* @__PURE__ */ new Map();
      Object.keys(options.fromObject).forEach((key) => {
        const value = options.fromObject[key];
        const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];
        this.map.set(key, values);
      });
    } else {
      this.map = null;
    }
  }
  /**
   * Reports whether the body includes one or more values for a given parameter.
   * @param param The parameter name.
   * @returns True if the parameter has one or more values,
   * false if it has no value or is not present.
   */
  has(param) {
    this.init();
    return this.map.has(param);
  }
  /**
   * Retrieves the first value for a parameter.
   * @param param The parameter name.
   * @returns The first value of the given parameter,
   * or `null` if the parameter is not present.
   */
  get(param) {
    this.init();
    const res = this.map.get(param);
    return !!res ? res[0] : null;
  }
  /**
   * Retrieves all values for a  parameter.
   * @param param The parameter name.
   * @returns All values in a string array,
   * or `null` if the parameter not present.
   */
  getAll(param) {
    this.init();
    return this.map.get(param) || null;
  }
  /**
   * Retrieves all the parameters for this body.
   * @returns The parameter names in a string array.
   */
  keys() {
    this.init();
    return Array.from(this.map.keys());
  }
  /**
   * Appends a new value to existing values for a parameter.
   * @param param The parameter name.
   * @param value The new value to add.
   * @return A new body with the appended value.
   */
  append(param, value) {
    return this.clone({
      param,
      value,
      op: "a"
    });
  }
  /**
   * Constructs a new body with appended values for the given parameter name.
   * @param params parameters and values
   * @return A new body with the new value.
   */
  appendAll(params) {
    const updates = [];
    Object.keys(params).forEach((param) => {
      const value = params[param];
      if (Array.isArray(value)) {
        value.forEach((_value) => {
          updates.push({
            param,
            value: _value,
            op: "a"
          });
        });
      } else {
        updates.push({
          param,
          value,
          op: "a"
        });
      }
    });
    return this.clone(updates);
  }
  /**
   * Replaces the value for a parameter.
   * @param param The parameter name.
   * @param value The new value.
   * @return A new body with the new value.
   */
  set(param, value) {
    return this.clone({
      param,
      value,
      op: "s"
    });
  }
  /**
   * Removes a given value or all values from a parameter.
   * @param param The parameter name.
   * @param value The value to remove, if provided.
   * @return A new body with the given value removed, or with all values
   * removed if no value is specified.
   */
  delete(param, value) {
    return this.clone({
      param,
      value,
      op: "d"
    });
  }
  /**
   * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are
   * separated by `&`s.
   */
  toString() {
    this.init();
    return this.keys().map((key) => {
      const eKey = this.encoder.encodeKey(key);
      return this.map.get(key).map((value) => eKey + "=" + this.encoder.encodeValue(value)).join("&");
    }).filter((param) => param !== "").join("&");
  }
  clone(update) {
    const clone = new _HttpParams({
      encoder: this.encoder
    });
    clone.cloneFrom = this.cloneFrom || this;
    clone.updates = (this.updates || []).concat(update);
    return clone;
  }
  init() {
    if (this.map === null) {
      this.map = /* @__PURE__ */ new Map();
    }
    if (this.cloneFrom !== null) {
      this.cloneFrom.init();
      this.cloneFrom.keys().forEach((key) => this.map.set(key, this.cloneFrom.map.get(key)));
      this.updates.forEach((update) => {
        switch (update.op) {
          case "a":
          case "s":
            const base = (update.op === "a" ? this.map.get(update.param) : void 0) || [];
            base.push(valueToString(update.value));
            this.map.set(update.param, base);
            break;
          case "d":
            if (update.value !== void 0) {
              let base2 = this.map.get(update.param) || [];
              const idx = base2.indexOf(valueToString(update.value));
              if (idx !== -1) {
                base2.splice(idx, 1);
              }
              if (base2.length > 0) {
                this.map.set(update.param, base2);
              } else {
                this.map.delete(update.param);
              }
            } else {
              this.map.delete(update.param);
              break;
            }
        }
      });
      this.cloneFrom = this.updates = null;
    }
  }
};
var HttpContext = class {
  map = /* @__PURE__ */ new Map();
  /**
   * Store a value in the context. If a value is already present it will be overwritten.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   * @param value The value to store.
   *
   * @returns A reference to itself for easy chaining.
   */
  set(token, value) {
    this.map.set(token, value);
    return this;
  }
  /**
   * Retrieve the value associated with the given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns The stored value or default if one is defined.
   */
  get(token) {
    if (!this.map.has(token)) {
      this.map.set(token, token.defaultValue());
    }
    return this.map.get(token);
  }
  /**
   * Delete the value associated with the given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns A reference to itself for easy chaining.
   */
  delete(token) {
    this.map.delete(token);
    return this;
  }
  /**
   * Checks for existence of a given token.
   *
   * @param token The reference to an instance of `HttpContextToken`.
   *
   * @returns True if the token exists, false otherwise.
   */
  has(token) {
    return this.map.has(token);
  }
  /**
   * @returns a list of tokens currently stored in the context.
   */
  keys() {
    return this.map.keys();
  }
};
function mightHaveBody(method) {
  switch (method) {
    case "DELETE":
    case "GET":
    case "HEAD":
    case "OPTIONS":
    case "JSONP":
      return false;
    default:
      return true;
  }
}
function isArrayBuffer(value) {
  return typeof ArrayBuffer !== "undefined" && value instanceof ArrayBuffer;
}
function isBlob(value) {
  return typeof Blob !== "undefined" && value instanceof Blob;
}
function isFormData(value) {
  return typeof FormData !== "undefined" && value instanceof FormData;
}
function isUrlSearchParams(value) {
  return typeof URLSearchParams !== "undefined" && value instanceof URLSearchParams;
}
var CONTENT_TYPE_HEADER = "Content-Type";
var ACCEPT_HEADER = "Accept";
var X_REQUEST_URL_HEADER = "X-Request-URL";
var TEXT_CONTENT_TYPE = "text/plain";
var JSON_CONTENT_TYPE = "application/json";
var ACCEPT_HEADER_VALUE = `${JSON_CONTENT_TYPE}, ${TEXT_CONTENT_TYPE}, */*`;
var HttpRequest = class _HttpRequest {
  url;
  /**
   * The request body, or `null` if one isn't set.
   *
   * Bodies are not enforced to be immutable, as they can include a reference to any
   * user-defined data type. However, interceptors should take care to preserve
   * idempotence by treating them as such.
   */
  body = null;
  /**
   * Outgoing headers for this request.
   */
  // TODO(issue/24571): remove '!'.
  headers;
  /**
   * Shared and mutable context that can be used by interceptors
   */
  context;
  /**
   * Whether this request should be made in a way that exposes progress events.
   *
   * Progress events are expensive (change detection runs on each event) and so
   * they should only be requested if the consumer intends to monitor them.
   *
   * Note: The `FetchBackend` doesn't support progress report on uploads.
   */
  reportProgress = false;
  /**
   * Whether this request should be sent with outgoing credentials (cookies).
   */
  withCredentials = false;
  /**
   * The expected response type of the server.
   *
   * This is used to parse the response appropriately before returning it to
   * the requestee.
   */
  responseType = "json";
  /**
   * The outgoing HTTP request method.
   */
  method;
  /**
   * Outgoing URL parameters.
   *
   * To pass a string representation of HTTP parameters in the URL-query-string format,
   * the `HttpParamsOptions`' `fromString` may be used. For example:
   *
   * ```ts
   * new HttpParams({fromString: 'angular=awesome'})
   * ```
   */
  // TODO(issue/24571): remove '!'.
  params;
  /**
   * The outgoing URL with all URL parameters set.
   */
  urlWithParams;
  /**
   * The HttpTransferCache option for the request
   */
  transferCache;
  constructor(method, url, third, fourth) {
    this.url = url;
    this.method = method.toUpperCase();
    let options;
    if (mightHaveBody(this.method) || !!fourth) {
      this.body = third !== void 0 ? third : null;
      options = fourth;
    } else {
      options = third;
    }
    if (options) {
      this.reportProgress = !!options.reportProgress;
      this.withCredentials = !!options.withCredentials;
      if (!!options.responseType) {
        this.responseType = options.responseType;
      }
      if (!!options.headers) {
        this.headers = options.headers;
      }
      if (!!options.context) {
        this.context = options.context;
      }
      if (!!options.params) {
        this.params = options.params;
      }
      this.transferCache = options.transferCache;
    }
    this.headers ??= new HttpHeaders();
    this.context ??= new HttpContext();
    if (!this.params) {
      this.params = new HttpParams();
      this.urlWithParams = url;
    } else {
      const params = this.params.toString();
      if (params.length === 0) {
        this.urlWithParams = url;
      } else {
        const qIdx = url.indexOf("?");
        const sep = qIdx === -1 ? "?" : qIdx < url.length - 1 ? "&" : "";
        this.urlWithParams = url + sep + params;
      }
    }
  }
  /**
   * Transform the free-form body into a serialized format suitable for
   * transmission to the server.
   */
  serializeBody() {
    if (this.body === null) {
      return null;
    }
    if (typeof this.body === "string" || isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) || isUrlSearchParams(this.body)) {
      return this.body;
    }
    if (this.body instanceof HttpParams) {
      return this.body.toString();
    }
    if (typeof this.body === "object" || typeof this.body === "boolean" || Array.isArray(this.body)) {
      return JSON.stringify(this.body);
    }
    return this.body.toString();
  }
  /**
   * Examine the body and attempt to infer an appropriate MIME type
   * for it.
   *
   * If no such type can be inferred, this method will return `null`.
   */
  detectContentTypeHeader() {
    if (this.body === null) {
      return null;
    }
    if (isFormData(this.body)) {
      return null;
    }
    if (isBlob(this.body)) {
      return this.body.type || null;
    }
    if (isArrayBuffer(this.body)) {
      return null;
    }
    if (typeof this.body === "string") {
      return TEXT_CONTENT_TYPE;
    }
    if (this.body instanceof HttpParams) {
      return "application/x-www-form-urlencoded;charset=UTF-8";
    }
    if (typeof this.body === "object" || typeof this.body === "number" || typeof this.body === "boolean") {
      return JSON_CONTENT_TYPE;
    }
    return null;
  }
  clone(update = {}) {
    const method = update.method || this.method;
    const url = update.url || this.url;
    const responseType = update.responseType || this.responseType;
    const transferCache = update.transferCache ?? this.transferCache;
    const body = update.body !== void 0 ? update.body : this.body;
    const withCredentials = update.withCredentials ?? this.withCredentials;
    const reportProgress = update.reportProgress ?? this.reportProgress;
    let headers = update.headers || this.headers;
    let params = update.params || this.params;
    const context = update.context ?? this.context;
    if (update.setHeaders !== void 0) {
      headers = Object.keys(update.setHeaders).reduce((headers2, name) => headers2.set(name, update.setHeaders[name]), headers);
    }
    if (update.setParams) {
      params = Object.keys(update.setParams).reduce((params2, param) => params2.set(param, update.setParams[param]), params);
    }
    return new _HttpRequest(method, url, body, {
      params,
      headers,
      context,
      reportProgress,
      responseType,
      withCredentials,
      transferCache
    });
  }
};
var HttpEventType;
(function(HttpEventType2) {
  HttpEventType2[HttpEventType2["Sent"] = 0] = "Sent";
  HttpEventType2[HttpEventType2["UploadProgress"] = 1] = "UploadProgress";
  HttpEventType2[HttpEventType2["ResponseHeader"] = 2] = "ResponseHeader";
  HttpEventType2[HttpEventType2["DownloadProgress"] = 3] = "DownloadProgress";
  HttpEventType2[HttpEventType2["Response"] = 4] = "Response";
  HttpEventType2[HttpEventType2["User"] = 5] = "User";
})(HttpEventType || (HttpEventType = {}));
var HttpResponseBase = class {
  /**
   * All response headers.
   */
  headers;
  /**
   * Response status code.
   */
  status;
  /**
   * Textual description of response status code, defaults to OK.
   *
   * Do not depend on this.
   */
  statusText;
  /**
   * URL of the resource retrieved, or null if not available.
   */
  url;
  /**
   * Whether the status code falls in the 2xx range.
   */
  ok;
  /**
   * Type of the response, narrowed to either the full response or the header.
   */
  // TODO(issue/24571): remove '!'.
  type;
  /**
   * Super-constructor for all responses.
   *
   * The single parameter accepted is an initialization hash. Any properties
   * of the response passed there will override the default values.
   */
  constructor(init, defaultStatus = 200, defaultStatusText = "OK") {
    this.headers = init.headers || new HttpHeaders();
    this.status = init.status !== void 0 ? init.status : defaultStatus;
    this.statusText = init.statusText || defaultStatusText;
    this.url = init.url || null;
    this.ok = this.status >= 200 && this.status < 300;
  }
};
var HttpHeaderResponse = class _HttpHeaderResponse extends HttpResponseBase {
  /**
   * Create a new `HttpHeaderResponse` with the given parameters.
   */
  constructor(init = {}) {
    super(init);
  }
  type = HttpEventType.ResponseHeader;
  /**
   * Copy this `HttpHeaderResponse`, overriding its contents with the
   * given parameter hash.
   */
  clone(update = {}) {
    return new _HttpHeaderResponse({
      headers: update.headers || this.headers,
      status: update.status !== void 0 ? update.status : this.status,
      statusText: update.statusText || this.statusText,
      url: update.url || this.url || void 0
    });
  }
};
var HttpResponse = class _HttpResponse extends HttpResponseBase {
  /**
   * The response body, or `null` if one was not returned.
   */
  body;
  /**
   * Construct a new `HttpResponse`.
   */
  constructor(init = {}) {
    super(init);
    this.body = init.body !== void 0 ? init.body : null;
  }
  type = HttpEventType.Response;
  clone(update = {}) {
    return new _HttpResponse({
      body: update.body !== void 0 ? update.body : this.body,
      headers: update.headers || this.headers,
      status: update.status !== void 0 ? update.status : this.status,
      statusText: update.statusText || this.statusText,
      url: update.url || this.url || void 0
    });
  }
};
var HttpErrorResponse = class extends HttpResponseBase {
  name = "HttpErrorResponse";
  message;
  error;
  /**
   * Errors are never okay, even when the status code is in the 2xx success range.
   */
  ok = false;
  constructor(init) {
    super(init, 0, "Unknown Error");
    if (this.status >= 200 && this.status < 300) {
      this.message = `Http failure during parsing for ${init.url || "(unknown url)"}`;
    } else {
      this.message = `Http failure response for ${init.url || "(unknown url)"}: ${init.status} ${init.statusText}`;
    }
    this.error = init.error || null;
  }
};
var HTTP_STATUS_CODE_OK = 200;
var HTTP_STATUS_CODE_NO_CONTENT = 204;
var HttpStatusCode;
(function(HttpStatusCode2) {
  HttpStatusCode2[HttpStatusCode2["Continue"] = 100] = "Continue";
  HttpStatusCode2[HttpStatusCode2["SwitchingProtocols"] = 101] = "SwitchingProtocols";
  HttpStatusCode2[HttpStatusCode2["Processing"] = 102] = "Processing";
  HttpStatusCode2[HttpStatusCode2["EarlyHints"] = 103] = "EarlyHints";
  HttpStatusCode2[HttpStatusCode2["Ok"] = 200] = "Ok";
  HttpStatusCode2[HttpStatusCode2["Created"] = 201] = "Created";
  HttpStatusCode2[HttpStatusCode2["Accepted"] = 202] = "Accepted";
  HttpStatusCode2[HttpStatusCode2["NonAuthoritativeInformation"] = 203] = "NonAuthoritativeInformation";
  HttpStatusCode2[HttpStatusCode2["NoContent"] = 204] = "NoContent";
  HttpStatusCode2[HttpStatusCode2["ResetContent"] = 205] = "ResetContent";
  HttpStatusCode2[HttpStatusCode2["PartialContent"] = 206] = "PartialContent";
  HttpStatusCode2[HttpStatusCode2["MultiStatus"] = 207] = "MultiStatus";
  HttpStatusCode2[HttpStatusCode2["AlreadyReported"] = 208] = "AlreadyReported";
  HttpStatusCode2[HttpStatusCode2["ImUsed"] = 226] = "ImUsed";
  HttpStatusCode2[HttpStatusCode2["MultipleChoices"] = 300] = "MultipleChoices";
  HttpStatusCode2[HttpStatusCode2["MovedPermanently"] = 301] = "MovedPermanently";
  HttpStatusCode2[HttpStatusCode2["Found"] = 302] = "Found";
  HttpStatusCode2[HttpStatusCode2["SeeOther"] = 303] = "SeeOther";
  HttpStatusCode2[HttpStatusCode2["NotModified"] = 304] = "NotModified";
  HttpStatusCode2[HttpStatusCode2["UseProxy"] = 305] = "UseProxy";
  HttpStatusCode2[HttpStatusCode2["Unused"] = 306] = "Unused";
  HttpStatusCode2[HttpStatusCode2["TemporaryRedirect"] = 307] = "TemporaryRedirect";
  HttpStatusCode2[HttpStatusCode2["PermanentRedirect"] = 308] = "PermanentRedirect";
  HttpStatusCode2[HttpStatusCode2["BadRequest"] = 400] = "BadRequest";
  HttpStatusCode2[HttpStatusCode2["Unauthorized"] = 401] = "Unauthorized";
  HttpStatusCode2[HttpStatusCode2["PaymentRequired"] = 402] = "PaymentRequired";
  HttpStatusCode2[HttpStatusCode2["Forbidden"] = 403] = "Forbidden";
  HttpStatusCode2[HttpStatusCode2["NotFound"] = 404] = "NotFound";
  HttpStatusCode2[HttpStatusCode2["MethodNotAllowed"] = 405] = "MethodNotAllowed";
  HttpStatusCode2[HttpStatusCode2["NotAcceptable"] = 406] = "NotAcceptable";
  HttpStatusCode2[HttpStatusCode2["ProxyAuthenticationRequired"] = 407] = "ProxyAuthenticationRequired";
  HttpStatusCode2[HttpStatusCode2["RequestTimeout"] = 408] = "RequestTimeout";
  HttpStatusCode2[HttpStatusCode2["Conflict"] = 409] = "Conflict";
  HttpStatusCode2[HttpStatusCode2["Gone"] = 410] = "Gone";
  HttpStatusCode2[HttpStatusCode2["LengthRequired"] = 411] = "LengthRequired";
  HttpStatusCode2[HttpStatusCode2["PreconditionFailed"] = 412] = "PreconditionFailed";
  HttpStatusCode2[HttpStatusCode2["PayloadTooLarge"] = 413] = "PayloadTooLarge";
  HttpStatusCode2[HttpStatusCode2["UriTooLong"] = 414] = "UriTooLong";
  HttpStatusCode2[HttpStatusCode2["UnsupportedMediaType"] = 415] = "UnsupportedMediaType";
  HttpStatusCode2[HttpStatusCode2["RangeNotSatisfiable"] = 416] = "RangeNotSatisfiable";
  HttpStatusCode2[HttpStatusCode2["ExpectationFailed"] = 417] = "ExpectationFailed";
  HttpStatusCode2[HttpStatusCode2["ImATeapot"] = 418] = "ImATeapot";
  HttpStatusCode2[HttpStatusCode2["MisdirectedRequest"] = 421] = "MisdirectedRequest";
  HttpStatusCode2[HttpStatusCode2["UnprocessableEntity"] = 422] = "UnprocessableEntity";
  HttpStatusCode2[HttpStatusCode2["Locked"] = 423] = "Locked";
  HttpStatusCode2[HttpStatusCode2["FailedDependency"] = 424] = "FailedDependency";
  HttpStatusCode2[HttpStatusCode2["TooEarly"] = 425] = "TooEarly";
  HttpStatusCode2[HttpStatusCode2["UpgradeRequired"] = 426] = "UpgradeRequired";
  HttpStatusCode2[HttpStatusCode2["PreconditionRequired"] = 428] = "PreconditionRequired";
  HttpStatusCode2[HttpStatusCode2["TooManyRequests"] = 429] = "TooManyRequests";
  HttpStatusCode2[HttpStatusCode2["RequestHeaderFieldsTooLarge"] = 431] = "RequestHeaderFieldsTooLarge";
  HttpStatusCode2[HttpStatusCode2["UnavailableForLegalReasons"] = 451] = "UnavailableForLegalReasons";
  HttpStatusCode2[HttpStatusCode2["InternalServerError"] = 500] = "InternalServerError";
  HttpStatusCode2[HttpStatusCode2["NotImplemented"] = 501] = "NotImplemented";
  HttpStatusCode2[HttpStatusCode2["BadGateway"] = 502] = "BadGateway";
  HttpStatusCode2[HttpStatusCode2["ServiceUnavailable"] = 503] = "ServiceUnavailable";
  HttpStatusCode2[HttpStatusCode2["GatewayTimeout"] = 504] = "GatewayTimeout";
  HttpStatusCode2[HttpStatusCode2["HttpVersionNotSupported"] = 505] = "HttpVersionNotSupported";
  HttpStatusCode2[HttpStatusCode2["VariantAlsoNegotiates"] = 506] = "VariantAlsoNegotiates";
  HttpStatusCode2[HttpStatusCode2["InsufficientStorage"] = 507] = "InsufficientStorage";
  HttpStatusCode2[HttpStatusCode2["LoopDetected"] = 508] = "LoopDetected";
  HttpStatusCode2[HttpStatusCode2["NotExtended"] = 510] = "NotExtended";
  HttpStatusCode2[HttpStatusCode2["NetworkAuthenticationRequired"] = 511] = "NetworkAuthenticationRequired";
})(HttpStatusCode || (HttpStatusCode = {}));
function addBody(options, body) {
  return {
    body,
    headers: options.headers,
    context: options.context,
    observe: options.observe,
    params: options.params,
    reportProgress: options.reportProgress,
    responseType: options.responseType,
    withCredentials: options.withCredentials,
    transferCache: options.transferCache
  };
}
var HttpClient = class _HttpClient {
  handler;
  constructor(handler) {
    this.handler = handler;
  }
  /**
   * Constructs an observable for a generic HTTP request that, when subscribed,
   * fires the request through the chain of registered interceptors and on to the
   * server.
   *
   * You can pass an `HttpRequest` directly as the only parameter. In this case,
   * the call returns an observable of the raw `HttpEvent` stream.
   *
   * Alternatively you can pass an HTTP method as the first parameter,
   * a URL string as the second, and an options hash containing the request body as the third.
   * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the
   * type of returned observable.
   *   * The `responseType` value determines how a successful response body is parsed.
   *   * If `responseType` is the default `json`, you can pass a type interface for the resulting
   * object as a type parameter to the call.
   *
   * The `observe` value determines the return type, according to what you are interested in
   * observing.
   *   * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including
   * progress events by default.
   *   * An `observe` value of response returns an observable of `HttpResponse<T>`,
   * where the `T` parameter depends on the `responseType` and any optionally provided type
   * parameter.
   *   * An `observe` value of body returns an observable of `<T>` with the same `T` body type.
   *
   */
  request(first2, url, options = {}) {
    let req;
    if (first2 instanceof HttpRequest) {
      req = first2;
    } else {
      let headers = void 0;
      if (options.headers instanceof HttpHeaders) {
        headers = options.headers;
      } else {
        headers = new HttpHeaders(options.headers);
      }
      let params = void 0;
      if (!!options.params) {
        if (options.params instanceof HttpParams) {
          params = options.params;
        } else {
          params = new HttpParams({
            fromObject: options.params
          });
        }
      }
      req = new HttpRequest(first2, url, options.body !== void 0 ? options.body : null, {
        headers,
        context: options.context,
        params,
        reportProgress: options.reportProgress,
        // By default, JSON is assumed to be returned for all calls.
        responseType: options.responseType || "json",
        withCredentials: options.withCredentials,
        transferCache: options.transferCache
      });
    }
    const events$ = of(req).pipe(concatMap((req2) => this.handler.handle(req2)));
    if (first2 instanceof HttpRequest || options.observe === "events") {
      return events$;
    }
    const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));
    switch (options.observe || "body") {
      case "body":
        switch (req.responseType) {
          case "arraybuffer":
            return res$.pipe(map((res) => {
              if (res.body !== null && !(res.body instanceof ArrayBuffer)) {
                throw new RuntimeError(2806, ngDevMode && "Response is not an ArrayBuffer.");
              }
              return res.body;
            }));
          case "blob":
            return res$.pipe(map((res) => {
              if (res.body !== null && !(res.body instanceof Blob)) {
                throw new RuntimeError(2807, ngDevMode && "Response is not a Blob.");
              }
              return res.body;
            }));
          case "text":
            return res$.pipe(map((res) => {
              if (res.body !== null && typeof res.body !== "string") {
                throw new RuntimeError(2808, ngDevMode && "Response is not a string.");
              }
              return res.body;
            }));
          case "json":
          default:
            return res$.pipe(map((res) => res.body));
        }
      case "response":
        return res$;
      default:
        throw new RuntimeError(2809, ngDevMode && `Unreachable: unhandled observe type ${options.observe}}`);
    }
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `DELETE` request to execute on the server. See the individual overloads for
   * details on the return type.
   *
   * @param url     The endpoint URL.
   * @param options The HTTP options to send with the request.
   *
   */
  delete(url, options = {}) {
    return this.request("DELETE", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `GET` request to execute on the server. See the individual overloads for
   * details on the return type.
   */
  get(url, options = {}) {
    return this.request("GET", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `HEAD` request to execute on the server. The `HEAD` method returns
   * meta information about the resource without transferring the
   * resource itself. See the individual overloads for
   * details on the return type.
   */
  head(url, options = {}) {
    return this.request("HEAD", url, options);
  }
  /**
   * Constructs an `Observable` that, when subscribed, causes a request with the special method
   * `JSONP` to be dispatched via the interceptor pipeline.
   * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain
   * API endpoints that don't support newer,
   * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.
   * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the
   * requests even if the API endpoint is not located on the same domain (origin) as the client-side
   * application making the request.
   * The endpoint API must support JSONP callback for JSONP requests to work.
   * The resource API returns the JSON response wrapped in a callback function.
   * You can pass the callback function name as one of the query parameters.
   * Note that JSONP requests can only be used with `GET` requests.
   *
   * @param url The resource URL.
   * @param callbackParam The callback function name.
   *
   */
  jsonp(url, callbackParam) {
    return this.request("JSONP", url, {
      params: new HttpParams().append(callbackParam, "JSONP_CALLBACK"),
      observe: "body",
      responseType: "json"
    });
  }
  /**
   * Constructs an `Observable` that, when subscribed, causes the configured
   * `OPTIONS` request to execute on the server. This method allows the client
   * to determine the supported HTTP methods and other capabilities of an endpoint,
   * without implying a resource action. See the individual overloads for
   * details on the return type.
   */
  options(url, options = {}) {
    return this.request("OPTIONS", url, options);
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `PATCH` request to execute on the server. See the individual overloads for
   * details on the return type.
   */
  patch(url, body, options = {}) {
    return this.request("PATCH", url, addBody(options, body));
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `POST` request to execute on the server. The server responds with the location of
   * the replaced resource. See the individual overloads for
   * details on the return type.
   */
  post(url, body, options = {}) {
    return this.request("POST", url, addBody(options, body));
  }
  /**
   * Constructs an observable that, when subscribed, causes the configured
   * `PUT` request to execute on the server. The `PUT` method replaces an existing resource
   * with a new set of values.
   * See the individual overloads for details on the return type.
   */
  put(url, body, options = {}) {
    return this.request("PUT", url, addBody(options, body));
  }
  static \u0275fac = function HttpClient_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpClient)(\u0275\u0275inject(HttpHandler));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HttpClient,
    factory: _HttpClient.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClient, [{
    type: Injectable
  }], () => [{
    type: HttpHandler
  }], null);
})();
var XSSI_PREFIX$1 = /^\)\]\}',?\n/;
function getResponseUrl$1(response) {
  if (response.url) {
    return response.url;
  }
  const xRequestUrl = X_REQUEST_URL_HEADER.toLocaleLowerCase();
  return response.headers.get(xRequestUrl);
}
var FETCH_BACKEND = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "FETCH_BACKEND" : "");
var FetchBackend = class _FetchBackend {
  // We use an arrow function to always reference the current global implementation of `fetch`.
  // This is helpful for cases when the global `fetch` implementation is modified by external code,
  // see https://github.com/angular/angular/issues/57527.
  fetchImpl = inject(FetchFactory, {
    optional: true
  })?.fetch ?? ((...args) => globalThis.fetch(...args));
  ngZone = inject(NgZone);
  handle(request) {
    return new Observable((observer) => {
      const aborter = new AbortController();
      this.doRequest(request, aborter.signal, observer).then(noop, (error) => observer.error(new HttpErrorResponse({
        error
      })));
      return () => aborter.abort();
    });
  }
  async doRequest(request, signal2, observer) {
    const init = this.createRequestInit(request);
    let response;
    try {
      const fetchPromise = this.ngZone.runOutsideAngular(() => this.fetchImpl(request.urlWithParams, __spreadValues({
        signal: signal2
      }, init)));
      silenceSuperfluousUnhandledPromiseRejection(fetchPromise);
      observer.next({
        type: HttpEventType.Sent
      });
      response = await fetchPromise;
    } catch (error) {
      observer.error(new HttpErrorResponse({
        error,
        status: error.status ?? 0,
        statusText: error.statusText,
        url: request.urlWithParams,
        headers: error.headers
      }));
      return;
    }
    const headers = new HttpHeaders(response.headers);
    const statusText = response.statusText;
    const url = getResponseUrl$1(response) ?? request.urlWithParams;
    let status = response.status;
    let body = null;
    if (request.reportProgress) {
      observer.next(new HttpHeaderResponse({
        headers,
        status,
        statusText,
        url
      }));
    }
    if (response.body) {
      const contentLength = response.headers.get("content-length");
      const chunks = [];
      const reader = response.body.getReader();
      let receivedLength = 0;
      let decoder;
      let partialText;
      const reqZone = typeof Zone !== "undefined" && Zone.current;
      await this.ngZone.runOutsideAngular(async () => {
        while (true) {
          const {
            done,
            value
          } = await reader.read();
          if (done) {
            break;
          }
          chunks.push(value);
          receivedLength += value.length;
          if (request.reportProgress) {
            partialText = request.responseType === "text" ? (partialText ?? "") + (decoder ??= new TextDecoder()).decode(value, {
              stream: true
            }) : void 0;
            const reportProgress = () => observer.next({
              type: HttpEventType.DownloadProgress,
              total: contentLength ? +contentLength : void 0,
              loaded: receivedLength,
              partialText
            });
            reqZone ? reqZone.run(reportProgress) : reportProgress();
          }
        }
      });
      const chunksAll = this.concatChunks(chunks, receivedLength);
      try {
        const contentType = response.headers.get(CONTENT_TYPE_HEADER) ?? "";
        body = this.parseBody(request, chunksAll, contentType);
      } catch (error) {
        observer.error(new HttpErrorResponse({
          error,
          headers: new HttpHeaders(response.headers),
          status: response.status,
          statusText: response.statusText,
          url: getResponseUrl$1(response) ?? request.urlWithParams
        }));
        return;
      }
    }
    if (status === 0) {
      status = body ? HTTP_STATUS_CODE_OK : 0;
    }
    const ok = status >= 200 && status < 300;
    if (ok) {
      observer.next(new HttpResponse({
        body,
        headers,
        status,
        statusText,
        url
      }));
      observer.complete();
    } else {
      observer.error(new HttpErrorResponse({
        error: body,
        headers,
        status,
        statusText,
        url
      }));
    }
  }
  parseBody(request, binContent, contentType) {
    switch (request.responseType) {
      case "json":
        const text = new TextDecoder().decode(binContent).replace(XSSI_PREFIX$1, "");
        return text === "" ? null : JSON.parse(text);
      case "text":
        return new TextDecoder().decode(binContent);
      case "blob":
        return new Blob([binContent], {
          type: contentType
        });
      case "arraybuffer":
        return binContent.buffer;
    }
  }
  createRequestInit(req) {
    const headers = {};
    const credentials = req.withCredentials ? "include" : void 0;
    req.headers.forEach((name, values) => headers[name] = values.join(","));
    if (!req.headers.has(ACCEPT_HEADER)) {
      headers[ACCEPT_HEADER] = ACCEPT_HEADER_VALUE;
    }
    if (!req.headers.has(CONTENT_TYPE_HEADER)) {
      const detectedType = req.detectContentTypeHeader();
      if (detectedType !== null) {
        headers[CONTENT_TYPE_HEADER] = detectedType;
      }
    }
    return {
      body: req.serializeBody(),
      method: req.method,
      headers,
      credentials
    };
  }
  concatChunks(chunks, totalLength) {
    const chunksAll = new Uint8Array(totalLength);
    let position = 0;
    for (const chunk of chunks) {
      chunksAll.set(chunk, position);
      position += chunk.length;
    }
    return chunksAll;
  }
  static \u0275fac = function FetchBackend_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _FetchBackend)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _FetchBackend,
    factory: _FetchBackend.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(FetchBackend, [{
    type: Injectable
  }], null, null);
})();
var FetchFactory = class {
};
function noop() {
}
function silenceSuperfluousUnhandledPromiseRejection(promise) {
  promise.then(noop, noop);
}
function interceptorChainEndFn(req, finalHandlerFn) {
  return finalHandlerFn(req);
}
function adaptLegacyInterceptorToChain(chainTailFn, interceptor) {
  return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {
    handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)
  });
}
function chainedInterceptorFn(chainTailFn, interceptorFn, injector) {
  return (initialRequest, finalHandlerFn) => runInInjectionContext(injector, () => interceptorFn(initialRequest, (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)));
}
var HTTP_INTERCEPTORS = new InjectionToken(ngDevMode ? "HTTP_INTERCEPTORS" : "");
var HTTP_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? "HTTP_INTERCEPTOR_FNS" : "");
var HTTP_ROOT_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? "HTTP_ROOT_INTERCEPTOR_FNS" : "");
var REQUESTS_CONTRIBUTE_TO_STABILITY = new InjectionToken(ngDevMode ? "REQUESTS_CONTRIBUTE_TO_STABILITY" : "", {
  providedIn: "root",
  factory: () => true
});
function legacyInterceptorFnFactory() {
  let chain = null;
  return (req, handler) => {
    if (chain === null) {
      const interceptors = inject(HTTP_INTERCEPTORS, {
        optional: true
      }) ?? [];
      chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);
    }
    const pendingTasks = inject(PendingTasksInternal);
    const contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);
    if (contributeToStability) {
      const taskId = pendingTasks.add();
      return chain(req, handler).pipe(finalize(() => pendingTasks.remove(taskId)));
    } else {
      return chain(req, handler);
    }
  };
}
var fetchBackendWarningDisplayed = false;
var HttpInterceptorHandler = class _HttpInterceptorHandler extends HttpHandler {
  backend;
  injector;
  chain = null;
  pendingTasks = inject(PendingTasksInternal);
  contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);
  constructor(backend, injector) {
    super();
    this.backend = backend;
    this.injector = injector;
    if ((typeof ngDevMode === "undefined" || ngDevMode) && !fetchBackendWarningDisplayed) {
      const isServer = isPlatformServer(injector.get(PLATFORM_ID));
      const isTestingBackend = this.backend.isTestingBackend;
      if (isServer && !(this.backend instanceof FetchBackend) && !isTestingBackend) {
        fetchBackendWarningDisplayed = true;
        injector.get(Console).warn(formatRuntimeError(2801, "Angular detected that `HttpClient` is not configured to use `fetch` APIs. It's strongly recommended to enable `fetch` for applications that use Server-Side Rendering for better performance and compatibility. To enable `fetch`, add the `withFetch()` to the `provideHttpClient()` call at the root of the application."));
      }
    }
  }
  handle(initialRequest) {
    if (this.chain === null) {
      const dedupedInterceptorFns = Array.from(/* @__PURE__ */ new Set([...this.injector.get(HTTP_INTERCEPTOR_FNS), ...this.injector.get(HTTP_ROOT_INTERCEPTOR_FNS, [])]));
      this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);
    }
    if (this.contributeToStability) {
      const taskId = this.pendingTasks.add();
      return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest)).pipe(finalize(() => this.pendingTasks.remove(taskId)));
    } else {
      return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest));
    }
  }
  static \u0275fac = function HttpInterceptorHandler_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpInterceptorHandler)(\u0275\u0275inject(HttpBackend), \u0275\u0275inject(EnvironmentInjector));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HttpInterceptorHandler,
    factory: _HttpInterceptorHandler.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpInterceptorHandler, [{
    type: Injectable
  }], () => [{
    type: HttpBackend
  }, {
    type: EnvironmentInjector
  }], null);
})();
var nextRequestId = 0;
var foreignDocument;
var JSONP_ERR_NO_CALLBACK = "JSONP injected script did not invoke callback.";
var JSONP_ERR_WRONG_METHOD = "JSONP requests must use JSONP request method.";
var JSONP_ERR_WRONG_RESPONSE_TYPE = "JSONP requests must use Json response type.";
var JSONP_ERR_HEADERS_NOT_SUPPORTED = "JSONP requests do not support headers.";
var JsonpCallbackContext = class {
};
function jsonpCallbackContext() {
  if (typeof window === "object") {
    return window;
  }
  return {};
}
var JsonpClientBackend = class _JsonpClientBackend {
  callbackMap;
  document;
  /**
   * A resolved promise that can be used to schedule microtasks in the event handlers.
   */
  resolvedPromise = Promise.resolve();
  constructor(callbackMap, document2) {
    this.callbackMap = callbackMap;
    this.document = document2;
  }
  /**
   * Get the name of the next callback method, by incrementing the global `nextRequestId`.
   */
  nextCallback() {
    return `ng_jsonp_callback_${nextRequestId++}`;
  }
  /**
   * Processes a JSONP request and returns an event stream of the results.
   * @param req The request object.
   * @returns An observable of the response events.
   *
   */
  handle(req) {
    if (req.method !== "JSONP") {
      throw new RuntimeError(2810, ngDevMode && JSONP_ERR_WRONG_METHOD);
    } else if (req.responseType !== "json") {
      throw new RuntimeError(2811, ngDevMode && JSONP_ERR_WRONG_RESPONSE_TYPE);
    }
    if (req.headers.keys().length > 0) {
      throw new RuntimeError(2812, ngDevMode && JSONP_ERR_HEADERS_NOT_SUPPORTED);
    }
    return new Observable((observer) => {
      const callback = this.nextCallback();
      const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);
      const node = this.document.createElement("script");
      node.src = url;
      let body = null;
      let finished = false;
      this.callbackMap[callback] = (data) => {
        delete this.callbackMap[callback];
        body = data;
        finished = true;
      };
      const cleanup = () => {
        node.removeEventListener("load", onLoad);
        node.removeEventListener("error", onError);
        node.remove();
        delete this.callbackMap[callback];
      };
      const onLoad = () => {
        this.resolvedPromise.then(() => {
          cleanup();
          if (!finished) {
            observer.error(new HttpErrorResponse({
              url,
              status: 0,
              statusText: "JSONP Error",
              error: new Error(JSONP_ERR_NO_CALLBACK)
            }));
            return;
          }
          observer.next(new HttpResponse({
            body,
            status: HTTP_STATUS_CODE_OK,
            statusText: "OK",
            url
          }));
          observer.complete();
        });
      };
      const onError = (error) => {
        cleanup();
        observer.error(new HttpErrorResponse({
          error,
          status: 0,
          statusText: "JSONP Error",
          url
        }));
      };
      node.addEventListener("load", onLoad);
      node.addEventListener("error", onError);
      this.document.body.appendChild(node);
      observer.next({
        type: HttpEventType.Sent
      });
      return () => {
        if (!finished) {
          this.removeListeners(node);
        }
        cleanup();
      };
    });
  }
  removeListeners(script) {
    foreignDocument ??= this.document.implementation.createHTMLDocument();
    foreignDocument.adoptNode(script);
  }
  static \u0275fac = function JsonpClientBackend_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _JsonpClientBackend)(\u0275\u0275inject(JsonpCallbackContext), \u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _JsonpClientBackend,
    factory: _JsonpClientBackend.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonpClientBackend, [{
    type: Injectable
  }], () => [{
    type: JsonpCallbackContext
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
function jsonpInterceptorFn(req, next) {
  if (req.method === "JSONP") {
    return inject(JsonpClientBackend).handle(req);
  }
  return next(req);
}
var JsonpInterceptor = class _JsonpInterceptor {
  injector;
  constructor(injector) {
    this.injector = injector;
  }
  /**
   * Identifies and handles a given JSONP request.
   * @param initialRequest The outgoing request object to handle.
   * @param next The next interceptor in the chain, or the backend
   * if no interceptors remain in the chain.
   * @returns An observable of the event stream.
   */
  intercept(initialRequest, next) {
    return runInInjectionContext(this.injector, () => jsonpInterceptorFn(initialRequest, (downstreamRequest) => next.handle(downstreamRequest)));
  }
  static \u0275fac = function JsonpInterceptor_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _JsonpInterceptor)(\u0275\u0275inject(EnvironmentInjector));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _JsonpInterceptor,
    factory: _JsonpInterceptor.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(JsonpInterceptor, [{
    type: Injectable
  }], () => [{
    type: EnvironmentInjector
  }], null);
})();
var XSSI_PREFIX = /^\)\]\}',?\n/;
var X_REQUEST_URL_REGEXP = RegExp(`^${X_REQUEST_URL_HEADER}:`, "m");
function getResponseUrl(xhr) {
  if ("responseURL" in xhr && xhr.responseURL) {
    return xhr.responseURL;
  }
  if (X_REQUEST_URL_REGEXP.test(xhr.getAllResponseHeaders())) {
    return xhr.getResponseHeader(X_REQUEST_URL_HEADER);
  }
  return null;
}
var HttpXhrBackend = class _HttpXhrBackend {
  xhrFactory;
  constructor(xhrFactory) {
    this.xhrFactory = xhrFactory;
  }
  /**
   * Processes a request and returns a stream of response events.
   * @param req The request object.
   * @returns An observable of the response events.
   */
  handle(req) {
    if (req.method === "JSONP") {
      throw new RuntimeError(-2800, (typeof ngDevMode === "undefined" || ngDevMode) && `Cannot make a JSONP request without JSONP support. To fix the problem, either add the \`withJsonpSupport()\` call (if \`provideHttpClient()\` is used) or import the \`HttpClientJsonpModule\` in the root NgModule.`);
    }
    const xhrFactory = this.xhrFactory;
    const source = xhrFactory.\u0275loadImpl ? from(xhrFactory.\u0275loadImpl()) : of(null);
    return source.pipe(switchMap(() => {
      return new Observable((observer) => {
        const xhr = xhrFactory.build();
        xhr.open(req.method, req.urlWithParams);
        if (req.withCredentials) {
          xhr.withCredentials = true;
        }
        req.headers.forEach((name, values) => xhr.setRequestHeader(name, values.join(",")));
        if (!req.headers.has(ACCEPT_HEADER)) {
          xhr.setRequestHeader(ACCEPT_HEADER, ACCEPT_HEADER_VALUE);
        }
        if (!req.headers.has(CONTENT_TYPE_HEADER)) {
          const detectedType = req.detectContentTypeHeader();
          if (detectedType !== null) {
            xhr.setRequestHeader(CONTENT_TYPE_HEADER, detectedType);
          }
        }
        if (req.responseType) {
          const responseType = req.responseType.toLowerCase();
          xhr.responseType = responseType !== "json" ? responseType : "text";
        }
        const reqBody = req.serializeBody();
        let headerResponse = null;
        const partialFromXhr = () => {
          if (headerResponse !== null) {
            return headerResponse;
          }
          const statusText = xhr.statusText || "OK";
          const headers = new HttpHeaders(xhr.getAllResponseHeaders());
          const url = getResponseUrl(xhr) || req.url;
          headerResponse = new HttpHeaderResponse({
            headers,
            status: xhr.status,
            statusText,
            url
          });
          return headerResponse;
        };
        const onLoad = () => {
          let {
            headers,
            status,
            statusText,
            url
          } = partialFromXhr();
          let body = null;
          if (status !== HTTP_STATUS_CODE_NO_CONTENT) {
            body = typeof xhr.response === "undefined" ? xhr.responseText : xhr.response;
          }
          if (status === 0) {
            status = !!body ? HTTP_STATUS_CODE_OK : 0;
          }
          let ok = status >= 200 && status < 300;
          if (req.responseType === "json" && typeof body === "string") {
            const originalBody = body;
            body = body.replace(XSSI_PREFIX, "");
            try {
              body = body !== "" ? JSON.parse(body) : null;
            } catch (error) {
              body = originalBody;
              if (ok) {
                ok = false;
                body = {
                  error,
                  text: body
                };
              }
            }
          }
          if (ok) {
            observer.next(new HttpResponse({
              body,
              headers,
              status,
              statusText,
              url: url || void 0
            }));
            observer.complete();
          } else {
            observer.error(new HttpErrorResponse({
              // The error in this case is the response body (error from the server).
              error: body,
              headers,
              status,
              statusText,
              url: url || void 0
            }));
          }
        };
        const onError = (error) => {
          const {
            url
          } = partialFromXhr();
          const res = new HttpErrorResponse({
            error,
            status: xhr.status || 0,
            statusText: xhr.statusText || "Unknown Error",
            url: url || void 0
          });
          observer.error(res);
        };
        let sentHeaders = false;
        const onDownProgress = (event) => {
          if (!sentHeaders) {
            observer.next(partialFromXhr());
            sentHeaders = true;
          }
          let progressEvent = {
            type: HttpEventType.DownloadProgress,
            loaded: event.loaded
          };
          if (event.lengthComputable) {
            progressEvent.total = event.total;
          }
          if (req.responseType === "text" && !!xhr.responseText) {
            progressEvent.partialText = xhr.responseText;
          }
          observer.next(progressEvent);
        };
        const onUpProgress = (event) => {
          let progress = {
            type: HttpEventType.UploadProgress,
            loaded: event.loaded
          };
          if (event.lengthComputable) {
            progress.total = event.total;
          }
          observer.next(progress);
        };
        xhr.addEventListener("load", onLoad);
        xhr.addEventListener("error", onError);
        xhr.addEventListener("timeout", onError);
        xhr.addEventListener("abort", onError);
        if (req.reportProgress) {
          xhr.addEventListener("progress", onDownProgress);
          if (reqBody !== null && xhr.upload) {
            xhr.upload.addEventListener("progress", onUpProgress);
          }
        }
        xhr.send(reqBody);
        observer.next({
          type: HttpEventType.Sent
        });
        return () => {
          xhr.removeEventListener("error", onError);
          xhr.removeEventListener("abort", onError);
          xhr.removeEventListener("load", onLoad);
          xhr.removeEventListener("timeout", onError);
          if (req.reportProgress) {
            xhr.removeEventListener("progress", onDownProgress);
            if (reqBody !== null && xhr.upload) {
              xhr.upload.removeEventListener("progress", onUpProgress);
            }
          }
          if (xhr.readyState !== xhr.DONE) {
            xhr.abort();
          }
        };
      });
    }));
  }
  static \u0275fac = function HttpXhrBackend_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpXhrBackend)(\u0275\u0275inject(XhrFactory));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HttpXhrBackend,
    factory: _HttpXhrBackend.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXhrBackend, [{
    type: Injectable
  }], () => [{
    type: XhrFactory
  }], null);
})();
var XSRF_ENABLED = new InjectionToken(ngDevMode ? "XSRF_ENABLED" : "");
var XSRF_DEFAULT_COOKIE_NAME = "XSRF-TOKEN";
var XSRF_COOKIE_NAME = new InjectionToken(ngDevMode ? "XSRF_COOKIE_NAME" : "", {
  providedIn: "root",
  factory: () => XSRF_DEFAULT_COOKIE_NAME
});
var XSRF_DEFAULT_HEADER_NAME = "X-XSRF-TOKEN";
var XSRF_HEADER_NAME = new InjectionToken(ngDevMode ? "XSRF_HEADER_NAME" : "", {
  providedIn: "root",
  factory: () => XSRF_DEFAULT_HEADER_NAME
});
var HttpXsrfTokenExtractor = class {
};
var HttpXsrfCookieExtractor = class _HttpXsrfCookieExtractor {
  doc;
  platform;
  cookieName;
  lastCookieString = "";
  lastToken = null;
  /**
   * @internal for testing
   */
  parseCount = 0;
  constructor(doc, platform, cookieName) {
    this.doc = doc;
    this.platform = platform;
    this.cookieName = cookieName;
  }
  getToken() {
    if (this.platform === "server") {
      return null;
    }
    const cookieString = this.doc.cookie || "";
    if (cookieString !== this.lastCookieString) {
      this.parseCount++;
      this.lastToken = parseCookieValue(cookieString, this.cookieName);
      this.lastCookieString = cookieString;
    }
    return this.lastToken;
  }
  static \u0275fac = function HttpXsrfCookieExtractor_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpXsrfCookieExtractor)(\u0275\u0275inject(DOCUMENT), \u0275\u0275inject(PLATFORM_ID), \u0275\u0275inject(XSRF_COOKIE_NAME));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HttpXsrfCookieExtractor,
    factory: _HttpXsrfCookieExtractor.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXsrfCookieExtractor, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [XSRF_COOKIE_NAME]
    }]
  }], null);
})();
function xsrfInterceptorFn(req, next) {
  const lcUrl = req.url.toLowerCase();
  if (!inject(XSRF_ENABLED) || req.method === "GET" || req.method === "HEAD" || lcUrl.startsWith("http://") || lcUrl.startsWith("https://")) {
    return next(req);
  }
  const token = inject(HttpXsrfTokenExtractor).getToken();
  const headerName = inject(XSRF_HEADER_NAME);
  if (token != null && !req.headers.has(headerName)) {
    req = req.clone({
      headers: req.headers.set(headerName, token)
    });
  }
  return next(req);
}
var HttpXsrfInterceptor = class _HttpXsrfInterceptor {
  injector;
  constructor(injector) {
    this.injector = injector;
  }
  intercept(initialRequest, next) {
    return runInInjectionContext(this.injector, () => xsrfInterceptorFn(initialRequest, (downstreamRequest) => next.handle(downstreamRequest)));
  }
  static \u0275fac = function HttpXsrfInterceptor_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpXsrfInterceptor)(\u0275\u0275inject(EnvironmentInjector));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HttpXsrfInterceptor,
    factory: _HttpXsrfInterceptor.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpXsrfInterceptor, [{
    type: Injectable
  }], () => [{
    type: EnvironmentInjector
  }], null);
})();
var HttpFeatureKind;
(function(HttpFeatureKind2) {
  HttpFeatureKind2[HttpFeatureKind2["Interceptors"] = 0] = "Interceptors";
  HttpFeatureKind2[HttpFeatureKind2["LegacyInterceptors"] = 1] = "LegacyInterceptors";
  HttpFeatureKind2[HttpFeatureKind2["CustomXsrfConfiguration"] = 2] = "CustomXsrfConfiguration";
  HttpFeatureKind2[HttpFeatureKind2["NoXsrfProtection"] = 3] = "NoXsrfProtection";
  HttpFeatureKind2[HttpFeatureKind2["JsonpSupport"] = 4] = "JsonpSupport";
  HttpFeatureKind2[HttpFeatureKind2["RequestsMadeViaParent"] = 5] = "RequestsMadeViaParent";
  HttpFeatureKind2[HttpFeatureKind2["Fetch"] = 6] = "Fetch";
})(HttpFeatureKind || (HttpFeatureKind = {}));
function makeHttpFeature(kind, providers) {
  return {
    \u0275kind: kind,
    \u0275providers: providers
  };
}
function provideHttpClient(...features) {
  if (ngDevMode) {
    const featureKinds = new Set(features.map((f) => f.\u0275kind));
    if (featureKinds.has(HttpFeatureKind.NoXsrfProtection) && featureKinds.has(HttpFeatureKind.CustomXsrfConfiguration)) {
      throw new Error(ngDevMode ? `Configuration error: found both withXsrfConfiguration() and withNoXsrfProtection() in the same call to provideHttpClient(), which is a contradiction.` : "");
    }
  }
  const providers = [HttpClient, HttpXhrBackend, HttpInterceptorHandler, {
    provide: HttpHandler,
    useExisting: HttpInterceptorHandler
  }, {
    provide: HttpBackend,
    useFactory: () => {
      return inject(FETCH_BACKEND, {
        optional: true
      }) ?? inject(HttpXhrBackend);
    }
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useValue: xsrfInterceptorFn,
    multi: true
  }, {
    provide: XSRF_ENABLED,
    useValue: true
  }, {
    provide: HttpXsrfTokenExtractor,
    useClass: HttpXsrfCookieExtractor
  }];
  for (const feature of features) {
    providers.push(...feature.\u0275providers);
  }
  return makeEnvironmentProviders(providers);
}
var LEGACY_INTERCEPTOR_FN = new InjectionToken(ngDevMode ? "LEGACY_INTERCEPTOR_FN" : "");
function withInterceptorsFromDi() {
  return makeHttpFeature(HttpFeatureKind.LegacyInterceptors, [{
    provide: LEGACY_INTERCEPTOR_FN,
    useFactory: legacyInterceptorFnFactory
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useExisting: LEGACY_INTERCEPTOR_FN,
    multi: true
  }]);
}
function withXsrfConfiguration({
  cookieName,
  headerName
}) {
  const providers = [];
  if (cookieName !== void 0) {
    providers.push({
      provide: XSRF_COOKIE_NAME,
      useValue: cookieName
    });
  }
  if (headerName !== void 0) {
    providers.push({
      provide: XSRF_HEADER_NAME,
      useValue: headerName
    });
  }
  return makeHttpFeature(HttpFeatureKind.CustomXsrfConfiguration, providers);
}
function withNoXsrfProtection() {
  return makeHttpFeature(HttpFeatureKind.NoXsrfProtection, [{
    provide: XSRF_ENABLED,
    useValue: false
  }]);
}
function withJsonpSupport() {
  return makeHttpFeature(HttpFeatureKind.JsonpSupport, [JsonpClientBackend, {
    provide: JsonpCallbackContext,
    useFactory: jsonpCallbackContext
  }, {
    provide: HTTP_INTERCEPTOR_FNS,
    useValue: jsonpInterceptorFn,
    multi: true
  }]);
}
function withFetch() {
  return makeHttpFeature(HttpFeatureKind.Fetch, [FetchBackend, {
    provide: FETCH_BACKEND,
    useExisting: FetchBackend
  }, {
    provide: HttpBackend,
    useExisting: FetchBackend
  }]);
}
var HttpClientXsrfModule = class _HttpClientXsrfModule {
  /**
   * Disable the default XSRF protection.
   */
  static disable() {
    return {
      ngModule: _HttpClientXsrfModule,
      providers: [withNoXsrfProtection().\u0275providers]
    };
  }
  /**
   * Configure XSRF protection.
   * @param options An object that can specify either or both
   * cookie name or header name.
   * - Cookie name default is `XSRF-TOKEN`.
   * - Header name default is `X-XSRF-TOKEN`.
   *
   */
  static withOptions(options = {}) {
    return {
      ngModule: _HttpClientXsrfModule,
      providers: withXsrfConfiguration(options).\u0275providers
    };
  }
  static \u0275fac = function HttpClientXsrfModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpClientXsrfModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _HttpClientXsrfModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({
    providers: [HttpXsrfInterceptor, {
      provide: HTTP_INTERCEPTORS,
      useExisting: HttpXsrfInterceptor,
      multi: true
    }, {
      provide: HttpXsrfTokenExtractor,
      useClass: HttpXsrfCookieExtractor
    }, withXsrfConfiguration({
      cookieName: XSRF_DEFAULT_COOKIE_NAME,
      headerName: XSRF_DEFAULT_HEADER_NAME
    }).\u0275providers, {
      provide: XSRF_ENABLED,
      useValue: true
    }]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientXsrfModule, [{
    type: NgModule,
    args: [{
      providers: [HttpXsrfInterceptor, {
        provide: HTTP_INTERCEPTORS,
        useExisting: HttpXsrfInterceptor,
        multi: true
      }, {
        provide: HttpXsrfTokenExtractor,
        useClass: HttpXsrfCookieExtractor
      }, withXsrfConfiguration({
        cookieName: XSRF_DEFAULT_COOKIE_NAME,
        headerName: XSRF_DEFAULT_HEADER_NAME
      }).\u0275providers, {
        provide: XSRF_ENABLED,
        useValue: true
      }]
    }]
  }], null, null);
})();
var HttpClientModule = class _HttpClientModule {
  static \u0275fac = function HttpClientModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpClientModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _HttpClientModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({
    providers: [provideHttpClient(withInterceptorsFromDi())]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientModule, [{
    type: NgModule,
    args: [{
      /**
       * Configures the dependency injector where it is imported
       * with supporting services for HTTP communications.
       */
      providers: [provideHttpClient(withInterceptorsFromDi())]
    }]
  }], null, null);
})();
var HttpClientJsonpModule = class _HttpClientJsonpModule {
  static \u0275fac = function HttpClientJsonpModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HttpClientJsonpModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _HttpClientJsonpModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({
    providers: [withJsonpSupport().\u0275providers]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HttpClientJsonpModule, [{
    type: NgModule,
    args: [{
      providers: [withJsonpSupport().\u0275providers]
    }]
  }], null, null);
})();
var httpResource = (() => {
  const jsonFn = makeHttpResourceFn("json");
  jsonFn.arrayBuffer = makeHttpResourceFn("arraybuffer");
  jsonFn.blob = makeHttpResourceFn("blob");
  jsonFn.text = makeHttpResourceFn("text");
  return jsonFn;
})();
function makeHttpResourceFn(responseType) {
  return function httpResourceRef(request, options) {
    options?.injector || assertInInjectionContext(httpResource);
    const injector = options?.injector ?? inject(Injector);
    return new HttpResourceImpl(injector, () => normalizeRequest(request, responseType), options?.defaultValue, options?.parse, options?.equal);
  };
}
function normalizeRequest(request, responseType) {
  let unwrappedRequest = typeof request === "function" ? request() : request;
  if (unwrappedRequest === void 0) {
    return void 0;
  } else if (typeof unwrappedRequest === "string") {
    unwrappedRequest = {
      url: unwrappedRequest
    };
  }
  const headers = unwrappedRequest.headers instanceof HttpHeaders ? unwrappedRequest.headers : new HttpHeaders(unwrappedRequest.headers);
  const params = unwrappedRequest.params instanceof HttpParams ? unwrappedRequest.params : new HttpParams({
    fromObject: unwrappedRequest.params
  });
  return new HttpRequest(unwrappedRequest.method ?? "GET", unwrappedRequest.url, unwrappedRequest.body ?? null, {
    headers,
    params,
    reportProgress: unwrappedRequest.reportProgress,
    withCredentials: unwrappedRequest.withCredentials,
    responseType,
    context: unwrappedRequest.context,
    transferCache: unwrappedRequest.transferCache
  });
}
var HttpResourceImpl = class extends ResourceImpl {
  client;
  _headers = linkedSignal({
    source: this.extRequest,
    computation: () => void 0
  });
  _progress = linkedSignal({
    source: this.extRequest,
    computation: () => void 0
  });
  _statusCode = linkedSignal({
    source: this.extRequest,
    computation: () => void 0
  });
  headers = computed(() => this.status() === ResourceStatus.Resolved || this.status() === ResourceStatus.Error ? this._headers() : void 0);
  progress = this._progress.asReadonly();
  statusCode = this._statusCode.asReadonly();
  constructor(injector, request, defaultValue, parse, equal) {
    super(request, ({
      request: request2,
      abortSignal
    }) => {
      let sub;
      const onAbort = () => sub.unsubscribe();
      abortSignal.addEventListener("abort", onAbort);
      const stream = signal({
        value: void 0
      });
      let resolve;
      const promise = new Promise((r) => resolve = r);
      const send = (value) => {
        stream.set(value);
        resolve?.(stream);
        resolve = void 0;
      };
      sub = this.client.request(request2).subscribe({
        next: (event) => {
          switch (event.type) {
            case HttpEventType.Response:
              this._headers.set(event.headers);
              this._statusCode.set(event.status);
              try {
                send({
                  value: parse ? parse(event.body) : event.body
                });
              } catch (error) {
                send({
                  error
                });
              }
              break;
            case HttpEventType.DownloadProgress:
              this._progress.set(event);
              break;
          }
        },
        error: (error) => send({
          error
        }),
        complete: () => {
          if (resolve) {
            send({
              error: new Error("Resource completed before producing a value")
            });
          }
          abortSignal.removeEventListener("abort", onAbort);
        }
      });
      return promise;
    }, defaultValue, equal, injector);
    this.client = injector.get(HttpClient);
  }
};
var HTTP_TRANSFER_CACHE_ORIGIN_MAP = new InjectionToken(ngDevMode ? "HTTP_TRANSFER_CACHE_ORIGIN_MAP" : "");
var BODY = "b";
var HEADERS = "h";
var STATUS = "s";
var STATUS_TEXT = "st";
var REQ_URL = "u";
var RESPONSE_TYPE = "rt";
var CACHE_OPTIONS = new InjectionToken(ngDevMode ? "HTTP_TRANSFER_STATE_CACHE_OPTIONS" : "");
var ALLOWED_METHODS = ["GET", "HEAD"];
function transferCacheInterceptorFn(req, next) {
  const _a = inject(CACHE_OPTIONS), {
    isCacheActive
  } = _a, globalOptions = __objRest(_a, [
    "isCacheActive"
  ]);
  const {
    transferCache: requestOptions,
    method: requestMethod
  } = req;
  if (!isCacheActive || requestOptions === false || // POST requests are allowed either globally or at request level
  requestMethod === "POST" && !globalOptions.includePostRequests && !requestOptions || requestMethod !== "POST" && !ALLOWED_METHODS.includes(requestMethod) || // Do not cache request that require authorization when includeRequestsWithAuthHeaders is falsey
  !globalOptions.includeRequestsWithAuthHeaders && hasAuthHeaders(req) || globalOptions.filter?.(req) === false) {
    return next(req);
  }
  const transferState = inject(TransferState);
  const originMap = inject(HTTP_TRANSFER_CACHE_ORIGIN_MAP, {
    optional: true
  });
  if (originMap) {
    throw new RuntimeError(2803, ngDevMode && "Angular detected that the `HTTP_TRANSFER_CACHE_ORIGIN_MAP` token is configured and present in the client side code. Please ensure that this token is only provided in the server code of the application.");
  }
  const requestUrl = false ? mapRequestOriginUrl(req.url, originMap) : req.url;
  const storeKey = makeCacheKey(req, requestUrl);
  const response = transferState.get(storeKey, null);
  let headersToInclude = globalOptions.includeHeaders;
  if (typeof requestOptions === "object" && requestOptions.includeHeaders) {
    headersToInclude = requestOptions.includeHeaders;
  }
  if (response) {
    const {
      [BODY]: undecodedBody,
      [RESPONSE_TYPE]: responseType,
      [HEADERS]: httpHeaders,
      [STATUS]: status,
      [STATUS_TEXT]: statusText,
      [REQ_URL]: url
    } = response;
    let body = undecodedBody;
    switch (responseType) {
      case "arraybuffer":
        body = new TextEncoder().encode(undecodedBody).buffer;
        break;
      case "blob":
        body = new Blob([undecodedBody]);
        break;
    }
    let headers = new HttpHeaders(httpHeaders);
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      headers = appendMissingHeadersDetection(req.url, headers, headersToInclude ?? []);
    }
    return of(new HttpResponse({
      body,
      headers,
      status,
      statusText,
      url
    }));
  }
  return next(req).pipe(tap((event) => {
    if (event instanceof HttpResponse && true && false) {
      transferState.set(storeKey, {
        [BODY]: event.body,
        [HEADERS]: getFilteredHeaders(event.headers, headersToInclude),
        [STATUS]: event.status,
        [STATUS_TEXT]: event.statusText,
        [REQ_URL]: requestUrl,
        [RESPONSE_TYPE]: req.responseType
      });
    }
  }));
}
function hasAuthHeaders(req) {
  return req.headers.has("authorization") || req.headers.has("proxy-authorization");
}
function sortAndConcatParams(params) {
  return [...params.keys()].sort().map((k) => `${k}=${params.getAll(k)}`).join("&");
}
function makeCacheKey(request, mappedRequestUrl) {
  const {
    params,
    method,
    responseType
  } = request;
  const encodedParams = sortAndConcatParams(params);
  let serializedBody = request.serializeBody();
  if (serializedBody instanceof URLSearchParams) {
    serializedBody = sortAndConcatParams(serializedBody);
  } else if (typeof serializedBody !== "string") {
    serializedBody = "";
  }
  const key = [method, responseType, mappedRequestUrl, serializedBody, encodedParams].join("|");
  const hash = generateHash(key);
  return makeStateKey(hash);
}
function generateHash(value) {
  let hash = 0;
  for (const char of value) {
    hash = Math.imul(31, hash) + char.charCodeAt(0) << 0;
  }
  hash += 2147483647 + 1;
  return hash.toString();
}
function withHttpTransferCache(cacheOptions) {
  return [{
    provide: CACHE_OPTIONS,
    useFactory: () => {
      performanceMarkFeature("NgHttpTransferCache");
      return __spreadValues({
        isCacheActive: true
      }, cacheOptions);
    }
  }, {
    provide: HTTP_ROOT_INTERCEPTOR_FNS,
    useValue: transferCacheInterceptorFn,
    multi: true
  }, {
    provide: APP_BOOTSTRAP_LISTENER,
    multi: true,
    useFactory: () => {
      const appRef = inject(ApplicationRef);
      const cacheState = inject(CACHE_OPTIONS);
      return () => {
        appRef.whenStable().then(() => {
          cacheState.isCacheActive = false;
        });
      };
    }
  }];
}
function appendMissingHeadersDetection(url, headers, headersToInclude) {
  const warningProduced = /* @__PURE__ */ new Set();
  return new Proxy(headers, {
    get(target, prop) {
      const value = Reflect.get(target, prop);
      const methods = /* @__PURE__ */ new Set(["get", "has", "getAll"]);
      if (typeof value !== "function" || !methods.has(prop)) {
        return value;
      }
      return (headerName) => {
        const key = (prop + ":" + headerName).toLowerCase();
        if (!headersToInclude.includes(headerName) && !warningProduced.has(key)) {
          warningProduced.add(key);
          const truncatedUrl = truncateMiddle(url);
          console.warn(formatRuntimeError(2802, `Angular detected that the \`${headerName}\` header is accessed, but the value of the header was not transferred from the server to the client by the HttpTransferCache. To include the value of the \`${headerName}\` header for the \`${truncatedUrl}\` request, use the \`includeHeaders\` list. The \`includeHeaders\` can be defined either on a request level by adding the \`transferCache\` parameter, or on an application level by adding the \`httpCacheTransfer.includeHeaders\` argument to the \`provideClientHydration()\` call. `));
        }
        return value.apply(target, [headerName]);
      };
    }
  });
}

// node_modules/@angular/platform-browser/fesm2022/platform-browser.mjs
var GenericBrowserDomAdapter = class extends DomAdapter {
  supportsDOMEvents = true;
};
var BrowserDomAdapter = class _BrowserDomAdapter extends GenericBrowserDomAdapter {
  static makeCurrent() {
    setRootDomAdapter(new _BrowserDomAdapter());
  }
  onAndCancel(el, evt, listener, options) {
    el.addEventListener(evt, listener, options);
    return () => {
      el.removeEventListener(evt, listener, options);
    };
  }
  dispatchEvent(el, evt) {
    el.dispatchEvent(evt);
  }
  remove(node) {
    node.remove();
  }
  createElement(tagName, doc) {
    doc = doc || this.getDefaultDocument();
    return doc.createElement(tagName);
  }
  createHtmlDocument() {
    return document.implementation.createHTMLDocument("fakeTitle");
  }
  getDefaultDocument() {
    return document;
  }
  isElementNode(node) {
    return node.nodeType === Node.ELEMENT_NODE;
  }
  isShadowRoot(node) {
    return node instanceof DocumentFragment;
  }
  /** @deprecated No longer being used in Ivy code. To be removed in version 14. */
  getGlobalEventTarget(doc, target) {
    if (target === "window") {
      return window;
    }
    if (target === "document") {
      return doc;
    }
    if (target === "body") {
      return doc.body;
    }
    return null;
  }
  getBaseHref(doc) {
    const href = getBaseElementHref();
    return href == null ? null : relativePath(href);
  }
  resetBaseElement() {
    baseElement = null;
  }
  getUserAgent() {
    return window.navigator.userAgent;
  }
  getCookie(name) {
    return parseCookieValue(document.cookie, name);
  }
};
var baseElement = null;
function getBaseElementHref() {
  baseElement = baseElement || document.querySelector("base");
  return baseElement ? baseElement.getAttribute("href") : null;
}
function relativePath(url) {
  return new URL(url, document.baseURI).pathname;
}
var BrowserGetTestability = class {
  addToWindow(registry) {
    _global["getAngularTestability"] = (elem, findInAncestors = true) => {
      const testability = registry.findTestabilityInTree(elem, findInAncestors);
      if (testability == null) {
        throw new RuntimeError(5103, (typeof ngDevMode === "undefined" || ngDevMode) && "Could not find testability for element.");
      }
      return testability;
    };
    _global["getAllAngularTestabilities"] = () => registry.getAllTestabilities();
    _global["getAllAngularRootElements"] = () => registry.getAllRootElements();
    const whenAllStable = (callback) => {
      const testabilities = _global["getAllAngularTestabilities"]();
      let count = testabilities.length;
      const decrement = function() {
        count--;
        if (count == 0) {
          callback();
        }
      };
      testabilities.forEach((testability) => {
        testability.whenStable(decrement);
      });
    };
    if (!_global["frameworkStabilizers"]) {
      _global["frameworkStabilizers"] = [];
    }
    _global["frameworkStabilizers"].push(whenAllStable);
  }
  findTestabilityInTree(registry, elem, findInAncestors) {
    if (elem == null) {
      return null;
    }
    const t = registry.getTestability(elem);
    if (t != null) {
      return t;
    } else if (!findInAncestors) {
      return null;
    }
    if (getDOM().isShadowRoot(elem)) {
      return this.findTestabilityInTree(registry, elem.host, true);
    }
    return this.findTestabilityInTree(registry, elem.parentElement, true);
  }
};
var BrowserXhr = class _BrowserXhr {
  build() {
    return new XMLHttpRequest();
  }
  static \u0275fac = function BrowserXhr_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _BrowserXhr)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _BrowserXhr,
    factory: _BrowserXhr.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserXhr, [{
    type: Injectable
  }], null, null);
})();
var EVENT_MANAGER_PLUGINS = new InjectionToken(ngDevMode ? "EventManagerPlugins" : "");
var EventManager = class _EventManager {
  _zone;
  _plugins;
  _eventNameToPlugin = /* @__PURE__ */ new Map();
  /**
   * Initializes an instance of the event-manager service.
   */
  constructor(plugins, _zone) {
    this._zone = _zone;
    plugins.forEach((plugin) => {
      plugin.manager = this;
    });
    this._plugins = plugins.slice().reverse();
  }
  /**
   * Registers a handler for a specific element and event.
   *
   * @param element The HTML element to receive event notifications.
   * @param eventName The name of the event to listen for.
   * @param handler A function to call when the notification occurs. Receives the
   * event object as an argument.
   * @param options Options that configure how the event listener is bound.
   * @returns  A callback function that can be used to remove the handler.
   */
  addEventListener(element, eventName, handler, options) {
    const plugin = this._findPluginFor(eventName);
    return plugin.addEventListener(element, eventName, handler, options);
  }
  /**
   * Retrieves the compilation zone in which event listeners are registered.
   */
  getZone() {
    return this._zone;
  }
  /** @internal */
  _findPluginFor(eventName) {
    let plugin = this._eventNameToPlugin.get(eventName);
    if (plugin) {
      return plugin;
    }
    const plugins = this._plugins;
    plugin = plugins.find((plugin2) => plugin2.supports(eventName));
    if (!plugin) {
      throw new RuntimeError(5101, (typeof ngDevMode === "undefined" || ngDevMode) && `No event manager plugin found for event ${eventName}`);
    }
    this._eventNameToPlugin.set(eventName, plugin);
    return plugin;
  }
  static \u0275fac = function EventManager_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _EventManager)(\u0275\u0275inject(EVENT_MANAGER_PLUGINS), \u0275\u0275inject(NgZone));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _EventManager,
    factory: _EventManager.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(EventManager, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [EVENT_MANAGER_PLUGINS]
    }]
  }, {
    type: NgZone
  }], null);
})();
var EventManagerPlugin = class {
  _doc;
  // TODO: remove (has some usage in G3)
  constructor(_doc) {
    this._doc = _doc;
  }
  // Using non-null assertion because it's set by EventManager's constructor
  manager;
};
var APP_ID_ATTRIBUTE_NAME = "ng-app-id";
function removeElements(elements) {
  for (const element of elements) {
    element.remove();
  }
}
function createStyleElement(style, doc) {
  const styleElement = doc.createElement("style");
  styleElement.textContent = style;
  return styleElement;
}
function addServerStyles(doc, appId, inline, external) {
  const elements = doc.head?.querySelectorAll(`style[${APP_ID_ATTRIBUTE_NAME}="${appId}"],link[${APP_ID_ATTRIBUTE_NAME}="${appId}"]`);
  if (elements) {
    for (const styleElement of elements) {
      styleElement.removeAttribute(APP_ID_ATTRIBUTE_NAME);
      if (styleElement instanceof HTMLLinkElement) {
        external.set(styleElement.href.slice(styleElement.href.lastIndexOf("/") + 1), {
          usage: 0,
          elements: [styleElement]
        });
      } else if (styleElement.textContent) {
        inline.set(styleElement.textContent, {
          usage: 0,
          elements: [styleElement]
        });
      }
    }
  }
}
function createLinkElement(url, doc) {
  const linkElement = doc.createElement("link");
  linkElement.setAttribute("rel", "stylesheet");
  linkElement.setAttribute("href", url);
  return linkElement;
}
var SharedStylesHost = class _SharedStylesHost {
  doc;
  appId;
  nonce;
  /**
   * Provides usage information for active inline style content and associated HTML <style> elements.
   * Embedded styles typically originate from the `styles` metadata of a rendered component.
   */
  inline = /* @__PURE__ */ new Map();
  /**
   * Provides usage information for active external style URLs and the associated HTML <link> elements.
   * External styles typically originate from the `ɵɵExternalStylesFeature` of a rendered component.
   */
  external = /* @__PURE__ */ new Map();
  /**
   * Set of host DOM nodes that will have styles attached.
   */
  hosts = /* @__PURE__ */ new Set();
  /**
   * Whether the application code is currently executing on a server.
   */
  isServer;
  constructor(doc, appId, nonce, platformId = {}) {
    this.doc = doc;
    this.appId = appId;
    this.nonce = nonce;
    this.isServer = isPlatformServer(platformId);
    addServerStyles(doc, appId, this.inline, this.external);
    this.hosts.add(doc.head);
  }
  /**
   * Adds embedded styles to the DOM via HTML `style` elements.
   * @param styles An array of style content strings.
   */
  addStyles(styles, urls) {
    for (const value of styles) {
      this.addUsage(value, this.inline, createStyleElement);
    }
    urls?.forEach((value) => this.addUsage(value, this.external, createLinkElement));
  }
  /**
   * Removes embedded styles from the DOM that were added as HTML `style` elements.
   * @param styles An array of style content strings.
   */
  removeStyles(styles, urls) {
    for (const value of styles) {
      this.removeUsage(value, this.inline);
    }
    urls?.forEach((value) => this.removeUsage(value, this.external));
  }
  addUsage(value, usages, creator) {
    const record = usages.get(value);
    if (record) {
      if ((typeof ngDevMode === "undefined" || ngDevMode) && record.usage === 0) {
        record.elements.forEach((element) => element.setAttribute("ng-style-reused", ""));
      }
      record.usage++;
    } else {
      usages.set(value, {
        usage: 1,
        elements: [...this.hosts].map((host) => this.addElement(host, creator(value, this.doc)))
      });
    }
  }
  removeUsage(value, usages) {
    const record = usages.get(value);
    if (record) {
      record.usage--;
      if (record.usage <= 0) {
        removeElements(record.elements);
        usages.delete(value);
      }
    }
  }
  ngOnDestroy() {
    for (const [, {
      elements
    }] of [...this.inline, ...this.external]) {
      removeElements(elements);
    }
    this.hosts.clear();
  }
  /**
   * Adds a host node to the set of style hosts and adds all existing style usage to
   * the newly added host node.
   *
   * This is currently only used for Shadow DOM encapsulation mode.
   */
  addHost(hostNode) {
    this.hosts.add(hostNode);
    for (const [style, {
      elements
    }] of this.inline) {
      elements.push(this.addElement(hostNode, createStyleElement(style, this.doc)));
    }
    for (const [url, {
      elements
    }] of this.external) {
      elements.push(this.addElement(hostNode, createLinkElement(url, this.doc)));
    }
  }
  removeHost(hostNode) {
    this.hosts.delete(hostNode);
  }
  addElement(host, element) {
    if (this.nonce) {
      element.setAttribute("nonce", this.nonce);
    }
    if (this.isServer) {
      element.setAttribute(APP_ID_ATTRIBUTE_NAME, this.appId);
    }
    return host.appendChild(element);
  }
  static \u0275fac = function SharedStylesHost_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _SharedStylesHost)(\u0275\u0275inject(DOCUMENT), \u0275\u0275inject(APP_ID), \u0275\u0275inject(CSP_NONCE, 8), \u0275\u0275inject(PLATFORM_ID));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _SharedStylesHost,
    factory: _SharedStylesHost.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(SharedStylesHost, [{
    type: Injectable
  }], () => [{
    type: Document,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [APP_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [CSP_NONCE]
    }, {
      type: Optional
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }], null);
})();
var NAMESPACE_URIS = {
  "svg": "http://www.w3.org/2000/svg",
  "xhtml": "http://www.w3.org/1999/xhtml",
  "xlink": "http://www.w3.org/1999/xlink",
  "xml": "http://www.w3.org/XML/1998/namespace",
  "xmlns": "http://www.w3.org/2000/xmlns/",
  "math": "http://www.w3.org/1998/Math/MathML"
};
var COMPONENT_REGEX = /%COMP%/g;
var SOURCEMAP_URL_REGEXP = /\/\*#\s*sourceMappingURL=(.+?)\s*\*\//;
var PROTOCOL_REGEXP = /^https?:/;
var COMPONENT_VARIABLE = "%COMP%";
var HOST_ATTR = `_nghost-${COMPONENT_VARIABLE}`;
var CONTENT_ATTR = `_ngcontent-${COMPONENT_VARIABLE}`;
var REMOVE_STYLES_ON_COMPONENT_DESTROY_DEFAULT = true;
var REMOVE_STYLES_ON_COMPONENT_DESTROY = new InjectionToken(ngDevMode ? "RemoveStylesOnCompDestroy" : "", {
  providedIn: "root",
  factory: () => REMOVE_STYLES_ON_COMPONENT_DESTROY_DEFAULT
});
function shimContentAttribute(componentShortId) {
  return CONTENT_ATTR.replace(COMPONENT_REGEX, componentShortId);
}
function shimHostAttribute(componentShortId) {
  return HOST_ATTR.replace(COMPONENT_REGEX, componentShortId);
}
function shimStylesContent(compId, styles) {
  return styles.map((s) => s.replace(COMPONENT_REGEX, compId));
}
function addBaseHrefToCssSourceMap(baseHref, styles) {
  if (!baseHref) {
    return styles;
  }
  const absoluteBaseHrefUrl = new URL(baseHref, "http://localhost");
  return styles.map((cssContent) => {
    if (!cssContent.includes("sourceMappingURL=")) {
      return cssContent;
    }
    return cssContent.replace(SOURCEMAP_URL_REGEXP, (_, sourceMapUrl) => {
      if (sourceMapUrl[0] === "/" || sourceMapUrl.startsWith("data:") || PROTOCOL_REGEXP.test(sourceMapUrl)) {
        return `/*# sourceMappingURL=${sourceMapUrl} */`;
      }
      const {
        pathname: resolvedSourceMapUrl
      } = new URL(sourceMapUrl, absoluteBaseHrefUrl);
      return `/*# sourceMappingURL=${resolvedSourceMapUrl} */`;
    });
  });
}
var DomRendererFactory2 = class _DomRendererFactory2 {
  eventManager;
  sharedStylesHost;
  appId;
  removeStylesOnCompDestroy;
  doc;
  platformId;
  ngZone;
  nonce;
  tracingService;
  rendererByCompId = /* @__PURE__ */ new Map();
  defaultRenderer;
  platformIsServer;
  constructor(eventManager, sharedStylesHost, appId, removeStylesOnCompDestroy, doc, platformId, ngZone, nonce = null, tracingService = null) {
    this.eventManager = eventManager;
    this.sharedStylesHost = sharedStylesHost;
    this.appId = appId;
    this.removeStylesOnCompDestroy = removeStylesOnCompDestroy;
    this.doc = doc;
    this.platformId = platformId;
    this.ngZone = ngZone;
    this.nonce = nonce;
    this.tracingService = tracingService;
    this.platformIsServer = isPlatformServer(platformId);
    this.defaultRenderer = new DefaultDomRenderer2(eventManager, doc, ngZone, this.platformIsServer, this.tracingService);
  }
  createRenderer(element, type) {
    if (!element || !type) {
      return this.defaultRenderer;
    }
    if (this.platformIsServer && type.encapsulation === ViewEncapsulation.ShadowDom) {
      type = __spreadProps(__spreadValues({}, type), {
        encapsulation: ViewEncapsulation.Emulated
      });
    }
    const renderer = this.getOrCreateRenderer(element, type);
    if (renderer instanceof EmulatedEncapsulationDomRenderer2) {
      renderer.applyToHost(element);
    } else if (renderer instanceof NoneEncapsulationDomRenderer) {
      renderer.applyStyles();
    }
    return renderer;
  }
  getOrCreateRenderer(element, type) {
    const rendererByCompId = this.rendererByCompId;
    let renderer = rendererByCompId.get(type.id);
    if (!renderer) {
      const doc = this.doc;
      const ngZone = this.ngZone;
      const eventManager = this.eventManager;
      const sharedStylesHost = this.sharedStylesHost;
      const removeStylesOnCompDestroy = this.removeStylesOnCompDestroy;
      const platformIsServer = this.platformIsServer;
      const tracingService = this.tracingService;
      switch (type.encapsulation) {
        case ViewEncapsulation.Emulated:
          renderer = new EmulatedEncapsulationDomRenderer2(eventManager, sharedStylesHost, type, this.appId, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, tracingService);
          break;
        case ViewEncapsulation.ShadowDom:
          return new ShadowDomRenderer(eventManager, sharedStylesHost, element, type, doc, ngZone, this.nonce, platformIsServer, tracingService);
        default:
          renderer = new NoneEncapsulationDomRenderer(eventManager, sharedStylesHost, type, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, tracingService);
          break;
      }
      rendererByCompId.set(type.id, renderer);
    }
    return renderer;
  }
  ngOnDestroy() {
    this.rendererByCompId.clear();
  }
  /**
   * Used during HMR to clear any cached data about a component.
   * @param componentId ID of the component that is being replaced.
   */
  componentReplaced(componentId) {
    this.rendererByCompId.delete(componentId);
  }
  static \u0275fac = function DomRendererFactory2_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DomRendererFactory2)(\u0275\u0275inject(EventManager), \u0275\u0275inject(SharedStylesHost), \u0275\u0275inject(APP_ID), \u0275\u0275inject(REMOVE_STYLES_ON_COMPONENT_DESTROY), \u0275\u0275inject(DOCUMENT), \u0275\u0275inject(PLATFORM_ID), \u0275\u0275inject(NgZone), \u0275\u0275inject(CSP_NONCE), \u0275\u0275inject(TracingService, 8));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DomRendererFactory2,
    factory: _DomRendererFactory2.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomRendererFactory2, [{
    type: Injectable
  }], () => [{
    type: EventManager
  }, {
    type: SharedStylesHost
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [APP_ID]
    }]
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [REMOVE_STYLES_ON_COMPONENT_DESTROY]
    }]
  }, {
    type: Document,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: Object,
    decorators: [{
      type: Inject,
      args: [PLATFORM_ID]
    }]
  }, {
    type: NgZone
  }, {
    type: void 0,
    decorators: [{
      type: Inject,
      args: [CSP_NONCE]
    }]
  }, {
    type: TracingService,
    decorators: [{
      type: Inject,
      args: [TracingService]
    }, {
      type: Optional
    }]
  }], null);
})();
var DefaultDomRenderer2 = class {
  eventManager;
  doc;
  ngZone;
  platformIsServer;
  tracingService;
  data = /* @__PURE__ */ Object.create(null);
  /**
   * By default this renderer throws when encountering synthetic properties
   * This can be disabled for example by the AsyncAnimationRendererFactory
   */
  throwOnSyntheticProps = true;
  constructor(eventManager, doc, ngZone, platformIsServer, tracingService) {
    this.eventManager = eventManager;
    this.doc = doc;
    this.ngZone = ngZone;
    this.platformIsServer = platformIsServer;
    this.tracingService = tracingService;
  }
  destroy() {
  }
  destroyNode = null;
  createElement(name, namespace) {
    if (namespace) {
      return this.doc.createElementNS(NAMESPACE_URIS[namespace] || namespace, name);
    }
    return this.doc.createElement(name);
  }
  createComment(value) {
    return this.doc.createComment(value);
  }
  createText(value) {
    return this.doc.createTextNode(value);
  }
  appendChild(parent, newChild) {
    const targetParent = isTemplateNode(parent) ? parent.content : parent;
    targetParent.appendChild(newChild);
  }
  insertBefore(parent, newChild, refChild) {
    if (parent) {
      const targetParent = isTemplateNode(parent) ? parent.content : parent;
      targetParent.insertBefore(newChild, refChild);
    }
  }
  removeChild(_parent, oldChild) {
    oldChild.remove();
  }
  selectRootElement(selectorOrNode, preserveContent) {
    let el = typeof selectorOrNode === "string" ? this.doc.querySelector(selectorOrNode) : selectorOrNode;
    if (!el) {
      throw new RuntimeError(-5104, (typeof ngDevMode === "undefined" || ngDevMode) && `The selector "${selectorOrNode}" did not match any elements`);
    }
    if (!preserveContent) {
      el.textContent = "";
    }
    return el;
  }
  parentNode(node) {
    return node.parentNode;
  }
  nextSibling(node) {
    return node.nextSibling;
  }
  setAttribute(el, name, value, namespace) {
    if (namespace) {
      name = namespace + ":" + name;
      const namespaceUri = NAMESPACE_URIS[namespace];
      if (namespaceUri) {
        el.setAttributeNS(namespaceUri, name, value);
      } else {
        el.setAttribute(name, value);
      }
    } else {
      el.setAttribute(name, value);
    }
  }
  removeAttribute(el, name, namespace) {
    if (namespace) {
      const namespaceUri = NAMESPACE_URIS[namespace];
      if (namespaceUri) {
        el.removeAttributeNS(namespaceUri, name);
      } else {
        el.removeAttribute(`${namespace}:${name}`);
      }
    } else {
      el.removeAttribute(name);
    }
  }
  addClass(el, name) {
    el.classList.add(name);
  }
  removeClass(el, name) {
    el.classList.remove(name);
  }
  setStyle(el, style, value, flags) {
    if (flags & (RendererStyleFlags2.DashCase | RendererStyleFlags2.Important)) {
      el.style.setProperty(style, value, flags & RendererStyleFlags2.Important ? "important" : "");
    } else {
      el.style[style] = value;
    }
  }
  removeStyle(el, style, flags) {
    if (flags & RendererStyleFlags2.DashCase) {
      el.style.removeProperty(style);
    } else {
      el.style[style] = "";
    }
  }
  setProperty(el, name, value) {
    if (el == null) {
      return;
    }
    (typeof ngDevMode === "undefined" || ngDevMode) && this.throwOnSyntheticProps && checkNoSyntheticProp(name, "property");
    el[name] = value;
  }
  setValue(node, value) {
    node.nodeValue = value;
  }
  listen(target, event, callback, options) {
    (typeof ngDevMode === "undefined" || ngDevMode) && this.throwOnSyntheticProps && checkNoSyntheticProp(event, "listener");
    if (typeof target === "string") {
      target = getDOM().getGlobalEventTarget(this.doc, target);
      if (!target) {
        throw new RuntimeError(5102, (typeof ngDevMode === "undefined" || ngDevMode) && `Unsupported event target ${target} for event ${event}`);
      }
    }
    let wrappedCallback = this.decoratePreventDefault(callback);
    if (this.tracingService?.wrapEventListener) {
      wrappedCallback = this.tracingService.wrapEventListener(target, event, wrappedCallback);
    }
    return this.eventManager.addEventListener(target, event, wrappedCallback, options);
  }
  decoratePreventDefault(eventHandler) {
    return (event) => {
      if (event === "__ngUnwrap__") {
        return eventHandler;
      }
      const allowDefaultBehavior = this.platformIsServer ? this.ngZone.runGuarded(() => eventHandler(event)) : eventHandler(event);
      if (allowDefaultBehavior === false) {
        event.preventDefault();
      }
      return void 0;
    };
  }
};
var AT_CHARCODE = (() => "@".charCodeAt(0))();
function checkNoSyntheticProp(name, nameKind) {
  if (name.charCodeAt(0) === AT_CHARCODE) {
    throw new RuntimeError(5105, `Unexpected synthetic ${nameKind} ${name} found. Please make sure that:
  - Make sure \`provideAnimationsAsync()\`, \`provideAnimations()\` or \`provideNoopAnimations()\` call was added to a list of providers used to bootstrap an application.
  - There is a corresponding animation configuration named \`${name}\` defined in the \`animations\` field of the \`@Component\` decorator (see https://angular.dev/api/core/Component#animations).`);
  }
}
function isTemplateNode(node) {
  return node.tagName === "TEMPLATE" && node.content !== void 0;
}
var ShadowDomRenderer = class extends DefaultDomRenderer2 {
  sharedStylesHost;
  hostEl;
  shadowRoot;
  constructor(eventManager, sharedStylesHost, hostEl, component, doc, ngZone, nonce, platformIsServer, tracingService) {
    super(eventManager, doc, ngZone, platformIsServer, tracingService);
    this.sharedStylesHost = sharedStylesHost;
    this.hostEl = hostEl;
    this.shadowRoot = hostEl.attachShadow({
      mode: "open"
    });
    this.sharedStylesHost.addHost(this.shadowRoot);
    let styles = component.styles;
    if (ngDevMode) {
      const baseHref = getDOM().getBaseHref(doc) ?? "";
      styles = addBaseHrefToCssSourceMap(baseHref, styles);
    }
    styles = shimStylesContent(component.id, styles);
    for (const style of styles) {
      const styleEl = document.createElement("style");
      if (nonce) {
        styleEl.setAttribute("nonce", nonce);
      }
      styleEl.textContent = style;
      this.shadowRoot.appendChild(styleEl);
    }
    const styleUrls = component.getExternalStyles?.();
    if (styleUrls) {
      for (const styleUrl of styleUrls) {
        const linkEl = createLinkElement(styleUrl, doc);
        if (nonce) {
          linkEl.setAttribute("nonce", nonce);
        }
        this.shadowRoot.appendChild(linkEl);
      }
    }
  }
  nodeOrShadowRoot(node) {
    return node === this.hostEl ? this.shadowRoot : node;
  }
  appendChild(parent, newChild) {
    return super.appendChild(this.nodeOrShadowRoot(parent), newChild);
  }
  insertBefore(parent, newChild, refChild) {
    return super.insertBefore(this.nodeOrShadowRoot(parent), newChild, refChild);
  }
  removeChild(_parent, oldChild) {
    return super.removeChild(null, oldChild);
  }
  parentNode(node) {
    return this.nodeOrShadowRoot(super.parentNode(this.nodeOrShadowRoot(node)));
  }
  destroy() {
    this.sharedStylesHost.removeHost(this.shadowRoot);
  }
};
var NoneEncapsulationDomRenderer = class extends DefaultDomRenderer2 {
  sharedStylesHost;
  removeStylesOnCompDestroy;
  styles;
  styleUrls;
  constructor(eventManager, sharedStylesHost, component, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, tracingService, compId) {
    super(eventManager, doc, ngZone, platformIsServer, tracingService);
    this.sharedStylesHost = sharedStylesHost;
    this.removeStylesOnCompDestroy = removeStylesOnCompDestroy;
    let styles = component.styles;
    if (ngDevMode) {
      const baseHref = getDOM().getBaseHref(doc) ?? "";
      styles = addBaseHrefToCssSourceMap(baseHref, styles);
    }
    this.styles = compId ? shimStylesContent(compId, styles) : styles;
    this.styleUrls = component.getExternalStyles?.(compId);
  }
  applyStyles() {
    this.sharedStylesHost.addStyles(this.styles, this.styleUrls);
  }
  destroy() {
    if (!this.removeStylesOnCompDestroy) {
      return;
    }
    this.sharedStylesHost.removeStyles(this.styles, this.styleUrls);
  }
};
var EmulatedEncapsulationDomRenderer2 = class extends NoneEncapsulationDomRenderer {
  contentAttr;
  hostAttr;
  constructor(eventManager, sharedStylesHost, component, appId, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, tracingService) {
    const compId = appId + "-" + component.id;
    super(eventManager, sharedStylesHost, component, removeStylesOnCompDestroy, doc, ngZone, platformIsServer, tracingService, compId);
    this.contentAttr = shimContentAttribute(compId);
    this.hostAttr = shimHostAttribute(compId);
  }
  applyToHost(element) {
    this.applyStyles();
    this.setAttribute(element, this.hostAttr, "");
  }
  createElement(parent, name) {
    const el = super.createElement(parent, name);
    super.setAttribute(el, this.contentAttr, "");
    return el;
  }
};
var DomEventsPlugin = class _DomEventsPlugin extends EventManagerPlugin {
  constructor(doc) {
    super(doc);
  }
  // This plugin should come last in the list of plugins, because it accepts all
  // events.
  supports(eventName) {
    return true;
  }
  addEventListener(element, eventName, handler, options) {
    element.addEventListener(eventName, handler, options);
    return () => this.removeEventListener(element, eventName, handler, options);
  }
  removeEventListener(target, eventName, callback, options) {
    return target.removeEventListener(eventName, callback, options);
  }
  static \u0275fac = function DomEventsPlugin_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DomEventsPlugin)(\u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DomEventsPlugin,
    factory: _DomEventsPlugin.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomEventsPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var MODIFIER_KEYS = ["alt", "control", "meta", "shift"];
var _keyMap = {
  "\b": "Backspace",
  "	": "Tab",
  "\x7F": "Delete",
  "\x1B": "Escape",
  "Del": "Delete",
  "Esc": "Escape",
  "Left": "ArrowLeft",
  "Right": "ArrowRight",
  "Up": "ArrowUp",
  "Down": "ArrowDown",
  "Menu": "ContextMenu",
  "Scroll": "ScrollLock",
  "Win": "OS"
};
var MODIFIER_KEY_GETTERS = {
  "alt": (event) => event.altKey,
  "control": (event) => event.ctrlKey,
  "meta": (event) => event.metaKey,
  "shift": (event) => event.shiftKey
};
var KeyEventsPlugin = class _KeyEventsPlugin extends EventManagerPlugin {
  /**
   * Initializes an instance of the browser plug-in.
   * @param doc The document in which key events will be detected.
   */
  constructor(doc) {
    super(doc);
  }
  /**
   * Reports whether a named key event is supported.
   * @param eventName The event name to query.
   * @return True if the named key event is supported.
   */
  supports(eventName) {
    return _KeyEventsPlugin.parseEventName(eventName) != null;
  }
  /**
   * Registers a handler for a specific element and key event.
   * @param element The HTML element to receive event notifications.
   * @param eventName The name of the key event to listen for.
   * @param handler A function to call when the notification occurs. Receives the
   * event object as an argument.
   * @returns The key event that was registered.
   */
  addEventListener(element, eventName, handler, options) {
    const parsedEvent = _KeyEventsPlugin.parseEventName(eventName);
    const outsideHandler = _KeyEventsPlugin.eventCallback(parsedEvent["fullKey"], handler, this.manager.getZone());
    return this.manager.getZone().runOutsideAngular(() => {
      return getDOM().onAndCancel(element, parsedEvent["domEventName"], outsideHandler, options);
    });
  }
  /**
   * Parses the user provided full keyboard event definition and normalizes it for
   * later internal use. It ensures the string is all lowercase, converts special
   * characters to a standard spelling, and orders all the values consistently.
   *
   * @param eventName The name of the key event to listen for.
   * @returns an object with the full, normalized string, and the dom event name
   * or null in the case when the event doesn't match a keyboard event.
   */
  static parseEventName(eventName) {
    const parts = eventName.toLowerCase().split(".");
    const domEventName = parts.shift();
    if (parts.length === 0 || !(domEventName === "keydown" || domEventName === "keyup")) {
      return null;
    }
    const key = _KeyEventsPlugin._normalizeKey(parts.pop());
    let fullKey = "";
    let codeIX = parts.indexOf("code");
    if (codeIX > -1) {
      parts.splice(codeIX, 1);
      fullKey = "code.";
    }
    MODIFIER_KEYS.forEach((modifierName) => {
      const index = parts.indexOf(modifierName);
      if (index > -1) {
        parts.splice(index, 1);
        fullKey += modifierName + ".";
      }
    });
    fullKey += key;
    if (parts.length != 0 || key.length === 0) {
      return null;
    }
    const result = {};
    result["domEventName"] = domEventName;
    result["fullKey"] = fullKey;
    return result;
  }
  /**
   * Determines whether the actual keys pressed match the configured key code string.
   * The `fullKeyCode` event is normalized in the `parseEventName` method when the
   * event is attached to the DOM during the `addEventListener` call. This is unseen
   * by the end user and is normalized for internal consistency and parsing.
   *
   * @param event The keyboard event.
   * @param fullKeyCode The normalized user defined expected key event string
   * @returns boolean.
   */
  static matchEventFullKeyCode(event, fullKeyCode) {
    let keycode = _keyMap[event.key] || event.key;
    let key = "";
    if (fullKeyCode.indexOf("code.") > -1) {
      keycode = event.code;
      key = "code.";
    }
    if (keycode == null || !keycode) return false;
    keycode = keycode.toLowerCase();
    if (keycode === " ") {
      keycode = "space";
    } else if (keycode === ".") {
      keycode = "dot";
    }
    MODIFIER_KEYS.forEach((modifierName) => {
      if (modifierName !== keycode) {
        const modifierGetter = MODIFIER_KEY_GETTERS[modifierName];
        if (modifierGetter(event)) {
          key += modifierName + ".";
        }
      }
    });
    key += keycode;
    return key === fullKeyCode;
  }
  /**
   * Configures a handler callback for a key event.
   * @param fullKey The event name that combines all simultaneous keystrokes.
   * @param handler The function that responds to the key event.
   * @param zone The zone in which the event occurred.
   * @returns A callback function.
   */
  static eventCallback(fullKey, handler, zone) {
    return (event) => {
      if (_KeyEventsPlugin.matchEventFullKeyCode(event, fullKey)) {
        zone.runGuarded(() => handler(event));
      }
    };
  }
  /** @internal */
  static _normalizeKey(keyName) {
    return keyName === "esc" ? "escape" : keyName;
  }
  static \u0275fac = function KeyEventsPlugin_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _KeyEventsPlugin)(\u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _KeyEventsPlugin,
    factory: _KeyEventsPlugin.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(KeyEventsPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
function bootstrapApplication(rootComponent, options) {
  return internalCreateApplication(__spreadValues({
    rootComponent
  }, createProvidersConfig(options)));
}
function createProvidersConfig(options) {
  return {
    appProviders: [...BROWSER_MODULE_PROVIDERS, ...options?.providers ?? []],
    platformProviders: INTERNAL_BROWSER_PLATFORM_PROVIDERS
  };
}
function initDomAdapter() {
  BrowserDomAdapter.makeCurrent();
}
function errorHandler() {
  return new ErrorHandler();
}
function _document() {
  setDocument(document);
  return document;
}
var INTERNAL_BROWSER_PLATFORM_PROVIDERS = [{
  provide: PLATFORM_ID,
  useValue: PLATFORM_BROWSER_ID
}, {
  provide: PLATFORM_INITIALIZER,
  useValue: initDomAdapter,
  multi: true
}, {
  provide: DOCUMENT,
  useFactory: _document,
  deps: []
}];
var platformBrowser = createPlatformFactory(platformCore, "browser", INTERNAL_BROWSER_PLATFORM_PROVIDERS);
var BROWSER_MODULE_PROVIDERS_MARKER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "BrowserModule Providers Marker" : "");
var TESTABILITY_PROVIDERS = [{
  provide: TESTABILITY_GETTER,
  useClass: BrowserGetTestability,
  deps: []
}, {
  provide: TESTABILITY,
  useClass: Testability,
  deps: [NgZone, TestabilityRegistry, TESTABILITY_GETTER]
}, {
  provide: Testability,
  // Also provide as `Testability` for backwards-compatibility.
  useClass: Testability,
  deps: [NgZone, TestabilityRegistry, TESTABILITY_GETTER]
}];
var BROWSER_MODULE_PROVIDERS = [{
  provide: INJECTOR_SCOPE,
  useValue: "root"
}, {
  provide: ErrorHandler,
  useFactory: errorHandler,
  deps: []
}, {
  provide: EVENT_MANAGER_PLUGINS,
  useClass: DomEventsPlugin,
  multi: true,
  deps: [DOCUMENT]
}, {
  provide: EVENT_MANAGER_PLUGINS,
  useClass: KeyEventsPlugin,
  multi: true,
  deps: [DOCUMENT]
}, DomRendererFactory2, SharedStylesHost, EventManager, {
  provide: RendererFactory2,
  useExisting: DomRendererFactory2
}, {
  provide: XhrFactory,
  useClass: BrowserXhr,
  deps: []
}, typeof ngDevMode === "undefined" || ngDevMode ? {
  provide: BROWSER_MODULE_PROVIDERS_MARKER,
  useValue: true
} : []];
var BrowserModule = class _BrowserModule {
  constructor() {
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      const providersAlreadyPresent = inject(BROWSER_MODULE_PROVIDERS_MARKER, {
        optional: true,
        skipSelf: true
      });
      if (providersAlreadyPresent) {
        throw new RuntimeError(5100, `Providers from the \`BrowserModule\` have already been loaded. If you need access to common directives such as NgIf and NgFor, import the \`CommonModule\` instead.`);
      }
    }
  }
  static \u0275fac = function BrowserModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _BrowserModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _BrowserModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({
    providers: [...BROWSER_MODULE_PROVIDERS, ...TESTABILITY_PROVIDERS],
    imports: [CommonModule, ApplicationModule]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(BrowserModule, [{
    type: NgModule,
    args: [{
      providers: [...BROWSER_MODULE_PROVIDERS, ...TESTABILITY_PROVIDERS],
      exports: [CommonModule, ApplicationModule]
    }]
  }], () => [], null);
})();
var Meta = class _Meta {
  _doc;
  _dom;
  constructor(_doc) {
    this._doc = _doc;
    this._dom = getDOM();
  }
  /**
   * Retrieves or creates a specific `<meta>` tag element in the current HTML document.
   * In searching for an existing tag, Angular attempts to match the `name` or `property` attribute
   * values in the provided tag definition, and verifies that all other attribute values are equal.
   * If an existing element is found, it is returned and is not modified in any way.
   * @param tag The definition of a `<meta>` element to match or create.
   * @param forceCreation True to create a new element without checking whether one already exists.
   * @returns The existing element with the same attributes and values if found,
   * the new element if no match is found, or `null` if the tag parameter is not defined.
   */
  addTag(tag, forceCreation = false) {
    if (!tag) return null;
    return this._getOrCreateElement(tag, forceCreation);
  }
  /**
   * Retrieves or creates a set of `<meta>` tag elements in the current HTML document.
   * In searching for an existing tag, Angular attempts to match the `name` or `property` attribute
   * values in the provided tag definition, and verifies that all other attribute values are equal.
   * @param tags An array of tag definitions to match or create.
   * @param forceCreation True to create new elements without checking whether they already exist.
   * @returns The matching elements if found, or the new elements.
   */
  addTags(tags, forceCreation = false) {
    if (!tags) return [];
    return tags.reduce((result, tag) => {
      if (tag) {
        result.push(this._getOrCreateElement(tag, forceCreation));
      }
      return result;
    }, []);
  }
  /**
   * Retrieves a `<meta>` tag element in the current HTML document.
   * @param attrSelector The tag attribute and value to match against, in the format
   * `"tag_attribute='value string'"`.
   * @returns The matching element, if any.
   */
  getTag(attrSelector) {
    if (!attrSelector) return null;
    return this._doc.querySelector(`meta[${attrSelector}]`) || null;
  }
  /**
   * Retrieves a set of `<meta>` tag elements in the current HTML document.
   * @param attrSelector The tag attribute and value to match against, in the format
   * `"tag_attribute='value string'"`.
   * @returns The matching elements, if any.
   */
  getTags(attrSelector) {
    if (!attrSelector) return [];
    const list = this._doc.querySelectorAll(`meta[${attrSelector}]`);
    return list ? [].slice.call(list) : [];
  }
  /**
   * Modifies an existing `<meta>` tag element in the current HTML document.
   * @param tag The tag description with which to replace the existing tag content.
   * @param selector A tag attribute and value to match against, to identify
   * an existing tag. A string in the format `"tag_attribute=`value string`"`.
   * If not supplied, matches a tag with the same `name` or `property` attribute value as the
   * replacement tag.
   * @return The modified element.
   */
  updateTag(tag, selector) {
    if (!tag) return null;
    selector = selector || this._parseSelector(tag);
    const meta = this.getTag(selector);
    if (meta) {
      return this._setMetaElementAttributes(tag, meta);
    }
    return this._getOrCreateElement(tag, true);
  }
  /**
   * Removes an existing `<meta>` tag element from the current HTML document.
   * @param attrSelector A tag attribute and value to match against, to identify
   * an existing tag. A string in the format `"tag_attribute=`value string`"`.
   */
  removeTag(attrSelector) {
    this.removeTagElement(this.getTag(attrSelector));
  }
  /**
   * Removes an existing `<meta>` tag element from the current HTML document.
   * @param meta The tag definition to match against to identify an existing tag.
   */
  removeTagElement(meta) {
    if (meta) {
      this._dom.remove(meta);
    }
  }
  _getOrCreateElement(meta, forceCreation = false) {
    if (!forceCreation) {
      const selector = this._parseSelector(meta);
      const elem = this.getTags(selector).filter((elem2) => this._containsAttributes(meta, elem2))[0];
      if (elem !== void 0) return elem;
    }
    const element = this._dom.createElement("meta");
    this._setMetaElementAttributes(meta, element);
    const head = this._doc.getElementsByTagName("head")[0];
    head.appendChild(element);
    return element;
  }
  _setMetaElementAttributes(tag, el) {
    Object.keys(tag).forEach((prop) => el.setAttribute(this._getMetaKeyMap(prop), tag[prop]));
    return el;
  }
  _parseSelector(tag) {
    const attr = tag.name ? "name" : "property";
    return `${attr}="${tag[attr]}"`;
  }
  _containsAttributes(tag, elem) {
    return Object.keys(tag).every((key) => elem.getAttribute(this._getMetaKeyMap(key)) === tag[key]);
  }
  _getMetaKeyMap(prop) {
    return META_KEYS_MAP[prop] || prop;
  }
  static \u0275fac = function Meta_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _Meta)(\u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _Meta,
    factory: _Meta.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Meta, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var META_KEYS_MAP = {
  httpEquiv: "http-equiv"
};
var Title = class _Title {
  _doc;
  constructor(_doc) {
    this._doc = _doc;
  }
  /**
   * Get the title of the current HTML document.
   */
  getTitle() {
    return this._doc.title;
  }
  /**
   * Set the title of the current HTML document.
   * @param newTitle
   */
  setTitle(newTitle) {
    this._doc.title = newTitle || "";
  }
  static \u0275fac = function Title_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _Title)(\u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _Title,
    factory: _Title.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Title, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var EVENT_NAMES = {
  // pan
  "pan": true,
  "panstart": true,
  "panmove": true,
  "panend": true,
  "pancancel": true,
  "panleft": true,
  "panright": true,
  "panup": true,
  "pandown": true,
  // pinch
  "pinch": true,
  "pinchstart": true,
  "pinchmove": true,
  "pinchend": true,
  "pinchcancel": true,
  "pinchin": true,
  "pinchout": true,
  // press
  "press": true,
  "pressup": true,
  // rotate
  "rotate": true,
  "rotatestart": true,
  "rotatemove": true,
  "rotateend": true,
  "rotatecancel": true,
  // swipe
  "swipe": true,
  "swipeleft": true,
  "swiperight": true,
  "swipeup": true,
  "swipedown": true,
  // tap
  "tap": true,
  "doubletap": true
};
var HAMMER_GESTURE_CONFIG = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "HammerGestureConfig" : "");
var HAMMER_LOADER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "HammerLoader" : "");
var HammerGestureConfig = class _HammerGestureConfig {
  /**
   * A set of supported event names for gestures to be used in Angular.
   * Angular supports all built-in recognizers, as listed in
   * [HammerJS documentation](https://hammerjs.github.io/).
   */
  events = [];
  /**
   * Maps gesture event names to a set of configuration options
   * that specify overrides to the default values for specific properties.
   *
   * The key is a supported event name to be configured,
   * and the options object contains a set of properties, with override values
   * to be applied to the named recognizer event.
   * For example, to disable recognition of the rotate event, specify
   *  `{"rotate": {"enable": false}}`.
   *
   * Properties that are not present take the HammerJS default values.
   * For information about which properties are supported for which events,
   * and their allowed and default values, see
   * [HammerJS documentation](https://hammerjs.github.io/).
   *
   */
  overrides = {};
  /**
   * Properties whose default values can be overridden for a given event.
   * Different sets of properties apply to different events.
   * For information about which properties are supported for which events,
   * and their allowed and default values, see
   * [HammerJS documentation](https://hammerjs.github.io/).
   */
  options;
  /**
   * Creates a [HammerJS Manager](https://hammerjs.github.io/api/#hammermanager)
   * and attaches it to a given HTML element.
   * @param element The element that will recognize gestures.
   * @returns A HammerJS event-manager object.
   */
  buildHammer(element) {
    const mc = new Hammer(element, this.options);
    mc.get("pinch").set({
      enable: true
    });
    mc.get("rotate").set({
      enable: true
    });
    for (const eventName in this.overrides) {
      mc.get(eventName).set(this.overrides[eventName]);
    }
    return mc;
  }
  static \u0275fac = function HammerGestureConfig_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HammerGestureConfig)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HammerGestureConfig,
    factory: _HammerGestureConfig.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerGestureConfig, [{
    type: Injectable
  }], null, null);
})();
var HammerGesturesPlugin = class _HammerGesturesPlugin extends EventManagerPlugin {
  _config;
  _injector;
  loader;
  _loaderPromise = null;
  constructor(doc, _config, _injector, loader) {
    super(doc);
    this._config = _config;
    this._injector = _injector;
    this.loader = loader;
  }
  supports(eventName) {
    if (!EVENT_NAMES.hasOwnProperty(eventName.toLowerCase()) && !this.isCustomEvent(eventName)) {
      return false;
    }
    if (!window.Hammer && !this.loader) {
      if (typeof ngDevMode === "undefined" || ngDevMode) {
        const _console = this._injector.get(Console);
        _console.warn(`The "${eventName}" event cannot be bound because Hammer.JS is not loaded and no custom loader has been specified.`);
      }
      return false;
    }
    return true;
  }
  addEventListener(element, eventName, handler) {
    const zone = this.manager.getZone();
    eventName = eventName.toLowerCase();
    if (!window.Hammer && this.loader) {
      this._loaderPromise = this._loaderPromise || zone.runOutsideAngular(() => this.loader());
      let cancelRegistration = false;
      let deregister = () => {
        cancelRegistration = true;
      };
      zone.runOutsideAngular(() => this._loaderPromise.then(() => {
        if (!window.Hammer) {
          if (typeof ngDevMode === "undefined" || ngDevMode) {
            const _console = this._injector.get(Console);
            _console.warn(`The custom HAMMER_LOADER completed, but Hammer.JS is not present.`);
          }
          deregister = () => {
          };
          return;
        }
        if (!cancelRegistration) {
          deregister = this.addEventListener(element, eventName, handler);
        }
      }).catch(() => {
        if (typeof ngDevMode === "undefined" || ngDevMode) {
          const _console = this._injector.get(Console);
          _console.warn(`The "${eventName}" event cannot be bound because the custom Hammer.JS loader failed.`);
        }
        deregister = () => {
        };
      }));
      return () => {
        deregister();
      };
    }
    return zone.runOutsideAngular(() => {
      const mc = this._config.buildHammer(element);
      const callback = function(eventObj) {
        zone.runGuarded(function() {
          handler(eventObj);
        });
      };
      mc.on(eventName, callback);
      return () => {
        mc.off(eventName, callback);
        if (typeof mc.destroy === "function") {
          mc.destroy();
        }
      };
    });
  }
  isCustomEvent(eventName) {
    return this._config.events.indexOf(eventName) > -1;
  }
  static \u0275fac = function HammerGesturesPlugin_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HammerGesturesPlugin)(\u0275\u0275inject(DOCUMENT), \u0275\u0275inject(HAMMER_GESTURE_CONFIG), \u0275\u0275inject(Injector), \u0275\u0275inject(HAMMER_LOADER, 8));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HammerGesturesPlugin,
    factory: _HammerGesturesPlugin.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerGesturesPlugin, [{
    type: Injectable
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }, {
    type: HammerGestureConfig,
    decorators: [{
      type: Inject,
      args: [HAMMER_GESTURE_CONFIG]
    }]
  }, {
    type: Injector
  }, {
    type: void 0,
    decorators: [{
      type: Optional
    }, {
      type: Inject,
      args: [HAMMER_LOADER]
    }]
  }], null);
})();
var HammerModule = class _HammerModule {
  static \u0275fac = function HammerModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _HammerModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _HammerModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({
    providers: [{
      provide: EVENT_MANAGER_PLUGINS,
      useClass: HammerGesturesPlugin,
      multi: true,
      deps: [DOCUMENT, HAMMER_GESTURE_CONFIG, Injector, [new Optional(), HAMMER_LOADER]]
    }, {
      provide: HAMMER_GESTURE_CONFIG,
      useClass: HammerGestureConfig,
      deps: []
    }]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HammerModule, [{
    type: NgModule,
    args: [{
      providers: [{
        provide: EVENT_MANAGER_PLUGINS,
        useClass: HammerGesturesPlugin,
        multi: true,
        deps: [DOCUMENT, HAMMER_GESTURE_CONFIG, Injector, [new Optional(), HAMMER_LOADER]]
      }, {
        provide: HAMMER_GESTURE_CONFIG,
        useClass: HammerGestureConfig,
        deps: []
      }]
    }]
  }], null, null);
})();
var DomSanitizer = class _DomSanitizer {
  static \u0275fac = function DomSanitizer_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DomSanitizer)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DomSanitizer,
    factory: function DomSanitizer_Factory(__ngFactoryType__) {
      let __ngConditionalFactory__ = null;
      if (__ngFactoryType__) {
        __ngConditionalFactory__ = new (__ngFactoryType__ || _DomSanitizer)();
      } else {
        __ngConditionalFactory__ = \u0275\u0275inject(DomSanitizerImpl);
      }
      return __ngConditionalFactory__;
    },
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomSanitizer, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useExisting: forwardRef(() => DomSanitizerImpl)
    }]
  }], null, null);
})();
var DomSanitizerImpl = class _DomSanitizerImpl extends DomSanitizer {
  _doc;
  constructor(_doc) {
    super();
    this._doc = _doc;
  }
  sanitize(ctx, value) {
    if (value == null) return null;
    switch (ctx) {
      case SecurityContext.NONE:
        return value;
      case SecurityContext.HTML:
        if (allowSanitizationBypassAndThrow(
          value,
          "HTML"
          /* BypassType.Html */
        )) {
          return unwrapSafeValue(value);
        }
        return _sanitizeHtml(this._doc, String(value)).toString();
      case SecurityContext.STYLE:
        if (allowSanitizationBypassAndThrow(
          value,
          "Style"
          /* BypassType.Style */
        )) {
          return unwrapSafeValue(value);
        }
        return value;
      case SecurityContext.SCRIPT:
        if (allowSanitizationBypassAndThrow(
          value,
          "Script"
          /* BypassType.Script */
        )) {
          return unwrapSafeValue(value);
        }
        throw new RuntimeError(5200, (typeof ngDevMode === "undefined" || ngDevMode) && "unsafe value used in a script context");
      case SecurityContext.URL:
        if (allowSanitizationBypassAndThrow(
          value,
          "URL"
          /* BypassType.Url */
        )) {
          return unwrapSafeValue(value);
        }
        return _sanitizeUrl(String(value));
      case SecurityContext.RESOURCE_URL:
        if (allowSanitizationBypassAndThrow(
          value,
          "ResourceURL"
          /* BypassType.ResourceUrl */
        )) {
          return unwrapSafeValue(value);
        }
        throw new RuntimeError(5201, (typeof ngDevMode === "undefined" || ngDevMode) && `unsafe value used in a resource URL context (see ${XSS_SECURITY_URL})`);
      default:
        throw new RuntimeError(5202, (typeof ngDevMode === "undefined" || ngDevMode) && `Unexpected SecurityContext ${ctx} (see ${XSS_SECURITY_URL})`);
    }
  }
  bypassSecurityTrustHtml(value) {
    return bypassSanitizationTrustHtml(value);
  }
  bypassSecurityTrustStyle(value) {
    return bypassSanitizationTrustStyle(value);
  }
  bypassSecurityTrustScript(value) {
    return bypassSanitizationTrustScript(value);
  }
  bypassSecurityTrustUrl(value) {
    return bypassSanitizationTrustUrl(value);
  }
  bypassSecurityTrustResourceUrl(value) {
    return bypassSanitizationTrustResourceUrl(value);
  }
  static \u0275fac = function DomSanitizerImpl_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DomSanitizerImpl)(\u0275\u0275inject(DOCUMENT));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DomSanitizerImpl,
    factory: _DomSanitizerImpl.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DomSanitizerImpl, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: void 0,
    decorators: [{
      type: Inject,
      args: [DOCUMENT]
    }]
  }], null);
})();
var HydrationFeatureKind;
(function(HydrationFeatureKind2) {
  HydrationFeatureKind2[HydrationFeatureKind2["NoHttpTransferCache"] = 0] = "NoHttpTransferCache";
  HydrationFeatureKind2[HydrationFeatureKind2["HttpTransferCacheOptions"] = 1] = "HttpTransferCacheOptions";
  HydrationFeatureKind2[HydrationFeatureKind2["I18nSupport"] = 2] = "I18nSupport";
  HydrationFeatureKind2[HydrationFeatureKind2["EventReplay"] = 3] = "EventReplay";
  HydrationFeatureKind2[HydrationFeatureKind2["IncrementalHydration"] = 4] = "IncrementalHydration";
})(HydrationFeatureKind || (HydrationFeatureKind = {}));
function provideZoneJsCompatibilityDetector() {
  return [{
    provide: ENVIRONMENT_INITIALIZER,
    useValue: () => {
      const ngZone = inject(NgZone);
      const isZoneless = inject(ZONELESS_ENABLED);
      if (!isZoneless && ngZone.constructor !== NgZone) {
        const console2 = inject(Console);
        const message = formatRuntimeError(-5e3, "Angular detected that hydration was enabled for an application that uses a custom or a noop Zone.js implementation. This is not yet a fully supported configuration.");
        console2.warn(message);
      }
    },
    multi: true
  }];
}
function provideClientHydration(...features) {
  const providers = [];
  const featuresKind = /* @__PURE__ */ new Set();
  const hasHttpTransferCacheOptions = featuresKind.has(HydrationFeatureKind.HttpTransferCacheOptions);
  for (const {
    \u0275providers,
    \u0275kind
  } of features) {
    featuresKind.add(\u0275kind);
    if (\u0275providers.length) {
      providers.push(\u0275providers);
    }
  }
  if (typeof ngDevMode !== "undefined" && ngDevMode && featuresKind.has(HydrationFeatureKind.NoHttpTransferCache) && hasHttpTransferCacheOptions) {
    throw new Error("Configuration error: found both withHttpTransferCacheOptions() and withNoHttpTransferCache() in the same call to provideClientHydration(), which is a contradiction.");
  }
  return makeEnvironmentProviders([typeof ngDevMode !== "undefined" && ngDevMode ? provideZoneJsCompatibilityDetector() : [], withDomHydration(), featuresKind.has(HydrationFeatureKind.NoHttpTransferCache) || hasHttpTransferCacheOptions ? [] : withHttpTransferCache({}), providers]);
}
var VERSION2 = new Version("0.0.0");

// node_modules/@angular/router/fesm2022/router.mjs
var PRIMARY_OUTLET = "primary";
var RouteTitleKey = /* @__PURE__ */ Symbol("RouteTitle");
var ParamsAsMap = class {
  params;
  constructor(params) {
    this.params = params || {};
  }
  has(name) {
    return Object.prototype.hasOwnProperty.call(this.params, name);
  }
  get(name) {
    if (this.has(name)) {
      const v = this.params[name];
      return Array.isArray(v) ? v[0] : v;
    }
    return null;
  }
  getAll(name) {
    if (this.has(name)) {
      const v = this.params[name];
      return Array.isArray(v) ? v : [v];
    }
    return [];
  }
  get keys() {
    return Object.keys(this.params);
  }
};
function convertToParamMap(params) {
  return new ParamsAsMap(params);
}
function defaultUrlMatcher(segments, segmentGroup, route) {
  const parts = route.path.split("/");
  if (parts.length > segments.length) {
    return null;
  }
  if (route.pathMatch === "full" && (segmentGroup.hasChildren() || parts.length < segments.length)) {
    return null;
  }
  const posParams = {};
  for (let index = 0; index < parts.length; index++) {
    const part = parts[index];
    const segment = segments[index];
    const isParameter = part[0] === ":";
    if (isParameter) {
      posParams[part.substring(1)] = segment;
    } else if (part !== segment.path) {
      return null;
    }
  }
  return {
    consumed: segments.slice(0, parts.length),
    posParams
  };
}
function shallowEqualArrays(a, b) {
  if (a.length !== b.length) return false;
  for (let i = 0; i < a.length; ++i) {
    if (!shallowEqual(a[i], b[i])) return false;
  }
  return true;
}
function shallowEqual(a, b) {
  const k1 = a ? getDataKeys(a) : void 0;
  const k2 = b ? getDataKeys(b) : void 0;
  if (!k1 || !k2 || k1.length != k2.length) {
    return false;
  }
  let key;
  for (let i = 0; i < k1.length; i++) {
    key = k1[i];
    if (!equalArraysOrString(a[key], b[key])) {
      return false;
    }
  }
  return true;
}
function getDataKeys(obj) {
  return [...Object.keys(obj), ...Object.getOwnPropertySymbols(obj)];
}
function equalArraysOrString(a, b) {
  if (Array.isArray(a) && Array.isArray(b)) {
    if (a.length !== b.length) return false;
    const aSorted = [...a].sort();
    const bSorted = [...b].sort();
    return aSorted.every((val, index) => bSorted[index] === val);
  } else {
    return a === b;
  }
}
function last2(a) {
  return a.length > 0 ? a[a.length - 1] : null;
}
function wrapIntoObservable(value) {
  if (isObservable(value)) {
    return value;
  }
  if (isPromise(value)) {
    return from(Promise.resolve(value));
  }
  return of(value);
}
var pathCompareMap = {
  "exact": equalSegmentGroups,
  "subset": containsSegmentGroup
};
var paramCompareMap = {
  "exact": equalParams,
  "subset": containsParams,
  "ignored": () => true
};
function containsTree(container, containee, options) {
  return pathCompareMap[options.paths](container.root, containee.root, options.matrixParams) && paramCompareMap[options.queryParams](container.queryParams, containee.queryParams) && !(options.fragment === "exact" && container.fragment !== containee.fragment);
}
function equalParams(container, containee) {
  return shallowEqual(container, containee);
}
function equalSegmentGroups(container, containee, matrixParams) {
  if (!equalPath(container.segments, containee.segments)) return false;
  if (!matrixParamsMatch(container.segments, containee.segments, matrixParams)) {
    return false;
  }
  if (container.numberOfChildren !== containee.numberOfChildren) return false;
  for (const c in containee.children) {
    if (!container.children[c]) return false;
    if (!equalSegmentGroups(container.children[c], containee.children[c], matrixParams)) return false;
  }
  return true;
}
function containsParams(container, containee) {
  return Object.keys(containee).length <= Object.keys(container).length && Object.keys(containee).every((key) => equalArraysOrString(container[key], containee[key]));
}
function containsSegmentGroup(container, containee, matrixParams) {
  return containsSegmentGroupHelper(container, containee, containee.segments, matrixParams);
}
function containsSegmentGroupHelper(container, containee, containeePaths, matrixParams) {
  if (container.segments.length > containeePaths.length) {
    const current = container.segments.slice(0, containeePaths.length);
    if (!equalPath(current, containeePaths)) return false;
    if (containee.hasChildren()) return false;
    if (!matrixParamsMatch(current, containeePaths, matrixParams)) return false;
    return true;
  } else if (container.segments.length === containeePaths.length) {
    if (!equalPath(container.segments, containeePaths)) return false;
    if (!matrixParamsMatch(container.segments, containeePaths, matrixParams)) return false;
    for (const c in containee.children) {
      if (!container.children[c]) return false;
      if (!containsSegmentGroup(container.children[c], containee.children[c], matrixParams)) {
        return false;
      }
    }
    return true;
  } else {
    const current = containeePaths.slice(0, container.segments.length);
    const next = containeePaths.slice(container.segments.length);
    if (!equalPath(container.segments, current)) return false;
    if (!matrixParamsMatch(container.segments, current, matrixParams)) return false;
    if (!container.children[PRIMARY_OUTLET]) return false;
    return containsSegmentGroupHelper(container.children[PRIMARY_OUTLET], containee, next, matrixParams);
  }
}
function matrixParamsMatch(containerPaths, containeePaths, options) {
  return containeePaths.every((containeeSegment, i) => {
    return paramCompareMap[options](containerPaths[i].parameters, containeeSegment.parameters);
  });
}
var UrlTree = class {
  root;
  queryParams;
  fragment;
  /** @internal */
  _queryParamMap;
  constructor(root = new UrlSegmentGroup([], {}), queryParams = {}, fragment = null) {
    this.root = root;
    this.queryParams = queryParams;
    this.fragment = fragment;
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      if (root.segments.length > 0) {
        throw new RuntimeError(4015, "The root `UrlSegmentGroup` should not contain `segments`. Instead, these segments belong in the `children` so they can be associated with a named outlet.");
      }
    }
  }
  get queryParamMap() {
    this._queryParamMap ??= convertToParamMap(this.queryParams);
    return this._queryParamMap;
  }
  /** @docsNotRequired */
  toString() {
    return DEFAULT_SERIALIZER.serialize(this);
  }
};
var UrlSegmentGroup = class {
  segments;
  children;
  /** The parent node in the url tree */
  parent = null;
  constructor(segments, children) {
    this.segments = segments;
    this.children = children;
    Object.values(children).forEach((v) => v.parent = this);
  }
  /** Whether the segment has child segments */
  hasChildren() {
    return this.numberOfChildren > 0;
  }
  /** Number of child segments */
  get numberOfChildren() {
    return Object.keys(this.children).length;
  }
  /** @docsNotRequired */
  toString() {
    return serializePaths(this);
  }
};
var UrlSegment = class {
  path;
  parameters;
  /** @internal */
  _parameterMap;
  constructor(path, parameters) {
    this.path = path;
    this.parameters = parameters;
  }
  get parameterMap() {
    this._parameterMap ??= convertToParamMap(this.parameters);
    return this._parameterMap;
  }
  /** @docsNotRequired */
  toString() {
    return serializePath(this);
  }
};
function equalSegments(as, bs) {
  return equalPath(as, bs) && as.every((a, i) => shallowEqual(a.parameters, bs[i].parameters));
}
function equalPath(as, bs) {
  if (as.length !== bs.length) return false;
  return as.every((a, i) => a.path === bs[i].path);
}
function mapChildrenIntoArray(segment, fn) {
  let res = [];
  Object.entries(segment.children).forEach(([childOutlet, child]) => {
    if (childOutlet === PRIMARY_OUTLET) {
      res = res.concat(fn(child, childOutlet));
    }
  });
  Object.entries(segment.children).forEach(([childOutlet, child]) => {
    if (childOutlet !== PRIMARY_OUTLET) {
      res = res.concat(fn(child, childOutlet));
    }
  });
  return res;
}
var UrlSerializer = class _UrlSerializer {
  static \u0275fac = function UrlSerializer_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _UrlSerializer)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _UrlSerializer,
    factory: () => (() => new DefaultUrlSerializer())(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(UrlSerializer, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => new DefaultUrlSerializer()
    }]
  }], null, null);
})();
var DefaultUrlSerializer = class {
  /** Parses a url into a `UrlTree` */
  parse(url) {
    const p = new UrlParser(url);
    return new UrlTree(p.parseRootSegment(), p.parseQueryParams(), p.parseFragment());
  }
  /** Converts a `UrlTree` into a url */
  serialize(tree2) {
    const segment = `/${serializeSegment(tree2.root, true)}`;
    const query = serializeQueryParams(tree2.queryParams);
    const fragment = typeof tree2.fragment === `string` ? `#${encodeUriFragment(tree2.fragment)}` : "";
    return `${segment}${query}${fragment}`;
  }
};
var DEFAULT_SERIALIZER = new DefaultUrlSerializer();
function serializePaths(segment) {
  return segment.segments.map((p) => serializePath(p)).join("/");
}
function serializeSegment(segment, root) {
  if (!segment.hasChildren()) {
    return serializePaths(segment);
  }
  if (root) {
    const primary = segment.children[PRIMARY_OUTLET] ? serializeSegment(segment.children[PRIMARY_OUTLET], false) : "";
    const children = [];
    Object.entries(segment.children).forEach(([k, v]) => {
      if (k !== PRIMARY_OUTLET) {
        children.push(`${k}:${serializeSegment(v, false)}`);
      }
    });
    return children.length > 0 ? `${primary}(${children.join("//")})` : primary;
  } else {
    const children = mapChildrenIntoArray(segment, (v, k) => {
      if (k === PRIMARY_OUTLET) {
        return [serializeSegment(segment.children[PRIMARY_OUTLET], false)];
      }
      return [`${k}:${serializeSegment(v, false)}`];
    });
    if (Object.keys(segment.children).length === 1 && segment.children[PRIMARY_OUTLET] != null) {
      return `${serializePaths(segment)}/${children[0]}`;
    }
    return `${serializePaths(segment)}/(${children.join("//")})`;
  }
}
function encodeUriString(s) {
  return encodeURIComponent(s).replace(/%40/g, "@").replace(/%3A/gi, ":").replace(/%24/g, "$").replace(/%2C/gi, ",");
}
function encodeUriQuery(s) {
  return encodeUriString(s).replace(/%3B/gi, ";");
}
function encodeUriFragment(s) {
  return encodeURI(s);
}
function encodeUriSegment(s) {
  return encodeUriString(s).replace(/\(/g, "%28").replace(/\)/g, "%29").replace(/%26/gi, "&");
}
function decode(s) {
  return decodeURIComponent(s);
}
function decodeQuery(s) {
  return decode(s.replace(/\+/g, "%20"));
}
function serializePath(path) {
  return `${encodeUriSegment(path.path)}${serializeMatrixParams(path.parameters)}`;
}
function serializeMatrixParams(params) {
  return Object.entries(params).map(([key, value]) => `;${encodeUriSegment(key)}=${encodeUriSegment(value)}`).join("");
}
function serializeQueryParams(params) {
  const strParams = Object.entries(params).map(([name, value]) => {
    return Array.isArray(value) ? value.map((v) => `${encodeUriQuery(name)}=${encodeUriQuery(v)}`).join("&") : `${encodeUriQuery(name)}=${encodeUriQuery(value)}`;
  }).filter((s) => s);
  return strParams.length ? `?${strParams.join("&")}` : "";
}
var SEGMENT_RE = /^[^\/()?;#]+/;
function matchSegments(str) {
  const match2 = str.match(SEGMENT_RE);
  return match2 ? match2[0] : "";
}
var MATRIX_PARAM_SEGMENT_RE = /^[^\/()?;=#]+/;
function matchMatrixKeySegments(str) {
  const match2 = str.match(MATRIX_PARAM_SEGMENT_RE);
  return match2 ? match2[0] : "";
}
var QUERY_PARAM_RE = /^[^=?&#]+/;
function matchQueryParams(str) {
  const match2 = str.match(QUERY_PARAM_RE);
  return match2 ? match2[0] : "";
}
var QUERY_PARAM_VALUE_RE = /^[^&#]+/;
function matchUrlQueryParamValue(str) {
  const match2 = str.match(QUERY_PARAM_VALUE_RE);
  return match2 ? match2[0] : "";
}
var UrlParser = class {
  url;
  remaining;
  constructor(url) {
    this.url = url;
    this.remaining = url;
  }
  parseRootSegment() {
    this.consumeOptional("/");
    if (this.remaining === "" || this.peekStartsWith("?") || this.peekStartsWith("#")) {
      return new UrlSegmentGroup([], {});
    }
    return new UrlSegmentGroup([], this.parseChildren());
  }
  parseQueryParams() {
    const params = {};
    if (this.consumeOptional("?")) {
      do {
        this.parseQueryParam(params);
      } while (this.consumeOptional("&"));
    }
    return params;
  }
  parseFragment() {
    return this.consumeOptional("#") ? decodeURIComponent(this.remaining) : null;
  }
  parseChildren() {
    if (this.remaining === "") {
      return {};
    }
    this.consumeOptional("/");
    const segments = [];
    if (!this.peekStartsWith("(")) {
      segments.push(this.parseSegment());
    }
    while (this.peekStartsWith("/") && !this.peekStartsWith("//") && !this.peekStartsWith("/(")) {
      this.capture("/");
      segments.push(this.parseSegment());
    }
    let children = {};
    if (this.peekStartsWith("/(")) {
      this.capture("/");
      children = this.parseParens(true);
    }
    let res = {};
    if (this.peekStartsWith("(")) {
      res = this.parseParens(false);
    }
    if (segments.length > 0 || Object.keys(children).length > 0) {
      res[PRIMARY_OUTLET] = new UrlSegmentGroup(segments, children);
    }
    return res;
  }
  // parse a segment with its matrix parameters
  // ie `name;k1=v1;k2`
  parseSegment() {
    const path = matchSegments(this.remaining);
    if (path === "" && this.peekStartsWith(";")) {
      throw new RuntimeError(4009, (typeof ngDevMode === "undefined" || ngDevMode) && `Empty path url segment cannot have parameters: '${this.remaining}'.`);
    }
    this.capture(path);
    return new UrlSegment(decode(path), this.parseMatrixParams());
  }
  parseMatrixParams() {
    const params = {};
    while (this.consumeOptional(";")) {
      this.parseParam(params);
    }
    return params;
  }
  parseParam(params) {
    const key = matchMatrixKeySegments(this.remaining);
    if (!key) {
      return;
    }
    this.capture(key);
    let value = "";
    if (this.consumeOptional("=")) {
      const valueMatch = matchSegments(this.remaining);
      if (valueMatch) {
        value = valueMatch;
        this.capture(value);
      }
    }
    params[decode(key)] = decode(value);
  }
  // Parse a single query parameter `name[=value]`
  parseQueryParam(params) {
    const key = matchQueryParams(this.remaining);
    if (!key) {
      return;
    }
    this.capture(key);
    let value = "";
    if (this.consumeOptional("=")) {
      const valueMatch = matchUrlQueryParamValue(this.remaining);
      if (valueMatch) {
        value = valueMatch;
        this.capture(value);
      }
    }
    const decodedKey = decodeQuery(key);
    const decodedVal = decodeQuery(value);
    if (params.hasOwnProperty(decodedKey)) {
      let currentVal = params[decodedKey];
      if (!Array.isArray(currentVal)) {
        currentVal = [currentVal];
        params[decodedKey] = currentVal;
      }
      currentVal.push(decodedVal);
    } else {
      params[decodedKey] = decodedVal;
    }
  }
  // parse `(a/b//outlet_name:c/d)`
  parseParens(allowPrimary) {
    const segments = {};
    this.capture("(");
    while (!this.consumeOptional(")") && this.remaining.length > 0) {
      const path = matchSegments(this.remaining);
      const next = this.remaining[path.length];
      if (next !== "/" && next !== ")" && next !== ";") {
        throw new RuntimeError(4010, (typeof ngDevMode === "undefined" || ngDevMode) && `Cannot parse url '${this.url}'`);
      }
      let outletName = void 0;
      if (path.indexOf(":") > -1) {
        outletName = path.slice(0, path.indexOf(":"));
        this.capture(outletName);
        this.capture(":");
      } else if (allowPrimary) {
        outletName = PRIMARY_OUTLET;
      }
      const children = this.parseChildren();
      segments[outletName] = Object.keys(children).length === 1 ? children[PRIMARY_OUTLET] : new UrlSegmentGroup([], children);
      this.consumeOptional("//");
    }
    return segments;
  }
  peekStartsWith(str) {
    return this.remaining.startsWith(str);
  }
  // Consumes the prefix when it is present and returns whether it has been consumed
  consumeOptional(str) {
    if (this.peekStartsWith(str)) {
      this.remaining = this.remaining.substring(str.length);
      return true;
    }
    return false;
  }
  capture(str) {
    if (!this.consumeOptional(str)) {
      throw new RuntimeError(4011, (typeof ngDevMode === "undefined" || ngDevMode) && `Expected "${str}".`);
    }
  }
};
function createRoot(rootCandidate) {
  return rootCandidate.segments.length > 0 ? new UrlSegmentGroup([], {
    [PRIMARY_OUTLET]: rootCandidate
  }) : rootCandidate;
}
function squashSegmentGroup(segmentGroup) {
  const newChildren = {};
  for (const [childOutlet, child] of Object.entries(segmentGroup.children)) {
    const childCandidate = squashSegmentGroup(child);
    if (childOutlet === PRIMARY_OUTLET && childCandidate.segments.length === 0 && childCandidate.hasChildren()) {
      for (const [grandChildOutlet, grandChild] of Object.entries(childCandidate.children)) {
        newChildren[grandChildOutlet] = grandChild;
      }
    } else if (childCandidate.segments.length > 0 || childCandidate.hasChildren()) {
      newChildren[childOutlet] = childCandidate;
    }
  }
  const s = new UrlSegmentGroup(segmentGroup.segments, newChildren);
  return mergeTrivialChildren(s);
}
function mergeTrivialChildren(s) {
  if (s.numberOfChildren === 1 && s.children[PRIMARY_OUTLET]) {
    const c = s.children[PRIMARY_OUTLET];
    return new UrlSegmentGroup(s.segments.concat(c.segments), c.children);
  }
  return s;
}
function isUrlTree(v) {
  return v instanceof UrlTree;
}
function createUrlTreeFromSnapshot(relativeTo, commands, queryParams = null, fragment = null) {
  const relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeTo);
  return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, queryParams, fragment);
}
function createSegmentGroupFromRoute(route) {
  let targetGroup;
  function createSegmentGroupFromRouteRecursive(currentRoute) {
    const childOutlets = {};
    for (const childSnapshot of currentRoute.children) {
      const root = createSegmentGroupFromRouteRecursive(childSnapshot);
      childOutlets[childSnapshot.outlet] = root;
    }
    const segmentGroup = new UrlSegmentGroup(currentRoute.url, childOutlets);
    if (currentRoute === route) {
      targetGroup = segmentGroup;
    }
    return segmentGroup;
  }
  const rootCandidate = createSegmentGroupFromRouteRecursive(route.root);
  const rootSegmentGroup = createRoot(rootCandidate);
  return targetGroup ?? rootSegmentGroup;
}
function createUrlTreeFromSegmentGroup(relativeTo, commands, queryParams, fragment) {
  let root = relativeTo;
  while (root.parent) {
    root = root.parent;
  }
  if (commands.length === 0) {
    return tree(root, root, root, queryParams, fragment);
  }
  const nav = computeNavigation(commands);
  if (nav.toRoot()) {
    return tree(root, root, new UrlSegmentGroup([], {}), queryParams, fragment);
  }
  const position = findStartingPositionForTargetGroup(nav, root, relativeTo);
  const newSegmentGroup = position.processChildren ? updateSegmentGroupChildren(position.segmentGroup, position.index, nav.commands) : updateSegmentGroup(position.segmentGroup, position.index, nav.commands);
  return tree(root, position.segmentGroup, newSegmentGroup, queryParams, fragment);
}
function isMatrixParams(command) {
  return typeof command === "object" && command != null && !command.outlets && !command.segmentPath;
}
function isCommandWithOutlets(command) {
  return typeof command === "object" && command != null && command.outlets;
}
function tree(oldRoot, oldSegmentGroup, newSegmentGroup, queryParams, fragment) {
  let qp = {};
  if (queryParams) {
    Object.entries(queryParams).forEach(([name, value]) => {
      qp[name] = Array.isArray(value) ? value.map((v) => `${v}`) : `${value}`;
    });
  }
  let rootCandidate;
  if (oldRoot === oldSegmentGroup) {
    rootCandidate = newSegmentGroup;
  } else {
    rootCandidate = replaceSegment(oldRoot, oldSegmentGroup, newSegmentGroup);
  }
  const newRoot = createRoot(squashSegmentGroup(rootCandidate));
  return new UrlTree(newRoot, qp, fragment);
}
function replaceSegment(current, oldSegment, newSegment) {
  const children = {};
  Object.entries(current.children).forEach(([outletName, c]) => {
    if (c === oldSegment) {
      children[outletName] = newSegment;
    } else {
      children[outletName] = replaceSegment(c, oldSegment, newSegment);
    }
  });
  return new UrlSegmentGroup(current.segments, children);
}
var Navigation = class {
  isAbsolute;
  numberOfDoubleDots;
  commands;
  constructor(isAbsolute, numberOfDoubleDots, commands) {
    this.isAbsolute = isAbsolute;
    this.numberOfDoubleDots = numberOfDoubleDots;
    this.commands = commands;
    if (isAbsolute && commands.length > 0 && isMatrixParams(commands[0])) {
      throw new RuntimeError(4003, (typeof ngDevMode === "undefined" || ngDevMode) && "Root segment cannot have matrix parameters");
    }
    const cmdWithOutlet = commands.find(isCommandWithOutlets);
    if (cmdWithOutlet && cmdWithOutlet !== last2(commands)) {
      throw new RuntimeError(4004, (typeof ngDevMode === "undefined" || ngDevMode) && "{outlets:{}} has to be the last command");
    }
  }
  toRoot() {
    return this.isAbsolute && this.commands.length === 1 && this.commands[0] == "/";
  }
};
function computeNavigation(commands) {
  if (typeof commands[0] === "string" && commands.length === 1 && commands[0] === "/") {
    return new Navigation(true, 0, commands);
  }
  let numberOfDoubleDots = 0;
  let isAbsolute = false;
  const res = commands.reduce((res2, cmd, cmdIdx) => {
    if (typeof cmd === "object" && cmd != null) {
      if (cmd.outlets) {
        const outlets = {};
        Object.entries(cmd.outlets).forEach(([name, commands2]) => {
          outlets[name] = typeof commands2 === "string" ? commands2.split("/") : commands2;
        });
        return [...res2, {
          outlets
        }];
      }
      if (cmd.segmentPath) {
        return [...res2, cmd.segmentPath];
      }
    }
    if (!(typeof cmd === "string")) {
      return [...res2, cmd];
    }
    if (cmdIdx === 0) {
      cmd.split("/").forEach((urlPart, partIndex) => {
        if (partIndex == 0 && urlPart === ".") ;
        else if (partIndex == 0 && urlPart === "") {
          isAbsolute = true;
        } else if (urlPart === "..") {
          numberOfDoubleDots++;
        } else if (urlPart != "") {
          res2.push(urlPart);
        }
      });
      return res2;
    }
    return [...res2, cmd];
  }, []);
  return new Navigation(isAbsolute, numberOfDoubleDots, res);
}
var Position = class {
  segmentGroup;
  processChildren;
  index;
  constructor(segmentGroup, processChildren, index) {
    this.segmentGroup = segmentGroup;
    this.processChildren = processChildren;
    this.index = index;
  }
};
function findStartingPositionForTargetGroup(nav, root, target) {
  if (nav.isAbsolute) {
    return new Position(root, true, 0);
  }
  if (!target) {
    return new Position(root, false, NaN);
  }
  if (target.parent === null) {
    return new Position(target, true, 0);
  }
  const modifier = isMatrixParams(nav.commands[0]) ? 0 : 1;
  const index = target.segments.length - 1 + modifier;
  return createPositionApplyingDoubleDots(target, index, nav.numberOfDoubleDots);
}
function createPositionApplyingDoubleDots(group, index, numberOfDoubleDots) {
  let g = group;
  let ci = index;
  let dd = numberOfDoubleDots;
  while (dd > ci) {
    dd -= ci;
    g = g.parent;
    if (!g) {
      throw new RuntimeError(4005, (typeof ngDevMode === "undefined" || ngDevMode) && "Invalid number of '../'");
    }
    ci = g.segments.length;
  }
  return new Position(g, false, ci - dd);
}
function getOutlets(commands) {
  if (isCommandWithOutlets(commands[0])) {
    return commands[0].outlets;
  }
  return {
    [PRIMARY_OUTLET]: commands
  };
}
function updateSegmentGroup(segmentGroup, startIndex, commands) {
  segmentGroup ??= new UrlSegmentGroup([], {});
  if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {
    return updateSegmentGroupChildren(segmentGroup, startIndex, commands);
  }
  const m = prefixedWith(segmentGroup, startIndex, commands);
  const slicedCommands = commands.slice(m.commandIndex);
  if (m.match && m.pathIndex < segmentGroup.segments.length) {
    const g = new UrlSegmentGroup(segmentGroup.segments.slice(0, m.pathIndex), {});
    g.children[PRIMARY_OUTLET] = new UrlSegmentGroup(segmentGroup.segments.slice(m.pathIndex), segmentGroup.children);
    return updateSegmentGroupChildren(g, 0, slicedCommands);
  } else if (m.match && slicedCommands.length === 0) {
    return new UrlSegmentGroup(segmentGroup.segments, {});
  } else if (m.match && !segmentGroup.hasChildren()) {
    return createNewSegmentGroup(segmentGroup, startIndex, commands);
  } else if (m.match) {
    return updateSegmentGroupChildren(segmentGroup, 0, slicedCommands);
  } else {
    return createNewSegmentGroup(segmentGroup, startIndex, commands);
  }
}
function updateSegmentGroupChildren(segmentGroup, startIndex, commands) {
  if (commands.length === 0) {
    return new UrlSegmentGroup(segmentGroup.segments, {});
  } else {
    const outlets = getOutlets(commands);
    const children = {};
    if (Object.keys(outlets).some((o) => o !== PRIMARY_OUTLET) && segmentGroup.children[PRIMARY_OUTLET] && segmentGroup.numberOfChildren === 1 && segmentGroup.children[PRIMARY_OUTLET].segments.length === 0) {
      const childrenOfEmptyChild = updateSegmentGroupChildren(segmentGroup.children[PRIMARY_OUTLET], startIndex, commands);
      return new UrlSegmentGroup(segmentGroup.segments, childrenOfEmptyChild.children);
    }
    Object.entries(outlets).forEach(([outlet, commands2]) => {
      if (typeof commands2 === "string") {
        commands2 = [commands2];
      }
      if (commands2 !== null) {
        children[outlet] = updateSegmentGroup(segmentGroup.children[outlet], startIndex, commands2);
      }
    });
    Object.entries(segmentGroup.children).forEach(([childOutlet, child]) => {
      if (outlets[childOutlet] === void 0) {
        children[childOutlet] = child;
      }
    });
    return new UrlSegmentGroup(segmentGroup.segments, children);
  }
}
function prefixedWith(segmentGroup, startIndex, commands) {
  let currentCommandIndex = 0;
  let currentPathIndex = startIndex;
  const noMatch2 = {
    match: false,
    pathIndex: 0,
    commandIndex: 0
  };
  while (currentPathIndex < segmentGroup.segments.length) {
    if (currentCommandIndex >= commands.length) return noMatch2;
    const path = segmentGroup.segments[currentPathIndex];
    const command = commands[currentCommandIndex];
    if (isCommandWithOutlets(command)) {
      break;
    }
    const curr = `${command}`;
    const next = currentCommandIndex < commands.length - 1 ? commands[currentCommandIndex + 1] : null;
    if (currentPathIndex > 0 && curr === void 0) break;
    if (curr && next && typeof next === "object" && next.outlets === void 0) {
      if (!compare(curr, next, path)) return noMatch2;
      currentCommandIndex += 2;
    } else {
      if (!compare(curr, {}, path)) return noMatch2;
      currentCommandIndex++;
    }
    currentPathIndex++;
  }
  return {
    match: true,
    pathIndex: currentPathIndex,
    commandIndex: currentCommandIndex
  };
}
function createNewSegmentGroup(segmentGroup, startIndex, commands) {
  const paths = segmentGroup.segments.slice(0, startIndex);
  let i = 0;
  while (i < commands.length) {
    const command = commands[i];
    if (isCommandWithOutlets(command)) {
      const children = createNewSegmentChildren(command.outlets);
      return new UrlSegmentGroup(paths, children);
    }
    if (i === 0 && isMatrixParams(commands[0])) {
      const p = segmentGroup.segments[startIndex];
      paths.push(new UrlSegment(p.path, stringify2(commands[0])));
      i++;
      continue;
    }
    const curr = isCommandWithOutlets(command) ? command.outlets[PRIMARY_OUTLET] : `${command}`;
    const next = i < commands.length - 1 ? commands[i + 1] : null;
    if (curr && next && isMatrixParams(next)) {
      paths.push(new UrlSegment(curr, stringify2(next)));
      i += 2;
    } else {
      paths.push(new UrlSegment(curr, {}));
      i++;
    }
  }
  return new UrlSegmentGroup(paths, {});
}
function createNewSegmentChildren(outlets) {
  const children = {};
  Object.entries(outlets).forEach(([outlet, commands]) => {
    if (typeof commands === "string") {
      commands = [commands];
    }
    if (commands !== null) {
      children[outlet] = createNewSegmentGroup(new UrlSegmentGroup([], {}), 0, commands);
    }
  });
  return children;
}
function stringify2(params) {
  const res = {};
  Object.entries(params).forEach(([k, v]) => res[k] = `${v}`);
  return res;
}
function compare(path, params, segment) {
  return path == segment.path && shallowEqual(params, segment.parameters);
}
var IMPERATIVE_NAVIGATION = "imperative";
var EventType;
(function(EventType2) {
  EventType2[EventType2["NavigationStart"] = 0] = "NavigationStart";
  EventType2[EventType2["NavigationEnd"] = 1] = "NavigationEnd";
  EventType2[EventType2["NavigationCancel"] = 2] = "NavigationCancel";
  EventType2[EventType2["NavigationError"] = 3] = "NavigationError";
  EventType2[EventType2["RoutesRecognized"] = 4] = "RoutesRecognized";
  EventType2[EventType2["ResolveStart"] = 5] = "ResolveStart";
  EventType2[EventType2["ResolveEnd"] = 6] = "ResolveEnd";
  EventType2[EventType2["GuardsCheckStart"] = 7] = "GuardsCheckStart";
  EventType2[EventType2["GuardsCheckEnd"] = 8] = "GuardsCheckEnd";
  EventType2[EventType2["RouteConfigLoadStart"] = 9] = "RouteConfigLoadStart";
  EventType2[EventType2["RouteConfigLoadEnd"] = 10] = "RouteConfigLoadEnd";
  EventType2[EventType2["ChildActivationStart"] = 11] = "ChildActivationStart";
  EventType2[EventType2["ChildActivationEnd"] = 12] = "ChildActivationEnd";
  EventType2[EventType2["ActivationStart"] = 13] = "ActivationStart";
  EventType2[EventType2["ActivationEnd"] = 14] = "ActivationEnd";
  EventType2[EventType2["Scroll"] = 15] = "Scroll";
  EventType2[EventType2["NavigationSkipped"] = 16] = "NavigationSkipped";
})(EventType || (EventType = {}));
var RouterEvent = class {
  id;
  url;
  constructor(id, url) {
    this.id = id;
    this.url = url;
  }
};
var NavigationStart = class extends RouterEvent {
  type = EventType.NavigationStart;
  /**
   * Identifies the call or event that triggered the navigation.
   * An `imperative` trigger is a call to `router.navigateByUrl()` or `router.navigate()`.
   *
   * @see {@link NavigationEnd}
   * @see {@link NavigationCancel}
   * @see {@link NavigationError}
   */
  navigationTrigger;
  /**
   * The navigation state that was previously supplied to the `pushState` call,
   * when the navigation is triggered by a `popstate` event. Otherwise null.
   *
   * The state object is defined by `NavigationExtras`, and contains any
   * developer-defined state value, as well as a unique ID that
   * the router assigns to every router transition/navigation.
   *
   * From the perspective of the router, the router never "goes back".
   * When the user clicks on the back button in the browser,
   * a new navigation ID is created.
   *
   * Use the ID in this previous-state object to differentiate between a newly created
   * state and one returned to by a `popstate` event, so that you can restore some
   * remembered state, such as scroll position.
   *
   */
  restoredState;
  constructor(id, url, navigationTrigger = "imperative", restoredState = null) {
    super(id, url);
    this.navigationTrigger = navigationTrigger;
    this.restoredState = restoredState;
  }
  /** @docsNotRequired */
  toString() {
    return `NavigationStart(id: ${this.id}, url: '${this.url}')`;
  }
};
var NavigationEnd = class extends RouterEvent {
  urlAfterRedirects;
  type = EventType.NavigationEnd;
  constructor(id, url, urlAfterRedirects) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
  }
  /** @docsNotRequired */
  toString() {
    return `NavigationEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}')`;
  }
};
var NavigationCancellationCode;
(function(NavigationCancellationCode2) {
  NavigationCancellationCode2[NavigationCancellationCode2["Redirect"] = 0] = "Redirect";
  NavigationCancellationCode2[NavigationCancellationCode2["SupersededByNewNavigation"] = 1] = "SupersededByNewNavigation";
  NavigationCancellationCode2[NavigationCancellationCode2["NoDataFromResolver"] = 2] = "NoDataFromResolver";
  NavigationCancellationCode2[NavigationCancellationCode2["GuardRejected"] = 3] = "GuardRejected";
})(NavigationCancellationCode || (NavigationCancellationCode = {}));
var NavigationSkippedCode;
(function(NavigationSkippedCode2) {
  NavigationSkippedCode2[NavigationSkippedCode2["IgnoredSameUrlNavigation"] = 0] = "IgnoredSameUrlNavigation";
  NavigationSkippedCode2[NavigationSkippedCode2["IgnoredByUrlHandlingStrategy"] = 1] = "IgnoredByUrlHandlingStrategy";
})(NavigationSkippedCode || (NavigationSkippedCode = {}));
var NavigationCancel = class extends RouterEvent {
  reason;
  code;
  type = EventType.NavigationCancel;
  constructor(id, url, reason, code) {
    super(id, url);
    this.reason = reason;
    this.code = code;
  }
  /** @docsNotRequired */
  toString() {
    return `NavigationCancel(id: ${this.id}, url: '${this.url}')`;
  }
};
var NavigationSkipped = class extends RouterEvent {
  reason;
  code;
  type = EventType.NavigationSkipped;
  constructor(id, url, reason, code) {
    super(id, url);
    this.reason = reason;
    this.code = code;
  }
};
var NavigationError = class extends RouterEvent {
  error;
  target;
  type = EventType.NavigationError;
  constructor(id, url, error, target) {
    super(id, url);
    this.error = error;
    this.target = target;
  }
  /** @docsNotRequired */
  toString() {
    return `NavigationError(id: ${this.id}, url: '${this.url}', error: ${this.error})`;
  }
};
var RoutesRecognized = class extends RouterEvent {
  urlAfterRedirects;
  state;
  type = EventType.RoutesRecognized;
  constructor(id, url, urlAfterRedirects, state) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
    this.state = state;
  }
  /** @docsNotRequired */
  toString() {
    return `RoutesRecognized(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;
  }
};
var GuardsCheckStart = class extends RouterEvent {
  urlAfterRedirects;
  state;
  type = EventType.GuardsCheckStart;
  constructor(id, url, urlAfterRedirects, state) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
    this.state = state;
  }
  toString() {
    return `GuardsCheckStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;
  }
};
var GuardsCheckEnd = class extends RouterEvent {
  urlAfterRedirects;
  state;
  shouldActivate;
  type = EventType.GuardsCheckEnd;
  constructor(id, url, urlAfterRedirects, state, shouldActivate) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
    this.state = state;
    this.shouldActivate = shouldActivate;
  }
  toString() {
    return `GuardsCheckEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state}, shouldActivate: ${this.shouldActivate})`;
  }
};
var ResolveStart = class extends RouterEvent {
  urlAfterRedirects;
  state;
  type = EventType.ResolveStart;
  constructor(id, url, urlAfterRedirects, state) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
    this.state = state;
  }
  toString() {
    return `ResolveStart(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;
  }
};
var ResolveEnd = class extends RouterEvent {
  urlAfterRedirects;
  state;
  type = EventType.ResolveEnd;
  constructor(id, url, urlAfterRedirects, state) {
    super(id, url);
    this.urlAfterRedirects = urlAfterRedirects;
    this.state = state;
  }
  toString() {
    return `ResolveEnd(id: ${this.id}, url: '${this.url}', urlAfterRedirects: '${this.urlAfterRedirects}', state: ${this.state})`;
  }
};
var RouteConfigLoadStart = class {
  route;
  type = EventType.RouteConfigLoadStart;
  constructor(route) {
    this.route = route;
  }
  toString() {
    return `RouteConfigLoadStart(path: ${this.route.path})`;
  }
};
var RouteConfigLoadEnd = class {
  route;
  type = EventType.RouteConfigLoadEnd;
  constructor(route) {
    this.route = route;
  }
  toString() {
    return `RouteConfigLoadEnd(path: ${this.route.path})`;
  }
};
var ChildActivationStart = class {
  snapshot;
  type = EventType.ChildActivationStart;
  constructor(snapshot) {
    this.snapshot = snapshot;
  }
  toString() {
    const path = this.snapshot.routeConfig && this.snapshot.routeConfig.path || "";
    return `ChildActivationStart(path: '${path}')`;
  }
};
var ChildActivationEnd = class {
  snapshot;
  type = EventType.ChildActivationEnd;
  constructor(snapshot) {
    this.snapshot = snapshot;
  }
  toString() {
    const path = this.snapshot.routeConfig && this.snapshot.routeConfig.path || "";
    return `ChildActivationEnd(path: '${path}')`;
  }
};
var ActivationStart = class {
  snapshot;
  type = EventType.ActivationStart;
  constructor(snapshot) {
    this.snapshot = snapshot;
  }
  toString() {
    const path = this.snapshot.routeConfig && this.snapshot.routeConfig.path || "";
    return `ActivationStart(path: '${path}')`;
  }
};
var ActivationEnd = class {
  snapshot;
  type = EventType.ActivationEnd;
  constructor(snapshot) {
    this.snapshot = snapshot;
  }
  toString() {
    const path = this.snapshot.routeConfig && this.snapshot.routeConfig.path || "";
    return `ActivationEnd(path: '${path}')`;
  }
};
var Scroll = class {
  routerEvent;
  position;
  anchor;
  type = EventType.Scroll;
  constructor(routerEvent, position, anchor) {
    this.routerEvent = routerEvent;
    this.position = position;
    this.anchor = anchor;
  }
  toString() {
    const pos = this.position ? `${this.position[0]}, ${this.position[1]}` : null;
    return `Scroll(anchor: '${this.anchor}', position: '${pos}')`;
  }
};
var BeforeActivateRoutes = class {
};
var RedirectRequest = class {
  url;
  navigationBehaviorOptions;
  constructor(url, navigationBehaviorOptions) {
    this.url = url;
    this.navigationBehaviorOptions = navigationBehaviorOptions;
  }
};
function stringifyEvent(routerEvent) {
  switch (routerEvent.type) {
    case EventType.ActivationEnd:
      return `ActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ""}')`;
    case EventType.ActivationStart:
      return `ActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ""}')`;
    case EventType.ChildActivationEnd:
      return `ChildActivationEnd(path: '${routerEvent.snapshot.routeConfig?.path || ""}')`;
    case EventType.ChildActivationStart:
      return `ChildActivationStart(path: '${routerEvent.snapshot.routeConfig?.path || ""}')`;
    case EventType.GuardsCheckEnd:
      return `GuardsCheckEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state}, shouldActivate: ${routerEvent.shouldActivate})`;
    case EventType.GuardsCheckStart:
      return `GuardsCheckStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;
    case EventType.NavigationCancel:
      return `NavigationCancel(id: ${routerEvent.id}, url: '${routerEvent.url}')`;
    case EventType.NavigationSkipped:
      return `NavigationSkipped(id: ${routerEvent.id}, url: '${routerEvent.url}')`;
    case EventType.NavigationEnd:
      return `NavigationEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}')`;
    case EventType.NavigationError:
      return `NavigationError(id: ${routerEvent.id}, url: '${routerEvent.url}', error: ${routerEvent.error})`;
    case EventType.NavigationStart:
      return `NavigationStart(id: ${routerEvent.id}, url: '${routerEvent.url}')`;
    case EventType.ResolveEnd:
      return `ResolveEnd(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;
    case EventType.ResolveStart:
      return `ResolveStart(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;
    case EventType.RouteConfigLoadEnd:
      return `RouteConfigLoadEnd(path: ${routerEvent.route.path})`;
    case EventType.RouteConfigLoadStart:
      return `RouteConfigLoadStart(path: ${routerEvent.route.path})`;
    case EventType.RoutesRecognized:
      return `RoutesRecognized(id: ${routerEvent.id}, url: '${routerEvent.url}', urlAfterRedirects: '${routerEvent.urlAfterRedirects}', state: ${routerEvent.state})`;
    case EventType.Scroll:
      const pos = routerEvent.position ? `${routerEvent.position[0]}, ${routerEvent.position[1]}` : null;
      return `Scroll(anchor: '${routerEvent.anchor}', position: '${pos}')`;
  }
}
function getOrCreateRouteInjectorIfNeeded(route, currentInjector) {
  if (route.providers && !route._injector) {
    route._injector = createEnvironmentInjector(route.providers, currentInjector, `Route: ${route.path}`);
  }
  return route._injector ?? currentInjector;
}
function validateConfig(config, parentPath = "", requireStandaloneComponents = false) {
  for (let i = 0; i < config.length; i++) {
    const route = config[i];
    const fullPath = getFullPath(parentPath, route);
    validateNode(route, fullPath, requireStandaloneComponents);
  }
}
function assertStandalone(fullPath, component) {
  if (component && isNgModule(component)) {
    throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}'. You are using 'loadComponent' with a module, but it must be used with standalone components. Use 'loadChildren' instead.`);
  } else if (component && !isStandalone(component)) {
    throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}'. The component must be standalone.`);
  }
}
function validateNode(route, fullPath, requireStandaloneComponents) {
  if (typeof ngDevMode === "undefined" || ngDevMode) {
    if (!route) {
      throw new RuntimeError(4014, `
      Invalid configuration of route '${fullPath}': Encountered undefined route.
      The reason might be an extra comma.

      Example:
      const routes: Routes = [
        { path: '', redirectTo: '/dashboard', pathMatch: 'full' },
        { path: 'dashboard',  component: DashboardComponent },, << two commas
        { path: 'detail/:id', component: HeroDetailComponent }
      ];
    `);
    }
    if (Array.isArray(route)) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': Array cannot be specified`);
    }
    if (!route.redirectTo && !route.component && !route.loadComponent && !route.children && !route.loadChildren && route.outlet && route.outlet !== PRIMARY_OUTLET) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': a componentless route without children or loadChildren cannot have a named outlet set`);
    }
    if (route.redirectTo && route.children) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': redirectTo and children cannot be used together`);
    }
    if (route.redirectTo && route.loadChildren) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': redirectTo and loadChildren cannot be used together`);
    }
    if (route.children && route.loadChildren) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': children and loadChildren cannot be used together`);
    }
    if (route.redirectTo && (route.component || route.loadComponent)) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': redirectTo and component/loadComponent cannot be used together`);
    }
    if (route.component && route.loadComponent) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': component and loadComponent cannot be used together`);
    }
    if (route.redirectTo && route.canActivate) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': redirectTo and canActivate cannot be used together. Redirects happen before activation so canActivate will never be executed.`);
    }
    if (route.path && route.matcher) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': path and matcher cannot be used together`);
    }
    if (route.redirectTo === void 0 && !route.component && !route.loadComponent && !route.children && !route.loadChildren) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}'. One of the following must be provided: component, loadComponent, redirectTo, children or loadChildren`);
    }
    if (route.path === void 0 && route.matcher === void 0) {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': routes must have either a path or a matcher specified`);
    }
    if (typeof route.path === "string" && route.path.charAt(0) === "/") {
      throw new RuntimeError(4014, `Invalid configuration of route '${fullPath}': path cannot start with a slash`);
    }
    if (route.path === "" && route.redirectTo !== void 0 && route.pathMatch === void 0) {
      const exp = `The default value of 'pathMatch' is 'prefix', but often the intent is to use 'full'.`;
      throw new RuntimeError(4014, `Invalid configuration of route '{path: "${fullPath}", redirectTo: "${route.redirectTo}"}': please provide 'pathMatch'. ${exp}`);
    }
    if (requireStandaloneComponents) {
      assertStandalone(fullPath, route.component);
    }
  }
  if (route.children) {
    validateConfig(route.children, fullPath, requireStandaloneComponents);
  }
}
function getFullPath(parentPath, currentRoute) {
  if (!currentRoute) {
    return parentPath;
  }
  if (!parentPath && !currentRoute.path) {
    return "";
  } else if (parentPath && !currentRoute.path) {
    return `${parentPath}/`;
  } else if (!parentPath && currentRoute.path) {
    return currentRoute.path;
  } else {
    return `${parentPath}/${currentRoute.path}`;
  }
}
function getOutlet(route) {
  return route.outlet || PRIMARY_OUTLET;
}
function sortByMatchingOutlets(routes, outletName) {
  const sortedConfig = routes.filter((r) => getOutlet(r) === outletName);
  sortedConfig.push(...routes.filter((r) => getOutlet(r) !== outletName));
  return sortedConfig;
}
function getClosestRouteInjector(snapshot) {
  if (!snapshot) return null;
  if (snapshot.routeConfig?._injector) {
    return snapshot.routeConfig._injector;
  }
  for (let s = snapshot.parent; s; s = s.parent) {
    const route = s.routeConfig;
    if (route?._loadedInjector) return route._loadedInjector;
    if (route?._injector) return route._injector;
  }
  return null;
}
var OutletContext = class {
  rootInjector;
  outlet = null;
  route = null;
  children;
  attachRef = null;
  get injector() {
    return getClosestRouteInjector(this.route?.snapshot) ?? this.rootInjector;
  }
  constructor(rootInjector) {
    this.rootInjector = rootInjector;
    this.children = new ChildrenOutletContexts(this.rootInjector);
  }
};
var ChildrenOutletContexts = class _ChildrenOutletContexts {
  rootInjector;
  // contexts for child outlets, by name.
  contexts = /* @__PURE__ */ new Map();
  /** @nodoc */
  constructor(rootInjector) {
    this.rootInjector = rootInjector;
  }
  /** Called when a `RouterOutlet` directive is instantiated */
  onChildOutletCreated(childName, outlet) {
    const context = this.getOrCreateContext(childName);
    context.outlet = outlet;
    this.contexts.set(childName, context);
  }
  /**
   * Called when a `RouterOutlet` directive is destroyed.
   * We need to keep the context as the outlet could be destroyed inside a NgIf and might be
   * re-created later.
   */
  onChildOutletDestroyed(childName) {
    const context = this.getContext(childName);
    if (context) {
      context.outlet = null;
      context.attachRef = null;
    }
  }
  /**
   * Called when the corresponding route is deactivated during navigation.
   * Because the component get destroyed, all children outlet are destroyed.
   */
  onOutletDeactivated() {
    const contexts = this.contexts;
    this.contexts = /* @__PURE__ */ new Map();
    return contexts;
  }
  onOutletReAttached(contexts) {
    this.contexts = contexts;
  }
  getOrCreateContext(childName) {
    let context = this.getContext(childName);
    if (!context) {
      context = new OutletContext(this.rootInjector);
      this.contexts.set(childName, context);
    }
    return context;
  }
  getContext(childName) {
    return this.contexts.get(childName) || null;
  }
  static \u0275fac = function ChildrenOutletContexts_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _ChildrenOutletContexts)(\u0275\u0275inject(EnvironmentInjector));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _ChildrenOutletContexts,
    factory: _ChildrenOutletContexts.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(ChildrenOutletContexts, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: EnvironmentInjector
  }], null);
})();
var Tree = class {
  /** @internal */
  _root;
  constructor(root) {
    this._root = root;
  }
  get root() {
    return this._root.value;
  }
  /**
   * @internal
   */
  parent(t) {
    const p = this.pathFromRoot(t);
    return p.length > 1 ? p[p.length - 2] : null;
  }
  /**
   * @internal
   */
  children(t) {
    const n = findNode(t, this._root);
    return n ? n.children.map((t2) => t2.value) : [];
  }
  /**
   * @internal
   */
  firstChild(t) {
    const n = findNode(t, this._root);
    return n && n.children.length > 0 ? n.children[0].value : null;
  }
  /**
   * @internal
   */
  siblings(t) {
    const p = findPath(t, this._root);
    if (p.length < 2) return [];
    const c = p[p.length - 2].children.map((c2) => c2.value);
    return c.filter((cc) => cc !== t);
  }
  /**
   * @internal
   */
  pathFromRoot(t) {
    return findPath(t, this._root).map((s) => s.value);
  }
};
function findNode(value, node) {
  if (value === node.value) return node;
  for (const child of node.children) {
    const node2 = findNode(value, child);
    if (node2) return node2;
  }
  return null;
}
function findPath(value, node) {
  if (value === node.value) return [node];
  for (const child of node.children) {
    const path = findPath(value, child);
    if (path.length) {
      path.unshift(node);
      return path;
    }
  }
  return [];
}
var TreeNode = class {
  value;
  children;
  constructor(value, children) {
    this.value = value;
    this.children = children;
  }
  toString() {
    return `TreeNode(${this.value})`;
  }
};
function nodeChildrenAsMap(node) {
  const map2 = {};
  if (node) {
    node.children.forEach((child) => map2[child.value.outlet] = child);
  }
  return map2;
}
var RouterState = class extends Tree {
  snapshot;
  /** @internal */
  constructor(root, snapshot) {
    super(root);
    this.snapshot = snapshot;
    setRouterState(this, root);
  }
  toString() {
    return this.snapshot.toString();
  }
};
function createEmptyState(rootComponent) {
  const snapshot = createEmptyStateSnapshot(rootComponent);
  const emptyUrl = new BehaviorSubject([new UrlSegment("", {})]);
  const emptyParams = new BehaviorSubject({});
  const emptyData = new BehaviorSubject({});
  const emptyQueryParams = new BehaviorSubject({});
  const fragment = new BehaviorSubject("");
  const activated = new ActivatedRoute(emptyUrl, emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, snapshot.root);
  activated.snapshot = snapshot.root;
  return new RouterState(new TreeNode(activated, []), snapshot);
}
function createEmptyStateSnapshot(rootComponent) {
  const emptyParams = {};
  const emptyData = {};
  const emptyQueryParams = {};
  const fragment = "";
  const activated = new ActivatedRouteSnapshot([], emptyParams, emptyQueryParams, fragment, emptyData, PRIMARY_OUTLET, rootComponent, null, {});
  return new RouterStateSnapshot("", new TreeNode(activated, []));
}
var ActivatedRoute = class {
  urlSubject;
  paramsSubject;
  queryParamsSubject;
  fragmentSubject;
  dataSubject;
  outlet;
  component;
  /** The current snapshot of this route */
  snapshot;
  /** @internal */
  _futureSnapshot;
  /** @internal */
  _routerState;
  /** @internal */
  _paramMap;
  /** @internal */
  _queryParamMap;
  /** An Observable of the resolved route title */
  title;
  /** An observable of the URL segments matched by this route. */
  url;
  /** An observable of the matrix parameters scoped to this route. */
  params;
  /** An observable of the query parameters shared by all the routes. */
  queryParams;
  /** An observable of the URL fragment shared by all the routes. */
  fragment;
  /** An observable of the static and resolved data of this route. */
  data;
  /** @internal */
  constructor(urlSubject, paramsSubject, queryParamsSubject, fragmentSubject, dataSubject, outlet, component, futureSnapshot) {
    this.urlSubject = urlSubject;
    this.paramsSubject = paramsSubject;
    this.queryParamsSubject = queryParamsSubject;
    this.fragmentSubject = fragmentSubject;
    this.dataSubject = dataSubject;
    this.outlet = outlet;
    this.component = component;
    this._futureSnapshot = futureSnapshot;
    this.title = this.dataSubject?.pipe(map((d) => d[RouteTitleKey])) ?? of(void 0);
    this.url = urlSubject;
    this.params = paramsSubject;
    this.queryParams = queryParamsSubject;
    this.fragment = fragmentSubject;
    this.data = dataSubject;
  }
  /** The configuration used to match this route. */
  get routeConfig() {
    return this._futureSnapshot.routeConfig;
  }
  /** The root of the router state. */
  get root() {
    return this._routerState.root;
  }
  /** The parent of this route in the router state tree. */
  get parent() {
    return this._routerState.parent(this);
  }
  /** The first child of this route in the router state tree. */
  get firstChild() {
    return this._routerState.firstChild(this);
  }
  /** The children of this route in the router state tree. */
  get children() {
    return this._routerState.children(this);
  }
  /** The path from the root of the router state tree to this route. */
  get pathFromRoot() {
    return this._routerState.pathFromRoot(this);
  }
  /**
   * An Observable that contains a map of the required and optional parameters
   * specific to the route.
   * The map supports retrieving single and multiple values from the same parameter.
   */
  get paramMap() {
    this._paramMap ??= this.params.pipe(map((p) => convertToParamMap(p)));
    return this._paramMap;
  }
  /**
   * An Observable that contains a map of the query parameters available to all routes.
   * The map supports retrieving single and multiple values from the query parameter.
   */
  get queryParamMap() {
    this._queryParamMap ??= this.queryParams.pipe(map((p) => convertToParamMap(p)));
    return this._queryParamMap;
  }
  toString() {
    return this.snapshot ? this.snapshot.toString() : `Future(${this._futureSnapshot})`;
  }
};
function getInherited(route, parent, paramsInheritanceStrategy = "emptyOnly") {
  let inherited;
  const {
    routeConfig
  } = route;
  if (parent !== null && (paramsInheritanceStrategy === "always" || // inherit parent data if route is empty path
  routeConfig?.path === "" || // inherit parent data if parent was componentless
  !parent.component && !parent.routeConfig?.loadComponent)) {
    inherited = {
      params: __spreadValues(__spreadValues({}, parent.params), route.params),
      data: __spreadValues(__spreadValues({}, parent.data), route.data),
      resolve: __spreadValues(__spreadValues(__spreadValues(__spreadValues({}, route.data), parent.data), routeConfig?.data), route._resolvedData)
    };
  } else {
    inherited = {
      params: __spreadValues({}, route.params),
      data: __spreadValues({}, route.data),
      resolve: __spreadValues(__spreadValues({}, route.data), route._resolvedData ?? {})
    };
  }
  if (routeConfig && hasStaticTitle(routeConfig)) {
    inherited.resolve[RouteTitleKey] = routeConfig.title;
  }
  return inherited;
}
var ActivatedRouteSnapshot = class {
  url;
  params;
  queryParams;
  fragment;
  data;
  outlet;
  component;
  /** The configuration used to match this route **/
  routeConfig;
  /** @internal */
  _resolve;
  /** @internal */
  _resolvedData;
  /** @internal */
  _routerState;
  /** @internal */
  _paramMap;
  /** @internal */
  _queryParamMap;
  /** The resolved route title */
  get title() {
    return this.data?.[RouteTitleKey];
  }
  /** @internal */
  constructor(url, params, queryParams, fragment, data, outlet, component, routeConfig, resolve) {
    this.url = url;
    this.params = params;
    this.queryParams = queryParams;
    this.fragment = fragment;
    this.data = data;
    this.outlet = outlet;
    this.component = component;
    this.routeConfig = routeConfig;
    this._resolve = resolve;
  }
  /** The root of the router state */
  get root() {
    return this._routerState.root;
  }
  /** The parent of this route in the router state tree */
  get parent() {
    return this._routerState.parent(this);
  }
  /** The first child of this route in the router state tree */
  get firstChild() {
    return this._routerState.firstChild(this);
  }
  /** The children of this route in the router state tree */
  get children() {
    return this._routerState.children(this);
  }
  /** The path from the root of the router state tree to this route */
  get pathFromRoot() {
    return this._routerState.pathFromRoot(this);
  }
  get paramMap() {
    this._paramMap ??= convertToParamMap(this.params);
    return this._paramMap;
  }
  get queryParamMap() {
    this._queryParamMap ??= convertToParamMap(this.queryParams);
    return this._queryParamMap;
  }
  toString() {
    const url = this.url.map((segment) => segment.toString()).join("/");
    const matched = this.routeConfig ? this.routeConfig.path : "";
    return `Route(url:'${url}', path:'${matched}')`;
  }
};
var RouterStateSnapshot = class extends Tree {
  url;
  /** @internal */
  constructor(url, root) {
    super(root);
    this.url = url;
    setRouterState(this, root);
  }
  toString() {
    return serializeNode(this._root);
  }
};
function setRouterState(state, node) {
  node.value._routerState = state;
  node.children.forEach((c) => setRouterState(state, c));
}
function serializeNode(node) {
  const c = node.children.length > 0 ? ` { ${node.children.map(serializeNode).join(", ")} } ` : "";
  return `${node.value}${c}`;
}
function advanceActivatedRoute(route) {
  if (route.snapshot) {
    const currentSnapshot = route.snapshot;
    const nextSnapshot = route._futureSnapshot;
    route.snapshot = nextSnapshot;
    if (!shallowEqual(currentSnapshot.queryParams, nextSnapshot.queryParams)) {
      route.queryParamsSubject.next(nextSnapshot.queryParams);
    }
    if (currentSnapshot.fragment !== nextSnapshot.fragment) {
      route.fragmentSubject.next(nextSnapshot.fragment);
    }
    if (!shallowEqual(currentSnapshot.params, nextSnapshot.params)) {
      route.paramsSubject.next(nextSnapshot.params);
    }
    if (!shallowEqualArrays(currentSnapshot.url, nextSnapshot.url)) {
      route.urlSubject.next(nextSnapshot.url);
    }
    if (!shallowEqual(currentSnapshot.data, nextSnapshot.data)) {
      route.dataSubject.next(nextSnapshot.data);
    }
  } else {
    route.snapshot = route._futureSnapshot;
    route.dataSubject.next(route._futureSnapshot.data);
  }
}
function equalParamsAndUrlSegments(a, b) {
  const equalUrlParams = shallowEqual(a.params, b.params) && equalSegments(a.url, b.url);
  const parentsMismatch = !a.parent !== !b.parent;
  return equalUrlParams && !parentsMismatch && (!a.parent || equalParamsAndUrlSegments(a.parent, b.parent));
}
function hasStaticTitle(config) {
  return typeof config.title === "string" || config.title === null;
}
var ROUTER_OUTLET_DATA = new InjectionToken(ngDevMode ? "RouterOutlet data" : "");
var RouterOutlet = class _RouterOutlet {
  activated = null;
  /** @internal */
  get activatedComponentRef() {
    return this.activated;
  }
  _activatedRoute = null;
  /**
   * The name of the outlet
   *
   */
  name = PRIMARY_OUTLET;
  activateEvents = new EventEmitter();
  deactivateEvents = new EventEmitter();
  /**
   * Emits an attached component instance when the `RouteReuseStrategy` instructs to re-attach a
   * previously detached subtree.
   **/
  attachEvents = new EventEmitter();
  /**
   * Emits a detached component instance when the `RouteReuseStrategy` instructs to detach the
   * subtree.
   */
  detachEvents = new EventEmitter();
  /**
   * Data that will be provided to the child injector through the `ROUTER_OUTLET_DATA` token.
   *
   * When unset, the value of the token is `undefined` by default.
   */
  routerOutletData = input(void 0);
  parentContexts = inject(ChildrenOutletContexts);
  location = inject(ViewContainerRef);
  changeDetector = inject(ChangeDetectorRef);
  inputBinder = inject(INPUT_BINDER, {
    optional: true
  });
  /** @nodoc */
  supportsBindingToComponentInputs = true;
  /** @nodoc */
  ngOnChanges(changes) {
    if (changes["name"]) {
      const {
        firstChange,
        previousValue
      } = changes["name"];
      if (firstChange) {
        return;
      }
      if (this.isTrackedInParentContexts(previousValue)) {
        this.deactivate();
        this.parentContexts.onChildOutletDestroyed(previousValue);
      }
      this.initializeOutletWithName();
    }
  }
  /** @nodoc */
  ngOnDestroy() {
    if (this.isTrackedInParentContexts(this.name)) {
      this.parentContexts.onChildOutletDestroyed(this.name);
    }
    this.inputBinder?.unsubscribeFromRouteData(this);
  }
  isTrackedInParentContexts(outletName) {
    return this.parentContexts.getContext(outletName)?.outlet === this;
  }
  /** @nodoc */
  ngOnInit() {
    this.initializeOutletWithName();
  }
  initializeOutletWithName() {
    this.parentContexts.onChildOutletCreated(this.name, this);
    if (this.activated) {
      return;
    }
    const context = this.parentContexts.getContext(this.name);
    if (context?.route) {
      if (context.attachRef) {
        this.attach(context.attachRef, context.route);
      } else {
        this.activateWith(context.route, context.injector);
      }
    }
  }
  get isActivated() {
    return !!this.activated;
  }
  /**
   * @returns The currently activated component instance.
   * @throws An error if the outlet is not activated.
   */
  get component() {
    if (!this.activated) throw new RuntimeError(4012, (typeof ngDevMode === "undefined" || ngDevMode) && "Outlet is not activated");
    return this.activated.instance;
  }
  get activatedRoute() {
    if (!this.activated) throw new RuntimeError(4012, (typeof ngDevMode === "undefined" || ngDevMode) && "Outlet is not activated");
    return this._activatedRoute;
  }
  get activatedRouteData() {
    if (this._activatedRoute) {
      return this._activatedRoute.snapshot.data;
    }
    return {};
  }
  /**
   * Called when the `RouteReuseStrategy` instructs to detach the subtree
   */
  detach() {
    if (!this.activated) throw new RuntimeError(4012, (typeof ngDevMode === "undefined" || ngDevMode) && "Outlet is not activated");
    this.location.detach();
    const cmp = this.activated;
    this.activated = null;
    this._activatedRoute = null;
    this.detachEvents.emit(cmp.instance);
    return cmp;
  }
  /**
   * Called when the `RouteReuseStrategy` instructs to re-attach a previously detached subtree
   */
  attach(ref, activatedRoute) {
    this.activated = ref;
    this._activatedRoute = activatedRoute;
    this.location.insert(ref.hostView);
    this.inputBinder?.bindActivatedRouteToOutletComponent(this);
    this.attachEvents.emit(ref.instance);
  }
  deactivate() {
    if (this.activated) {
      const c = this.component;
      this.activated.destroy();
      this.activated = null;
      this._activatedRoute = null;
      this.deactivateEvents.emit(c);
    }
  }
  activateWith(activatedRoute, environmentInjector) {
    if (this.isActivated) {
      throw new RuntimeError(4013, (typeof ngDevMode === "undefined" || ngDevMode) && "Cannot activate an already activated outlet");
    }
    this._activatedRoute = activatedRoute;
    const location = this.location;
    const snapshot = activatedRoute.snapshot;
    const component = snapshot.component;
    const childContexts = this.parentContexts.getOrCreateContext(this.name).children;
    const injector = new OutletInjector(activatedRoute, childContexts, location.injector, this.routerOutletData);
    this.activated = location.createComponent(component, {
      index: location.length,
      injector,
      environmentInjector
    });
    this.changeDetector.markForCheck();
    this.inputBinder?.bindActivatedRouteToOutletComponent(this);
    this.activateEvents.emit(this.activated.instance);
  }
  static \u0275fac = function RouterOutlet_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterOutlet)();
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _RouterOutlet,
    selectors: [["router-outlet"]],
    inputs: {
      name: "name",
      routerOutletData: [1, "routerOutletData"]
    },
    outputs: {
      activateEvents: "activate",
      deactivateEvents: "deactivate",
      attachEvents: "attach",
      detachEvents: "detach"
    },
    exportAs: ["outlet"],
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterOutlet, [{
    type: Directive,
    args: [{
      selector: "router-outlet",
      exportAs: "outlet"
    }]
  }], null, {
    name: [{
      type: Input
    }],
    activateEvents: [{
      type: Output,
      args: ["activate"]
    }],
    deactivateEvents: [{
      type: Output,
      args: ["deactivate"]
    }],
    attachEvents: [{
      type: Output,
      args: ["attach"]
    }],
    detachEvents: [{
      type: Output,
      args: ["detach"]
    }]
  });
})();
var OutletInjector = class _OutletInjector {
  route;
  childContexts;
  parent;
  outletData;
  /**
   * This injector has a special handing for the `ActivatedRoute` and
   * `ChildrenOutletContexts` tokens: it returns corresponding values for those
   * tokens dynamically. This behavior is different from the regular injector logic,
   * when we initialize and store a value, which is later returned for all inject
   * requests.
   *
   * In some cases (e.g. when using `@defer`), this dynamic behavior requires special
   * handling. This function allows to identify an instance of the `OutletInjector` and
   * create an instance of it without referring to the class itself (so this logic can
   * be invoked from the `core` package). This helps to retain dynamic behavior for the
   * mentioned tokens.
   *
   * Note: it's a temporary solution and we should explore how to support this case better.
   */
  __ngOutletInjector(parentInjector) {
    return new _OutletInjector(this.route, this.childContexts, parentInjector, this.outletData);
  }
  constructor(route, childContexts, parent, outletData) {
    this.route = route;
    this.childContexts = childContexts;
    this.parent = parent;
    this.outletData = outletData;
  }
  get(token, notFoundValue) {
    if (token === ActivatedRoute) {
      return this.route;
    }
    if (token === ChildrenOutletContexts) {
      return this.childContexts;
    }
    if (token === ROUTER_OUTLET_DATA) {
      return this.outletData;
    }
    return this.parent.get(token, notFoundValue);
  }
};
var INPUT_BINDER = new InjectionToken("");
var RoutedComponentInputBinder = class _RoutedComponentInputBinder {
  outletDataSubscriptions = /* @__PURE__ */ new Map();
  bindActivatedRouteToOutletComponent(outlet) {
    this.unsubscribeFromRouteData(outlet);
    this.subscribeToRouteData(outlet);
  }
  unsubscribeFromRouteData(outlet) {
    this.outletDataSubscriptions.get(outlet)?.unsubscribe();
    this.outletDataSubscriptions.delete(outlet);
  }
  subscribeToRouteData(outlet) {
    const {
      activatedRoute
    } = outlet;
    const dataSubscription = combineLatest([activatedRoute.queryParams, activatedRoute.params, activatedRoute.data]).pipe(switchMap(([queryParams, params, data], index) => {
      data = __spreadValues(__spreadValues(__spreadValues({}, queryParams), params), data);
      if (index === 0) {
        return of(data);
      }
      return Promise.resolve(data);
    })).subscribe((data) => {
      if (!outlet.isActivated || !outlet.activatedComponentRef || outlet.activatedRoute !== activatedRoute || activatedRoute.component === null) {
        this.unsubscribeFromRouteData(outlet);
        return;
      }
      const mirror = reflectComponentType(activatedRoute.component);
      if (!mirror) {
        this.unsubscribeFromRouteData(outlet);
        return;
      }
      for (const {
        templateName
      } of mirror.inputs) {
        outlet.activatedComponentRef.setInput(templateName, data[templateName]);
      }
    });
    this.outletDataSubscriptions.set(outlet, dataSubscription);
  }
  static \u0275fac = function RoutedComponentInputBinder_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RoutedComponentInputBinder)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _RoutedComponentInputBinder,
    factory: _RoutedComponentInputBinder.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RoutedComponentInputBinder, [{
    type: Injectable
  }], null, null);
})();
function createRouterState(routeReuseStrategy, curr, prevState) {
  const root = createNode(routeReuseStrategy, curr._root, prevState ? prevState._root : void 0);
  return new RouterState(root, curr);
}
function createNode(routeReuseStrategy, curr, prevState) {
  if (prevState && routeReuseStrategy.shouldReuseRoute(curr.value, prevState.value.snapshot)) {
    const value = prevState.value;
    value._futureSnapshot = curr.value;
    const children = createOrReuseChildren(routeReuseStrategy, curr, prevState);
    return new TreeNode(value, children);
  } else {
    if (routeReuseStrategy.shouldAttach(curr.value)) {
      const detachedRouteHandle = routeReuseStrategy.retrieve(curr.value);
      if (detachedRouteHandle !== null) {
        const tree2 = detachedRouteHandle.route;
        tree2.value._futureSnapshot = curr.value;
        tree2.children = curr.children.map((c) => createNode(routeReuseStrategy, c));
        return tree2;
      }
    }
    const value = createActivatedRoute(curr.value);
    const children = curr.children.map((c) => createNode(routeReuseStrategy, c));
    return new TreeNode(value, children);
  }
}
function createOrReuseChildren(routeReuseStrategy, curr, prevState) {
  return curr.children.map((child) => {
    for (const p of prevState.children) {
      if (routeReuseStrategy.shouldReuseRoute(child.value, p.value.snapshot)) {
        return createNode(routeReuseStrategy, child, p);
      }
    }
    return createNode(routeReuseStrategy, child);
  });
}
function createActivatedRoute(c) {
  return new ActivatedRoute(new BehaviorSubject(c.url), new BehaviorSubject(c.params), new BehaviorSubject(c.queryParams), new BehaviorSubject(c.fragment), new BehaviorSubject(c.data), c.outlet, c.component, c);
}
var RedirectCommand = class {
  redirectTo;
  navigationBehaviorOptions;
  constructor(redirectTo, navigationBehaviorOptions) {
    this.redirectTo = redirectTo;
    this.navigationBehaviorOptions = navigationBehaviorOptions;
  }
};
var NAVIGATION_CANCELING_ERROR = "ngNavigationCancelingError";
function redirectingNavigationError(urlSerializer, redirect) {
  const {
    redirectTo,
    navigationBehaviorOptions
  } = isUrlTree(redirect) ? {
    redirectTo: redirect,
    navigationBehaviorOptions: void 0
  } : redirect;
  const error = navigationCancelingError(ngDevMode && `Redirecting to "${urlSerializer.serialize(redirectTo)}"`, NavigationCancellationCode.Redirect);
  error.url = redirectTo;
  error.navigationBehaviorOptions = navigationBehaviorOptions;
  return error;
}
function navigationCancelingError(message, code) {
  const error = new Error(`NavigationCancelingError: ${message || ""}`);
  error[NAVIGATION_CANCELING_ERROR] = true;
  error.cancellationCode = code;
  return error;
}
function isRedirectingNavigationCancelingError(error) {
  return isNavigationCancelingError(error) && isUrlTree(error.url);
}
function isNavigationCancelingError(error) {
  return !!error && error[NAVIGATION_CANCELING_ERROR];
}
var warnedAboutUnsupportedInputBinding = false;
var activateRoutes = (rootContexts, routeReuseStrategy, forwardEvent, inputBindingEnabled) => map((t) => {
  new ActivateRoutes(routeReuseStrategy, t.targetRouterState, t.currentRouterState, forwardEvent, inputBindingEnabled).activate(rootContexts);
  return t;
});
var ActivateRoutes = class {
  routeReuseStrategy;
  futureState;
  currState;
  forwardEvent;
  inputBindingEnabled;
  constructor(routeReuseStrategy, futureState, currState, forwardEvent, inputBindingEnabled) {
    this.routeReuseStrategy = routeReuseStrategy;
    this.futureState = futureState;
    this.currState = currState;
    this.forwardEvent = forwardEvent;
    this.inputBindingEnabled = inputBindingEnabled;
  }
  activate(parentContexts) {
    const futureRoot = this.futureState._root;
    const currRoot = this.currState ? this.currState._root : null;
    this.deactivateChildRoutes(futureRoot, currRoot, parentContexts);
    advanceActivatedRoute(this.futureState.root);
    this.activateChildRoutes(futureRoot, currRoot, parentContexts);
  }
  // De-activate the child route that are not re-used for the future state
  deactivateChildRoutes(futureNode, currNode, contexts) {
    const children = nodeChildrenAsMap(currNode);
    futureNode.children.forEach((futureChild) => {
      const childOutletName = futureChild.value.outlet;
      this.deactivateRoutes(futureChild, children[childOutletName], contexts);
      delete children[childOutletName];
    });
    Object.values(children).forEach((v) => {
      this.deactivateRouteAndItsChildren(v, contexts);
    });
  }
  deactivateRoutes(futureNode, currNode, parentContext) {
    const future = futureNode.value;
    const curr = currNode ? currNode.value : null;
    if (future === curr) {
      if (future.component) {
        const context = parentContext.getContext(future.outlet);
        if (context) {
          this.deactivateChildRoutes(futureNode, currNode, context.children);
        }
      } else {
        this.deactivateChildRoutes(futureNode, currNode, parentContext);
      }
    } else {
      if (curr) {
        this.deactivateRouteAndItsChildren(currNode, parentContext);
      }
    }
  }
  deactivateRouteAndItsChildren(route, parentContexts) {
    if (route.value.component && this.routeReuseStrategy.shouldDetach(route.value.snapshot)) {
      this.detachAndStoreRouteSubtree(route, parentContexts);
    } else {
      this.deactivateRouteAndOutlet(route, parentContexts);
    }
  }
  detachAndStoreRouteSubtree(route, parentContexts) {
    const context = parentContexts.getContext(route.value.outlet);
    const contexts = context && route.value.component ? context.children : parentContexts;
    const children = nodeChildrenAsMap(route);
    for (const treeNode of Object.values(children)) {
      this.deactivateRouteAndItsChildren(treeNode, contexts);
    }
    if (context && context.outlet) {
      const componentRef = context.outlet.detach();
      const contexts2 = context.children.onOutletDeactivated();
      this.routeReuseStrategy.store(route.value.snapshot, {
        componentRef,
        route,
        contexts: contexts2
      });
    }
  }
  deactivateRouteAndOutlet(route, parentContexts) {
    const context = parentContexts.getContext(route.value.outlet);
    const contexts = context && route.value.component ? context.children : parentContexts;
    const children = nodeChildrenAsMap(route);
    for (const treeNode of Object.values(children)) {
      this.deactivateRouteAndItsChildren(treeNode, contexts);
    }
    if (context) {
      if (context.outlet) {
        context.outlet.deactivate();
        context.children.onOutletDeactivated();
      }
      context.attachRef = null;
      context.route = null;
    }
  }
  activateChildRoutes(futureNode, currNode, contexts) {
    const children = nodeChildrenAsMap(currNode);
    futureNode.children.forEach((c) => {
      this.activateRoutes(c, children[c.value.outlet], contexts);
      this.forwardEvent(new ActivationEnd(c.value.snapshot));
    });
    if (futureNode.children.length) {
      this.forwardEvent(new ChildActivationEnd(futureNode.value.snapshot));
    }
  }
  activateRoutes(futureNode, currNode, parentContexts) {
    const future = futureNode.value;
    const curr = currNode ? currNode.value : null;
    advanceActivatedRoute(future);
    if (future === curr) {
      if (future.component) {
        const context = parentContexts.getOrCreateContext(future.outlet);
        this.activateChildRoutes(futureNode, currNode, context.children);
      } else {
        this.activateChildRoutes(futureNode, currNode, parentContexts);
      }
    } else {
      if (future.component) {
        const context = parentContexts.getOrCreateContext(future.outlet);
        if (this.routeReuseStrategy.shouldAttach(future.snapshot)) {
          const stored = this.routeReuseStrategy.retrieve(future.snapshot);
          this.routeReuseStrategy.store(future.snapshot, null);
          context.children.onOutletReAttached(stored.contexts);
          context.attachRef = stored.componentRef;
          context.route = stored.route.value;
          if (context.outlet) {
            context.outlet.attach(stored.componentRef, stored.route.value);
          }
          advanceActivatedRoute(stored.route.value);
          this.activateChildRoutes(futureNode, null, context.children);
        } else {
          context.attachRef = null;
          context.route = future;
          if (context.outlet) {
            context.outlet.activateWith(future, context.injector);
          }
          this.activateChildRoutes(futureNode, null, context.children);
        }
      } else {
        this.activateChildRoutes(futureNode, null, parentContexts);
      }
    }
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      const context = parentContexts.getOrCreateContext(future.outlet);
      const outlet = context.outlet;
      if (outlet && this.inputBindingEnabled && !outlet.supportsBindingToComponentInputs && !warnedAboutUnsupportedInputBinding) {
        console.warn(`'withComponentInputBinding' feature is enabled but this application is using an outlet that may not support binding to component inputs.`);
        warnedAboutUnsupportedInputBinding = true;
      }
    }
  }
};
var CanActivate = class {
  path;
  route;
  constructor(path) {
    this.path = path;
    this.route = this.path[this.path.length - 1];
  }
};
var CanDeactivate = class {
  component;
  route;
  constructor(component, route) {
    this.component = component;
    this.route = route;
  }
};
function getAllRouteGuards(future, curr, parentContexts) {
  const futureRoot = future._root;
  const currRoot = curr ? curr._root : null;
  return getChildRouteGuards(futureRoot, currRoot, parentContexts, [futureRoot.value]);
}
function getCanActivateChild(p) {
  const canActivateChild = p.routeConfig ? p.routeConfig.canActivateChild : null;
  if (!canActivateChild || canActivateChild.length === 0) return null;
  return {
    node: p,
    guards: canActivateChild
  };
}
function getTokenOrFunctionIdentity(tokenOrFunction, injector) {
  const NOT_FOUND = Symbol();
  const result = injector.get(tokenOrFunction, NOT_FOUND);
  if (result === NOT_FOUND) {
    if (typeof tokenOrFunction === "function" && !isInjectable(tokenOrFunction)) {
      return tokenOrFunction;
    } else {
      return injector.get(tokenOrFunction);
    }
  }
  return result;
}
function getChildRouteGuards(futureNode, currNode, contexts, futurePath, checks = {
  canDeactivateChecks: [],
  canActivateChecks: []
}) {
  const prevChildren = nodeChildrenAsMap(currNode);
  futureNode.children.forEach((c) => {
    getRouteGuards(c, prevChildren[c.value.outlet], contexts, futurePath.concat([c.value]), checks);
    delete prevChildren[c.value.outlet];
  });
  Object.entries(prevChildren).forEach(([k, v]) => deactivateRouteAndItsChildren(v, contexts.getContext(k), checks));
  return checks;
}
function getRouteGuards(futureNode, currNode, parentContexts, futurePath, checks = {
  canDeactivateChecks: [],
  canActivateChecks: []
}) {
  const future = futureNode.value;
  const curr = currNode ? currNode.value : null;
  const context = parentContexts ? parentContexts.getContext(futureNode.value.outlet) : null;
  if (curr && future.routeConfig === curr.routeConfig) {
    const shouldRun = shouldRunGuardsAndResolvers(curr, future, future.routeConfig.runGuardsAndResolvers);
    if (shouldRun) {
      checks.canActivateChecks.push(new CanActivate(futurePath));
    } else {
      future.data = curr.data;
      future._resolvedData = curr._resolvedData;
    }
    if (future.component) {
      getChildRouteGuards(futureNode, currNode, context ? context.children : null, futurePath, checks);
    } else {
      getChildRouteGuards(futureNode, currNode, parentContexts, futurePath, checks);
    }
    if (shouldRun && context && context.outlet && context.outlet.isActivated) {
      checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, curr));
    }
  } else {
    if (curr) {
      deactivateRouteAndItsChildren(currNode, context, checks);
    }
    checks.canActivateChecks.push(new CanActivate(futurePath));
    if (future.component) {
      getChildRouteGuards(futureNode, null, context ? context.children : null, futurePath, checks);
    } else {
      getChildRouteGuards(futureNode, null, parentContexts, futurePath, checks);
    }
  }
  return checks;
}
function shouldRunGuardsAndResolvers(curr, future, mode) {
  if (typeof mode === "function") {
    return mode(curr, future);
  }
  switch (mode) {
    case "pathParamsChange":
      return !equalPath(curr.url, future.url);
    case "pathParamsOrQueryParamsChange":
      return !equalPath(curr.url, future.url) || !shallowEqual(curr.queryParams, future.queryParams);
    case "always":
      return true;
    case "paramsOrQueryParamsChange":
      return !equalParamsAndUrlSegments(curr, future) || !shallowEqual(curr.queryParams, future.queryParams);
    case "paramsChange":
    default:
      return !equalParamsAndUrlSegments(curr, future);
  }
}
function deactivateRouteAndItsChildren(route, context, checks) {
  const children = nodeChildrenAsMap(route);
  const r = route.value;
  Object.entries(children).forEach(([childName, node]) => {
    if (!r.component) {
      deactivateRouteAndItsChildren(node, context, checks);
    } else if (context) {
      deactivateRouteAndItsChildren(node, context.children.getContext(childName), checks);
    } else {
      deactivateRouteAndItsChildren(node, null, checks);
    }
  });
  if (!r.component) {
    checks.canDeactivateChecks.push(new CanDeactivate(null, r));
  } else if (context && context.outlet && context.outlet.isActivated) {
    checks.canDeactivateChecks.push(new CanDeactivate(context.outlet.component, r));
  } else {
    checks.canDeactivateChecks.push(new CanDeactivate(null, r));
  }
}
function isFunction(v) {
  return typeof v === "function";
}
function isBoolean(v) {
  return typeof v === "boolean";
}
function isCanLoad(guard) {
  return guard && isFunction(guard.canLoad);
}
function isCanActivate(guard) {
  return guard && isFunction(guard.canActivate);
}
function isCanActivateChild(guard) {
  return guard && isFunction(guard.canActivateChild);
}
function isCanDeactivate(guard) {
  return guard && isFunction(guard.canDeactivate);
}
function isCanMatch(guard) {
  return guard && isFunction(guard.canMatch);
}
function isEmptyError(e) {
  return e instanceof EmptyError || e?.name === "EmptyError";
}
var INITIAL_VALUE = /* @__PURE__ */ Symbol("INITIAL_VALUE");
function prioritizedGuardValue() {
  return switchMap((obs) => {
    return combineLatest(obs.map((o) => o.pipe(take(1), startWith(INITIAL_VALUE)))).pipe(map((results) => {
      for (const result of results) {
        if (result === true) {
          continue;
        } else if (result === INITIAL_VALUE) {
          return INITIAL_VALUE;
        } else if (result === false || isRedirect(result)) {
          return result;
        }
      }
      return true;
    }), filter((item) => item !== INITIAL_VALUE), take(1));
  });
}
function isRedirect(val) {
  return isUrlTree(val) || val instanceof RedirectCommand;
}
function checkGuards(injector, forwardEvent) {
  return mergeMap((t) => {
    const {
      targetSnapshot,
      currentSnapshot,
      guards: {
        canActivateChecks,
        canDeactivateChecks
      }
    } = t;
    if (canDeactivateChecks.length === 0 && canActivateChecks.length === 0) {
      return of(__spreadProps(__spreadValues({}, t), {
        guardsResult: true
      }));
    }
    return runCanDeactivateChecks(canDeactivateChecks, targetSnapshot, currentSnapshot, injector).pipe(mergeMap((canDeactivate) => {
      return canDeactivate && isBoolean(canDeactivate) ? runCanActivateChecks(targetSnapshot, canActivateChecks, injector, forwardEvent) : of(canDeactivate);
    }), map((guardsResult) => __spreadProps(__spreadValues({}, t), {
      guardsResult
    })));
  });
}
function runCanDeactivateChecks(checks, futureRSS, currRSS, injector) {
  return from(checks).pipe(mergeMap((check) => runCanDeactivate(check.component, check.route, currRSS, futureRSS, injector)), first((result) => {
    return result !== true;
  }, true));
}
function runCanActivateChecks(futureSnapshot, checks, injector, forwardEvent) {
  return from(checks).pipe(concatMap((check) => {
    return concat(fireChildActivationStart(check.route.parent, forwardEvent), fireActivationStart(check.route, forwardEvent), runCanActivateChild(futureSnapshot, check.path, injector), runCanActivate(futureSnapshot, check.route, injector));
  }), first((result) => {
    return result !== true;
  }, true));
}
function fireActivationStart(snapshot, forwardEvent) {
  if (snapshot !== null && forwardEvent) {
    forwardEvent(new ActivationStart(snapshot));
  }
  return of(true);
}
function fireChildActivationStart(snapshot, forwardEvent) {
  if (snapshot !== null && forwardEvent) {
    forwardEvent(new ChildActivationStart(snapshot));
  }
  return of(true);
}
function runCanActivate(futureRSS, futureARS, injector) {
  const canActivate = futureARS.routeConfig ? futureARS.routeConfig.canActivate : null;
  if (!canActivate || canActivate.length === 0) return of(true);
  const canActivateObservables = canActivate.map((canActivate2) => {
    return defer(() => {
      const closestInjector = getClosestRouteInjector(futureARS) ?? injector;
      const guard = getTokenOrFunctionIdentity(canActivate2, closestInjector);
      const guardVal = isCanActivate(guard) ? guard.canActivate(futureARS, futureRSS) : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));
      return wrapIntoObservable(guardVal).pipe(first());
    });
  });
  return of(canActivateObservables).pipe(prioritizedGuardValue());
}
function runCanActivateChild(futureRSS, path, injector) {
  const futureARS = path[path.length - 1];
  const canActivateChildGuards = path.slice(0, path.length - 1).reverse().map((p) => getCanActivateChild(p)).filter((_) => _ !== null);
  const canActivateChildGuardsMapped = canActivateChildGuards.map((d) => {
    return defer(() => {
      const guardsMapped = d.guards.map((canActivateChild) => {
        const closestInjector = getClosestRouteInjector(d.node) ?? injector;
        const guard = getTokenOrFunctionIdentity(canActivateChild, closestInjector);
        const guardVal = isCanActivateChild(guard) ? guard.canActivateChild(futureARS, futureRSS) : runInInjectionContext(closestInjector, () => guard(futureARS, futureRSS));
        return wrapIntoObservable(guardVal).pipe(first());
      });
      return of(guardsMapped).pipe(prioritizedGuardValue());
    });
  });
  return of(canActivateChildGuardsMapped).pipe(prioritizedGuardValue());
}
function runCanDeactivate(component, currARS, currRSS, futureRSS, injector) {
  const canDeactivate = currARS && currARS.routeConfig ? currARS.routeConfig.canDeactivate : null;
  if (!canDeactivate || canDeactivate.length === 0) return of(true);
  const canDeactivateObservables = canDeactivate.map((c) => {
    const closestInjector = getClosestRouteInjector(currARS) ?? injector;
    const guard = getTokenOrFunctionIdentity(c, closestInjector);
    const guardVal = isCanDeactivate(guard) ? guard.canDeactivate(component, currARS, currRSS, futureRSS) : runInInjectionContext(closestInjector, () => guard(component, currARS, currRSS, futureRSS));
    return wrapIntoObservable(guardVal).pipe(first());
  });
  return of(canDeactivateObservables).pipe(prioritizedGuardValue());
}
function runCanLoadGuards(injector, route, segments, urlSerializer) {
  const canLoad = route.canLoad;
  if (canLoad === void 0 || canLoad.length === 0) {
    return of(true);
  }
  const canLoadObservables = canLoad.map((injectionToken) => {
    const guard = getTokenOrFunctionIdentity(injectionToken, injector);
    const guardVal = isCanLoad(guard) ? guard.canLoad(route, segments) : runInInjectionContext(injector, () => guard(route, segments));
    return wrapIntoObservable(guardVal);
  });
  return of(canLoadObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));
}
function redirectIfUrlTree(urlSerializer) {
  return pipe(tap((result) => {
    if (typeof result === "boolean") return;
    throw redirectingNavigationError(urlSerializer, result);
  }), map((result) => result === true));
}
function runCanMatchGuards(injector, route, segments, urlSerializer) {
  const canMatch = route.canMatch;
  if (!canMatch || canMatch.length === 0) return of(true);
  const canMatchObservables = canMatch.map((injectionToken) => {
    const guard = getTokenOrFunctionIdentity(injectionToken, injector);
    const guardVal = isCanMatch(guard) ? guard.canMatch(route, segments) : runInInjectionContext(injector, () => guard(route, segments));
    return wrapIntoObservable(guardVal);
  });
  return of(canMatchObservables).pipe(prioritizedGuardValue(), redirectIfUrlTree(urlSerializer));
}
var NoMatch = class {
  segmentGroup;
  constructor(segmentGroup) {
    this.segmentGroup = segmentGroup || null;
  }
};
var AbsoluteRedirect = class extends Error {
  urlTree;
  constructor(urlTree) {
    super();
    this.urlTree = urlTree;
  }
};
function noMatch$1(segmentGroup) {
  return throwError(new NoMatch(segmentGroup));
}
function namedOutletsRedirect(redirectTo) {
  return throwError(new RuntimeError(4e3, (typeof ngDevMode === "undefined" || ngDevMode) && `Only absolute redirects can have named outlets. redirectTo: '${redirectTo}'`));
}
function canLoadFails(route) {
  return throwError(navigationCancelingError((typeof ngDevMode === "undefined" || ngDevMode) && `Cannot load children because the guard of the route "path: '${route.path}'" returned false`, NavigationCancellationCode.GuardRejected));
}
var ApplyRedirects = class {
  urlSerializer;
  urlTree;
  constructor(urlSerializer, urlTree) {
    this.urlSerializer = urlSerializer;
    this.urlTree = urlTree;
  }
  lineralizeSegments(route, urlTree) {
    let res = [];
    let c = urlTree.root;
    while (true) {
      res = res.concat(c.segments);
      if (c.numberOfChildren === 0) {
        return of(res);
      }
      if (c.numberOfChildren > 1 || !c.children[PRIMARY_OUTLET]) {
        return namedOutletsRedirect(`${route.redirectTo}`);
      }
      c = c.children[PRIMARY_OUTLET];
    }
  }
  applyRedirectCommands(segments, redirectTo, posParams, currentSnapshot, injector) {
    if (typeof redirectTo !== "string") {
      const redirectToFn = redirectTo;
      const {
        queryParams,
        fragment,
        routeConfig,
        url,
        outlet,
        params,
        data,
        title
      } = currentSnapshot;
      const newRedirect = runInInjectionContext(injector, () => redirectToFn({
        params,
        data,
        queryParams,
        fragment,
        routeConfig,
        url,
        outlet,
        title
      }));
      if (newRedirect instanceof UrlTree) {
        throw new AbsoluteRedirect(newRedirect);
      }
      redirectTo = newRedirect;
    }
    const newTree = this.applyRedirectCreateUrlTree(redirectTo, this.urlSerializer.parse(redirectTo), segments, posParams);
    if (redirectTo[0] === "/") {
      throw new AbsoluteRedirect(newTree);
    }
    return newTree;
  }
  applyRedirectCreateUrlTree(redirectTo, urlTree, segments, posParams) {
    const newRoot = this.createSegmentGroup(redirectTo, urlTree.root, segments, posParams);
    return new UrlTree(newRoot, this.createQueryParams(urlTree.queryParams, this.urlTree.queryParams), urlTree.fragment);
  }
  createQueryParams(redirectToParams, actualParams) {
    const res = {};
    Object.entries(redirectToParams).forEach(([k, v]) => {
      const copySourceValue = typeof v === "string" && v[0] === ":";
      if (copySourceValue) {
        const sourceName = v.substring(1);
        res[k] = actualParams[sourceName];
      } else {
        res[k] = v;
      }
    });
    return res;
  }
  createSegmentGroup(redirectTo, group, segments, posParams) {
    const updatedSegments = this.createSegments(redirectTo, group.segments, segments, posParams);
    let children = {};
    Object.entries(group.children).forEach(([name, child]) => {
      children[name] = this.createSegmentGroup(redirectTo, child, segments, posParams);
    });
    return new UrlSegmentGroup(updatedSegments, children);
  }
  createSegments(redirectTo, redirectToSegments, actualSegments, posParams) {
    return redirectToSegments.map((s) => s.path[0] === ":" ? this.findPosParam(redirectTo, s, posParams) : this.findOrReturn(s, actualSegments));
  }
  findPosParam(redirectTo, redirectToUrlSegment, posParams) {
    const pos = posParams[redirectToUrlSegment.path.substring(1)];
    if (!pos) throw new RuntimeError(4001, (typeof ngDevMode === "undefined" || ngDevMode) && `Cannot redirect to '${redirectTo}'. Cannot find '${redirectToUrlSegment.path}'.`);
    return pos;
  }
  findOrReturn(redirectToUrlSegment, actualSegments) {
    let idx = 0;
    for (const s of actualSegments) {
      if (s.path === redirectToUrlSegment.path) {
        actualSegments.splice(idx);
        return s;
      }
      idx++;
    }
    return redirectToUrlSegment;
  }
};
var noMatch = {
  matched: false,
  consumedSegments: [],
  remainingSegments: [],
  parameters: {},
  positionalParamSegments: {}
};
function matchWithChecks(segmentGroup, route, segments, injector, urlSerializer) {
  const result = match(segmentGroup, route, segments);
  if (!result.matched) {
    return of(result);
  }
  injector = getOrCreateRouteInjectorIfNeeded(route, injector);
  return runCanMatchGuards(injector, route, segments, urlSerializer).pipe(map((v) => v === true ? result : __spreadValues({}, noMatch)));
}
function match(segmentGroup, route, segments) {
  if (route.path === "**") {
    return createWildcardMatchResult(segments);
  }
  if (route.path === "") {
    if (route.pathMatch === "full" && (segmentGroup.hasChildren() || segments.length > 0)) {
      return __spreadValues({}, noMatch);
    }
    return {
      matched: true,
      consumedSegments: [],
      remainingSegments: segments,
      parameters: {},
      positionalParamSegments: {}
    };
  }
  const matcher = route.matcher || defaultUrlMatcher;
  const res = matcher(segments, segmentGroup, route);
  if (!res) return __spreadValues({}, noMatch);
  const posParams = {};
  Object.entries(res.posParams ?? {}).forEach(([k, v]) => {
    posParams[k] = v.path;
  });
  const parameters = res.consumed.length > 0 ? __spreadValues(__spreadValues({}, posParams), res.consumed[res.consumed.length - 1].parameters) : posParams;
  return {
    matched: true,
    consumedSegments: res.consumed,
    remainingSegments: segments.slice(res.consumed.length),
    // TODO(atscott): investigate combining parameters and positionalParamSegments
    parameters,
    positionalParamSegments: res.posParams ?? {}
  };
}
function createWildcardMatchResult(segments) {
  return {
    matched: true,
    parameters: segments.length > 0 ? last2(segments).parameters : {},
    consumedSegments: segments,
    remainingSegments: [],
    positionalParamSegments: {}
  };
}
function split(segmentGroup, consumedSegments, slicedSegments, config) {
  if (slicedSegments.length > 0 && containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, config)) {
    const s2 = new UrlSegmentGroup(consumedSegments, createChildrenForEmptyPaths(config, new UrlSegmentGroup(slicedSegments, segmentGroup.children)));
    return {
      segmentGroup: s2,
      slicedSegments: []
    };
  }
  if (slicedSegments.length === 0 && containsEmptyPathMatches(segmentGroup, slicedSegments, config)) {
    const s2 = new UrlSegmentGroup(segmentGroup.segments, addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, config, segmentGroup.children));
    return {
      segmentGroup: s2,
      slicedSegments
    };
  }
  const s = new UrlSegmentGroup(segmentGroup.segments, segmentGroup.children);
  return {
    segmentGroup: s,
    slicedSegments
  };
}
function addEmptyPathsToChildrenIfNeeded(segmentGroup, slicedSegments, routes, children) {
  const res = {};
  for (const r of routes) {
    if (emptyPathMatch(segmentGroup, slicedSegments, r) && !children[getOutlet(r)]) {
      const s = new UrlSegmentGroup([], {});
      res[getOutlet(r)] = s;
    }
  }
  return __spreadValues(__spreadValues({}, children), res);
}
function createChildrenForEmptyPaths(routes, primarySegment) {
  const res = {};
  res[PRIMARY_OUTLET] = primarySegment;
  for (const r of routes) {
    if (r.path === "" && getOutlet(r) !== PRIMARY_OUTLET) {
      const s = new UrlSegmentGroup([], {});
      res[getOutlet(r)] = s;
    }
  }
  return res;
}
function containsEmptyPathMatchesWithNamedOutlets(segmentGroup, slicedSegments, routes) {
  return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r) && getOutlet(r) !== PRIMARY_OUTLET);
}
function containsEmptyPathMatches(segmentGroup, slicedSegments, routes) {
  return routes.some((r) => emptyPathMatch(segmentGroup, slicedSegments, r));
}
function emptyPathMatch(segmentGroup, slicedSegments, r) {
  if ((segmentGroup.hasChildren() || slicedSegments.length > 0) && r.pathMatch === "full") {
    return false;
  }
  return r.path === "";
}
function noLeftoversInUrl(segmentGroup, segments, outlet) {
  return segments.length === 0 && !segmentGroup.children[outlet];
}
var NoLeftoversInUrl = class {
};
function recognize$1(injector, configLoader, rootComponentType, config, urlTree, urlSerializer, paramsInheritanceStrategy = "emptyOnly") {
  return new Recognizer(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer).recognize();
}
var MAX_ALLOWED_REDIRECTS = 31;
var Recognizer = class {
  injector;
  configLoader;
  rootComponentType;
  config;
  urlTree;
  paramsInheritanceStrategy;
  urlSerializer;
  applyRedirects;
  absoluteRedirectCount = 0;
  allowRedirects = true;
  constructor(injector, configLoader, rootComponentType, config, urlTree, paramsInheritanceStrategy, urlSerializer) {
    this.injector = injector;
    this.configLoader = configLoader;
    this.rootComponentType = rootComponentType;
    this.config = config;
    this.urlTree = urlTree;
    this.paramsInheritanceStrategy = paramsInheritanceStrategy;
    this.urlSerializer = urlSerializer;
    this.applyRedirects = new ApplyRedirects(this.urlSerializer, this.urlTree);
  }
  noMatchError(e) {
    return new RuntimeError(4002, typeof ngDevMode === "undefined" || ngDevMode ? `Cannot match any routes. URL Segment: '${e.segmentGroup}'` : `'${e.segmentGroup}'`);
  }
  recognize() {
    const rootSegmentGroup = split(this.urlTree.root, [], [], this.config).segmentGroup;
    return this.match(rootSegmentGroup).pipe(map(({
      children,
      rootSnapshot
    }) => {
      const rootNode = new TreeNode(rootSnapshot, children);
      const routeState = new RouterStateSnapshot("", rootNode);
      const tree2 = createUrlTreeFromSnapshot(rootSnapshot, [], this.urlTree.queryParams, this.urlTree.fragment);
      tree2.queryParams = this.urlTree.queryParams;
      routeState.url = this.urlSerializer.serialize(tree2);
      return {
        state: routeState,
        tree: tree2
      };
    }));
  }
  match(rootSegmentGroup) {
    const rootSnapshot = new ActivatedRouteSnapshot([], Object.freeze({}), Object.freeze(__spreadValues({}, this.urlTree.queryParams)), this.urlTree.fragment, Object.freeze({}), PRIMARY_OUTLET, this.rootComponentType, null, {});
    return this.processSegmentGroup(this.injector, this.config, rootSegmentGroup, PRIMARY_OUTLET, rootSnapshot).pipe(map((children) => {
      return {
        children,
        rootSnapshot
      };
    }), catchError((e) => {
      if (e instanceof AbsoluteRedirect) {
        this.urlTree = e.urlTree;
        return this.match(e.urlTree.root);
      }
      if (e instanceof NoMatch) {
        throw this.noMatchError(e);
      }
      throw e;
    }));
  }
  processSegmentGroup(injector, config, segmentGroup, outlet, parentRoute) {
    if (segmentGroup.segments.length === 0 && segmentGroup.hasChildren()) {
      return this.processChildren(injector, config, segmentGroup, parentRoute);
    }
    return this.processSegment(injector, config, segmentGroup, segmentGroup.segments, outlet, true, parentRoute).pipe(map((child) => child instanceof TreeNode ? [child] : []));
  }
  /**
   * Matches every child outlet in the `segmentGroup` to a `Route` in the config. Returns `null` if
   * we cannot find a match for _any_ of the children.
   *
   * @param config - The `Routes` to match against
   * @param segmentGroup - The `UrlSegmentGroup` whose children need to be matched against the
   *     config.
   */
  processChildren(injector, config, segmentGroup, parentRoute) {
    const childOutlets = [];
    for (const child of Object.keys(segmentGroup.children)) {
      if (child === "primary") {
        childOutlets.unshift(child);
      } else {
        childOutlets.push(child);
      }
    }
    return from(childOutlets).pipe(concatMap((childOutlet) => {
      const child = segmentGroup.children[childOutlet];
      const sortedConfig = sortByMatchingOutlets(config, childOutlet);
      return this.processSegmentGroup(injector, sortedConfig, child, childOutlet, parentRoute);
    }), scan((children, outletChildren) => {
      children.push(...outletChildren);
      return children;
    }), defaultIfEmpty(null), last(), mergeMap((children) => {
      if (children === null) return noMatch$1(segmentGroup);
      const mergedChildren = mergeEmptyPathMatches(children);
      if (typeof ngDevMode === "undefined" || ngDevMode) {
        checkOutletNameUniqueness(mergedChildren);
      }
      sortActivatedRouteSnapshots(mergedChildren);
      return of(mergedChildren);
    }));
  }
  processSegment(injector, routes, segmentGroup, segments, outlet, allowRedirects, parentRoute) {
    return from(routes).pipe(concatMap((r) => {
      return this.processSegmentAgainstRoute(r._injector ?? injector, routes, r, segmentGroup, segments, outlet, allowRedirects, parentRoute).pipe(catchError((e) => {
        if (e instanceof NoMatch) {
          return of(null);
        }
        throw e;
      }));
    }), first((x) => !!x), catchError((e) => {
      if (isEmptyError(e)) {
        if (noLeftoversInUrl(segmentGroup, segments, outlet)) {
          return of(new NoLeftoversInUrl());
        }
        return noMatch$1(segmentGroup);
      }
      throw e;
    }));
  }
  processSegmentAgainstRoute(injector, routes, route, rawSegment, segments, outlet, allowRedirects, parentRoute) {
    if (getOutlet(route) !== outlet && (outlet === PRIMARY_OUTLET || !emptyPathMatch(rawSegment, segments, route))) {
      return noMatch$1(rawSegment);
    }
    if (route.redirectTo === void 0) {
      return this.matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute);
    }
    if (this.allowRedirects && allowRedirects) {
      return this.expandSegmentAgainstRouteUsingRedirect(injector, rawSegment, routes, route, segments, outlet, parentRoute);
    }
    return noMatch$1(rawSegment);
  }
  expandSegmentAgainstRouteUsingRedirect(injector, segmentGroup, routes, route, segments, outlet, parentRoute) {
    const {
      matched,
      parameters,
      consumedSegments,
      positionalParamSegments,
      remainingSegments
    } = match(segmentGroup, route, segments);
    if (!matched) return noMatch$1(segmentGroup);
    if (typeof route.redirectTo === "string" && route.redirectTo[0] === "/") {
      this.absoluteRedirectCount++;
      if (this.absoluteRedirectCount > MAX_ALLOWED_REDIRECTS) {
        if (ngDevMode) {
          throw new RuntimeError(4016, `Detected possible infinite redirect when redirecting from '${this.urlTree}' to '${route.redirectTo}'.
This is currently a dev mode only error but will become a call stack size exceeded error in production in a future major version.`);
        }
        this.allowRedirects = false;
      }
    }
    const currentSnapshot = new ActivatedRouteSnapshot(segments, parameters, Object.freeze(__spreadValues({}, this.urlTree.queryParams)), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));
    const inherited = getInherited(currentSnapshot, parentRoute, this.paramsInheritanceStrategy);
    currentSnapshot.params = Object.freeze(inherited.params);
    currentSnapshot.data = Object.freeze(inherited.data);
    const newTree = this.applyRedirects.applyRedirectCommands(consumedSegments, route.redirectTo, positionalParamSegments, currentSnapshot, injector);
    return this.applyRedirects.lineralizeSegments(route, newTree).pipe(mergeMap((newSegments) => {
      return this.processSegment(injector, routes, segmentGroup, newSegments.concat(remainingSegments), outlet, false, parentRoute);
    }));
  }
  matchSegmentAgainstRoute(injector, rawSegment, route, segments, outlet, parentRoute) {
    const matchResult = matchWithChecks(rawSegment, route, segments, injector, this.urlSerializer);
    if (route.path === "**") {
      rawSegment.children = {};
    }
    return matchResult.pipe(switchMap((result) => {
      if (!result.matched) {
        return noMatch$1(rawSegment);
      }
      injector = route._injector ?? injector;
      return this.getChildConfig(injector, route, segments).pipe(switchMap(({
        routes: childConfig
      }) => {
        const childInjector = route._loadedInjector ?? injector;
        const {
          parameters,
          consumedSegments,
          remainingSegments
        } = result;
        const snapshot = new ActivatedRouteSnapshot(consumedSegments, parameters, Object.freeze(__spreadValues({}, this.urlTree.queryParams)), this.urlTree.fragment, getData(route), getOutlet(route), route.component ?? route._loadedComponent ?? null, route, getResolve(route));
        const inherited = getInherited(snapshot, parentRoute, this.paramsInheritanceStrategy);
        snapshot.params = Object.freeze(inherited.params);
        snapshot.data = Object.freeze(inherited.data);
        const {
          segmentGroup,
          slicedSegments
        } = split(rawSegment, consumedSegments, remainingSegments, childConfig);
        if (slicedSegments.length === 0 && segmentGroup.hasChildren()) {
          return this.processChildren(childInjector, childConfig, segmentGroup, snapshot).pipe(map((children) => {
            return new TreeNode(snapshot, children);
          }));
        }
        if (childConfig.length === 0 && slicedSegments.length === 0) {
          return of(new TreeNode(snapshot, []));
        }
        const matchedOnOutlet = getOutlet(route) === outlet;
        return this.processSegment(childInjector, childConfig, segmentGroup, slicedSegments, matchedOnOutlet ? PRIMARY_OUTLET : outlet, true, snapshot).pipe(map((child) => {
          return new TreeNode(snapshot, child instanceof TreeNode ? [child] : []);
        }));
      }));
    }));
  }
  getChildConfig(injector, route, segments) {
    if (route.children) {
      return of({
        routes: route.children,
        injector
      });
    }
    if (route.loadChildren) {
      if (route._loadedRoutes !== void 0) {
        return of({
          routes: route._loadedRoutes,
          injector: route._loadedInjector
        });
      }
      return runCanLoadGuards(injector, route, segments, this.urlSerializer).pipe(mergeMap((shouldLoadResult) => {
        if (shouldLoadResult) {
          return this.configLoader.loadChildren(injector, route).pipe(tap((cfg) => {
            route._loadedRoutes = cfg.routes;
            route._loadedInjector = cfg.injector;
          }));
        }
        return canLoadFails(route);
      }));
    }
    return of({
      routes: [],
      injector
    });
  }
};
function sortActivatedRouteSnapshots(nodes) {
  nodes.sort((a, b) => {
    if (a.value.outlet === PRIMARY_OUTLET) return -1;
    if (b.value.outlet === PRIMARY_OUTLET) return 1;
    return a.value.outlet.localeCompare(b.value.outlet);
  });
}
function hasEmptyPathConfig(node) {
  const config = node.value.routeConfig;
  return config && config.path === "";
}
function mergeEmptyPathMatches(nodes) {
  const result = [];
  const mergedNodes = /* @__PURE__ */ new Set();
  for (const node of nodes) {
    if (!hasEmptyPathConfig(node)) {
      result.push(node);
      continue;
    }
    const duplicateEmptyPathNode = result.find((resultNode) => node.value.routeConfig === resultNode.value.routeConfig);
    if (duplicateEmptyPathNode !== void 0) {
      duplicateEmptyPathNode.children.push(...node.children);
      mergedNodes.add(duplicateEmptyPathNode);
    } else {
      result.push(node);
    }
  }
  for (const mergedNode of mergedNodes) {
    const mergedChildren = mergeEmptyPathMatches(mergedNode.children);
    result.push(new TreeNode(mergedNode.value, mergedChildren));
  }
  return result.filter((n) => !mergedNodes.has(n));
}
function checkOutletNameUniqueness(nodes) {
  const names = {};
  nodes.forEach((n) => {
    const routeWithSameOutletName = names[n.value.outlet];
    if (routeWithSameOutletName) {
      const p = routeWithSameOutletName.url.map((s) => s.toString()).join("/");
      const c = n.value.url.map((s) => s.toString()).join("/");
      throw new RuntimeError(4006, (typeof ngDevMode === "undefined" || ngDevMode) && `Two segments cannot have the same outlet name: '${p}' and '${c}'.`);
    }
    names[n.value.outlet] = n.value;
  });
}
function getData(route) {
  return route.data || {};
}
function getResolve(route) {
  return route.resolve || {};
}
function recognize(injector, configLoader, rootComponentType, config, serializer, paramsInheritanceStrategy) {
  return mergeMap((t) => recognize$1(injector, configLoader, rootComponentType, config, t.extractedUrl, serializer, paramsInheritanceStrategy).pipe(map(({
    state: targetSnapshot,
    tree: urlAfterRedirects
  }) => {
    return __spreadProps(__spreadValues({}, t), {
      targetSnapshot,
      urlAfterRedirects
    });
  })));
}
function resolveData(paramsInheritanceStrategy, injector) {
  return mergeMap((t) => {
    const {
      targetSnapshot,
      guards: {
        canActivateChecks
      }
    } = t;
    if (!canActivateChecks.length) {
      return of(t);
    }
    const routesWithResolversToRun = new Set(canActivateChecks.map((check) => check.route));
    const routesNeedingDataUpdates = /* @__PURE__ */ new Set();
    for (const route of routesWithResolversToRun) {
      if (routesNeedingDataUpdates.has(route)) {
        continue;
      }
      for (const newRoute of flattenRouteTree(route)) {
        routesNeedingDataUpdates.add(newRoute);
      }
    }
    let routesProcessed = 0;
    return from(routesNeedingDataUpdates).pipe(concatMap((route) => {
      if (routesWithResolversToRun.has(route)) {
        return runResolve(route, targetSnapshot, paramsInheritanceStrategy, injector);
      } else {
        route.data = getInherited(route, route.parent, paramsInheritanceStrategy).resolve;
        return of(void 0);
      }
    }), tap(() => routesProcessed++), takeLast(1), mergeMap((_) => routesProcessed === routesNeedingDataUpdates.size ? of(t) : EMPTY));
  });
}
function flattenRouteTree(route) {
  const descendants = route.children.map((child) => flattenRouteTree(child)).flat();
  return [route, ...descendants];
}
function runResolve(futureARS, futureRSS, paramsInheritanceStrategy, injector) {
  const config = futureARS.routeConfig;
  const resolve = futureARS._resolve;
  if (config?.title !== void 0 && !hasStaticTitle(config)) {
    resolve[RouteTitleKey] = config.title;
  }
  return defer(() => {
    futureARS.data = getInherited(futureARS, futureARS.parent, paramsInheritanceStrategy).resolve;
    return resolveNode(resolve, futureARS, futureRSS, injector).pipe(map((resolvedData) => {
      futureARS._resolvedData = resolvedData;
      futureARS.data = __spreadValues(__spreadValues({}, futureARS.data), resolvedData);
      return null;
    }));
  });
}
function resolveNode(resolve, futureARS, futureRSS, injector) {
  const keys = getDataKeys(resolve);
  if (keys.length === 0) {
    return of({});
  }
  const data = {};
  return from(keys).pipe(mergeMap((key) => getResolver(resolve[key], futureARS, futureRSS, injector).pipe(first(), tap((value) => {
    if (value instanceof RedirectCommand) {
      throw redirectingNavigationError(new DefaultUrlSerializer(), value);
    }
    data[key] = value;
  }))), takeLast(1), map(() => data), catchError((e) => isEmptyError(e) ? EMPTY : throwError(e)));
}
function getResolver(injectionToken, futureARS, futureRSS, injector) {
  const closestInjector = getClosestRouteInjector(futureARS) ?? injector;
  const resolver = getTokenOrFunctionIdentity(injectionToken, closestInjector);
  const resolverValue = resolver.resolve ? resolver.resolve(futureARS, futureRSS) : runInInjectionContext(closestInjector, () => resolver(futureARS, futureRSS));
  return wrapIntoObservable(resolverValue);
}
function switchTap(next) {
  return switchMap((v) => {
    const nextResult = next(v);
    if (nextResult) {
      return from(nextResult).pipe(map(() => v));
    }
    return of(v);
  });
}
var TitleStrategy = class _TitleStrategy {
  /**
   * @returns The `title` of the deepest primary route.
   */
  buildTitle(snapshot) {
    let pageTitle;
    let route = snapshot.root;
    while (route !== void 0) {
      pageTitle = this.getResolvedTitleForRoute(route) ?? pageTitle;
      route = route.children.find((child) => child.outlet === PRIMARY_OUTLET);
    }
    return pageTitle;
  }
  /**
   * Given an `ActivatedRouteSnapshot`, returns the final value of the
   * `Route.title` property, which can either be a static string or a resolved value.
   */
  getResolvedTitleForRoute(snapshot) {
    return snapshot.data[RouteTitleKey];
  }
  static \u0275fac = function TitleStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _TitleStrategy)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _TitleStrategy,
    factory: () => (() => inject(DefaultTitleStrategy))(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(TitleStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(DefaultTitleStrategy)
    }]
  }], null, null);
})();
var DefaultTitleStrategy = class _DefaultTitleStrategy extends TitleStrategy {
  title;
  constructor(title) {
    super();
    this.title = title;
  }
  /**
   * Sets the title of the browser to the given value.
   *
   * @param title The `pageTitle` from the deepest primary route.
   */
  updateTitle(snapshot) {
    const title = this.buildTitle(snapshot);
    if (title !== void 0) {
      this.title.setTitle(title);
    }
  }
  static \u0275fac = function DefaultTitleStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DefaultTitleStrategy)(\u0275\u0275inject(Title));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DefaultTitleStrategy,
    factory: _DefaultTitleStrategy.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DefaultTitleStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: Title
  }], null);
})();
var ROUTER_CONFIGURATION = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "router config" : "", {
  providedIn: "root",
  factory: () => ({})
});
var \u0275EmptyOutletComponent = class _\u0275EmptyOutletComponent {
  static \u0275fac = function \u0275EmptyOutletComponent_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _\u0275EmptyOutletComponent)();
  };
  static \u0275cmp = /* @__PURE__ */ \u0275\u0275defineComponent({
    type: _\u0275EmptyOutletComponent,
    selectors: [["ng-component"]],
    exportAs: ["emptyRouterOutlet"],
    decls: 1,
    vars: 0,
    template: function _EmptyOutletComponent_Template(rf, ctx) {
      if (rf & 1) {
        \u0275\u0275element(0, "router-outlet");
      }
    },
    dependencies: [RouterOutlet],
    encapsulation: 2
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(\u0275EmptyOutletComponent, [{
    type: Component,
    args: [{
      template: `<router-outlet/>`,
      imports: [RouterOutlet],
      // Used to avoid component ID collisions with user code.
      exportAs: "emptyRouterOutlet"
    }]
  }], null, null);
})();
function standardizeConfig(r) {
  const children = r.children && r.children.map(standardizeConfig);
  const c = children ? __spreadProps(__spreadValues({}, r), {
    children
  }) : __spreadValues({}, r);
  if (!c.component && !c.loadComponent && (children || c.loadChildren) && c.outlet && c.outlet !== PRIMARY_OUTLET) {
    c.component = \u0275EmptyOutletComponent;
  }
  return c;
}
var ROUTES = new InjectionToken(ngDevMode ? "ROUTES" : "");
var RouterConfigLoader = class _RouterConfigLoader {
  componentLoaders = /* @__PURE__ */ new WeakMap();
  childrenLoaders = /* @__PURE__ */ new WeakMap();
  onLoadStartListener;
  onLoadEndListener;
  compiler = inject(Compiler);
  loadComponent(route) {
    if (this.componentLoaders.get(route)) {
      return this.componentLoaders.get(route);
    } else if (route._loadedComponent) {
      return of(route._loadedComponent);
    }
    if (this.onLoadStartListener) {
      this.onLoadStartListener(route);
    }
    const loadRunner = wrapIntoObservable(route.loadComponent()).pipe(map(maybeUnwrapDefaultExport), tap((component) => {
      if (this.onLoadEndListener) {
        this.onLoadEndListener(route);
      }
      (typeof ngDevMode === "undefined" || ngDevMode) && assertStandalone(route.path ?? "", component);
      route._loadedComponent = component;
    }), finalize(() => {
      this.componentLoaders.delete(route);
    }));
    const loader = new ConnectableObservable(loadRunner, () => new Subject()).pipe(refCount());
    this.componentLoaders.set(route, loader);
    return loader;
  }
  loadChildren(parentInjector, route) {
    if (this.childrenLoaders.get(route)) {
      return this.childrenLoaders.get(route);
    } else if (route._loadedRoutes) {
      return of({
        routes: route._loadedRoutes,
        injector: route._loadedInjector
      });
    }
    if (this.onLoadStartListener) {
      this.onLoadStartListener(route);
    }
    const moduleFactoryOrRoutes$ = loadChildren(route, this.compiler, parentInjector, this.onLoadEndListener);
    const loadRunner = moduleFactoryOrRoutes$.pipe(finalize(() => {
      this.childrenLoaders.delete(route);
    }));
    const loader = new ConnectableObservable(loadRunner, () => new Subject()).pipe(refCount());
    this.childrenLoaders.set(route, loader);
    return loader;
  }
  static \u0275fac = function RouterConfigLoader_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterConfigLoader)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _RouterConfigLoader,
    factory: _RouterConfigLoader.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterConfigLoader, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
function loadChildren(route, compiler, parentInjector, onLoadEndListener) {
  return wrapIntoObservable(route.loadChildren()).pipe(map(maybeUnwrapDefaultExport), mergeMap((t) => {
    if (t instanceof NgModuleFactory$1 || Array.isArray(t)) {
      return of(t);
    } else {
      return from(compiler.compileModuleAsync(t));
    }
  }), map((factoryOrRoutes) => {
    if (onLoadEndListener) {
      onLoadEndListener(route);
    }
    let injector;
    let rawRoutes;
    let requireStandaloneComponents = false;
    if (Array.isArray(factoryOrRoutes)) {
      rawRoutes = factoryOrRoutes;
      requireStandaloneComponents = true;
    } else {
      injector = factoryOrRoutes.create(parentInjector).injector;
      rawRoutes = injector.get(ROUTES, [], {
        optional: true,
        self: true
      }).flat();
    }
    const routes = rawRoutes.map(standardizeConfig);
    (typeof ngDevMode === "undefined" || ngDevMode) && validateConfig(routes, route.path, requireStandaloneComponents);
    return {
      routes,
      injector
    };
  }));
}
function isWrappedDefaultExport(value) {
  return value && typeof value === "object" && "default" in value;
}
function maybeUnwrapDefaultExport(input2) {
  return isWrappedDefaultExport(input2) ? input2["default"] : input2;
}
var UrlHandlingStrategy = class _UrlHandlingStrategy {
  static \u0275fac = function UrlHandlingStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _UrlHandlingStrategy)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _UrlHandlingStrategy,
    factory: () => (() => inject(DefaultUrlHandlingStrategy))(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(UrlHandlingStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(DefaultUrlHandlingStrategy)
    }]
  }], null, null);
})();
var DefaultUrlHandlingStrategy = class _DefaultUrlHandlingStrategy {
  shouldProcessUrl(url) {
    return true;
  }
  extract(url) {
    return url;
  }
  merge(newUrlPart, wholeUrl) {
    return newUrlPart;
  }
  static \u0275fac = function DefaultUrlHandlingStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _DefaultUrlHandlingStrategy)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DefaultUrlHandlingStrategy,
    factory: _DefaultUrlHandlingStrategy.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DefaultUrlHandlingStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var CREATE_VIEW_TRANSITION = new InjectionToken(ngDevMode ? "view transition helper" : "");
var VIEW_TRANSITION_OPTIONS = new InjectionToken(ngDevMode ? "view transition options" : "");
function createViewTransition(injector, from2, to) {
  const transitionOptions = injector.get(VIEW_TRANSITION_OPTIONS);
  const document2 = injector.get(DOCUMENT);
  return injector.get(NgZone).runOutsideAngular(() => {
    if (!document2.startViewTransition || transitionOptions.skipNextTransition) {
      transitionOptions.skipNextTransition = false;
      return new Promise((resolve) => setTimeout(resolve));
    }
    let resolveViewTransitionStarted;
    const viewTransitionStarted = new Promise((resolve) => {
      resolveViewTransitionStarted = resolve;
    });
    const transition = document2.startViewTransition(() => {
      resolveViewTransitionStarted();
      return createRenderPromise(injector);
    });
    const {
      onViewTransitionCreated
    } = transitionOptions;
    if (onViewTransitionCreated) {
      runInInjectionContext(injector, () => onViewTransitionCreated({
        transition,
        from: from2,
        to
      }));
    }
    return viewTransitionStarted;
  });
}
function createRenderPromise(injector) {
  return new Promise((resolve) => {
    afterNextRender({
      read: () => setTimeout(resolve)
    }, {
      injector
    });
  });
}
var NAVIGATION_ERROR_HANDLER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "navigation error handler" : "");
var NavigationTransitions = class _NavigationTransitions {
  currentNavigation = null;
  currentTransition = null;
  lastSuccessfulNavigation = null;
  /**
   * These events are used to communicate back to the Router about the state of the transition. The
   * Router wants to respond to these events in various ways. Because the `NavigationTransition`
   * class is not public, this event subject is not publicly exposed.
   */
  events = new Subject();
  /**
   * Used to abort the current transition with an error.
   */
  transitionAbortSubject = new Subject();
  configLoader = inject(RouterConfigLoader);
  environmentInjector = inject(EnvironmentInjector);
  destroyRef = inject(DestroyRef);
  urlSerializer = inject(UrlSerializer);
  rootContexts = inject(ChildrenOutletContexts);
  location = inject(Location);
  inputBindingEnabled = inject(INPUT_BINDER, {
    optional: true
  }) !== null;
  titleStrategy = inject(TitleStrategy);
  options = inject(ROUTER_CONFIGURATION, {
    optional: true
  }) || {};
  paramsInheritanceStrategy = this.options.paramsInheritanceStrategy || "emptyOnly";
  urlHandlingStrategy = inject(UrlHandlingStrategy);
  createViewTransition = inject(CREATE_VIEW_TRANSITION, {
    optional: true
  });
  navigationErrorHandler = inject(NAVIGATION_ERROR_HANDLER, {
    optional: true
  });
  navigationId = 0;
  get hasRequestedNavigation() {
    return this.navigationId !== 0;
  }
  transitions;
  /**
   * Hook that enables you to pause navigation after the preactivation phase.
   * Used by `RouterModule`.
   *
   * @internal
   */
  afterPreactivation = () => of(void 0);
  /** @internal */
  rootComponentType = null;
  destroyed = false;
  constructor() {
    const onLoadStart = (r) => this.events.next(new RouteConfigLoadStart(r));
    const onLoadEnd = (r) => this.events.next(new RouteConfigLoadEnd(r));
    this.configLoader.onLoadEndListener = onLoadEnd;
    this.configLoader.onLoadStartListener = onLoadStart;
    this.destroyRef.onDestroy(() => {
      this.destroyed = true;
    });
  }
  complete() {
    this.transitions?.complete();
  }
  handleNavigationRequest(request) {
    const id = ++this.navigationId;
    this.transitions?.next(__spreadProps(__spreadValues({}, request), {
      extractedUrl: this.urlHandlingStrategy.extract(request.rawUrl),
      targetSnapshot: null,
      targetRouterState: null,
      guards: {
        canActivateChecks: [],
        canDeactivateChecks: []
      },
      guardsResult: null,
      id
    }));
  }
  setupNavigations(router) {
    this.transitions = new BehaviorSubject(null);
    return this.transitions.pipe(
      filter((t) => t !== null),
      // Using switchMap so we cancel executing navigations when a new one comes in
      switchMap((overallTransitionState) => {
        let completed = false;
        let errored = false;
        return of(overallTransitionState).pipe(
          switchMap((t) => {
            if (this.navigationId > overallTransitionState.id) {
              const cancellationReason = typeof ngDevMode === "undefined" || ngDevMode ? `Navigation ID ${overallTransitionState.id} is not equal to the current navigation id ${this.navigationId}` : "";
              this.cancelNavigationTransition(overallTransitionState, cancellationReason, NavigationCancellationCode.SupersededByNewNavigation);
              return EMPTY;
            }
            this.currentTransition = overallTransitionState;
            this.currentNavigation = {
              id: t.id,
              initialUrl: t.rawUrl,
              extractedUrl: t.extractedUrl,
              targetBrowserUrl: typeof t.extras.browserUrl === "string" ? this.urlSerializer.parse(t.extras.browserUrl) : t.extras.browserUrl,
              trigger: t.source,
              extras: t.extras,
              previousNavigation: !this.lastSuccessfulNavigation ? null : __spreadProps(__spreadValues({}, this.lastSuccessfulNavigation), {
                previousNavigation: null
              })
            };
            const urlTransition = !router.navigated || this.isUpdatingInternalState() || this.isUpdatedBrowserUrl();
            const onSameUrlNavigation = t.extras.onSameUrlNavigation ?? router.onSameUrlNavigation;
            if (!urlTransition && onSameUrlNavigation !== "reload") {
              const reason = typeof ngDevMode === "undefined" || ngDevMode ? `Navigation to ${t.rawUrl} was ignored because it is the same as the current Router URL.` : "";
              this.events.next(new NavigationSkipped(t.id, this.urlSerializer.serialize(t.rawUrl), reason, NavigationSkippedCode.IgnoredSameUrlNavigation));
              t.resolve(false);
              return EMPTY;
            }
            if (this.urlHandlingStrategy.shouldProcessUrl(t.rawUrl)) {
              return of(t).pipe(
                // Fire NavigationStart event
                switchMap((t2) => {
                  this.events.next(new NavigationStart(t2.id, this.urlSerializer.serialize(t2.extractedUrl), t2.source, t2.restoredState));
                  if (t2.id !== this.navigationId) {
                    return EMPTY;
                  }
                  return Promise.resolve(t2);
                }),
                // Recognize
                recognize(this.environmentInjector, this.configLoader, this.rootComponentType, router.config, this.urlSerializer, this.paramsInheritanceStrategy),
                // Update URL if in `eager` update mode
                tap((t2) => {
                  overallTransitionState.targetSnapshot = t2.targetSnapshot;
                  overallTransitionState.urlAfterRedirects = t2.urlAfterRedirects;
                  this.currentNavigation = __spreadProps(__spreadValues({}, this.currentNavigation), {
                    finalUrl: t2.urlAfterRedirects
                  });
                  const routesRecognized = new RoutesRecognized(t2.id, this.urlSerializer.serialize(t2.extractedUrl), this.urlSerializer.serialize(t2.urlAfterRedirects), t2.targetSnapshot);
                  this.events.next(routesRecognized);
                })
              );
            } else if (urlTransition && this.urlHandlingStrategy.shouldProcessUrl(t.currentRawUrl)) {
              const {
                id,
                extractedUrl,
                source,
                restoredState,
                extras
              } = t;
              const navStart = new NavigationStart(id, this.urlSerializer.serialize(extractedUrl), source, restoredState);
              this.events.next(navStart);
              const targetSnapshot = createEmptyState(this.rootComponentType).snapshot;
              this.currentTransition = overallTransitionState = __spreadProps(__spreadValues({}, t), {
                targetSnapshot,
                urlAfterRedirects: extractedUrl,
                extras: __spreadProps(__spreadValues({}, extras), {
                  skipLocationChange: false,
                  replaceUrl: false
                })
              });
              this.currentNavigation.finalUrl = extractedUrl;
              return of(overallTransitionState);
            } else {
              const reason = typeof ngDevMode === "undefined" || ngDevMode ? `Navigation was ignored because the UrlHandlingStrategy indicated neither the current URL ${t.currentRawUrl} nor target URL ${t.rawUrl} should be processed.` : "";
              this.events.next(new NavigationSkipped(t.id, this.urlSerializer.serialize(t.extractedUrl), reason, NavigationSkippedCode.IgnoredByUrlHandlingStrategy));
              t.resolve(false);
              return EMPTY;
            }
          }),
          // --- GUARDS ---
          tap((t) => {
            const guardsStart = new GuardsCheckStart(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot);
            this.events.next(guardsStart);
          }),
          map((t) => {
            this.currentTransition = overallTransitionState = __spreadProps(__spreadValues({}, t), {
              guards: getAllRouteGuards(t.targetSnapshot, t.currentSnapshot, this.rootContexts)
            });
            return overallTransitionState;
          }),
          checkGuards(this.environmentInjector, (evt) => this.events.next(evt)),
          tap((t) => {
            overallTransitionState.guardsResult = t.guardsResult;
            if (t.guardsResult && typeof t.guardsResult !== "boolean") {
              throw redirectingNavigationError(this.urlSerializer, t.guardsResult);
            }
            const guardsEnd = new GuardsCheckEnd(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects), t.targetSnapshot, !!t.guardsResult);
            this.events.next(guardsEnd);
          }),
          filter((t) => {
            if (!t.guardsResult) {
              this.cancelNavigationTransition(t, "", NavigationCancellationCode.GuardRejected);
              return false;
            }
            return true;
          }),
          // --- RESOLVE ---
          switchTap((t) => {
            if (t.guards.canActivateChecks.length === 0) {
              return void 0;
            }
            return of(t).pipe(tap((t2) => {
              const resolveStart = new ResolveStart(t2.id, this.urlSerializer.serialize(t2.extractedUrl), this.urlSerializer.serialize(t2.urlAfterRedirects), t2.targetSnapshot);
              this.events.next(resolveStart);
            }), switchMap((t2) => {
              let dataResolved = false;
              return of(t2).pipe(resolveData(this.paramsInheritanceStrategy, this.environmentInjector), tap({
                next: () => dataResolved = true,
                complete: () => {
                  if (!dataResolved) {
                    this.cancelNavigationTransition(t2, typeof ngDevMode === "undefined" || ngDevMode ? `At least one route resolver didn't emit any value.` : "", NavigationCancellationCode.NoDataFromResolver);
                  }
                }
              }));
            }), tap((t2) => {
              const resolveEnd = new ResolveEnd(t2.id, this.urlSerializer.serialize(t2.extractedUrl), this.urlSerializer.serialize(t2.urlAfterRedirects), t2.targetSnapshot);
              this.events.next(resolveEnd);
            }));
          }),
          // --- LOAD COMPONENTS ---
          switchTap((t) => {
            const loadComponents = (route) => {
              const loaders = [];
              if (route.routeConfig?.loadComponent && !route.routeConfig._loadedComponent) {
                loaders.push(this.configLoader.loadComponent(route.routeConfig).pipe(tap((loadedComponent) => {
                  route.component = loadedComponent;
                }), map(() => void 0)));
              }
              for (const child of route.children) {
                loaders.push(...loadComponents(child));
              }
              return loaders;
            };
            return combineLatest(loadComponents(t.targetSnapshot.root)).pipe(defaultIfEmpty(null), take(1));
          }),
          switchTap(() => this.afterPreactivation()),
          switchMap(() => {
            const {
              currentSnapshot,
              targetSnapshot
            } = overallTransitionState;
            const viewTransitionStarted = this.createViewTransition?.(this.environmentInjector, currentSnapshot.root, targetSnapshot.root);
            return viewTransitionStarted ? from(viewTransitionStarted).pipe(map(() => overallTransitionState)) : of(overallTransitionState);
          }),
          map((t) => {
            const targetRouterState = createRouterState(router.routeReuseStrategy, t.targetSnapshot, t.currentRouterState);
            this.currentTransition = overallTransitionState = __spreadProps(__spreadValues({}, t), {
              targetRouterState
            });
            this.currentNavigation.targetRouterState = targetRouterState;
            return overallTransitionState;
          }),
          tap(() => {
            this.events.next(new BeforeActivateRoutes());
          }),
          activateRoutes(this.rootContexts, router.routeReuseStrategy, (evt) => this.events.next(evt), this.inputBindingEnabled),
          // Ensure that if some observable used to drive the transition doesn't
          // complete, the navigation still finalizes This should never happen, but
          // this is done as a safety measure to avoid surfacing this error (#49567).
          take(1),
          tap({
            next: (t) => {
              completed = true;
              this.lastSuccessfulNavigation = this.currentNavigation;
              this.events.next(new NavigationEnd(t.id, this.urlSerializer.serialize(t.extractedUrl), this.urlSerializer.serialize(t.urlAfterRedirects)));
              this.titleStrategy?.updateTitle(t.targetRouterState.snapshot);
              t.resolve(true);
            },
            complete: () => {
              completed = true;
            }
          }),
          // There used to be a lot more logic happening directly within the
          // transition Observable. Some of this logic has been refactored out to
          // other places but there may still be errors that happen there. This gives
          // us a way to cancel the transition from the outside. This may also be
          // required in the future to support something like the abort signal of the
          // Navigation API where the navigation gets aborted from outside the
          // transition.
          takeUntil(this.transitionAbortSubject.pipe(tap((err) => {
            throw err;
          }))),
          finalize(() => {
            if (!completed && !errored) {
              const cancelationReason = typeof ngDevMode === "undefined" || ngDevMode ? `Navigation ID ${overallTransitionState.id} is not equal to the current navigation id ${this.navigationId}` : "";
              this.cancelNavigationTransition(overallTransitionState, cancelationReason, NavigationCancellationCode.SupersededByNewNavigation);
            }
            if (this.currentTransition?.id === overallTransitionState.id) {
              this.currentNavigation = null;
              this.currentTransition = null;
            }
          }),
          catchError((e) => {
            if (this.destroyed) {
              overallTransitionState.resolve(false);
              return EMPTY;
            }
            errored = true;
            if (isNavigationCancelingError(e)) {
              this.events.next(new NavigationCancel(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), e.message, e.cancellationCode));
              if (!isRedirectingNavigationCancelingError(e)) {
                overallTransitionState.resolve(false);
              } else {
                this.events.next(new RedirectRequest(e.url, e.navigationBehaviorOptions));
              }
            } else {
              const navigationError = new NavigationError(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), e, overallTransitionState.targetSnapshot ?? void 0);
              try {
                const navigationErrorHandlerResult = runInInjectionContext(this.environmentInjector, () => this.navigationErrorHandler?.(navigationError));
                if (navigationErrorHandlerResult instanceof RedirectCommand) {
                  const {
                    message,
                    cancellationCode
                  } = redirectingNavigationError(this.urlSerializer, navigationErrorHandlerResult);
                  this.events.next(new NavigationCancel(overallTransitionState.id, this.urlSerializer.serialize(overallTransitionState.extractedUrl), message, cancellationCode));
                  this.events.next(new RedirectRequest(navigationErrorHandlerResult.redirectTo, navigationErrorHandlerResult.navigationBehaviorOptions));
                } else {
                  this.events.next(navigationError);
                  throw e;
                }
              } catch (ee) {
                if (this.options.resolveNavigationPromiseOnError) {
                  overallTransitionState.resolve(false);
                } else {
                  overallTransitionState.reject(ee);
                }
              }
            }
            return EMPTY;
          })
        );
      })
    );
  }
  cancelNavigationTransition(t, reason, code) {
    const navCancel = new NavigationCancel(t.id, this.urlSerializer.serialize(t.extractedUrl), reason, code);
    this.events.next(navCancel);
    t.resolve(false);
  }
  /**
   * @returns Whether we're navigating to somewhere that is not what the Router is
   * currently set to.
   */
  isUpdatingInternalState() {
    return this.currentTransition?.extractedUrl.toString() !== this.currentTransition?.currentUrlTree.toString();
  }
  /**
   * @returns Whether we're updating the browser URL to something new (navigation is going
   * to somewhere not displayed in the URL bar and we will update the URL
   * bar if navigation succeeds).
   */
  isUpdatedBrowserUrl() {
    const currentBrowserUrl = this.urlHandlingStrategy.extract(this.urlSerializer.parse(this.location.path(true)));
    const targetBrowserUrl = this.currentNavigation?.targetBrowserUrl ?? this.currentNavigation?.extractedUrl;
    return currentBrowserUrl.toString() !== targetBrowserUrl?.toString() && !this.currentNavigation?.extras.skipLocationChange;
  }
  static \u0275fac = function NavigationTransitions_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NavigationTransitions)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _NavigationTransitions,
    factory: _NavigationTransitions.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NavigationTransitions, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function isBrowserTriggeredNavigation(source) {
  return source !== IMPERATIVE_NAVIGATION;
}
var RouteReuseStrategy = class _RouteReuseStrategy {
  static \u0275fac = function RouteReuseStrategy_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouteReuseStrategy)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _RouteReuseStrategy,
    factory: () => (() => inject(DefaultRouteReuseStrategy))(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouteReuseStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(DefaultRouteReuseStrategy)
    }]
  }], null, null);
})();
var BaseRouteReuseStrategy = class {
  /**
   * Whether the given route should detach for later reuse.
   * Always returns false for `BaseRouteReuseStrategy`.
   * */
  shouldDetach(route) {
    return false;
  }
  /**
   * A no-op; the route is never stored since this strategy never detaches routes for later re-use.
   */
  store(route, detachedTree) {
  }
  /** Returns `false`, meaning the route (and its subtree) is never reattached */
  shouldAttach(route) {
    return false;
  }
  /** Returns `null` because this strategy does not store routes for later re-use. */
  retrieve(route) {
    return null;
  }
  /**
   * Determines if a route should be reused.
   * This strategy returns `true` when the future route config and current route config are
   * identical.
   */
  shouldReuseRoute(future, curr) {
    return future.routeConfig === curr.routeConfig;
  }
};
var DefaultRouteReuseStrategy = class _DefaultRouteReuseStrategy extends BaseRouteReuseStrategy {
  static \u0275fac = /* @__PURE__ */ (() => {
    let \u0275DefaultRouteReuseStrategy_BaseFactory;
    return function DefaultRouteReuseStrategy_Factory(__ngFactoryType__) {
      return (\u0275DefaultRouteReuseStrategy_BaseFactory || (\u0275DefaultRouteReuseStrategy_BaseFactory = \u0275\u0275getInheritedFactory(_DefaultRouteReuseStrategy)))(__ngFactoryType__ || _DefaultRouteReuseStrategy);
    };
  })();
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _DefaultRouteReuseStrategy,
    factory: _DefaultRouteReuseStrategy.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(DefaultRouteReuseStrategy, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var StateManager = class _StateManager {
  static \u0275fac = function StateManager_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _StateManager)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _StateManager,
    factory: () => (() => inject(HistoryStateManager))(),
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(StateManager, [{
    type: Injectable,
    args: [{
      providedIn: "root",
      useFactory: () => inject(HistoryStateManager)
    }]
  }], null, null);
})();
var HistoryStateManager = class _HistoryStateManager extends StateManager {
  location = inject(Location);
  urlSerializer = inject(UrlSerializer);
  options = inject(ROUTER_CONFIGURATION, {
    optional: true
  }) || {};
  canceledNavigationResolution = this.options.canceledNavigationResolution || "replace";
  urlHandlingStrategy = inject(UrlHandlingStrategy);
  urlUpdateStrategy = this.options.urlUpdateStrategy || "deferred";
  currentUrlTree = new UrlTree();
  getCurrentUrlTree() {
    return this.currentUrlTree;
  }
  rawUrlTree = this.currentUrlTree;
  getRawUrlTree() {
    return this.rawUrlTree;
  }
  /**
   * The id of the currently active page in the router.
   * Updated to the transition's target id on a successful navigation.
   *
   * This is used to track what page the router last activated. When an attempted navigation fails,
   * the router can then use this to compute how to restore the state back to the previously active
   * page.
   */
  currentPageId = 0;
  lastSuccessfulId = -1;
  restoredState() {
    return this.location.getState();
  }
  /**
   * The ɵrouterPageId of whatever page is currently active in the browser history. This is
   * important for computing the target page id for new navigations because we need to ensure each
   * page id in the browser history is 1 more than the previous entry.
   */
  get browserPageId() {
    if (this.canceledNavigationResolution !== "computed") {
      return this.currentPageId;
    }
    return this.restoredState()?.\u0275routerPageId ?? this.currentPageId;
  }
  routerState = createEmptyState(null);
  getRouterState() {
    return this.routerState;
  }
  stateMemento = this.createStateMemento();
  createStateMemento() {
    return {
      rawUrlTree: this.rawUrlTree,
      currentUrlTree: this.currentUrlTree,
      routerState: this.routerState
    };
  }
  registerNonRouterCurrentEntryChangeListener(listener) {
    return this.location.subscribe((event) => {
      if (event["type"] === "popstate") {
        listener(event["url"], event.state);
      }
    });
  }
  handleRouterEvent(e, currentTransition) {
    if (e instanceof NavigationStart) {
      this.stateMemento = this.createStateMemento();
    } else if (e instanceof NavigationSkipped) {
      this.rawUrlTree = currentTransition.initialUrl;
    } else if (e instanceof RoutesRecognized) {
      if (this.urlUpdateStrategy === "eager") {
        if (!currentTransition.extras.skipLocationChange) {
          const rawUrl = this.urlHandlingStrategy.merge(currentTransition.finalUrl, currentTransition.initialUrl);
          this.setBrowserUrl(currentTransition.targetBrowserUrl ?? rawUrl, currentTransition);
        }
      }
    } else if (e instanceof BeforeActivateRoutes) {
      this.currentUrlTree = currentTransition.finalUrl;
      this.rawUrlTree = this.urlHandlingStrategy.merge(currentTransition.finalUrl, currentTransition.initialUrl);
      this.routerState = currentTransition.targetRouterState;
      if (this.urlUpdateStrategy === "deferred" && !currentTransition.extras.skipLocationChange) {
        this.setBrowserUrl(currentTransition.targetBrowserUrl ?? this.rawUrlTree, currentTransition);
      }
    } else if (e instanceof NavigationCancel && (e.code === NavigationCancellationCode.GuardRejected || e.code === NavigationCancellationCode.NoDataFromResolver)) {
      this.restoreHistory(currentTransition);
    } else if (e instanceof NavigationError) {
      this.restoreHistory(currentTransition, true);
    } else if (e instanceof NavigationEnd) {
      this.lastSuccessfulId = e.id;
      this.currentPageId = this.browserPageId;
    }
  }
  setBrowserUrl(url, transition) {
    const path = url instanceof UrlTree ? this.urlSerializer.serialize(url) : url;
    if (this.location.isCurrentPathEqualTo(path) || !!transition.extras.replaceUrl) {
      const currentBrowserPageId = this.browserPageId;
      const state = __spreadValues(__spreadValues({}, transition.extras.state), this.generateNgRouterState(transition.id, currentBrowserPageId));
      this.location.replaceState(path, "", state);
    } else {
      const state = __spreadValues(__spreadValues({}, transition.extras.state), this.generateNgRouterState(transition.id, this.browserPageId + 1));
      this.location.go(path, "", state);
    }
  }
  /**
   * Performs the necessary rollback action to restore the browser URL to the
   * state before the transition.
   */
  restoreHistory(navigation, restoringFromCaughtError = false) {
    if (this.canceledNavigationResolution === "computed") {
      const currentBrowserPageId = this.browserPageId;
      const targetPagePosition = this.currentPageId - currentBrowserPageId;
      if (targetPagePosition !== 0) {
        this.location.historyGo(targetPagePosition);
      } else if (this.currentUrlTree === navigation.finalUrl && targetPagePosition === 0) {
        this.resetState(navigation);
        this.resetUrlToCurrentUrlTree();
      } else ;
    } else if (this.canceledNavigationResolution === "replace") {
      if (restoringFromCaughtError) {
        this.resetState(navigation);
      }
      this.resetUrlToCurrentUrlTree();
    }
  }
  resetState(navigation) {
    this.routerState = this.stateMemento.routerState;
    this.currentUrlTree = this.stateMemento.currentUrlTree;
    this.rawUrlTree = this.urlHandlingStrategy.merge(this.currentUrlTree, navigation.finalUrl ?? this.rawUrlTree);
  }
  resetUrlToCurrentUrlTree() {
    this.location.replaceState(this.urlSerializer.serialize(this.rawUrlTree), "", this.generateNgRouterState(this.lastSuccessfulId, this.currentPageId));
  }
  generateNgRouterState(navigationId, routerPageId) {
    if (this.canceledNavigationResolution === "computed") {
      return {
        navigationId,
        \u0275routerPageId: routerPageId
      };
    }
    return {
      navigationId
    };
  }
  static \u0275fac = /* @__PURE__ */ (() => {
    let \u0275HistoryStateManager_BaseFactory;
    return function HistoryStateManager_Factory(__ngFactoryType__) {
      return (\u0275HistoryStateManager_BaseFactory || (\u0275HistoryStateManager_BaseFactory = \u0275\u0275getInheritedFactory(_HistoryStateManager)))(__ngFactoryType__ || _HistoryStateManager);
    };
  })();
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _HistoryStateManager,
    factory: _HistoryStateManager.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(HistoryStateManager, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
function afterNextNavigation(router, action) {
  router.events.pipe(filter((e) => e instanceof NavigationEnd || e instanceof NavigationCancel || e instanceof NavigationError || e instanceof NavigationSkipped), map((e) => {
    if (e instanceof NavigationEnd || e instanceof NavigationSkipped) {
      return 0;
    }
    const redirecting = e instanceof NavigationCancel ? e.code === NavigationCancellationCode.Redirect || e.code === NavigationCancellationCode.SupersededByNewNavigation : false;
    return redirecting ? 2 : 1;
  }), filter(
    (result) => result !== 2
    /* NavigationResult.REDIRECTING */
  ), take(1)).subscribe(() => {
    action();
  });
}
var exactMatchOptions = {
  paths: "exact",
  fragment: "ignored",
  matrixParams: "ignored",
  queryParams: "exact"
};
var subsetMatchOptions = {
  paths: "subset",
  fragment: "ignored",
  matrixParams: "ignored",
  queryParams: "subset"
};
var Router = class _Router {
  get currentUrlTree() {
    return this.stateManager.getCurrentUrlTree();
  }
  get rawUrlTree() {
    return this.stateManager.getRawUrlTree();
  }
  disposed = false;
  nonRouterCurrentEntryChangeSubscription;
  console = inject(Console);
  stateManager = inject(StateManager);
  options = inject(ROUTER_CONFIGURATION, {
    optional: true
  }) || {};
  pendingTasks = inject(PendingTasksInternal);
  urlUpdateStrategy = this.options.urlUpdateStrategy || "deferred";
  navigationTransitions = inject(NavigationTransitions);
  urlSerializer = inject(UrlSerializer);
  location = inject(Location);
  urlHandlingStrategy = inject(UrlHandlingStrategy);
  injector = inject(EnvironmentInjector);
  /**
   * The private `Subject` type for the public events exposed in the getter. This is used internally
   * to push events to. The separate field allows us to expose separate types in the public API
   * (i.e., an Observable rather than the Subject).
   */
  _events = new Subject();
  /**
   * An event stream for routing events.
   */
  get events() {
    return this._events;
  }
  /**
   * The current state of routing in this NgModule.
   */
  get routerState() {
    return this.stateManager.getRouterState();
  }
  /**
   * True if at least one navigation event has occurred,
   * false otherwise.
   */
  navigated = false;
  /**
   * A strategy for re-using routes.
   *
   * @deprecated Configure using `providers` instead:
   *   `{provide: RouteReuseStrategy, useClass: MyStrategy}`.
   */
  routeReuseStrategy = inject(RouteReuseStrategy);
  /**
   * How to handle a navigation request to the current URL.
   *
   *
   * @deprecated Configure this through `provideRouter` or `RouterModule.forRoot` instead.
   * @see {@link withRouterConfig}
   * @see {@link provideRouter}
   * @see {@link RouterModule}
   */
  onSameUrlNavigation = this.options.onSameUrlNavigation || "ignore";
  config = inject(ROUTES, {
    optional: true
  })?.flat() ?? [];
  /**
   * Indicates whether the application has opted in to binding Router data to component inputs.
   *
   * This option is enabled by the `withComponentInputBinding` feature of `provideRouter` or
   * `bindToComponentInputs` in the `ExtraOptions` of `RouterModule.forRoot`.
   */
  componentInputBindingEnabled = !!inject(INPUT_BINDER, {
    optional: true
  });
  constructor() {
    this.resetConfig(this.config);
    this.navigationTransitions.setupNavigations(this).subscribe({
      error: (e) => {
        this.console.warn(ngDevMode ? `Unhandled Navigation Error: ${e}` : e);
      }
    });
    this.subscribeToNavigationEvents();
  }
  eventsSubscription = new Subscription();
  subscribeToNavigationEvents() {
    const subscription = this.navigationTransitions.events.subscribe((e) => {
      try {
        const currentTransition = this.navigationTransitions.currentTransition;
        const currentNavigation = this.navigationTransitions.currentNavigation;
        if (currentTransition !== null && currentNavigation !== null) {
          this.stateManager.handleRouterEvent(e, currentNavigation);
          if (e instanceof NavigationCancel && e.code !== NavigationCancellationCode.Redirect && e.code !== NavigationCancellationCode.SupersededByNewNavigation) {
            this.navigated = true;
          } else if (e instanceof NavigationEnd) {
            this.navigated = true;
          } else if (e instanceof RedirectRequest) {
            const opts = e.navigationBehaviorOptions;
            const mergedTree = this.urlHandlingStrategy.merge(e.url, currentTransition.currentRawUrl);
            const extras = __spreadValues({
              browserUrl: currentTransition.extras.browserUrl,
              info: currentTransition.extras.info,
              skipLocationChange: currentTransition.extras.skipLocationChange,
              // The URL is already updated at this point if we have 'eager' URL
              // updates or if the navigation was triggered by the browser (back
              // button, URL bar, etc). We want to replace that item in history
              // if the navigation is rejected.
              replaceUrl: currentTransition.extras.replaceUrl || this.urlUpdateStrategy === "eager" || isBrowserTriggeredNavigation(currentTransition.source)
            }, opts);
            this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras, {
              resolve: currentTransition.resolve,
              reject: currentTransition.reject,
              promise: currentTransition.promise
            });
          }
        }
        if (isPublicRouterEvent(e)) {
          this._events.next(e);
        }
      } catch (e2) {
        this.navigationTransitions.transitionAbortSubject.next(e2);
      }
    });
    this.eventsSubscription.add(subscription);
  }
  /** @internal */
  resetRootComponentType(rootComponentType) {
    this.routerState.root.component = rootComponentType;
    this.navigationTransitions.rootComponentType = rootComponentType;
  }
  /**
   * Sets up the location change listener and performs the initial navigation.
   */
  initialNavigation() {
    this.setUpLocationChangeListener();
    if (!this.navigationTransitions.hasRequestedNavigation) {
      this.navigateToSyncWithBrowser(this.location.path(true), IMPERATIVE_NAVIGATION, this.stateManager.restoredState());
    }
  }
  /**
   * Sets up the location change listener. This listener detects navigations triggered from outside
   * the Router (the browser back/forward buttons, for example) and schedules a corresponding Router
   * navigation so that the correct events, guards, etc. are triggered.
   */
  setUpLocationChangeListener() {
    this.nonRouterCurrentEntryChangeSubscription ??= this.stateManager.registerNonRouterCurrentEntryChangeListener((url, state) => {
      setTimeout(() => {
        this.navigateToSyncWithBrowser(url, "popstate", state);
      }, 0);
    });
  }
  /**
   * Schedules a router navigation to synchronize Router state with the browser state.
   *
   * This is done as a response to a popstate event and the initial navigation. These
   * two scenarios represent times when the browser URL/state has been updated and
   * the Router needs to respond to ensure its internal state matches.
   */
  navigateToSyncWithBrowser(url, source, state) {
    const extras = {
      replaceUrl: true
    };
    const restoredState = state?.navigationId ? state : null;
    if (state) {
      const stateCopy = __spreadValues({}, state);
      delete stateCopy.navigationId;
      delete stateCopy.\u0275routerPageId;
      if (Object.keys(stateCopy).length !== 0) {
        extras.state = stateCopy;
      }
    }
    const urlTree = this.parseUrl(url);
    this.scheduleNavigation(urlTree, source, restoredState, extras).catch((e) => {
      this.injector.get(INTERNAL_APPLICATION_ERROR_HANDLER)(e);
    });
  }
  /** The current URL. */
  get url() {
    return this.serializeUrl(this.currentUrlTree);
  }
  /**
   * Returns the current `Navigation` object when the router is navigating,
   * and `null` when idle.
   */
  getCurrentNavigation() {
    return this.navigationTransitions.currentNavigation;
  }
  /**
   * The `Navigation` object of the most recent navigation to succeed and `null` if there
   *     has not been a successful navigation yet.
   */
  get lastSuccessfulNavigation() {
    return this.navigationTransitions.lastSuccessfulNavigation;
  }
  /**
   * Resets the route configuration used for navigation and generating links.
   *
   * @param config The route array for the new configuration.
   *
   * @usageNotes
   *
   * ```ts
   * router.resetConfig([
   *  { path: 'team/:id', component: TeamCmp, children: [
   *    { path: 'simple', component: SimpleCmp },
   *    { path: 'user/:name', component: UserCmp }
   *  ]}
   * ]);
   * ```
   */
  resetConfig(config) {
    (typeof ngDevMode === "undefined" || ngDevMode) && validateConfig(config);
    this.config = config.map(standardizeConfig);
    this.navigated = false;
  }
  /** @nodoc */
  ngOnDestroy() {
    this.dispose();
  }
  /** Disposes of the router. */
  dispose() {
    this._events.unsubscribe();
    this.navigationTransitions.complete();
    if (this.nonRouterCurrentEntryChangeSubscription) {
      this.nonRouterCurrentEntryChangeSubscription.unsubscribe();
      this.nonRouterCurrentEntryChangeSubscription = void 0;
    }
    this.disposed = true;
    this.eventsSubscription.unsubscribe();
  }
  /**
   * Appends URL segments to the current URL tree to create a new URL tree.
   *
   * @param commands An array of URL fragments with which to construct the new URL tree.
   * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path
   * segments, followed by the parameters for each segment.
   * The fragments are applied to the current URL tree or the one provided  in the `relativeTo`
   * property of the options object, if supplied.
   * @param navigationExtras Options that control the navigation strategy.
   * @returns The new URL tree.
   *
   * @usageNotes
   *
   * ```
   * // create /team/33/user/11
   * router.createUrlTree(['/team', 33, 'user', 11]);
   *
   * // create /team/33;expand=true/user/11
   * router.createUrlTree(['/team', 33, {expand: true}, 'user', 11]);
   *
   * // you can collapse static segments like this (this works only with the first passed-in value):
   * router.createUrlTree(['/team/33/user', userId]);
   *
   * // If the first segment can contain slashes, and you do not want the router to split it,
   * // you can do the following:
   * router.createUrlTree([{segmentPath: '/one/two'}]);
   *
   * // create /team/33/(user/11//right:chat)
   * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: 'chat'}}]);
   *
   * // remove the right secondary node
   * router.createUrlTree(['/team', 33, {outlets: {primary: 'user/11', right: null}}]);
   *
   * // assuming the current url is `/team/33/user/11` and the route points to `user/11`
   *
   * // navigate to /team/33/user/11/details
   * router.createUrlTree(['details'], {relativeTo: route});
   *
   * // navigate to /team/33/user/22
   * router.createUrlTree(['../22'], {relativeTo: route});
   *
   * // navigate to /team/44/user/22
   * router.createUrlTree(['../../team/44/user/22'], {relativeTo: route});
   *
   * Note that a value of `null` or `undefined` for `relativeTo` indicates that the
   * tree should be created relative to the root.
   * ```
   */
  createUrlTree(commands, navigationExtras = {}) {
    const {
      relativeTo,
      queryParams,
      fragment,
      queryParamsHandling,
      preserveFragment
    } = navigationExtras;
    const f = preserveFragment ? this.currentUrlTree.fragment : fragment;
    let q = null;
    switch (queryParamsHandling ?? this.options.defaultQueryParamsHandling) {
      case "merge":
        q = __spreadValues(__spreadValues({}, this.currentUrlTree.queryParams), queryParams);
        break;
      case "preserve":
        q = this.currentUrlTree.queryParams;
        break;
      default:
        q = queryParams || null;
    }
    if (q !== null) {
      q = this.removeEmptyProps(q);
    }
    let relativeToUrlSegmentGroup;
    try {
      const relativeToSnapshot = relativeTo ? relativeTo.snapshot : this.routerState.snapshot.root;
      relativeToUrlSegmentGroup = createSegmentGroupFromRoute(relativeToSnapshot);
    } catch (e) {
      if (typeof commands[0] !== "string" || commands[0][0] !== "/") {
        commands = [];
      }
      relativeToUrlSegmentGroup = this.currentUrlTree.root;
    }
    return createUrlTreeFromSegmentGroup(relativeToUrlSegmentGroup, commands, q, f ?? null);
  }
  /**
   * Navigates to a view using an absolute route path.
   *
   * @param url An absolute path for a defined route. The function does not apply any delta to the
   *     current URL.
   * @param extras An object containing properties that modify the navigation strategy.
   *
   * @returns A Promise that resolves to 'true' when navigation succeeds,
   * to 'false' when navigation fails, or is rejected on error.
   *
   * @usageNotes
   *
   * The following calls request navigation to an absolute path.
   *
   * ```ts
   * router.navigateByUrl("/team/33/user/11");
   *
   * // Navigate without updating the URL
   * router.navigateByUrl("/team/33/user/11", { skipLocationChange: true });
   * ```
   *
   * @see [Routing and Navigation guide](guide/routing/common-router-tasks)
   *
   */
  navigateByUrl(url, extras = {
    skipLocationChange: false
  }) {
    const urlTree = isUrlTree(url) ? url : this.parseUrl(url);
    const mergedTree = this.urlHandlingStrategy.merge(urlTree, this.rawUrlTree);
    return this.scheduleNavigation(mergedTree, IMPERATIVE_NAVIGATION, null, extras);
  }
  /**
   * Navigate based on the provided array of commands and a starting point.
   * If no starting route is provided, the navigation is absolute.
   *
   * @param commands An array of URL fragments with which to construct the target URL.
   * If the path is static, can be the literal URL string. For a dynamic path, pass an array of path
   * segments, followed by the parameters for each segment.
   * The fragments are applied to the current URL or the one provided  in the `relativeTo` property
   * of the options object, if supplied.
   * @param extras An options object that determines how the URL should be constructed or
   *     interpreted.
   *
   * @returns A Promise that resolves to `true` when navigation succeeds, or `false` when navigation
   *     fails. The Promise is rejected when an error occurs if `resolveNavigationPromiseOnError` is
   * not `true`.
   *
   * @usageNotes
   *
   * The following calls request navigation to a dynamic route path relative to the current URL.
   *
   * ```ts
   * router.navigate(['team', 33, 'user', 11], {relativeTo: route});
   *
   * // Navigate without updating the URL, overriding the default behavior
   * router.navigate(['team', 33, 'user', 11], {relativeTo: route, skipLocationChange: true});
   * ```
   *
   * @see [Routing and Navigation guide](guide/routing/common-router-tasks)
   *
   */
  navigate(commands, extras = {
    skipLocationChange: false
  }) {
    validateCommands(commands);
    return this.navigateByUrl(this.createUrlTree(commands, extras), extras);
  }
  /** Serializes a `UrlTree` into a string */
  serializeUrl(url) {
    return this.urlSerializer.serialize(url);
  }
  /** Parses a string into a `UrlTree` */
  parseUrl(url) {
    try {
      return this.urlSerializer.parse(url);
    } catch {
      return this.urlSerializer.parse("/");
    }
  }
  isActive(url, matchOptions) {
    let options;
    if (matchOptions === true) {
      options = __spreadValues({}, exactMatchOptions);
    } else if (matchOptions === false) {
      options = __spreadValues({}, subsetMatchOptions);
    } else {
      options = matchOptions;
    }
    if (isUrlTree(url)) {
      return containsTree(this.currentUrlTree, url, options);
    }
    const urlTree = this.parseUrl(url);
    return containsTree(this.currentUrlTree, urlTree, options);
  }
  removeEmptyProps(params) {
    return Object.entries(params).reduce((result, [key, value]) => {
      if (value !== null && value !== void 0) {
        result[key] = value;
      }
      return result;
    }, {});
  }
  scheduleNavigation(rawUrl, source, restoredState, extras, priorPromise) {
    if (this.disposed) {
      return Promise.resolve(false);
    }
    let resolve;
    let reject;
    let promise;
    if (priorPromise) {
      resolve = priorPromise.resolve;
      reject = priorPromise.reject;
      promise = priorPromise.promise;
    } else {
      promise = new Promise((res, rej) => {
        resolve = res;
        reject = rej;
      });
    }
    const taskId = this.pendingTasks.add();
    afterNextNavigation(this, () => {
      queueMicrotask(() => this.pendingTasks.remove(taskId));
    });
    this.navigationTransitions.handleNavigationRequest({
      source,
      restoredState,
      currentUrlTree: this.currentUrlTree,
      currentRawUrl: this.currentUrlTree,
      rawUrl,
      extras,
      resolve,
      reject,
      promise,
      currentSnapshot: this.routerState.snapshot,
      currentRouterState: this.routerState
    });
    return promise.catch((e) => {
      return Promise.reject(e);
    });
  }
  static \u0275fac = function Router_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _Router)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _Router,
    factory: _Router.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(Router, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [], null);
})();
function validateCommands(commands) {
  for (let i = 0; i < commands.length; i++) {
    const cmd = commands[i];
    if (cmd == null) {
      throw new RuntimeError(4008, (typeof ngDevMode === "undefined" || ngDevMode) && `The requested path contains ${cmd} segment at index ${i}`);
    }
  }
}
function isPublicRouterEvent(e) {
  return !(e instanceof BeforeActivateRoutes) && !(e instanceof RedirectRequest);
}
var RouterLink = class _RouterLink {
  router;
  route;
  tabIndexAttribute;
  renderer;
  el;
  locationStrategy;
  /**
   * Represents an `href` attribute value applied to a host element,
   * when a host element is `<a>`. For other tags, the value is `null`.
   */
  href = null;
  /**
   * Represents the `target` attribute on a host element.
   * This is only used when the host element is an `<a>` tag.
   */
  target;
  /**
   * Passed to {@link Router#createUrlTree} as part of the
   * `UrlCreationOptions`.
   * @see {@link UrlCreationOptions#queryParams}
   * @see {@link Router#createUrlTree}
   */
  queryParams;
  /**
   * Passed to {@link Router#createUrlTree} as part of the
   * `UrlCreationOptions`.
   * @see {@link UrlCreationOptions#fragment}
   * @see {@link Router#createUrlTree}
   */
  fragment;
  /**
   * Passed to {@link Router#createUrlTree} as part of the
   * `UrlCreationOptions`.
   * @see {@link UrlCreationOptions#queryParamsHandling}
   * @see {@link Router#createUrlTree}
   */
  queryParamsHandling;
  /**
   * Passed to {@link Router#navigateByUrl} as part of the
   * `NavigationBehaviorOptions`.
   * @see {@link NavigationBehaviorOptions#state}
   * @see {@link Router#navigateByUrl}
   */
  state;
  /**
   * Passed to {@link Router#navigateByUrl} as part of the
   * `NavigationBehaviorOptions`.
   * @see {@link NavigationBehaviorOptions#info}
   * @see {@link Router#navigateByUrl}
   */
  info;
  /**
   * Passed to {@link Router#createUrlTree} as part of the
   * `UrlCreationOptions`.
   * Specify a value here when you do not want to use the default value
   * for `routerLink`, which is the current activated route.
   * Note that a value of `undefined` here will use the `routerLink` default.
   * @see {@link UrlCreationOptions#relativeTo}
   * @see {@link Router#createUrlTree}
   */
  relativeTo;
  /** Whether a host element is an `<a>` tag. */
  isAnchorElement;
  subscription;
  /** @internal */
  onChanges = new Subject();
  applicationErrorHandler = inject(INTERNAL_APPLICATION_ERROR_HANDLER);
  constructor(router, route, tabIndexAttribute, renderer, el, locationStrategy) {
    this.router = router;
    this.route = route;
    this.tabIndexAttribute = tabIndexAttribute;
    this.renderer = renderer;
    this.el = el;
    this.locationStrategy = locationStrategy;
    const tagName = el.nativeElement.tagName?.toLowerCase();
    this.isAnchorElement = tagName === "a" || tagName === "area";
    if (this.isAnchorElement) {
      this.subscription = router.events.subscribe((s) => {
        if (s instanceof NavigationEnd) {
          this.updateHref();
        }
      });
    } else {
      this.setTabIndexIfNotOnNativeEl("0");
    }
  }
  /**
   * Passed to {@link Router#createUrlTree} as part of the
   * `UrlCreationOptions`.
   * @see {@link UrlCreationOptions#preserveFragment}
   * @see {@link Router#createUrlTree}
   */
  preserveFragment = false;
  /**
   * Passed to {@link Router#navigateByUrl} as part of the
   * `NavigationBehaviorOptions`.
   * @see {@link NavigationBehaviorOptions#skipLocationChange}
   * @see {@link Router#navigateByUrl}
   */
  skipLocationChange = false;
  /**
   * Passed to {@link Router#navigateByUrl} as part of the
   * `NavigationBehaviorOptions`.
   * @see {@link NavigationBehaviorOptions#replaceUrl}
   * @see {@link Router#navigateByUrl}
   */
  replaceUrl = false;
  /**
   * Modifies the tab index if there was not a tabindex attribute on the element during
   * instantiation.
   */
  setTabIndexIfNotOnNativeEl(newTabIndex) {
    if (this.tabIndexAttribute != null || this.isAnchorElement) {
      return;
    }
    this.applyAttributeValue("tabindex", newTabIndex);
  }
  /** @nodoc */
  // TODO(atscott): Remove changes parameter in major version as a breaking change.
  ngOnChanges(changes) {
    if (ngDevMode && isUrlTree(this.routerLinkInput) && (this.fragment !== void 0 || this.queryParams || this.queryParamsHandling || this.preserveFragment || this.relativeTo)) {
      throw new RuntimeError(4016, "Cannot configure queryParams or fragment when using a UrlTree as the routerLink input value.");
    }
    if (this.isAnchorElement) {
      this.updateHref();
    }
    this.onChanges.next(this);
  }
  routerLinkInput = null;
  /**
   * Commands to pass to {@link Router#createUrlTree} or a `UrlTree`.
   *   - **array**: commands to pass to {@link Router#createUrlTree}.
   *   - **string**: shorthand for array of commands with just the string, i.e. `['/route']`
   *   - **UrlTree**: a `UrlTree` for this link rather than creating one from the commands
   *     and other inputs that correspond to properties of `UrlCreationOptions`.
   *   - **null|undefined**: effectively disables the `routerLink`
   * @see {@link Router#createUrlTree}
   */
  set routerLink(commandsOrUrlTree) {
    if (commandsOrUrlTree == null) {
      this.routerLinkInput = null;
      this.setTabIndexIfNotOnNativeEl(null);
    } else {
      if (isUrlTree(commandsOrUrlTree)) {
        this.routerLinkInput = commandsOrUrlTree;
      } else {
        this.routerLinkInput = Array.isArray(commandsOrUrlTree) ? commandsOrUrlTree : [commandsOrUrlTree];
      }
      this.setTabIndexIfNotOnNativeEl("0");
    }
  }
  /** @nodoc */
  onClick(button, ctrlKey, shiftKey, altKey, metaKey) {
    const urlTree = this.urlTree;
    if (urlTree === null) {
      return true;
    }
    if (this.isAnchorElement) {
      if (button !== 0 || ctrlKey || shiftKey || altKey || metaKey) {
        return true;
      }
      if (typeof this.target === "string" && this.target != "_self") {
        return true;
      }
    }
    const extras = {
      skipLocationChange: this.skipLocationChange,
      replaceUrl: this.replaceUrl,
      state: this.state,
      info: this.info
    };
    this.router.navigateByUrl(urlTree, extras)?.catch((e) => {
      this.applicationErrorHandler(e);
    });
    return !this.isAnchorElement;
  }
  /** @nodoc */
  ngOnDestroy() {
    this.subscription?.unsubscribe();
  }
  updateHref() {
    const urlTree = this.urlTree;
    this.href = urlTree !== null && this.locationStrategy ? this.locationStrategy?.prepareExternalUrl(this.router.serializeUrl(urlTree)) : null;
    const sanitizedValue = this.href === null ? null : (
      // This class represents a directive that can be added to both `<a>` elements,
      // as well as other elements. As a result, we can't define security context at
      // compile time. So the security context is deferred to runtime.
      // The `ɵɵsanitizeUrlOrResourceUrl` selects the necessary sanitizer function
      // based on the tag and property names. The logic mimics the one from
      // `packages/compiler/src/schema/dom_security_schema.ts`, which is used at compile time.
      //
      // Note: we should investigate whether we can switch to using `@HostBinding('attr.href')`
      // instead of applying a value via a renderer, after a final merge of the
      // `RouterLinkWithHref` directive.
      \u0275\u0275sanitizeUrlOrResourceUrl(this.href, this.el.nativeElement.tagName.toLowerCase(), "href")
    );
    this.applyAttributeValue("href", sanitizedValue);
  }
  applyAttributeValue(attrName, attrValue) {
    const renderer = this.renderer;
    const nativeElement = this.el.nativeElement;
    if (attrValue !== null) {
      renderer.setAttribute(nativeElement, attrName, attrValue);
    } else {
      renderer.removeAttribute(nativeElement, attrName);
    }
  }
  get urlTree() {
    if (this.routerLinkInput === null) {
      return null;
    } else if (isUrlTree(this.routerLinkInput)) {
      return this.routerLinkInput;
    }
    return this.router.createUrlTree(this.routerLinkInput, {
      // If the `relativeTo` input is not defined, we want to use `this.route` by default.
      // Otherwise, we should use the value provided by the user in the input.
      relativeTo: this.relativeTo !== void 0 ? this.relativeTo : this.route,
      queryParams: this.queryParams,
      fragment: this.fragment,
      queryParamsHandling: this.queryParamsHandling,
      preserveFragment: this.preserveFragment
    });
  }
  static \u0275fac = function RouterLink_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterLink)(\u0275\u0275directiveInject(Router), \u0275\u0275directiveInject(ActivatedRoute), \u0275\u0275injectAttribute("tabindex"), \u0275\u0275directiveInject(Renderer2), \u0275\u0275directiveInject(ElementRef), \u0275\u0275directiveInject(LocationStrategy));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _RouterLink,
    selectors: [["", "routerLink", ""]],
    hostVars: 1,
    hostBindings: function RouterLink_HostBindings(rf, ctx) {
      if (rf & 1) {
        \u0275\u0275listener("click", function RouterLink_click_HostBindingHandler($event) {
          return ctx.onClick($event.button, $event.ctrlKey, $event.shiftKey, $event.altKey, $event.metaKey);
        });
      }
      if (rf & 2) {
        \u0275\u0275attribute("target", ctx.target);
      }
    },
    inputs: {
      target: "target",
      queryParams: "queryParams",
      fragment: "fragment",
      queryParamsHandling: "queryParamsHandling",
      state: "state",
      info: "info",
      relativeTo: "relativeTo",
      preserveFragment: [2, "preserveFragment", "preserveFragment", booleanAttribute],
      skipLocationChange: [2, "skipLocationChange", "skipLocationChange", booleanAttribute],
      replaceUrl: [2, "replaceUrl", "replaceUrl", booleanAttribute],
      routerLink: "routerLink"
    },
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterLink, [{
    type: Directive,
    args: [{
      selector: "[routerLink]"
    }]
  }], () => [{
    type: Router
  }, {
    type: ActivatedRoute
  }, {
    type: void 0,
    decorators: [{
      type: Attribute,
      args: ["tabindex"]
    }]
  }, {
    type: Renderer2
  }, {
    type: ElementRef
  }, {
    type: LocationStrategy
  }], {
    target: [{
      type: HostBinding,
      args: ["attr.target"]
    }, {
      type: Input
    }],
    queryParams: [{
      type: Input
    }],
    fragment: [{
      type: Input
    }],
    queryParamsHandling: [{
      type: Input
    }],
    state: [{
      type: Input
    }],
    info: [{
      type: Input
    }],
    relativeTo: [{
      type: Input
    }],
    preserveFragment: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    skipLocationChange: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    replaceUrl: [{
      type: Input,
      args: [{
        transform: booleanAttribute
      }]
    }],
    routerLink: [{
      type: Input
    }],
    onClick: [{
      type: HostListener,
      args: ["click", ["$event.button", "$event.ctrlKey", "$event.shiftKey", "$event.altKey", "$event.metaKey"]]
    }]
  });
})();
var RouterLinkActive = class _RouterLinkActive {
  router;
  element;
  renderer;
  cdr;
  link;
  links;
  classes = [];
  routerEventsSubscription;
  linkInputChangesSubscription;
  _isActive = false;
  get isActive() {
    return this._isActive;
  }
  /**
   * Options to configure how to determine if the router link is active.
   *
   * These options are passed to the `Router.isActive()` function.
   *
   * @see {@link Router#isActive}
   */
  routerLinkActiveOptions = {
    exact: false
  };
  /**
   * Aria-current attribute to apply when the router link is active.
   *
   * Possible values: `'page'` | `'step'` | `'location'` | `'date'` | `'time'` | `true` | `false`.
   *
   * @see {@link https://developer.mozilla.org/en-US/docs/Web/Accessibility/ARIA/Attributes/aria-current}
   */
  ariaCurrentWhenActive;
  /**
   *
   * You can use the output `isActiveChange` to get notified each time the link becomes
   * active or inactive.
   *
   * Emits:
   * true  -> Route is active
   * false -> Route is inactive
   *
   * ```html
   * <a
   *  routerLink="/user/bob"
   *  routerLinkActive="active-link"
   *  (isActiveChange)="this.onRouterLinkActive($event)">Bob</a>
   * ```
   */
  isActiveChange = new EventEmitter();
  constructor(router, element, renderer, cdr, link) {
    this.router = router;
    this.element = element;
    this.renderer = renderer;
    this.cdr = cdr;
    this.link = link;
    this.routerEventsSubscription = router.events.subscribe((s) => {
      if (s instanceof NavigationEnd) {
        this.update();
      }
    });
  }
  /** @nodoc */
  ngAfterContentInit() {
    of(this.links.changes, of(null)).pipe(mergeAll()).subscribe((_) => {
      this.update();
      this.subscribeToEachLinkOnChanges();
    });
  }
  subscribeToEachLinkOnChanges() {
    this.linkInputChangesSubscription?.unsubscribe();
    const allLinkChanges = [...this.links.toArray(), this.link].filter((link) => !!link).map((link) => link.onChanges);
    this.linkInputChangesSubscription = from(allLinkChanges).pipe(mergeAll()).subscribe((link) => {
      if (this._isActive !== this.isLinkActive(this.router)(link)) {
        this.update();
      }
    });
  }
  set routerLinkActive(data) {
    const classes = Array.isArray(data) ? data : data.split(" ");
    this.classes = classes.filter((c) => !!c);
  }
  /** @nodoc */
  ngOnChanges(changes) {
    this.update();
  }
  /** @nodoc */
  ngOnDestroy() {
    this.routerEventsSubscription.unsubscribe();
    this.linkInputChangesSubscription?.unsubscribe();
  }
  update() {
    if (!this.links || !this.router.navigated) return;
    queueMicrotask(() => {
      const hasActiveLinks = this.hasActiveLinks();
      this.classes.forEach((c) => {
        if (hasActiveLinks) {
          this.renderer.addClass(this.element.nativeElement, c);
        } else {
          this.renderer.removeClass(this.element.nativeElement, c);
        }
      });
      if (hasActiveLinks && this.ariaCurrentWhenActive !== void 0) {
        this.renderer.setAttribute(this.element.nativeElement, "aria-current", this.ariaCurrentWhenActive.toString());
      } else {
        this.renderer.removeAttribute(this.element.nativeElement, "aria-current");
      }
      if (this._isActive !== hasActiveLinks) {
        this._isActive = hasActiveLinks;
        this.cdr.markForCheck();
        this.isActiveChange.emit(hasActiveLinks);
      }
    });
  }
  isLinkActive(router) {
    const options = isActiveMatchOptions(this.routerLinkActiveOptions) ? this.routerLinkActiveOptions : (
      // While the types should disallow `undefined` here, it's possible without strict inputs
      this.routerLinkActiveOptions.exact || false
    );
    return (link) => {
      const urlTree = link.urlTree;
      return urlTree ? router.isActive(urlTree, options) : false;
    };
  }
  hasActiveLinks() {
    const isActiveCheckFn = this.isLinkActive(this.router);
    return this.link && isActiveCheckFn(this.link) || this.links.some(isActiveCheckFn);
  }
  static \u0275fac = function RouterLinkActive_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterLinkActive)(\u0275\u0275directiveInject(Router), \u0275\u0275directiveInject(ElementRef), \u0275\u0275directiveInject(Renderer2), \u0275\u0275directiveInject(ChangeDetectorRef), \u0275\u0275directiveInject(RouterLink, 8));
  };
  static \u0275dir = /* @__PURE__ */ \u0275\u0275defineDirective({
    type: _RouterLinkActive,
    selectors: [["", "routerLinkActive", ""]],
    contentQueries: function RouterLinkActive_ContentQueries(rf, ctx, dirIndex) {
      if (rf & 1) {
        \u0275\u0275contentQuery(dirIndex, RouterLink, 5);
      }
      if (rf & 2) {
        let _t;
        \u0275\u0275queryRefresh(_t = \u0275\u0275loadQuery()) && (ctx.links = _t);
      }
    },
    inputs: {
      routerLinkActiveOptions: "routerLinkActiveOptions",
      ariaCurrentWhenActive: "ariaCurrentWhenActive",
      routerLinkActive: "routerLinkActive"
    },
    outputs: {
      isActiveChange: "isActiveChange"
    },
    exportAs: ["routerLinkActive"],
    features: [\u0275\u0275NgOnChangesFeature]
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterLinkActive, [{
    type: Directive,
    args: [{
      selector: "[routerLinkActive]",
      exportAs: "routerLinkActive"
    }]
  }], () => [{
    type: Router
  }, {
    type: ElementRef
  }, {
    type: Renderer2
  }, {
    type: ChangeDetectorRef
  }, {
    type: RouterLink,
    decorators: [{
      type: Optional
    }]
  }], {
    links: [{
      type: ContentChildren,
      args: [RouterLink, {
        descendants: true
      }]
    }],
    routerLinkActiveOptions: [{
      type: Input
    }],
    ariaCurrentWhenActive: [{
      type: Input
    }],
    isActiveChange: [{
      type: Output
    }],
    routerLinkActive: [{
      type: Input
    }]
  });
})();
function isActiveMatchOptions(options) {
  return !!options.paths;
}
var PreloadingStrategy = class {
};
var PreloadAllModules = class _PreloadAllModules {
  preload(route, fn) {
    return fn().pipe(catchError(() => of(null)));
  }
  static \u0275fac = function PreloadAllModules_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _PreloadAllModules)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _PreloadAllModules,
    factory: _PreloadAllModules.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(PreloadAllModules, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var NoPreloading = class _NoPreloading {
  preload(route, fn) {
    return of(null);
  }
  static \u0275fac = function NoPreloading_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _NoPreloading)();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _NoPreloading,
    factory: _NoPreloading.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(NoPreloading, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], null, null);
})();
var RouterPreloader = class _RouterPreloader {
  router;
  injector;
  preloadingStrategy;
  loader;
  subscription;
  constructor(router, compiler, injector, preloadingStrategy, loader) {
    this.router = router;
    this.injector = injector;
    this.preloadingStrategy = preloadingStrategy;
    this.loader = loader;
  }
  setUpPreloading() {
    this.subscription = this.router.events.pipe(filter((e) => e instanceof NavigationEnd), concatMap(() => this.preload())).subscribe(() => {
    });
  }
  preload() {
    return this.processRoutes(this.injector, this.router.config);
  }
  /** @nodoc */
  ngOnDestroy() {
    if (this.subscription) {
      this.subscription.unsubscribe();
    }
  }
  processRoutes(injector, routes) {
    const res = [];
    for (const route of routes) {
      if (route.providers && !route._injector) {
        route._injector = createEnvironmentInjector(route.providers, injector, `Route: ${route.path}`);
      }
      const injectorForCurrentRoute = route._injector ?? injector;
      const injectorForChildren = route._loadedInjector ?? injectorForCurrentRoute;
      if (route.loadChildren && !route._loadedRoutes && route.canLoad === void 0 || route.loadComponent && !route._loadedComponent) {
        res.push(this.preloadConfig(injectorForCurrentRoute, route));
      }
      if (route.children || route._loadedRoutes) {
        res.push(this.processRoutes(injectorForChildren, route.children ?? route._loadedRoutes));
      }
    }
    return from(res).pipe(mergeAll());
  }
  preloadConfig(injector, route) {
    return this.preloadingStrategy.preload(route, () => {
      let loadedChildren$;
      if (route.loadChildren && route.canLoad === void 0) {
        loadedChildren$ = this.loader.loadChildren(injector, route);
      } else {
        loadedChildren$ = of(null);
      }
      const recursiveLoadChildren$ = loadedChildren$.pipe(mergeMap((config) => {
        if (config === null) {
          return of(void 0);
        }
        route._loadedRoutes = config.routes;
        route._loadedInjector = config.injector;
        return this.processRoutes(config.injector ?? injector, config.routes);
      }));
      if (route.loadComponent && !route._loadedComponent) {
        const loadComponent$ = this.loader.loadComponent(route);
        return from([recursiveLoadChildren$, loadComponent$]).pipe(mergeAll());
      } else {
        return recursiveLoadChildren$;
      }
    });
  }
  static \u0275fac = function RouterPreloader_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterPreloader)(\u0275\u0275inject(Router), \u0275\u0275inject(Compiler), \u0275\u0275inject(EnvironmentInjector), \u0275\u0275inject(PreloadingStrategy), \u0275\u0275inject(RouterConfigLoader));
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _RouterPreloader,
    factory: _RouterPreloader.\u0275fac,
    providedIn: "root"
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterPreloader, [{
    type: Injectable,
    args: [{
      providedIn: "root"
    }]
  }], () => [{
    type: Router
  }, {
    type: Compiler
  }, {
    type: EnvironmentInjector
  }, {
    type: PreloadingStrategy
  }, {
    type: RouterConfigLoader
  }], null);
})();
var ROUTER_SCROLLER = new InjectionToken("");
var RouterScroller = class _RouterScroller {
  urlSerializer;
  transitions;
  viewportScroller;
  zone;
  options;
  routerEventsSubscription;
  scrollEventsSubscription;
  lastId = 0;
  lastSource = "imperative";
  restoredId = 0;
  store = {};
  /** @nodoc */
  constructor(urlSerializer, transitions, viewportScroller, zone, options = {}) {
    this.urlSerializer = urlSerializer;
    this.transitions = transitions;
    this.viewportScroller = viewportScroller;
    this.zone = zone;
    this.options = options;
    options.scrollPositionRestoration ||= "disabled";
    options.anchorScrolling ||= "disabled";
  }
  init() {
    if (this.options.scrollPositionRestoration !== "disabled") {
      this.viewportScroller.setHistoryScrollRestoration("manual");
    }
    this.routerEventsSubscription = this.createScrollEvents();
    this.scrollEventsSubscription = this.consumeScrollEvents();
  }
  createScrollEvents() {
    return this.transitions.events.subscribe((e) => {
      if (e instanceof NavigationStart) {
        this.store[this.lastId] = this.viewportScroller.getScrollPosition();
        this.lastSource = e.navigationTrigger;
        this.restoredId = e.restoredState ? e.restoredState.navigationId : 0;
      } else if (e instanceof NavigationEnd) {
        this.lastId = e.id;
        this.scheduleScrollEvent(e, this.urlSerializer.parse(e.urlAfterRedirects).fragment);
      } else if (e instanceof NavigationSkipped && e.code === NavigationSkippedCode.IgnoredSameUrlNavigation) {
        this.lastSource = void 0;
        this.restoredId = 0;
        this.scheduleScrollEvent(e, this.urlSerializer.parse(e.url).fragment);
      }
    });
  }
  consumeScrollEvents() {
    return this.transitions.events.subscribe((e) => {
      if (!(e instanceof Scroll)) return;
      if (e.position) {
        if (this.options.scrollPositionRestoration === "top") {
          this.viewportScroller.scrollToPosition([0, 0]);
        } else if (this.options.scrollPositionRestoration === "enabled") {
          this.viewportScroller.scrollToPosition(e.position);
        }
      } else {
        if (e.anchor && this.options.anchorScrolling === "enabled") {
          this.viewportScroller.scrollToAnchor(e.anchor);
        } else if (this.options.scrollPositionRestoration !== "disabled") {
          this.viewportScroller.scrollToPosition([0, 0]);
        }
      }
    });
  }
  scheduleScrollEvent(routerEvent, anchor) {
    this.zone.runOutsideAngular(async () => {
      await new Promise((resolve) => {
        setTimeout(resolve);
        if (typeof requestAnimationFrame !== "undefined") {
          requestAnimationFrame(resolve);
        }
      });
      this.zone.run(() => {
        this.transitions.events.next(new Scroll(routerEvent, this.lastSource === "popstate" ? this.store[this.restoredId] : null, anchor));
      });
    });
  }
  /** @nodoc */
  ngOnDestroy() {
    this.routerEventsSubscription?.unsubscribe();
    this.scrollEventsSubscription?.unsubscribe();
  }
  static \u0275fac = function RouterScroller_Factory(__ngFactoryType__) {
    \u0275\u0275invalidFactory();
  };
  static \u0275prov = /* @__PURE__ */ \u0275\u0275defineInjectable({
    token: _RouterScroller,
    factory: _RouterScroller.\u0275fac
  });
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterScroller, [{
    type: Injectable
  }], () => [{
    type: UrlSerializer
  }, {
    type: NavigationTransitions
  }, {
    type: ViewportScroller
  }, {
    type: NgZone
  }, {
    type: void 0
  }], null);
})();
function provideRouter(routes, ...features) {
  return makeEnvironmentProviders([{
    provide: ROUTES,
    multi: true,
    useValue: routes
  }, typeof ngDevMode === "undefined" || ngDevMode ? {
    provide: ROUTER_IS_PROVIDED,
    useValue: true
  } : [], {
    provide: ActivatedRoute,
    useFactory: rootRoute,
    deps: [Router]
  }, {
    provide: APP_BOOTSTRAP_LISTENER,
    multi: true,
    useFactory: getBootstrapListener
  }, features.map((feature) => feature.\u0275providers)]);
}
function rootRoute(router) {
  return router.routerState.root;
}
function routerFeature(kind, providers) {
  return {
    \u0275kind: kind,
    \u0275providers: providers
  };
}
var ROUTER_IS_PROVIDED = new InjectionToken("", {
  providedIn: "root",
  factory: () => false
});
function withInMemoryScrolling(options = {}) {
  const providers = [{
    provide: ROUTER_SCROLLER,
    useFactory: () => {
      const viewportScroller = inject(ViewportScroller);
      const zone = inject(NgZone);
      const transitions = inject(NavigationTransitions);
      const urlSerializer = inject(UrlSerializer);
      return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, options);
    }
  }];
  return routerFeature(4, providers);
}
function getBootstrapListener() {
  const injector = inject(Injector);
  return (bootstrappedComponentRef) => {
    const ref = injector.get(ApplicationRef);
    if (bootstrappedComponentRef !== ref.components[0]) {
      return;
    }
    const router = injector.get(Router);
    const bootstrapDone = injector.get(BOOTSTRAP_DONE);
    if (injector.get(INITIAL_NAVIGATION) === 1) {
      router.initialNavigation();
    }
    injector.get(ROUTER_PRELOADER, null, {
      optional: true
    })?.setUpPreloading();
    injector.get(ROUTER_SCROLLER, null, {
      optional: true
    })?.init();
    router.resetRootComponentType(ref.componentTypes[0]);
    if (!bootstrapDone.closed) {
      bootstrapDone.next();
      bootstrapDone.complete();
      bootstrapDone.unsubscribe();
    }
  };
}
var BOOTSTRAP_DONE = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "bootstrap done indicator" : "", {
  factory: () => {
    return new Subject();
  }
});
var INITIAL_NAVIGATION = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "initial navigation" : "", {
  providedIn: "root",
  factory: () => 1
  /* InitialNavigation.EnabledNonBlocking */
});
function withEnabledBlockingInitialNavigation() {
  const providers = [{
    provide: INITIAL_NAVIGATION,
    useValue: 0
    /* InitialNavigation.EnabledBlocking */
  }, {
    provide: APP_INITIALIZER,
    multi: true,
    deps: [Injector],
    useFactory: (injector) => {
      const locationInitialized = injector.get(LOCATION_INITIALIZED, Promise.resolve());
      return () => {
        return locationInitialized.then(() => {
          return new Promise((resolve) => {
            const router = injector.get(Router);
            const bootstrapDone = injector.get(BOOTSTRAP_DONE);
            afterNextNavigation(router, () => {
              resolve(true);
            });
            injector.get(NavigationTransitions).afterPreactivation = () => {
              resolve(true);
              return bootstrapDone.closed ? of(void 0) : bootstrapDone;
            };
            router.initialNavigation();
          });
        });
      };
    }
  }];
  return routerFeature(2, providers);
}
function withDisabledInitialNavigation() {
  const providers = [{
    provide: APP_INITIALIZER,
    multi: true,
    useFactory: () => {
      const router = inject(Router);
      return () => {
        router.setUpLocationChangeListener();
      };
    }
  }, {
    provide: INITIAL_NAVIGATION,
    useValue: 2
    /* InitialNavigation.Disabled */
  }];
  return routerFeature(3, providers);
}
function withDebugTracing() {
  let providers = [];
  if (typeof ngDevMode === "undefined" || ngDevMode) {
    providers = [{
      provide: ENVIRONMENT_INITIALIZER,
      multi: true,
      useFactory: () => {
        const router = inject(Router);
        return () => router.events.subscribe((e) => {
          console.group?.(`Router Event: ${e.constructor.name}`);
          console.log(stringifyEvent(e));
          console.log(e);
          console.groupEnd?.();
        });
      }
    }];
  } else {
    providers = [];
  }
  return routerFeature(1, providers);
}
var ROUTER_PRELOADER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "router preloader" : "");
function withPreloading(preloadingStrategy) {
  const providers = [{
    provide: ROUTER_PRELOADER,
    useExisting: RouterPreloader
  }, {
    provide: PreloadingStrategy,
    useExisting: preloadingStrategy
  }];
  return routerFeature(0, providers);
}
function withComponentInputBinding() {
  const providers = [RoutedComponentInputBinder, {
    provide: INPUT_BINDER,
    useExisting: RoutedComponentInputBinder
  }];
  return routerFeature(8, providers);
}
function withViewTransitions(options) {
  const providers = [{
    provide: CREATE_VIEW_TRANSITION,
    useValue: createViewTransition
  }, {
    provide: VIEW_TRANSITION_OPTIONS,
    useValue: __spreadValues({
      skipNextTransition: !!options?.skipInitialTransition
    }, options)
  }];
  return routerFeature(9, providers);
}
var ROUTER_DIRECTIVES = [RouterOutlet, RouterLink, RouterLinkActive, \u0275EmptyOutletComponent];
var ROUTER_FORROOT_GUARD = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "router duplicate forRoot guard" : "");
var ROUTER_PROVIDERS = [
  Location,
  {
    provide: UrlSerializer,
    useClass: DefaultUrlSerializer
  },
  Router,
  ChildrenOutletContexts,
  {
    provide: ActivatedRoute,
    useFactory: rootRoute,
    deps: [Router]
  },
  RouterConfigLoader,
  // Only used to warn when `provideRoutes` is used without `RouterModule` or `provideRouter`. Can
  // be removed when `provideRoutes` is removed.
  typeof ngDevMode === "undefined" || ngDevMode ? {
    provide: ROUTER_IS_PROVIDED,
    useValue: true
  } : []
];
var RouterModule = class _RouterModule {
  constructor() {
    if (typeof ngDevMode === "undefined" || ngDevMode) {
      inject(ROUTER_FORROOT_GUARD, {
        optional: true
      });
    }
  }
  /**
   * Creates and configures a module with all the router providers and directives.
   * Optionally sets up an application listener to perform an initial navigation.
   *
   * When registering the NgModule at the root, import as follows:
   *
   * ```ts
   * @NgModule({
   *   imports: [RouterModule.forRoot(ROUTES)]
   * })
   * class MyNgModule {}
   * ```
   *
   * @param routes An array of `Route` objects that define the navigation paths for the application.
   * @param config An `ExtraOptions` configuration object that controls how navigation is performed.
   * @return The new `NgModule`.
   *
   */
  static forRoot(routes, config) {
    return {
      ngModule: _RouterModule,
      providers: [ROUTER_PROVIDERS, typeof ngDevMode === "undefined" || ngDevMode ? config?.enableTracing ? withDebugTracing().\u0275providers : [] : [], {
        provide: ROUTES,
        multi: true,
        useValue: routes
      }, typeof ngDevMode === "undefined" || ngDevMode ? {
        provide: ROUTER_FORROOT_GUARD,
        useFactory: provideForRootGuard,
        deps: [[Router, new Optional(), new SkipSelf()]]
      } : [], config?.errorHandler ? {
        provide: NAVIGATION_ERROR_HANDLER,
        useValue: config.errorHandler
      } : [], {
        provide: ROUTER_CONFIGURATION,
        useValue: config ? config : {}
      }, config?.useHash ? provideHashLocationStrategy() : providePathLocationStrategy(), provideRouterScroller(), config?.preloadingStrategy ? withPreloading(config.preloadingStrategy).\u0275providers : [], config?.initialNavigation ? provideInitialNavigation(config) : [], config?.bindToComponentInputs ? withComponentInputBinding().\u0275providers : [], config?.enableViewTransitions ? withViewTransitions().\u0275providers : [], provideRouterInitializer()]
    };
  }
  /**
   * Creates a module with all the router directives and a provider registering routes,
   * without creating a new Router service.
   * When registering for submodules and lazy-loaded submodules, create the NgModule as follows:
   *
   * ```ts
   * @NgModule({
   *   imports: [RouterModule.forChild(ROUTES)]
   * })
   * class MyNgModule {}
   * ```
   *
   * @param routes An array of `Route` objects that define the navigation paths for the submodule.
   * @return The new NgModule.
   *
   */
  static forChild(routes) {
    return {
      ngModule: _RouterModule,
      providers: [{
        provide: ROUTES,
        multi: true,
        useValue: routes
      }]
    };
  }
  static \u0275fac = function RouterModule_Factory(__ngFactoryType__) {
    return new (__ngFactoryType__ || _RouterModule)();
  };
  static \u0275mod = /* @__PURE__ */ \u0275\u0275defineNgModule({
    type: _RouterModule
  });
  static \u0275inj = /* @__PURE__ */ \u0275\u0275defineInjector({});
};
(() => {
  (typeof ngDevMode === "undefined" || ngDevMode) && setClassMetadata(RouterModule, [{
    type: NgModule,
    args: [{
      imports: ROUTER_DIRECTIVES,
      exports: ROUTER_DIRECTIVES
    }]
  }], () => [], null);
})();
function provideRouterScroller() {
  return {
    provide: ROUTER_SCROLLER,
    useFactory: () => {
      const viewportScroller = inject(ViewportScroller);
      const zone = inject(NgZone);
      const config = inject(ROUTER_CONFIGURATION);
      const transitions = inject(NavigationTransitions);
      const urlSerializer = inject(UrlSerializer);
      if (config.scrollOffset) {
        viewportScroller.setOffset(config.scrollOffset);
      }
      return new RouterScroller(urlSerializer, transitions, viewportScroller, zone, config);
    }
  };
}
function provideHashLocationStrategy() {
  return {
    provide: LocationStrategy,
    useClass: HashLocationStrategy
  };
}
function providePathLocationStrategy() {
  return {
    provide: LocationStrategy,
    useClass: PathLocationStrategy
  };
}
function provideForRootGuard(router) {
  if (router) {
    throw new RuntimeError(4007, `The Router was provided more than once. This can happen if 'forRoot' is used outside of the root injector. Lazy loaded modules should use RouterModule.forChild() instead.`);
  }
  return "guarded";
}
function provideInitialNavigation(config) {
  return [config.initialNavigation === "disabled" ? withDisabledInitialNavigation().\u0275providers : [], config.initialNavigation === "enabledBlocking" ? withEnabledBlockingInitialNavigation().\u0275providers : []];
}
var ROUTER_INITIALIZER = new InjectionToken(typeof ngDevMode === "undefined" || ngDevMode ? "Router Initializer" : "");
function provideRouterInitializer() {
  return [
    // ROUTER_INITIALIZER token should be removed. It's public API but shouldn't be. We can just
    // have `getBootstrapListener` directly attached to APP_BOOTSTRAP_LISTENER.
    {
      provide: ROUTER_INITIALIZER,
      useFactory: getBootstrapListener
    },
    {
      provide: APP_BOOTSTRAP_LISTENER,
      multi: true,
      useExisting: ROUTER_INITIALIZER
    }
  ];
}
var VERSION3 = new Version("0.0.0");

export {
  getDOM,
  DOCUMENT,
  Location,
  NgClass,
  NgComponentOutlet,
  NgStyle,
  NgTemplateOutlet,
  CommonModule,
  isPlatformBrowser,
  isPlatformServer,
  ViewportScroller,
  HttpClient,
  provideHttpClient,
  withFetch,
  bootstrapApplication,
  Title,
  DomSanitizer,
  provideClientHydration,
  createUrlTreeFromSnapshot,
  NavigationStart,
  NavigationEnd,
  NavigationCancel,
  NavigationSkipped,
  NavigationError,
  Scroll,
  ActivatedRoute,
  RouterOutlet,
  TitleStrategy,
  RouteReuseStrategy,
  BaseRouteReuseStrategy,
  Router,
  RouterLink,
  RouterLinkActive,
  provideRouter,
  withInMemoryScrolling,
  withComponentInputBinding,
  withViewTransitions
};
/*! Bundled license information:

@angular/common/fesm2022/common.mjs:
  (**
   * @license Angular v0.0.0
   * (c) 2010-2025 Google LLC. https://angular.io/
   * License: MIT
   *)

@angular/common/fesm2022/http.mjs:
  (**
   * @license Angular v0.0.0
   * (c) 2010-2025 Google LLC. https://angular.io/
   * License: MIT
   *)

@angular/platform-browser/fesm2022/platform-browser.mjs:
  (**
   * @license Angular v0.0.0
   * (c) 2010-2025 Google LLC. https://angular.io/
   * License: MIT
   *)

@angular/router/fesm2022/router.mjs:
  (**
   * @license Angular v0.0.0
   * (c) 2010-2025 Google LLC. https://angular.io/
   * License: MIT
   *)
*/
//# sourceMappingURL=chunk-NWFUXB3Y.js.map